From d601e7857382c1a80f0516653eb7152938d556b8 Mon Sep 17 00:00:00 2001 From: Sofia Leon Date: Tue, 8 Jun 2021 05:24:09 +0000 Subject: [PATCH 01/63] feat: initial stub of library --- .../CODE_OF_CONDUCT.md | 94 ++++++++ .../CONTRIBUTING.md | 76 +++++++ packages/google-cloud-apigeeconnect/LICENSE | 202 ++++++++++++++++++ packages/google-cloud-apigeeconnect/README.md | 156 ++++++++++++++ 4 files changed, 528 insertions(+) create mode 100644 packages/google-cloud-apigeeconnect/CODE_OF_CONDUCT.md create mode 100644 packages/google-cloud-apigeeconnect/CONTRIBUTING.md create mode 100644 packages/google-cloud-apigeeconnect/LICENSE create mode 100644 packages/google-cloud-apigeeconnect/README.md diff --git a/packages/google-cloud-apigeeconnect/CODE_OF_CONDUCT.md b/packages/google-cloud-apigeeconnect/CODE_OF_CONDUCT.md new file mode 100644 index 00000000000..2add2547a81 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/CODE_OF_CONDUCT.md @@ -0,0 +1,94 @@ + +# Code of Conduct + +## Our Pledge + +In the interest of fostering an open and welcoming environment, we as +contributors and maintainers pledge to making participation in our project and +our community a harassment-free experience for everyone, regardless of age, body +size, disability, ethnicity, gender identity and expression, level of +experience, education, socio-economic status, nationality, personal appearance, +race, religion, or sexual identity and orientation. + +## Our Standards + +Examples of behavior that contributes to creating a positive environment +include: + +* Using welcoming and inclusive language +* Being respectful of differing viewpoints and experiences +* Gracefully accepting constructive criticism +* Focusing on what is best for the community +* Showing empathy towards other community members + +Examples of unacceptable behavior by participants include: + +* The use of sexualized language or imagery and unwelcome sexual attention or + advances +* Trolling, insulting/derogatory comments, and personal or political attacks +* Public or private harassment +* Publishing others' private information, such as a physical or electronic + address, without explicit permission +* Other conduct which could reasonably be considered inappropriate in a + professional setting + +## Our Responsibilities + +Project maintainers are responsible for clarifying the standards of acceptable +behavior and are expected to take appropriate and fair corrective action in +response to any instances of unacceptable behavior. + +Project maintainers have the right and responsibility to remove, edit, or reject +comments, commits, code, wiki edits, issues, and other contributions that are +not aligned to this Code of Conduct, or to ban temporarily or permanently any +contributor for other behaviors that they deem inappropriate, threatening, +offensive, or harmful. + +## Scope + +This Code of Conduct applies both within project spaces and in public spaces +when an individual is representing the project or its community. Examples of +representing a project or community include using an official project e-mail +address, posting via an official social media account, or acting as an appointed +representative at an online or offline event. Representation of a project may be +further defined and clarified by project maintainers. + +This Code of Conduct also applies outside the project spaces when the Project +Steward has a reasonable belief that an individual's behavior may have a +negative impact on the project or its community. + +## Conflict Resolution + +We do not believe that all conflict is bad; healthy debate and disagreement +often yield positive results. However, it is never okay to be disrespectful or +to engage in behavior that violates the project’s code of conduct. + +If you see someone violating the code of conduct, you are encouraged to address +the behavior directly with those involved. Many issues can be resolved quickly +and easily, and this gives people more control over the outcome of their +dispute. If you are unable to resolve the matter for any reason, or if the +behavior is threatening or harassing, report it. We are dedicated to providing +an environment where participants feel welcome and safe. + +Reports should be directed to *googleapis-stewards@google.com*, the +Project Steward(s) for *Google Cloud Client Libraries*. It is the Project Steward’s duty to +receive and address reported violations of the code of conduct. They will then +work with a committee consisting of representatives from the Open Source +Programs Office and the Google Open Source Strategy team. If for any reason you +are uncomfortable reaching out to the Project Steward, please email +opensource@google.com. + +We will investigate every complaint, but you may not receive a direct response. +We will use our discretion in determining when and how to follow up on reported +incidents, which may range from not taking action to permanent expulsion from +the project and project-sponsored spaces. We will notify the accused of the +report and provide them an opportunity to discuss it before any action is taken. +The identity of the reporter will be omitted from the details of the report +supplied to the accused. In potentially harmful situations, such as ongoing +harassment or threats to anyone's safety, we may take action without notice. + +## Attribution + +This Code of Conduct is adapted from the Contributor Covenant, version 1.4, +available at +https://www.contributor-covenant.org/version/1/4/code-of-conduct.html \ No newline at end of file diff --git a/packages/google-cloud-apigeeconnect/CONTRIBUTING.md b/packages/google-cloud-apigeeconnect/CONTRIBUTING.md new file mode 100644 index 00000000000..3b16f71ecb9 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/CONTRIBUTING.md @@ -0,0 +1,76 @@ +# How to become a contributor and submit your own code + +**Table of contents** + +* [Contributor License Agreements](#contributor-license-agreements) +* [Contributing a patch](#contributing-a-patch) +* [Running the tests](#running-the-tests) +* [Releasing the library](#releasing-the-library) + +## Contributor License Agreements + +We'd love to accept your sample apps and patches! Before we can take them, we +have to jump a couple of legal hurdles. + +Please fill out either the individual or corporate Contributor License Agreement +(CLA). + + * If you are an individual writing original source code and you're sure you + own the intellectual property, then you'll need to sign an [individual CLA](https://developers.google.com/open-source/cla/individual). + * If you work for a company that wants to allow you to contribute your work, + then you'll need to sign a [corporate CLA](https://developers.google.com/open-source/cla/corporate). + +Follow either of the two links above to access the appropriate CLA and +instructions for how to sign and return it. Once we receive it, we'll be able to +accept your pull requests. + +## Contributing A Patch + +1. Submit an issue describing your proposed change to the repo in question. +1. The repo owner will respond to your issue promptly. +1. If your proposed change is accepted, and you haven't already done so, sign a + Contributor License Agreement (see details above). +1. Fork the desired repo, develop and test your code changes. +1. Ensure that your code adheres to the existing style in the code to which + you are contributing. +1. Ensure that your code has an appropriate set of tests which all pass. +1. Title your pull request following [Conventional Commits](https://www.conventionalcommits.org/) styling. +1. Submit a pull request. + +### Before you begin + +1. [Select or create a Cloud Platform project][projects]. +1. [Enable billing for your project][billing]. +1. [Enable the Apigee Connect API API][enable_api]. +1. [Set up authentication with a service account][auth] so you can access the + API from your local workstation. + + +## Running the tests + +1. [Prepare your environment for Node.js setup][setup]. + +1. Install dependencies: + + npm install + +1. Run the tests: + + # Run unit tests. + npm test + + # Run sample integration tests. + npm run samples-test + + # Run all system tests. + npm run system-test + +1. Lint (and maybe fix) any changes: + + npm run fix + +[setup]: https://cloud.google.com/nodejs/docs/setup +[projects]: https://console.cloud.google.com/project +[billing]: https://support.google.com/cloud/answer/6293499#enable-billing +[enable_api]: https://console.cloud.google.com/flows/enableapi?apiid=apigeeconnect.googleapis.com +[auth]: https://cloud.google.com/docs/authentication/getting-started \ No newline at end of file diff --git a/packages/google-cloud-apigeeconnect/LICENSE b/packages/google-cloud-apigeeconnect/LICENSE new file mode 100644 index 00000000000..d6456956733 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md new file mode 100644 index 00000000000..0b7134e4725 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/README.md @@ -0,0 +1,156 @@ +[//]: # "This README.md file is auto-generated, all changes to this file will be lost." +[//]: # "To regenerate it, use `python -m synthtool`." +Google Cloud Platform logo + +# [Apigee Connect API: Node.js Client](https://github.com/googleapis/nodejs-apigee-connect) + +[![release level](https://img.shields.io/badge/release%20level-beta-yellow.svg?style=flat)](https://cloud.google.com/terms/launch-stages) +[![npm version](https://img.shields.io/npm/v/@google-cloud/apigee-connect.svg)](https://www.npmjs.org/package/@google-cloud/apigee-connect) +[![codecov](https://img.shields.io/codecov/c/github/googleapis/nodejs-apigee-connect/master.svg?style=flat)](https://codecov.io/gh/googleapis/nodejs-apigee-connect) + + + + +apigeeconnect client for Node.js + + +A comprehensive list of changes in each version may be found in +[the CHANGELOG](https://github.com/googleapis/nodejs-apigee-connect/blob/master/CHANGELOG.md). + +* [Apigee Connect API Node.js Client API Reference][client-docs] +* [Apigee Connect API Documentation][product-docs] +* [github.com/googleapis/nodejs-apigee-connect](https://github.com/googleapis/nodejs-apigee-connect) + +Read more about the client libraries for Cloud APIs, including the older +Google APIs Client Libraries, in [Client Libraries Explained][explained]. + +[explained]: https://cloud.google.com/apis/docs/client-libraries-explained + +**Table of contents:** + + +* [Quickstart](#quickstart) + * [Before you begin](#before-you-begin) + * [Installing the client library](#installing-the-client-library) + * [Using the client library](#using-the-client-library) +* [Samples](#samples) +* [Versioning](#versioning) +* [Contributing](#contributing) +* [License](#license) + +## Quickstart + +### Before you begin + +1. [Select or create a Cloud Platform project][projects]. +1. [Enable billing for your project][billing]. +1. [Enable the Apigee Connect API API][enable_api]. +1. [Set up authentication with a service account][auth] so you can access the + API from your local workstation. + +### Installing the client library + +```bash +npm install @google-cloud/apigee-connect +``` + + +### Using the client library + +```javascript +// Imports the Google Cloud client library + +// remove this line after package is released +// eslint-disable-next-line node/no-missing-require +const {TetherClient} = require('@google-cloud/apigee-connect'); + +// TODO(developer): replace with your prefered project ID. +// const projectId = 'my-project' + +// Creates a client +// eslint-disable-next-line no-unused-vars +const client = new {TetherClient}(); + +//TODO(library generator): write the actual function you will be testing +async function doSomething() { + console.log('DPE! Change this code so that it shows how to use the library! See comments below on structure.') + // const [thing] = await client.methodName({ + // }); + // console.info(thing); +} +doSomething(); + +``` + + + +## Samples + +Samples are in the [`samples/`](https://github.com/googleapis/nodejs-apigee-connect/tree/master/samples) directory. Each sample's `README.md` has instructions for running its sample. + +| Sample | Source Code | Try it | +| --------------------------- | --------------------------------- | ------ | +| Quickstart | [source code](https://github.com/googleapis/nodejs-apigee-connect/blob/master/samples/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/nodejs-apigee-connect&page=editor&open_in_editor=samples/quickstart.js,samples/README.md) | + + + +The [Apigee Connect API Node.js Client API Reference][client-docs] documentation +also contains samples. + +## Supported Node.js Versions + +Our client libraries follow the [Node.js release schedule](https://nodejs.org/en/about/releases/). +Libraries are compatible with all current _active_ and _maintenance_ versions of +Node.js. + +Client libraries targeting some end-of-life versions of Node.js are available, and +can be installed via npm [dist-tags](https://docs.npmjs.com/cli/dist-tag). +The dist-tags follow the naming convention `legacy-(version)`. + +_Legacy Node.js versions are supported as a best effort:_ + +* Legacy versions will not be tested in continuous integration. +* Some security patches may not be able to be backported. +* Dependencies will not be kept up-to-date, and features will not be backported. + +#### Legacy tags available + +* `legacy-8`: install client libraries from this dist-tag for versions + compatible with Node.js 8. + +## Versioning + +This library follows [Semantic Versioning](http://semver.org/). + + + + + + +More Information: [Google Cloud Platform Launch Stages][launch_stages] + +[launch_stages]: https://cloud.google.com/terms/launch-stages + +## Contributing + +Contributions welcome! See the [Contributing Guide](https://github.com/googleapis/nodejs-apigee-connect/blob/master/CONTRIBUTING.md). + +Please note that this `README.md`, the `samples/README.md`, +and a variety of configuration files in this repository (including `.nycrc` and `tsconfig.json`) +are generated from a central template. To edit one of these files, make an edit +to its template in this +[directory](https://github.com/googleapis/synthtool/tree/master/synthtool/gcp/templates/node_library). + +## License + +Apache Version 2.0 + +See [LICENSE](https://github.com/googleapis/nodejs-apigee-connect/blob/master/LICENSE) + +[client-docs]: https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect +[product-docs]: https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect/ +[shell_img]: https://gstatic.com/cloudssh/images/open-btn.png +[projects]: https://console.cloud.google.com/project +[billing]: https://support.google.com/cloud/answer/6293499#enable-billing +[enable_api]: https://console.cloud.google.com/flows/enableapi?apiid=apigeeconnect.googleapis.com +[auth]: https://cloud.google.com/docs/authentication/getting-started From e428570d46cce15cfca8345e91cd1f533b6530c2 Mon Sep 17 00:00:00 2001 From: Sofia Leon Date: Wed, 9 Jun 2021 04:58:42 +0000 Subject: [PATCH 02/63] feat: initial samples and tests --- .../google-cloud-apigeeconnect/.eslintignore | 6 + .../google-cloud-apigeeconnect/.eslintrc.json | 3 + .../google-cloud-apigeeconnect/.gitattributes | 4 + .../.github/.OwlBot.yaml | 22 + .../google-cloud-apigeeconnect/.gitignore | 14 + packages/google-cloud-apigeeconnect/.jsdoc.js | 55 + .../google-cloud-apigeeconnect/.mocharc.js | 29 + packages/google-cloud-apigeeconnect/.nycrc | 24 + .../.prettierignore | 6 + .../google-cloud-apigeeconnect/.prettierrc.js | 17 + .../.repo-metadata.json | 15 + .../api-extractor.json | 369 + .../linkinator.config.json | 1 + .../google-cloud-apigeeconnect/package.json | 66 + .../cloud/apigeeconnect/v1/connection.proto | 104 + .../cloud/apigeeconnect/v1/tether.proto | 215 + .../protos/protos.d.ts | 5430 ++++++ .../protos/protos.js | 14433 ++++++++++++++++ .../protos/protos.json | 1487 ++ .../samples/README.md | 50 + .../samples/package.json | 23 + .../samples/quickstart.js | 50 + .../samples/test/quickstart.js | 53 + .../google-cloud-apigeeconnect/src/index.ts | 29 + .../src/v1/connection_service_client.ts | 569 + .../v1/connection_service_client_config.json | 44 + .../src/v1/connection_service_proto_list.json | 4 + .../src/v1/gapic_metadata.json | 55 + .../src/v1/index.ts | 20 + .../src/v1/tether_client.ts | 326 + .../src/v1/tether_client_config.json | 30 + .../src/v1/tether_proto_list.json | 4 + .../system-test/fixtures/sample/src/index.js | 27 + .../system-test/fixtures/sample/src/index.ts | 41 + .../system-test/install.ts | 51 + .../test/gapic_connection_service_v1.ts | 554 + .../test/gapic_tether_v1.ts | 217 + .../google-cloud-apigeeconnect/tsconfig.json | 19 + .../webpack.config.js | 64 + 39 files changed, 24530 insertions(+) create mode 100644 packages/google-cloud-apigeeconnect/.eslintignore create mode 100644 packages/google-cloud-apigeeconnect/.eslintrc.json create mode 100644 packages/google-cloud-apigeeconnect/.gitattributes create mode 100644 packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml create mode 100644 packages/google-cloud-apigeeconnect/.gitignore create mode 100644 packages/google-cloud-apigeeconnect/.jsdoc.js create mode 100644 packages/google-cloud-apigeeconnect/.mocharc.js create mode 100644 packages/google-cloud-apigeeconnect/.nycrc create mode 100644 packages/google-cloud-apigeeconnect/.prettierignore create mode 100644 packages/google-cloud-apigeeconnect/.prettierrc.js create mode 100644 packages/google-cloud-apigeeconnect/.repo-metadata.json create mode 100644 packages/google-cloud-apigeeconnect/api-extractor.json create mode 100644 packages/google-cloud-apigeeconnect/linkinator.config.json create mode 100644 packages/google-cloud-apigeeconnect/package.json create mode 100644 packages/google-cloud-apigeeconnect/protos/google/cloud/apigeeconnect/v1/connection.proto create mode 100644 packages/google-cloud-apigeeconnect/protos/google/cloud/apigeeconnect/v1/tether.proto create mode 100644 packages/google-cloud-apigeeconnect/protos/protos.d.ts create mode 100644 packages/google-cloud-apigeeconnect/protos/protos.js create mode 100644 packages/google-cloud-apigeeconnect/protos/protos.json create mode 100644 packages/google-cloud-apigeeconnect/samples/README.md create mode 100644 packages/google-cloud-apigeeconnect/samples/package.json create mode 100644 packages/google-cloud-apigeeconnect/samples/quickstart.js create mode 100644 packages/google-cloud-apigeeconnect/samples/test/quickstart.js create mode 100644 packages/google-cloud-apigeeconnect/src/index.ts create mode 100644 packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts create mode 100644 packages/google-cloud-apigeeconnect/src/v1/connection_service_client_config.json create mode 100644 packages/google-cloud-apigeeconnect/src/v1/connection_service_proto_list.json create mode 100644 packages/google-cloud-apigeeconnect/src/v1/gapic_metadata.json create mode 100644 packages/google-cloud-apigeeconnect/src/v1/index.ts create mode 100644 packages/google-cloud-apigeeconnect/src/v1/tether_client.ts create mode 100644 packages/google-cloud-apigeeconnect/src/v1/tether_client_config.json create mode 100644 packages/google-cloud-apigeeconnect/src/v1/tether_proto_list.json create mode 100644 packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js create mode 100644 packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts create mode 100644 packages/google-cloud-apigeeconnect/system-test/install.ts create mode 100644 packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts create mode 100644 packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts create mode 100644 packages/google-cloud-apigeeconnect/tsconfig.json create mode 100644 packages/google-cloud-apigeeconnect/webpack.config.js diff --git a/packages/google-cloud-apigeeconnect/.eslintignore b/packages/google-cloud-apigeeconnect/.eslintignore new file mode 100644 index 00000000000..9340ad9b86d --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.eslintignore @@ -0,0 +1,6 @@ +**/node_modules +**/coverage +test/fixtures +build/ +docs/ +protos/ diff --git a/packages/google-cloud-apigeeconnect/.eslintrc.json b/packages/google-cloud-apigeeconnect/.eslintrc.json new file mode 100644 index 00000000000..78215349546 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.eslintrc.json @@ -0,0 +1,3 @@ +{ + "extends": "./node_modules/gts" +} diff --git a/packages/google-cloud-apigeeconnect/.gitattributes b/packages/google-cloud-apigeeconnect/.gitattributes new file mode 100644 index 00000000000..33739cb74e4 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.gitattributes @@ -0,0 +1,4 @@ +*.ts text eol=lf +*.js text eol=lf +protos/* linguist-generated +**/api-extractor.json linguist-language=JSON-with-Comments diff --git a/packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml b/packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml new file mode 100644 index 00000000000..1765fd1063f --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml @@ -0,0 +1,22 @@ +# Copyright 2021 Google LLC +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. +docker: + image: gcr.io/repo-automation-bots/owlbot-nodejs:latest + +deep-remove-regex: + - /owl-bot-staging + +deep-copy-regex: + - source: /google/cloud/apigeeconnect/(.*)/.*-nodejs/(.*) + dest: /owl-bot-staging/$1/$2 diff --git a/packages/google-cloud-apigeeconnect/.gitignore b/packages/google-cloud-apigeeconnect/.gitignore new file mode 100644 index 00000000000..5d32b23782f --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.gitignore @@ -0,0 +1,14 @@ +**/*.log +**/node_modules +.coverage +coverage +.nyc_output +docs/ +out/ +build/ +system-test/secrets.js +system-test/*key.json +*.lock +.DS_Store +package-lock.json +__pycache__ diff --git a/packages/google-cloud-apigeeconnect/.jsdoc.js b/packages/google-cloud-apigeeconnect/.jsdoc.js new file mode 100644 index 00000000000..2a7e82331b0 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.jsdoc.js @@ -0,0 +1,55 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +'use strict'; + +module.exports = { + opts: { + readme: './README.md', + package: './package.json', + template: './node_modules/jsdoc-fresh', + recurse: true, + verbose: true, + destination: './docs/' + }, + plugins: [ + 'plugins/markdown', + 'jsdoc-region-tag' + ], + source: { + excludePattern: '(^|\\/|\\\\)[._]', + include: [ + 'build/src', + 'protos' + ], + includePattern: '\\.js$' + }, + templates: { + copyright: 'Copyright 2021 Google LLC', + includeDate: false, + sourceFiles: false, + systemName: '@google-cloud/apigeeconnect', + theme: 'lumen', + default: { + outputSourceFiles: false + } + }, + markdown: { + idInHeadings: true + } +}; diff --git a/packages/google-cloud-apigeeconnect/.mocharc.js b/packages/google-cloud-apigeeconnect/.mocharc.js new file mode 100644 index 00000000000..0b600509bed --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.mocharc.js @@ -0,0 +1,29 @@ +// Copyright 2020 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +const config = { + "enable-source-maps": true, + "throw-deprecation": true, + "timeout": 10000, + "recursive": true +} +if (process.env.MOCHA_THROW_DEPRECATION === 'false') { + delete config['throw-deprecation']; +} +if (process.env.MOCHA_REPORTER) { + config.reporter = process.env.MOCHA_REPORTER; +} +if (process.env.MOCHA_REPORTER_OUTPUT) { + config['reporter-option'] = `output=${process.env.MOCHA_REPORTER_OUTPUT}`; +} +module.exports = config diff --git a/packages/google-cloud-apigeeconnect/.nycrc b/packages/google-cloud-apigeeconnect/.nycrc new file mode 100644 index 00000000000..b18d5472b62 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.nycrc @@ -0,0 +1,24 @@ +{ + "report-dir": "./.coverage", + "reporter": ["text", "lcov"], + "exclude": [ + "**/*-test", + "**/.coverage", + "**/apis", + "**/benchmark", + "**/conformance", + "**/docs", + "**/samples", + "**/scripts", + "**/protos", + "**/test", + "**/*.d.ts", + ".jsdoc.js", + "**/.jsdoc.js", + "karma.conf.js", + "webpack-tests.config.js", + "webpack.config.js" + ], + "exclude-after-remap": false, + "all": true +} diff --git a/packages/google-cloud-apigeeconnect/.prettierignore b/packages/google-cloud-apigeeconnect/.prettierignore new file mode 100644 index 00000000000..9340ad9b86d --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.prettierignore @@ -0,0 +1,6 @@ +**/node_modules +**/coverage +test/fixtures +build/ +docs/ +protos/ diff --git a/packages/google-cloud-apigeeconnect/.prettierrc.js b/packages/google-cloud-apigeeconnect/.prettierrc.js new file mode 100644 index 00000000000..d1b95106f4c --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.prettierrc.js @@ -0,0 +1,17 @@ +// Copyright 2020 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +module.exports = { + ...require('gts/.prettierrc.json') +} diff --git a/packages/google-cloud-apigeeconnect/.repo-metadata.json b/packages/google-cloud-apigeeconnect/.repo-metadata.json new file mode 100644 index 00000000000..52508522d81 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/.repo-metadata.json @@ -0,0 +1,15 @@ +{ + "name": "apigeeconnect", + "name_pretty": "Apigee Connect API", + "product_documentation": "https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect/", + "client_documentation": "https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect", + "issue_tracker": "https://github.com/googleapis/nodejs-apigee-connect/issues", + "release_level": "BETA", + "language": "nodejs", + "repo": "googleapis/nodejs-apigee-connect", + "distribution_name": "@google-cloud/apigee-connect", + "api_id": "apigeeconnect.googleapis.com", + "default_version": "v1", + "requires_billing": true +} + diff --git a/packages/google-cloud-apigeeconnect/api-extractor.json b/packages/google-cloud-apigeeconnect/api-extractor.json new file mode 100644 index 00000000000..de228294b23 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/api-extractor.json @@ -0,0 +1,369 @@ +/** + * Config file for API Extractor. For more info, please visit: https://api-extractor.com + */ +{ + "$schema": "https://developer.microsoft.com/json-schemas/api-extractor/v7/api-extractor.schema.json", + + /** + * Optionally specifies another JSON config file that this file extends from. This provides a way for + * standard settings to be shared across multiple projects. + * + * If the path starts with "./" or "../", the path is resolved relative to the folder of the file that contains + * the "extends" field. Otherwise, the first path segment is interpreted as an NPM package name, and will be + * resolved using NodeJS require(). + * + * SUPPORTED TOKENS: none + * DEFAULT VALUE: "" + */ + // "extends": "./shared/api-extractor-base.json" + // "extends": "my-package/include/api-extractor-base.json" + + /** + * Determines the "" token that can be used with other config file settings. The project folder + * typically contains the tsconfig.json and package.json config files, but the path is user-defined. + * + * The path is resolved relative to the folder of the config file that contains the setting. + * + * The default value for "projectFolder" is the token "", which means the folder is determined by traversing + * parent folders, starting from the folder containing api-extractor.json, and stopping at the first folder + * that contains a tsconfig.json file. If a tsconfig.json file cannot be found in this way, then an error + * will be reported. + * + * SUPPORTED TOKENS: + * DEFAULT VALUE: "" + */ + // "projectFolder": "..", + + /** + * (REQUIRED) Specifies the .d.ts file to be used as the starting point for analysis. API Extractor + * analyzes the symbols exported by this module. + * + * The file extension must be ".d.ts" and not ".ts". + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * SUPPORTED TOKENS: , , + */ + "mainEntryPointFilePath": "/protos/protos.d.ts", + + /** + * A list of NPM package names whose exports should be treated as part of this package. + * + * For example, suppose that Webpack is used to generate a distributed bundle for the project "library1", + * and another NPM package "library2" is embedded in this bundle. Some types from library2 may become part + * of the exported API for library1, but by default API Extractor would generate a .d.ts rollup that explicitly + * imports library2. To avoid this, we can specify: + * + * "bundledPackages": [ "library2" ], + * + * This would direct API Extractor to embed those types directly in the .d.ts rollup, as if they had been + * local files for library1. + */ + "bundledPackages": [ ], + + /** + * Determines how the TypeScript compiler engine will be invoked by API Extractor. + */ + "compiler": { + /** + * Specifies the path to the tsconfig.json file to be used by API Extractor when analyzing the project. + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * Note: This setting will be ignored if "overrideTsconfig" is used. + * + * SUPPORTED TOKENS: , , + * DEFAULT VALUE: "/tsconfig.json" + */ + // "tsconfigFilePath": "/tsconfig.json", + + /** + * Provides a compiler configuration that will be used instead of reading the tsconfig.json file from disk. + * The object must conform to the TypeScript tsconfig schema: + * + * http://json.schemastore.org/tsconfig + * + * If omitted, then the tsconfig.json file will be read from the "projectFolder". + * + * DEFAULT VALUE: no overrideTsconfig section + */ + // "overrideTsconfig": { + // . . . + // } + + /** + * This option causes the compiler to be invoked with the --skipLibCheck option. This option is not recommended + * and may cause API Extractor to produce incomplete or incorrect declarations, but it may be required when + * dependencies contain declarations that are incompatible with the TypeScript engine that API Extractor uses + * for its analysis. Where possible, the underlying issue should be fixed rather than relying on skipLibCheck. + * + * DEFAULT VALUE: false + */ + // "skipLibCheck": true, + }, + + /** + * Configures how the API report file (*.api.md) will be generated. + */ + "apiReport": { + /** + * (REQUIRED) Whether to generate an API report. + */ + "enabled": true, + + /** + * The filename for the API report files. It will be combined with "reportFolder" or "reportTempFolder" to produce + * a full file path. + * + * The file extension should be ".api.md", and the string should not contain a path separator such as "\" or "/". + * + * SUPPORTED TOKENS: , + * DEFAULT VALUE: ".api.md" + */ + // "reportFileName": ".api.md", + + /** + * Specifies the folder where the API report file is written. The file name portion is determined by + * the "reportFileName" setting. + * + * The API report file is normally tracked by Git. Changes to it can be used to trigger a branch policy, + * e.g. for an API review. + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * SUPPORTED TOKENS: , , + * DEFAULT VALUE: "/etc/" + */ + // "reportFolder": "/etc/", + + /** + * Specifies the folder where the temporary report file is written. The file name portion is determined by + * the "reportFileName" setting. + * + * After the temporary file is written to disk, it is compared with the file in the "reportFolder". + * If they are different, a production build will fail. + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * SUPPORTED TOKENS: , , + * DEFAULT VALUE: "/temp/" + */ + // "reportTempFolder": "/temp/" + }, + + /** + * Configures how the doc model file (*.api.json) will be generated. + */ + "docModel": { + /** + * (REQUIRED) Whether to generate a doc model file. + */ + "enabled": true, + + /** + * The output path for the doc model file. The file extension should be ".api.json". + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * SUPPORTED TOKENS: , , + * DEFAULT VALUE: "/temp/.api.json" + */ + // "apiJsonFilePath": "/temp/.api.json" + }, + + /** + * Configures how the .d.ts rollup file will be generated. + */ + "dtsRollup": { + /** + * (REQUIRED) Whether to generate the .d.ts rollup file. + */ + "enabled": true, + + /** + * Specifies the output path for a .d.ts rollup file to be generated without any trimming. + * This file will include all declarations that are exported by the main entry point. + * + * If the path is an empty string, then this file will not be written. + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * SUPPORTED TOKENS: , , + * DEFAULT VALUE: "/dist/.d.ts" + */ + // "untrimmedFilePath": "/dist/.d.ts", + + /** + * Specifies the output path for a .d.ts rollup file to be generated with trimming for a "beta" release. + * This file will include only declarations that are marked as "@public" or "@beta". + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * SUPPORTED TOKENS: , , + * DEFAULT VALUE: "" + */ + // "betaTrimmedFilePath": "/dist/-beta.d.ts", + + + /** + * Specifies the output path for a .d.ts rollup file to be generated with trimming for a "public" release. + * This file will include only declarations that are marked as "@public". + * + * If the path is an empty string, then this file will not be written. + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * SUPPORTED TOKENS: , , + * DEFAULT VALUE: "" + */ + // "publicTrimmedFilePath": "/dist/-public.d.ts", + + /** + * When a declaration is trimmed, by default it will be replaced by a code comment such as + * "Excluded from this release type: exampleMember". Set "omitTrimmingComments" to true to remove the + * declaration completely. + * + * DEFAULT VALUE: false + */ + // "omitTrimmingComments": true + }, + + /** + * Configures how the tsdoc-metadata.json file will be generated. + */ + "tsdocMetadata": { + /** + * Whether to generate the tsdoc-metadata.json file. + * + * DEFAULT VALUE: true + */ + // "enabled": true, + + /** + * Specifies where the TSDoc metadata file should be written. + * + * The path is resolved relative to the folder of the config file that contains the setting; to change this, + * prepend a folder token such as "". + * + * The default value is "", which causes the path to be automatically inferred from the "tsdocMetadata", + * "typings" or "main" fields of the project's package.json. If none of these fields are set, the lookup + * falls back to "tsdoc-metadata.json" in the package folder. + * + * SUPPORTED TOKENS: , , + * DEFAULT VALUE: "" + */ + // "tsdocMetadataFilePath": "/dist/tsdoc-metadata.json" + }, + + /** + * Specifies what type of newlines API Extractor should use when writing output files. By default, the output files + * will be written with Windows-style newlines. To use POSIX-style newlines, specify "lf" instead. + * To use the OS's default newline kind, specify "os". + * + * DEFAULT VALUE: "crlf" + */ + // "newlineKind": "crlf", + + /** + * Configures how API Extractor reports error and warning messages produced during analysis. + * + * There are three sources of messages: compiler messages, API Extractor messages, and TSDoc messages. + */ + "messages": { + /** + * Configures handling of diagnostic messages reported by the TypeScript compiler engine while analyzing + * the input .d.ts files. + * + * TypeScript message identifiers start with "TS" followed by an integer. For example: "TS2551" + * + * DEFAULT VALUE: A single "default" entry with logLevel=warning. + */ + "compilerMessageReporting": { + /** + * Configures the default routing for messages that don't match an explicit rule in this table. + */ + "default": { + /** + * Specifies whether the message should be written to the the tool's output log. Note that + * the "addToApiReportFile" property may supersede this option. + * + * Possible values: "error", "warning", "none" + * + * Errors cause the build to fail and return a nonzero exit code. Warnings cause a production build fail + * and return a nonzero exit code. For a non-production build (e.g. when "api-extractor run" includes + * the "--local" option), the warning is displayed but the build will not fail. + * + * DEFAULT VALUE: "warning" + */ + "logLevel": "warning", + + /** + * When addToApiReportFile is true: If API Extractor is configured to write an API report file (.api.md), + * then the message will be written inside that file; otherwise, the message is instead logged according to + * the "logLevel" option. + * + * DEFAULT VALUE: false + */ + // "addToApiReportFile": false + }, + + // "TS2551": { + // "logLevel": "warning", + // "addToApiReportFile": true + // }, + // + // . . . + }, + + /** + * Configures handling of messages reported by API Extractor during its analysis. + * + * API Extractor message identifiers start with "ae-". For example: "ae-extra-release-tag" + * + * DEFAULT VALUE: See api-extractor-defaults.json for the complete table of extractorMessageReporting mappings + */ + "extractorMessageReporting": { + "default": { + "logLevel": "warning", + // "addToApiReportFile": false + }, + + // "ae-extra-release-tag": { + // "logLevel": "warning", + // "addToApiReportFile": true + // }, + // + // . . . + }, + + /** + * Configures handling of messages reported by the TSDoc parser when analyzing code comments. + * + * TSDoc message identifiers start with "tsdoc-". For example: "tsdoc-link-tag-unescaped-text" + * + * DEFAULT VALUE: A single "default" entry with logLevel=warning. + */ + "tsdocMessageReporting": { + "default": { + "logLevel": "warning", + // "addToApiReportFile": false + } + + // "tsdoc-link-tag-unescaped-text": { + // "logLevel": "warning", + // "addToApiReportFile": true + // }, + // + // . . . + } + } + +} diff --git a/packages/google-cloud-apigeeconnect/linkinator.config.json b/packages/google-cloud-apigeeconnect/linkinator.config.json new file mode 100644 index 00000000000..0947c2e0e5b --- /dev/null +++ b/packages/google-cloud-apigeeconnect/linkinator.config.json @@ -0,0 +1 @@ +{"recurse":true,"skip":["https://codecov.io/gh/googleapis/","www.googleapis.com","img.shields.io"],"silent":true,"concurrency":10} \ No newline at end of file diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json new file mode 100644 index 00000000000..6716bf66fdf --- /dev/null +++ b/packages/google-cloud-apigeeconnect/package.json @@ -0,0 +1,66 @@ +{ + "name": "@google-cloud/apigee-connect", + "version": "0.1.0", + "description": "apigeeconnect client for Node.js", + "repository": "googleapis/googleapis/nodejs-apigee-connect", + "license": "Apache-2.0", + "author": "Google LLC", + "main": "build/src/index.js", + "files": [ + "build/src", + "build/protos" + ], + "keywords": [ + "google apis client", + "google api client", + "google apis", + "google api", + "google", + "google cloud platform", + "google cloud", + "cloud", + "google apigeeconnect", + "apigeeconnect", + "apigeeconnect service" + ], + "scripts": { + "clean": "gts clean", + "compile": "tsc -p . && cp -r protos build/", + "compile-protos": "compileProtos src", + "docs": "jsdoc -c .jsdoc.js", + "predocs-test": "npm run docs", + "docs-test": "linkinator docs", + "fix": "gts fix", + "lint": "gts check", + "prepare": "npm run compile-protos && npm run compile", + "system-test": "c8 mocha build/system-test", + "test": "c8 mocha build/test", + "samples-test": "cd samples/ && npm link ../ && npm test", + "prelint": "cd samples; npm link ../; npm i" + }, + "dependencies": { + "google-gax": "^2.12.0" + }, + "devDependencies": { + "@types/mocha": "^8.2.2", + "@types/node": "^14.14.44", + "@types/sinon": "^10.0.0", + "c8": "^7.7.2", + "gts": "^3.1.0", + "jsdoc": "^3.6.6", + "jsdoc-fresh": "^1.0.2", + "jsdoc-region-tag": "^1.0.6", + "linkinator": "^2.13.6", + "mocha": "^8.4.0", + "null-loader": "^4.0.1", + "pack-n-play": "^1.0.0-2", + "sinon": "^10.0.0", + "ts-loader": "^9.1.2", + "typescript": "^4.2.4", + "webpack": "^5.36.2", + "webpack-cli": "^4.7.0" + }, + "engines": { + "node": ">=v10.0.0" + } +} diff --git a/packages/google-cloud-apigeeconnect/protos/google/cloud/apigeeconnect/v1/connection.proto b/packages/google-cloud-apigeeconnect/protos/google/cloud/apigeeconnect/v1/connection.proto new file mode 100644 index 00000000000..021ae3b26d1 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/protos/google/cloud/apigeeconnect/v1/connection.proto @@ -0,0 +1,104 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +syntax = "proto3"; + +package google.cloud.apigeeconnect.v1; + +import "google/api/annotations.proto"; +import "google/api/client.proto"; +import "google/api/field_behavior.proto"; +import "google/api/resource.proto"; + +option csharp_namespace = "Google.Cloud.ApigeeConnect.V1"; +option go_package = "google.golang.org/genproto/googleapis/cloud/apigeeconnect/v1;apigeeconnect"; +option java_multiple_files = true; +option java_outer_classname = "ConnectionProto"; +option java_package = "com.google.cloud.apigeeconnect.v1"; +option php_namespace = "Google\\Cloud\\ApigeeConnect\\V1"; +option ruby_package = "Google::Cloud::ApigeeConnect::V1"; +option (google.api.resource_definition) = { + type: "apigeeconnect.googleapis.com/Endpoint" + pattern: "projects/{project}/endpoints/{endpoint}" +}; + +// Service Interface for the Apigee Connect connection management APIs. +service ConnectionService { + option (google.api.default_host) = "apigeeconnect.googleapis.com"; + option (google.api.oauth_scopes) = "https://www.googleapis.com/auth/cloud-platform"; + + // Lists connections that are currently active for the given Apigee Connect + // endpoint. + rpc ListConnections(ListConnectionsRequest) returns (ListConnectionsResponse) { + option (google.api.http) = { + get: "/v1/{parent=projects/*/endpoints/*}/connections" + }; + option (google.api.method_signature) = "parent"; + } +} + +// The request for [ListConnections][Management.ListConnections]. +message ListConnectionsRequest { + // Required. Parent name of the form: + // `projects/{project_number or project_id}/endpoints/{endpoint}`. + string parent = 1 [ + (google.api.field_behavior) = REQUIRED, + (google.api.resource_reference) = { + type: "apigeeconnect.googleapis.com/Endpoint" + } + ]; + + // The maximum number of connections to return. The service may return fewer + // than this value. If unspecified, at most 100 connections will be returned. + // The maximum value is 1000; values above 1000 will be coerced to 1000. + int32 page_size = 2; + + // A page token, received from a previous `ListConnections` call. + // Provide this to retrieve the subsequent page. + // + // When paginating, all other parameters provided to `ListConnections` must + // match the call that provided the page token. + string page_token = 3; +} + +// The response for +// [ListConnections][Management.ListConnections]. +message ListConnectionsResponse { + // A list of clients. + repeated Connection connections = 1; + + // A token that can be sent as `page_token` to retrieve the next page. + // If this field is omitted, there are no subsequent pages. + string next_page_token = 2; +} + +message Connection { + // The endpoint that the connection is made against. + // Format: `projects/{project_number}/endpoints/{endpoint}` + string endpoint = 1; + + // Cluster information. + Cluster cluster = 2; + + // The count of streams. + int32 stream_count = 3; +} + +message Cluster { + // The name of the cluster. + string name = 1; + + // The region of the cluster. + string region = 2; +} diff --git a/packages/google-cloud-apigeeconnect/protos/google/cloud/apigeeconnect/v1/tether.proto b/packages/google-cloud-apigeeconnect/protos/google/cloud/apigeeconnect/v1/tether.proto new file mode 100644 index 00000000000..8cd4eccb87b --- /dev/null +++ b/packages/google-cloud-apigeeconnect/protos/google/cloud/apigeeconnect/v1/tether.proto @@ -0,0 +1,215 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +syntax = "proto3"; + +package google.cloud.apigeeconnect.v1; + +import "google/protobuf/duration.proto"; +import "google/rpc/status.proto"; +import "google/api/client.proto"; + +option csharp_namespace = "Google.Cloud.ApigeeConnect.V1"; +option go_package = "google.golang.org/genproto/googleapis/cloud/apigeeconnect/v1;apigeeconnect"; +option java_multiple_files = true; +option java_outer_classname = "TetherProto"; +option java_package = "com.google.cloud.apigeeconnect.v1"; +option php_namespace = "Google\\Cloud\\ApigeeConnect\\V1"; +option ruby_package = "Google::Cloud::ApigeeConnect::V1"; + +// Tether provides a way for the control plane to send HTTP API requests to +// services in data planes that runs in a remote datacenter without +// requiring customers to open firewalls on their runtime plane. +service Tether { + option (google.api.default_host) = "apigeeconnect.googleapis.com"; + option (google.api.oauth_scopes) = "https://www.googleapis.com/auth/cloud-platform"; + + // Egress streams egress requests and responses. Logically, this is not + // actually a streaming request, but uses streaming as a mechanism to flip + // the client-server relationship of gRPC so that the server can act as a + // client. + // The listener, the RPC server, accepts connections from the dialer, + // the RPC client. + // The listener streams http requests and the dialer streams http responses. + rpc Egress(stream EgressResponse) returns (stream EgressRequest) { + } +} + +// gRPC request payload for tether. +message EgressRequest { + // Unique identifier for the request. + string id = 1; + + // Actual payload to send to agent. + Payload payload = 2; + + // Tether Endpoint. + TetherEndpoint endpoint = 3; + + // GCP Project. + // Format: `projects/{project_number}`. + string project = 4; + + // Unique identifier for clients to trace their request/response. + string trace_id = 5; + + // Timeout for the HTTP request. + google.protobuf.Duration timeout = 6; +} + +// Payload for EgressRequest. +message Payload { + // The kind of payload. + oneof kind { + // The HttpRequest proto. + HttpRequest http_request = 1; + + // The information of stream. + StreamInfo stream_info = 2; + + // The action taken by agent. + Action action = 3; + } +} + +// The Information of bi-directional stream. +message StreamInfo { + // Unique identifier for the stream. + string id = 1; +} + +// The action taken by agent. +enum Action { + // Unspecified Action. + ACTION_UNSPECIFIED = 0; + + // Indicates that agent should open a new stream. + OPEN_NEW_STREAM = 1; +} + +// gRPC response payload for tether. +message EgressResponse { + // Unique identifier for the response. Matches the EgressRequest's id. + string id = 1; + + // HttpResponse. + HttpResponse http_response = 2; + + // Errors from application when handling the http request. + google.rpc.Status status = 3; + + // GCP Project. + // Format: `projects/{project_number}`. + string project = 4; + + // Unique identifier for clients to trace their request/response. Matches the + // EgressRequest's trace id + string trace_id = 5; + + // Tether Endpoint. + TetherEndpoint endpoint = 6; + + // Name is the full resource path of endpoint. + // Format: `projects/{project_number or project_id}/endpoints/{endpoint}` + string name = 7; +} + +// Endpoint indicates where the messages will be delivered. +enum TetherEndpoint { + // Unspecified tether endpoint. + TETHER_ENDPOINT_UNSPECIFIED = 0; + + // Apigee MART endpoint. + APIGEE_MART = 1; + + // Apigee Runtime endpoint. + APIGEE_RUNTIME = 2; + + // Apigee Mint Rating endpoint. + APIGEE_MINT_RATING = 3; +} + +// HTTP Scheme. +enum Scheme { + // Unspecified scheme. + SCHEME_UNSPECIFIED = 0; + + // HTTPS protocol. + HTTPS = 1; +} + +// The proto definition of http request. +message HttpRequest { + // A unique identifier for the request. + string id = 1; + + // The HTTP request method. + // Valid methods: "GET", "HEAD", "POST", "PUT", "PATCH","DELETE". + string method = 2; + + // The HTTP request URL. + Url url = 3; + + // The HTTP request headers. + repeated Header headers = 4; + + // HTTP request body. + bytes body = 5; +} + +// The proto definition of url. +// A url represents a URL and the general form represented is: +// +// `[scheme://][google.cloud.apigeeconnect.v1.Url.host][path]` +message Url { + // Scheme. + Scheme scheme = 1; + + // Host or Host:Port. + string host = 2; + + // Path starts with `/`. + string path = 3; +} + +// The http headers. +message Header { + string key = 1; + + repeated string values = 2; +} + +// The proto definition of http response. +message HttpResponse { + // A unique identifier that matches the request ID. + string id = 1; + + // Status of http response, e.g. "200 OK". + string status = 2; + + // Status code of http response, e.g. 200. + int32 status_code = 3; + + // The HTTP 1.1 response body. + bytes body = 4; + + // The HTTP response headers. + repeated Header headers = 5; + + // Content length records the length of the associated content. The + // value -1 indicates that the length is unknown. Unless http method + // is "HEAD", values >= 0 indicate that the given number of bytes may + // be read from Body. + int64 content_length = 6; +} diff --git a/packages/google-cloud-apigeeconnect/protos/protos.d.ts b/packages/google-cloud-apigeeconnect/protos/protos.d.ts new file mode 100644 index 00000000000..63e7874d58f --- /dev/null +++ b/packages/google-cloud-apigeeconnect/protos/protos.d.ts @@ -0,0 +1,5430 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +import * as Long from "long"; +import {protobuf as $protobuf} from "google-gax"; +/** Namespace google. */ +export namespace google { + + /** Namespace cloud. */ + namespace cloud { + + /** Namespace apigeeconnect. */ + namespace apigeeconnect { + + /** Namespace v1. */ + namespace v1 { + + /** Represents a ConnectionService */ + class ConnectionService extends $protobuf.rpc.Service { + + /** + * Constructs a new ConnectionService service. + * @param rpcImpl RPC implementation + * @param [requestDelimited=false] Whether requests are length-delimited + * @param [responseDelimited=false] Whether responses are length-delimited + */ + constructor(rpcImpl: $protobuf.RPCImpl, requestDelimited?: boolean, responseDelimited?: boolean); + + /** + * Creates new ConnectionService service using the specified rpc implementation. + * @param rpcImpl RPC implementation + * @param [requestDelimited=false] Whether requests are length-delimited + * @param [responseDelimited=false] Whether responses are length-delimited + * @returns RPC service. Useful where requests and/or responses are streamed. + */ + public static create(rpcImpl: $protobuf.RPCImpl, requestDelimited?: boolean, responseDelimited?: boolean): ConnectionService; + + /** + * Calls ListConnections. + * @param request ListConnectionsRequest message or plain object + * @param callback Node-style callback called with the error, if any, and ListConnectionsResponse + */ + public listConnections(request: google.cloud.apigeeconnect.v1.IListConnectionsRequest, callback: google.cloud.apigeeconnect.v1.ConnectionService.ListConnectionsCallback): void; + + /** + * Calls ListConnections. + * @param request ListConnectionsRequest message or plain object + * @returns Promise + */ + public listConnections(request: google.cloud.apigeeconnect.v1.IListConnectionsRequest): Promise; + } + + namespace ConnectionService { + + /** + * Callback as used by {@link google.cloud.apigeeconnect.v1.ConnectionService#listConnections}. + * @param error Error, if any + * @param [response] ListConnectionsResponse + */ + type ListConnectionsCallback = (error: (Error|null), response?: google.cloud.apigeeconnect.v1.ListConnectionsResponse) => void; + } + + /** Properties of a ListConnectionsRequest. */ + interface IListConnectionsRequest { + + /** ListConnectionsRequest parent */ + parent?: (string|null); + + /** ListConnectionsRequest pageSize */ + pageSize?: (number|null); + + /** ListConnectionsRequest pageToken */ + pageToken?: (string|null); + } + + /** Represents a ListConnectionsRequest. */ + class ListConnectionsRequest implements IListConnectionsRequest { + + /** + * Constructs a new ListConnectionsRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IListConnectionsRequest); + + /** ListConnectionsRequest parent. */ + public parent: string; + + /** ListConnectionsRequest pageSize. */ + public pageSize: number; + + /** ListConnectionsRequest pageToken. */ + public pageToken: string; + + /** + * Creates a new ListConnectionsRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns ListConnectionsRequest instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IListConnectionsRequest): google.cloud.apigeeconnect.v1.ListConnectionsRequest; + + /** + * Encodes the specified ListConnectionsRequest message. Does not implicitly {@link google.cloud.apigeeconnect.v1.ListConnectionsRequest.verify|verify} messages. + * @param message ListConnectionsRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IListConnectionsRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ListConnectionsRequest message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.ListConnectionsRequest.verify|verify} messages. + * @param message ListConnectionsRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IListConnectionsRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ListConnectionsRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ListConnectionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.ListConnectionsRequest; + + /** + * Decodes a ListConnectionsRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ListConnectionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.ListConnectionsRequest; + + /** + * Verifies a ListConnectionsRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ListConnectionsRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ListConnectionsRequest + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.ListConnectionsRequest; + + /** + * Creates a plain object from a ListConnectionsRequest message. Also converts values to other types if specified. + * @param message ListConnectionsRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.ListConnectionsRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ListConnectionsRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a ListConnectionsResponse. */ + interface IListConnectionsResponse { + + /** ListConnectionsResponse connections */ + connections?: (google.cloud.apigeeconnect.v1.IConnection[]|null); + + /** ListConnectionsResponse nextPageToken */ + nextPageToken?: (string|null); + } + + /** Represents a ListConnectionsResponse. */ + class ListConnectionsResponse implements IListConnectionsResponse { + + /** + * Constructs a new ListConnectionsResponse. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IListConnectionsResponse); + + /** ListConnectionsResponse connections. */ + public connections: google.cloud.apigeeconnect.v1.IConnection[]; + + /** ListConnectionsResponse nextPageToken. */ + public nextPageToken: string; + + /** + * Creates a new ListConnectionsResponse instance using the specified properties. + * @param [properties] Properties to set + * @returns ListConnectionsResponse instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IListConnectionsResponse): google.cloud.apigeeconnect.v1.ListConnectionsResponse; + + /** + * Encodes the specified ListConnectionsResponse message. Does not implicitly {@link google.cloud.apigeeconnect.v1.ListConnectionsResponse.verify|verify} messages. + * @param message ListConnectionsResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IListConnectionsResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ListConnectionsResponse message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.ListConnectionsResponse.verify|verify} messages. + * @param message ListConnectionsResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IListConnectionsResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ListConnectionsResponse message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ListConnectionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.ListConnectionsResponse; + + /** + * Decodes a ListConnectionsResponse message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ListConnectionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.ListConnectionsResponse; + + /** + * Verifies a ListConnectionsResponse message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ListConnectionsResponse message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ListConnectionsResponse + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.ListConnectionsResponse; + + /** + * Creates a plain object from a ListConnectionsResponse message. Also converts values to other types if specified. + * @param message ListConnectionsResponse + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.ListConnectionsResponse, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ListConnectionsResponse to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a Connection. */ + interface IConnection { + + /** Connection endpoint */ + endpoint?: (string|null); + + /** Connection cluster */ + cluster?: (google.cloud.apigeeconnect.v1.ICluster|null); + + /** Connection streamCount */ + streamCount?: (number|null); + } + + /** Represents a Connection. */ + class Connection implements IConnection { + + /** + * Constructs a new Connection. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IConnection); + + /** Connection endpoint. */ + public endpoint: string; + + /** Connection cluster. */ + public cluster?: (google.cloud.apigeeconnect.v1.ICluster|null); + + /** Connection streamCount. */ + public streamCount: number; + + /** + * Creates a new Connection instance using the specified properties. + * @param [properties] Properties to set + * @returns Connection instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IConnection): google.cloud.apigeeconnect.v1.Connection; + + /** + * Encodes the specified Connection message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Connection.verify|verify} messages. + * @param message Connection message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IConnection, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Connection message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Connection.verify|verify} messages. + * @param message Connection message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IConnection, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Connection message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Connection + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.Connection; + + /** + * Decodes a Connection message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Connection + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.Connection; + + /** + * Verifies a Connection message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Connection message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Connection + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.Connection; + + /** + * Creates a plain object from a Connection message. Also converts values to other types if specified. + * @param message Connection + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.Connection, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Connection to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a Cluster. */ + interface ICluster { + + /** Cluster name */ + name?: (string|null); + + /** Cluster region */ + region?: (string|null); + } + + /** Represents a Cluster. */ + class Cluster implements ICluster { + + /** + * Constructs a new Cluster. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.ICluster); + + /** Cluster name. */ + public name: string; + + /** Cluster region. */ + public region: string; + + /** + * Creates a new Cluster instance using the specified properties. + * @param [properties] Properties to set + * @returns Cluster instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.ICluster): google.cloud.apigeeconnect.v1.Cluster; + + /** + * Encodes the specified Cluster message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Cluster.verify|verify} messages. + * @param message Cluster message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.ICluster, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Cluster message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Cluster.verify|verify} messages. + * @param message Cluster message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.ICluster, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Cluster message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Cluster + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.Cluster; + + /** + * Decodes a Cluster message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Cluster + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.Cluster; + + /** + * Verifies a Cluster message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Cluster message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Cluster + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.Cluster; + + /** + * Creates a plain object from a Cluster message. Also converts values to other types if specified. + * @param message Cluster + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.Cluster, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Cluster to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Represents a Tether */ + class Tether extends $protobuf.rpc.Service { + + /** + * Constructs a new Tether service. + * @param rpcImpl RPC implementation + * @param [requestDelimited=false] Whether requests are length-delimited + * @param [responseDelimited=false] Whether responses are length-delimited + */ + constructor(rpcImpl: $protobuf.RPCImpl, requestDelimited?: boolean, responseDelimited?: boolean); + + /** + * Creates new Tether service using the specified rpc implementation. + * @param rpcImpl RPC implementation + * @param [requestDelimited=false] Whether requests are length-delimited + * @param [responseDelimited=false] Whether responses are length-delimited + * @returns RPC service. Useful where requests and/or responses are streamed. + */ + public static create(rpcImpl: $protobuf.RPCImpl, requestDelimited?: boolean, responseDelimited?: boolean): Tether; + + /** + * Calls Egress. + * @param request EgressResponse message or plain object + * @param callback Node-style callback called with the error, if any, and EgressRequest + */ + public egress(request: google.cloud.apigeeconnect.v1.IEgressResponse, callback: google.cloud.apigeeconnect.v1.Tether.EgressCallback): void; + + /** + * Calls Egress. + * @param request EgressResponse message or plain object + * @returns Promise + */ + public egress(request: google.cloud.apigeeconnect.v1.IEgressResponse): Promise; + } + + namespace Tether { + + /** + * Callback as used by {@link google.cloud.apigeeconnect.v1.Tether#egress}. + * @param error Error, if any + * @param [response] EgressRequest + */ + type EgressCallback = (error: (Error|null), response?: google.cloud.apigeeconnect.v1.EgressRequest) => void; + } + + /** Properties of an EgressRequest. */ + interface IEgressRequest { + + /** EgressRequest id */ + id?: (string|null); + + /** EgressRequest payload */ + payload?: (google.cloud.apigeeconnect.v1.IPayload|null); + + /** EgressRequest endpoint */ + endpoint?: (google.cloud.apigeeconnect.v1.TetherEndpoint|keyof typeof google.cloud.apigeeconnect.v1.TetherEndpoint|null); + + /** EgressRequest project */ + project?: (string|null); + + /** EgressRequest traceId */ + traceId?: (string|null); + + /** EgressRequest timeout */ + timeout?: (google.protobuf.IDuration|null); + } + + /** Represents an EgressRequest. */ + class EgressRequest implements IEgressRequest { + + /** + * Constructs a new EgressRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IEgressRequest); + + /** EgressRequest id. */ + public id: string; + + /** EgressRequest payload. */ + public payload?: (google.cloud.apigeeconnect.v1.IPayload|null); + + /** EgressRequest endpoint. */ + public endpoint: (google.cloud.apigeeconnect.v1.TetherEndpoint|keyof typeof google.cloud.apigeeconnect.v1.TetherEndpoint); + + /** EgressRequest project. */ + public project: string; + + /** EgressRequest traceId. */ + public traceId: string; + + /** EgressRequest timeout. */ + public timeout?: (google.protobuf.IDuration|null); + + /** + * Creates a new EgressRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns EgressRequest instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IEgressRequest): google.cloud.apigeeconnect.v1.EgressRequest; + + /** + * Encodes the specified EgressRequest message. Does not implicitly {@link google.cloud.apigeeconnect.v1.EgressRequest.verify|verify} messages. + * @param message EgressRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IEgressRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EgressRequest message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.EgressRequest.verify|verify} messages. + * @param message EgressRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IEgressRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EgressRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EgressRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.EgressRequest; + + /** + * Decodes an EgressRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EgressRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.EgressRequest; + + /** + * Verifies an EgressRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EgressRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EgressRequest + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.EgressRequest; + + /** + * Creates a plain object from an EgressRequest message. Also converts values to other types if specified. + * @param message EgressRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.EgressRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EgressRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a Payload. */ + interface IPayload { + + /** Payload httpRequest */ + httpRequest?: (google.cloud.apigeeconnect.v1.IHttpRequest|null); + + /** Payload streamInfo */ + streamInfo?: (google.cloud.apigeeconnect.v1.IStreamInfo|null); + + /** Payload action */ + action?: (google.cloud.apigeeconnect.v1.Action|keyof typeof google.cloud.apigeeconnect.v1.Action|null); + } + + /** Represents a Payload. */ + class Payload implements IPayload { + + /** + * Constructs a new Payload. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IPayload); + + /** Payload httpRequest. */ + public httpRequest?: (google.cloud.apigeeconnect.v1.IHttpRequest|null); + + /** Payload streamInfo. */ + public streamInfo?: (google.cloud.apigeeconnect.v1.IStreamInfo|null); + + /** Payload action. */ + public action?: (google.cloud.apigeeconnect.v1.Action|keyof typeof google.cloud.apigeeconnect.v1.Action|null); + + /** Payload kind. */ + public kind?: ("httpRequest"|"streamInfo"|"action"); + + /** + * Creates a new Payload instance using the specified properties. + * @param [properties] Properties to set + * @returns Payload instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IPayload): google.cloud.apigeeconnect.v1.Payload; + + /** + * Encodes the specified Payload message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Payload.verify|verify} messages. + * @param message Payload message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IPayload, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Payload message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Payload.verify|verify} messages. + * @param message Payload message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IPayload, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Payload message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Payload + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.Payload; + + /** + * Decodes a Payload message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Payload + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.Payload; + + /** + * Verifies a Payload message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Payload message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Payload + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.Payload; + + /** + * Creates a plain object from a Payload message. Also converts values to other types if specified. + * @param message Payload + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.Payload, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Payload to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a StreamInfo. */ + interface IStreamInfo { + + /** StreamInfo id */ + id?: (string|null); + } + + /** Represents a StreamInfo. */ + class StreamInfo implements IStreamInfo { + + /** + * Constructs a new StreamInfo. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IStreamInfo); + + /** StreamInfo id. */ + public id: string; + + /** + * Creates a new StreamInfo instance using the specified properties. + * @param [properties] Properties to set + * @returns StreamInfo instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IStreamInfo): google.cloud.apigeeconnect.v1.StreamInfo; + + /** + * Encodes the specified StreamInfo message. Does not implicitly {@link google.cloud.apigeeconnect.v1.StreamInfo.verify|verify} messages. + * @param message StreamInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IStreamInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified StreamInfo message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.StreamInfo.verify|verify} messages. + * @param message StreamInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IStreamInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a StreamInfo message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns StreamInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.StreamInfo; + + /** + * Decodes a StreamInfo message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns StreamInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.StreamInfo; + + /** + * Verifies a StreamInfo message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a StreamInfo message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns StreamInfo + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.StreamInfo; + + /** + * Creates a plain object from a StreamInfo message. Also converts values to other types if specified. + * @param message StreamInfo + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.StreamInfo, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this StreamInfo to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Action enum. */ + enum Action { + ACTION_UNSPECIFIED = 0, + OPEN_NEW_STREAM = 1 + } + + /** Properties of an EgressResponse. */ + interface IEgressResponse { + + /** EgressResponse id */ + id?: (string|null); + + /** EgressResponse httpResponse */ + httpResponse?: (google.cloud.apigeeconnect.v1.IHttpResponse|null); + + /** EgressResponse status */ + status?: (google.rpc.IStatus|null); + + /** EgressResponse project */ + project?: (string|null); + + /** EgressResponse traceId */ + traceId?: (string|null); + + /** EgressResponse endpoint */ + endpoint?: (google.cloud.apigeeconnect.v1.TetherEndpoint|keyof typeof google.cloud.apigeeconnect.v1.TetherEndpoint|null); + + /** EgressResponse name */ + name?: (string|null); + } + + /** Represents an EgressResponse. */ + class EgressResponse implements IEgressResponse { + + /** + * Constructs a new EgressResponse. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IEgressResponse); + + /** EgressResponse id. */ + public id: string; + + /** EgressResponse httpResponse. */ + public httpResponse?: (google.cloud.apigeeconnect.v1.IHttpResponse|null); + + /** EgressResponse status. */ + public status?: (google.rpc.IStatus|null); + + /** EgressResponse project. */ + public project: string; + + /** EgressResponse traceId. */ + public traceId: string; + + /** EgressResponse endpoint. */ + public endpoint: (google.cloud.apigeeconnect.v1.TetherEndpoint|keyof typeof google.cloud.apigeeconnect.v1.TetherEndpoint); + + /** EgressResponse name. */ + public name: string; + + /** + * Creates a new EgressResponse instance using the specified properties. + * @param [properties] Properties to set + * @returns EgressResponse instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IEgressResponse): google.cloud.apigeeconnect.v1.EgressResponse; + + /** + * Encodes the specified EgressResponse message. Does not implicitly {@link google.cloud.apigeeconnect.v1.EgressResponse.verify|verify} messages. + * @param message EgressResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IEgressResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EgressResponse message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.EgressResponse.verify|verify} messages. + * @param message EgressResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IEgressResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EgressResponse message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EgressResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.EgressResponse; + + /** + * Decodes an EgressResponse message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EgressResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.EgressResponse; + + /** + * Verifies an EgressResponse message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EgressResponse message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EgressResponse + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.EgressResponse; + + /** + * Creates a plain object from an EgressResponse message. Also converts values to other types if specified. + * @param message EgressResponse + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.EgressResponse, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EgressResponse to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** TetherEndpoint enum. */ + enum TetherEndpoint { + TETHER_ENDPOINT_UNSPECIFIED = 0, + APIGEE_MART = 1, + APIGEE_RUNTIME = 2, + APIGEE_MINT_RATING = 3 + } + + /** Scheme enum. */ + enum Scheme { + SCHEME_UNSPECIFIED = 0, + HTTPS = 1 + } + + /** Properties of a HttpRequest. */ + interface IHttpRequest { + + /** HttpRequest id */ + id?: (string|null); + + /** HttpRequest method */ + method?: (string|null); + + /** HttpRequest url */ + url?: (google.cloud.apigeeconnect.v1.IUrl|null); + + /** HttpRequest headers */ + headers?: (google.cloud.apigeeconnect.v1.IHeader[]|null); + + /** HttpRequest body */ + body?: (Uint8Array|string|null); + } + + /** Represents a HttpRequest. */ + class HttpRequest implements IHttpRequest { + + /** + * Constructs a new HttpRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IHttpRequest); + + /** HttpRequest id. */ + public id: string; + + /** HttpRequest method. */ + public method: string; + + /** HttpRequest url. */ + public url?: (google.cloud.apigeeconnect.v1.IUrl|null); + + /** HttpRequest headers. */ + public headers: google.cloud.apigeeconnect.v1.IHeader[]; + + /** HttpRequest body. */ + public body: (Uint8Array|string); + + /** + * Creates a new HttpRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns HttpRequest instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IHttpRequest): google.cloud.apigeeconnect.v1.HttpRequest; + + /** + * Encodes the specified HttpRequest message. Does not implicitly {@link google.cloud.apigeeconnect.v1.HttpRequest.verify|verify} messages. + * @param message HttpRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IHttpRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified HttpRequest message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.HttpRequest.verify|verify} messages. + * @param message HttpRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IHttpRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a HttpRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns HttpRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.HttpRequest; + + /** + * Decodes a HttpRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns HttpRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.HttpRequest; + + /** + * Verifies a HttpRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a HttpRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns HttpRequest + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.HttpRequest; + + /** + * Creates a plain object from a HttpRequest message. Also converts values to other types if specified. + * @param message HttpRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.HttpRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this HttpRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of an Url. */ + interface IUrl { + + /** Url scheme */ + scheme?: (google.cloud.apigeeconnect.v1.Scheme|keyof typeof google.cloud.apigeeconnect.v1.Scheme|null); + + /** Url host */ + host?: (string|null); + + /** Url path */ + path?: (string|null); + } + + /** Represents an Url. */ + class Url implements IUrl { + + /** + * Constructs a new Url. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IUrl); + + /** Url scheme. */ + public scheme: (google.cloud.apigeeconnect.v1.Scheme|keyof typeof google.cloud.apigeeconnect.v1.Scheme); + + /** Url host. */ + public host: string; + + /** Url path. */ + public path: string; + + /** + * Creates a new Url instance using the specified properties. + * @param [properties] Properties to set + * @returns Url instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IUrl): google.cloud.apigeeconnect.v1.Url; + + /** + * Encodes the specified Url message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Url.verify|verify} messages. + * @param message Url message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IUrl, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Url message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Url.verify|verify} messages. + * @param message Url message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IUrl, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an Url message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Url + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.Url; + + /** + * Decodes an Url message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Url + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.Url; + + /** + * Verifies an Url message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an Url message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Url + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.Url; + + /** + * Creates a plain object from an Url message. Also converts values to other types if specified. + * @param message Url + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.Url, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Url to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a Header. */ + interface IHeader { + + /** Header key */ + key?: (string|null); + + /** Header values */ + values?: (string[]|null); + } + + /** Represents a Header. */ + class Header implements IHeader { + + /** + * Constructs a new Header. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IHeader); + + /** Header key. */ + public key: string; + + /** Header values. */ + public values: string[]; + + /** + * Creates a new Header instance using the specified properties. + * @param [properties] Properties to set + * @returns Header instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IHeader): google.cloud.apigeeconnect.v1.Header; + + /** + * Encodes the specified Header message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Header.verify|verify} messages. + * @param message Header message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IHeader, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Header message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Header.verify|verify} messages. + * @param message Header message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IHeader, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Header message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Header + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.Header; + + /** + * Decodes a Header message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Header + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.Header; + + /** + * Verifies a Header message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Header message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Header + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.Header; + + /** + * Creates a plain object from a Header message. Also converts values to other types if specified. + * @param message Header + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.Header, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Header to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a HttpResponse. */ + interface IHttpResponse { + + /** HttpResponse id */ + id?: (string|null); + + /** HttpResponse status */ + status?: (string|null); + + /** HttpResponse statusCode */ + statusCode?: (number|null); + + /** HttpResponse body */ + body?: (Uint8Array|string|null); + + /** HttpResponse headers */ + headers?: (google.cloud.apigeeconnect.v1.IHeader[]|null); + + /** HttpResponse contentLength */ + contentLength?: (number|Long|string|null); + } + + /** Represents a HttpResponse. */ + class HttpResponse implements IHttpResponse { + + /** + * Constructs a new HttpResponse. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.apigeeconnect.v1.IHttpResponse); + + /** HttpResponse id. */ + public id: string; + + /** HttpResponse status. */ + public status: string; + + /** HttpResponse statusCode. */ + public statusCode: number; + + /** HttpResponse body. */ + public body: (Uint8Array|string); + + /** HttpResponse headers. */ + public headers: google.cloud.apigeeconnect.v1.IHeader[]; + + /** HttpResponse contentLength. */ + public contentLength: (number|Long|string); + + /** + * Creates a new HttpResponse instance using the specified properties. + * @param [properties] Properties to set + * @returns HttpResponse instance + */ + public static create(properties?: google.cloud.apigeeconnect.v1.IHttpResponse): google.cloud.apigeeconnect.v1.HttpResponse; + + /** + * Encodes the specified HttpResponse message. Does not implicitly {@link google.cloud.apigeeconnect.v1.HttpResponse.verify|verify} messages. + * @param message HttpResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.apigeeconnect.v1.IHttpResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified HttpResponse message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.HttpResponse.verify|verify} messages. + * @param message HttpResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.apigeeconnect.v1.IHttpResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a HttpResponse message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns HttpResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.apigeeconnect.v1.HttpResponse; + + /** + * Decodes a HttpResponse message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns HttpResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.apigeeconnect.v1.HttpResponse; + + /** + * Verifies a HttpResponse message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a HttpResponse message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns HttpResponse + */ + public static fromObject(object: { [k: string]: any }): google.cloud.apigeeconnect.v1.HttpResponse; + + /** + * Creates a plain object from a HttpResponse message. Also converts values to other types if specified. + * @param message HttpResponse + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.apigeeconnect.v1.HttpResponse, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this HttpResponse to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } + } + } + + /** Namespace api. */ + namespace api { + + /** Properties of a Http. */ + interface IHttp { + + /** Http rules */ + rules?: (google.api.IHttpRule[]|null); + + /** Http fullyDecodeReservedExpansion */ + fullyDecodeReservedExpansion?: (boolean|null); + } + + /** Represents a Http. */ + class Http implements IHttp { + + /** + * Constructs a new Http. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.IHttp); + + /** Http rules. */ + public rules: google.api.IHttpRule[]; + + /** Http fullyDecodeReservedExpansion. */ + public fullyDecodeReservedExpansion: boolean; + + /** + * Creates a new Http instance using the specified properties. + * @param [properties] Properties to set + * @returns Http instance + */ + public static create(properties?: google.api.IHttp): google.api.Http; + + /** + * Encodes the specified Http message. Does not implicitly {@link google.api.Http.verify|verify} messages. + * @param message Http message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.IHttp, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Http message, length delimited. Does not implicitly {@link google.api.Http.verify|verify} messages. + * @param message Http message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.IHttp, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Http message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Http + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.Http; + + /** + * Decodes a Http message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Http + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.Http; + + /** + * Verifies a Http message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Http message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Http + */ + public static fromObject(object: { [k: string]: any }): google.api.Http; + + /** + * Creates a plain object from a Http message. Also converts values to other types if specified. + * @param message Http + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.Http, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Http to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a HttpRule. */ + interface IHttpRule { + + /** HttpRule selector */ + selector?: (string|null); + + /** HttpRule get */ + get?: (string|null); + + /** HttpRule put */ + put?: (string|null); + + /** HttpRule post */ + post?: (string|null); + + /** HttpRule delete */ + "delete"?: (string|null); + + /** HttpRule patch */ + patch?: (string|null); + + /** HttpRule custom */ + custom?: (google.api.ICustomHttpPattern|null); + + /** HttpRule body */ + body?: (string|null); + + /** HttpRule responseBody */ + responseBody?: (string|null); + + /** HttpRule additionalBindings */ + additionalBindings?: (google.api.IHttpRule[]|null); + } + + /** Represents a HttpRule. */ + class HttpRule implements IHttpRule { + + /** + * Constructs a new HttpRule. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.IHttpRule); + + /** HttpRule selector. */ + public selector: string; + + /** HttpRule get. */ + public get?: (string|null); + + /** HttpRule put. */ + public put?: (string|null); + + /** HttpRule post. */ + public post?: (string|null); + + /** HttpRule delete. */ + public delete?: (string|null); + + /** HttpRule patch. */ + public patch?: (string|null); + + /** HttpRule custom. */ + public custom?: (google.api.ICustomHttpPattern|null); + + /** HttpRule body. */ + public body: string; + + /** HttpRule responseBody. */ + public responseBody: string; + + /** HttpRule additionalBindings. */ + public additionalBindings: google.api.IHttpRule[]; + + /** HttpRule pattern. */ + public pattern?: ("get"|"put"|"post"|"delete"|"patch"|"custom"); + + /** + * Creates a new HttpRule instance using the specified properties. + * @param [properties] Properties to set + * @returns HttpRule instance + */ + public static create(properties?: google.api.IHttpRule): google.api.HttpRule; + + /** + * Encodes the specified HttpRule message. Does not implicitly {@link google.api.HttpRule.verify|verify} messages. + * @param message HttpRule message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.IHttpRule, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified HttpRule message, length delimited. Does not implicitly {@link google.api.HttpRule.verify|verify} messages. + * @param message HttpRule message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.IHttpRule, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a HttpRule message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns HttpRule + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.HttpRule; + + /** + * Decodes a HttpRule message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns HttpRule + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.HttpRule; + + /** + * Verifies a HttpRule message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a HttpRule message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns HttpRule + */ + public static fromObject(object: { [k: string]: any }): google.api.HttpRule; + + /** + * Creates a plain object from a HttpRule message. Also converts values to other types if specified. + * @param message HttpRule + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.HttpRule, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this HttpRule to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a CustomHttpPattern. */ + interface ICustomHttpPattern { + + /** CustomHttpPattern kind */ + kind?: (string|null); + + /** CustomHttpPattern path */ + path?: (string|null); + } + + /** Represents a CustomHttpPattern. */ + class CustomHttpPattern implements ICustomHttpPattern { + + /** + * Constructs a new CustomHttpPattern. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.ICustomHttpPattern); + + /** CustomHttpPattern kind. */ + public kind: string; + + /** CustomHttpPattern path. */ + public path: string; + + /** + * Creates a new CustomHttpPattern instance using the specified properties. + * @param [properties] Properties to set + * @returns CustomHttpPattern instance + */ + public static create(properties?: google.api.ICustomHttpPattern): google.api.CustomHttpPattern; + + /** + * Encodes the specified CustomHttpPattern message. Does not implicitly {@link google.api.CustomHttpPattern.verify|verify} messages. + * @param message CustomHttpPattern message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.ICustomHttpPattern, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified CustomHttpPattern message, length delimited. Does not implicitly {@link google.api.CustomHttpPattern.verify|verify} messages. + * @param message CustomHttpPattern message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.ICustomHttpPattern, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a CustomHttpPattern message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns CustomHttpPattern + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.CustomHttpPattern; + + /** + * Decodes a CustomHttpPattern message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns CustomHttpPattern + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.CustomHttpPattern; + + /** + * Verifies a CustomHttpPattern message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a CustomHttpPattern message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns CustomHttpPattern + */ + public static fromObject(object: { [k: string]: any }): google.api.CustomHttpPattern; + + /** + * Creates a plain object from a CustomHttpPattern message. Also converts values to other types if specified. + * @param message CustomHttpPattern + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.CustomHttpPattern, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this CustomHttpPattern to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** FieldBehavior enum. */ + enum FieldBehavior { + FIELD_BEHAVIOR_UNSPECIFIED = 0, + OPTIONAL = 1, + REQUIRED = 2, + OUTPUT_ONLY = 3, + INPUT_ONLY = 4, + IMMUTABLE = 5, + UNORDERED_LIST = 6 + } + + /** Properties of a ResourceDescriptor. */ + interface IResourceDescriptor { + + /** ResourceDescriptor type */ + type?: (string|null); + + /** ResourceDescriptor pattern */ + pattern?: (string[]|null); + + /** ResourceDescriptor nameField */ + nameField?: (string|null); + + /** ResourceDescriptor history */ + history?: (google.api.ResourceDescriptor.History|keyof typeof google.api.ResourceDescriptor.History|null); + + /** ResourceDescriptor plural */ + plural?: (string|null); + + /** ResourceDescriptor singular */ + singular?: (string|null); + + /** ResourceDescriptor style */ + style?: (google.api.ResourceDescriptor.Style[]|null); + } + + /** Represents a ResourceDescriptor. */ + class ResourceDescriptor implements IResourceDescriptor { + + /** + * Constructs a new ResourceDescriptor. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.IResourceDescriptor); + + /** ResourceDescriptor type. */ + public type: string; + + /** ResourceDescriptor pattern. */ + public pattern: string[]; + + /** ResourceDescriptor nameField. */ + public nameField: string; + + /** ResourceDescriptor history. */ + public history: (google.api.ResourceDescriptor.History|keyof typeof google.api.ResourceDescriptor.History); + + /** ResourceDescriptor plural. */ + public plural: string; + + /** ResourceDescriptor singular. */ + public singular: string; + + /** ResourceDescriptor style. */ + public style: google.api.ResourceDescriptor.Style[]; + + /** + * Creates a new ResourceDescriptor instance using the specified properties. + * @param [properties] Properties to set + * @returns ResourceDescriptor instance + */ + public static create(properties?: google.api.IResourceDescriptor): google.api.ResourceDescriptor; + + /** + * Encodes the specified ResourceDescriptor message. Does not implicitly {@link google.api.ResourceDescriptor.verify|verify} messages. + * @param message ResourceDescriptor message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.IResourceDescriptor, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ResourceDescriptor message, length delimited. Does not implicitly {@link google.api.ResourceDescriptor.verify|verify} messages. + * @param message ResourceDescriptor message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.IResourceDescriptor, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ResourceDescriptor message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ResourceDescriptor + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.ResourceDescriptor; + + /** + * Decodes a ResourceDescriptor message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ResourceDescriptor + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.ResourceDescriptor; + + /** + * Verifies a ResourceDescriptor message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ResourceDescriptor message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ResourceDescriptor + */ + public static fromObject(object: { [k: string]: any }): google.api.ResourceDescriptor; + + /** + * Creates a plain object from a ResourceDescriptor message. Also converts values to other types if specified. + * @param message ResourceDescriptor + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.ResourceDescriptor, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ResourceDescriptor to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace ResourceDescriptor { + + /** History enum. */ + enum History { + HISTORY_UNSPECIFIED = 0, + ORIGINALLY_SINGLE_PATTERN = 1, + FUTURE_MULTI_PATTERN = 2 + } + + /** Style enum. */ + enum Style { + STYLE_UNSPECIFIED = 0, + DECLARATIVE_FRIENDLY = 1 + } + } + + /** Properties of a ResourceReference. */ + interface IResourceReference { + + /** ResourceReference type */ + type?: (string|null); + + /** ResourceReference childType */ + childType?: (string|null); + } + + /** Represents a ResourceReference. */ + class ResourceReference implements IResourceReference { + + /** + * Constructs a new ResourceReference. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.IResourceReference); + + /** ResourceReference type. */ + public type: string; + + /** ResourceReference childType. */ + public childType: string; + + /** + * Creates a new ResourceReference instance using the specified properties. + * @param [properties] Properties to set + * @returns ResourceReference instance + */ + public static create(properties?: google.api.IResourceReference): google.api.ResourceReference; + + /** + * Encodes the specified ResourceReference message. Does not implicitly {@link google.api.ResourceReference.verify|verify} messages. + * @param message ResourceReference message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.IResourceReference, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ResourceReference message, length delimited. Does not implicitly {@link google.api.ResourceReference.verify|verify} messages. + * @param message ResourceReference message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.IResourceReference, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ResourceReference message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ResourceReference + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.ResourceReference; + + /** + * Decodes a ResourceReference message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ResourceReference + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.ResourceReference; + + /** + * Verifies a ResourceReference message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ResourceReference message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ResourceReference + */ + public static fromObject(object: { [k: string]: any }): google.api.ResourceReference; + + /** + * Creates a plain object from a ResourceReference message. Also converts values to other types if specified. + * @param message ResourceReference + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.ResourceReference, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ResourceReference to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } + + /** Namespace protobuf. */ + namespace protobuf { + + /** Properties of a FileDescriptorSet. */ + interface IFileDescriptorSet { + + /** FileDescriptorSet file */ + file?: (google.protobuf.IFileDescriptorProto[]|null); + } + + /** Represents a FileDescriptorSet. */ + class FileDescriptorSet implements IFileDescriptorSet { + + /** + * Constructs a new FileDescriptorSet. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFileDescriptorSet); + + /** FileDescriptorSet file. */ + public file: google.protobuf.IFileDescriptorProto[]; + + /** + * Creates a new FileDescriptorSet instance using the specified properties. + * @param [properties] Properties to set + * @returns FileDescriptorSet instance + */ + public static create(properties?: google.protobuf.IFileDescriptorSet): google.protobuf.FileDescriptorSet; + + /** + * Encodes the specified FileDescriptorSet message. Does not implicitly {@link google.protobuf.FileDescriptorSet.verify|verify} messages. + * @param message FileDescriptorSet message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFileDescriptorSet, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FileDescriptorSet message, length delimited. Does not implicitly {@link google.protobuf.FileDescriptorSet.verify|verify} messages. + * @param message FileDescriptorSet message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFileDescriptorSet, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FileDescriptorSet message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FileDescriptorSet + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FileDescriptorSet; + + /** + * Decodes a FileDescriptorSet message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FileDescriptorSet + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FileDescriptorSet; + + /** + * Verifies a FileDescriptorSet message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FileDescriptorSet message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FileDescriptorSet + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FileDescriptorSet; + + /** + * Creates a plain object from a FileDescriptorSet message. Also converts values to other types if specified. + * @param message FileDescriptorSet + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FileDescriptorSet, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FileDescriptorSet to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a FileDescriptorProto. */ + interface IFileDescriptorProto { + + /** FileDescriptorProto name */ + name?: (string|null); + + /** FileDescriptorProto package */ + "package"?: (string|null); + + /** FileDescriptorProto dependency */ + dependency?: (string[]|null); + + /** FileDescriptorProto publicDependency */ + publicDependency?: (number[]|null); + + /** FileDescriptorProto weakDependency */ + weakDependency?: (number[]|null); + + /** FileDescriptorProto messageType */ + messageType?: (google.protobuf.IDescriptorProto[]|null); + + /** FileDescriptorProto enumType */ + enumType?: (google.protobuf.IEnumDescriptorProto[]|null); + + /** FileDescriptorProto service */ + service?: (google.protobuf.IServiceDescriptorProto[]|null); + + /** FileDescriptorProto extension */ + extension?: (google.protobuf.IFieldDescriptorProto[]|null); + + /** FileDescriptorProto options */ + options?: (google.protobuf.IFileOptions|null); + + /** FileDescriptorProto sourceCodeInfo */ + sourceCodeInfo?: (google.protobuf.ISourceCodeInfo|null); + + /** FileDescriptorProto syntax */ + syntax?: (string|null); + } + + /** Represents a FileDescriptorProto. */ + class FileDescriptorProto implements IFileDescriptorProto { + + /** + * Constructs a new FileDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFileDescriptorProto); + + /** FileDescriptorProto name. */ + public name: string; + + /** FileDescriptorProto package. */ + public package: string; + + /** FileDescriptorProto dependency. */ + public dependency: string[]; + + /** FileDescriptorProto publicDependency. */ + public publicDependency: number[]; + + /** FileDescriptorProto weakDependency. */ + public weakDependency: number[]; + + /** FileDescriptorProto messageType. */ + public messageType: google.protobuf.IDescriptorProto[]; + + /** FileDescriptorProto enumType. */ + public enumType: google.protobuf.IEnumDescriptorProto[]; + + /** FileDescriptorProto service. */ + public service: google.protobuf.IServiceDescriptorProto[]; + + /** FileDescriptorProto extension. */ + public extension: google.protobuf.IFieldDescriptorProto[]; + + /** FileDescriptorProto options. */ + public options?: (google.protobuf.IFileOptions|null); + + /** FileDescriptorProto sourceCodeInfo. */ + public sourceCodeInfo?: (google.protobuf.ISourceCodeInfo|null); + + /** FileDescriptorProto syntax. */ + public syntax: string; + + /** + * Creates a new FileDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns FileDescriptorProto instance + */ + public static create(properties?: google.protobuf.IFileDescriptorProto): google.protobuf.FileDescriptorProto; + + /** + * Encodes the specified FileDescriptorProto message. Does not implicitly {@link google.protobuf.FileDescriptorProto.verify|verify} messages. + * @param message FileDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFileDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FileDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.FileDescriptorProto.verify|verify} messages. + * @param message FileDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFileDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FileDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FileDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FileDescriptorProto; + + /** + * Decodes a FileDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FileDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FileDescriptorProto; + + /** + * Verifies a FileDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FileDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FileDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FileDescriptorProto; + + /** + * Creates a plain object from a FileDescriptorProto message. Also converts values to other types if specified. + * @param message FileDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FileDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FileDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a DescriptorProto. */ + interface IDescriptorProto { + + /** DescriptorProto name */ + name?: (string|null); + + /** DescriptorProto field */ + field?: (google.protobuf.IFieldDescriptorProto[]|null); + + /** DescriptorProto extension */ + extension?: (google.protobuf.IFieldDescriptorProto[]|null); + + /** DescriptorProto nestedType */ + nestedType?: (google.protobuf.IDescriptorProto[]|null); + + /** DescriptorProto enumType */ + enumType?: (google.protobuf.IEnumDescriptorProto[]|null); + + /** DescriptorProto extensionRange */ + extensionRange?: (google.protobuf.DescriptorProto.IExtensionRange[]|null); + + /** DescriptorProto oneofDecl */ + oneofDecl?: (google.protobuf.IOneofDescriptorProto[]|null); + + /** DescriptorProto options */ + options?: (google.protobuf.IMessageOptions|null); + + /** DescriptorProto reservedRange */ + reservedRange?: (google.protobuf.DescriptorProto.IReservedRange[]|null); + + /** DescriptorProto reservedName */ + reservedName?: (string[]|null); + } + + /** Represents a DescriptorProto. */ + class DescriptorProto implements IDescriptorProto { + + /** + * Constructs a new DescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IDescriptorProto); + + /** DescriptorProto name. */ + public name: string; + + /** DescriptorProto field. */ + public field: google.protobuf.IFieldDescriptorProto[]; + + /** DescriptorProto extension. */ + public extension: google.protobuf.IFieldDescriptorProto[]; + + /** DescriptorProto nestedType. */ + public nestedType: google.protobuf.IDescriptorProto[]; + + /** DescriptorProto enumType. */ + public enumType: google.protobuf.IEnumDescriptorProto[]; + + /** DescriptorProto extensionRange. */ + public extensionRange: google.protobuf.DescriptorProto.IExtensionRange[]; + + /** DescriptorProto oneofDecl. */ + public oneofDecl: google.protobuf.IOneofDescriptorProto[]; + + /** DescriptorProto options. */ + public options?: (google.protobuf.IMessageOptions|null); + + /** DescriptorProto reservedRange. */ + public reservedRange: google.protobuf.DescriptorProto.IReservedRange[]; + + /** DescriptorProto reservedName. */ + public reservedName: string[]; + + /** + * Creates a new DescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns DescriptorProto instance + */ + public static create(properties?: google.protobuf.IDescriptorProto): google.protobuf.DescriptorProto; + + /** + * Encodes the specified DescriptorProto message. Does not implicitly {@link google.protobuf.DescriptorProto.verify|verify} messages. + * @param message DescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified DescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.verify|verify} messages. + * @param message DescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a DescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns DescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.DescriptorProto; + + /** + * Decodes a DescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns DescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.DescriptorProto; + + /** + * Verifies a DescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a DescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns DescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.DescriptorProto; + + /** + * Creates a plain object from a DescriptorProto message. Also converts values to other types if specified. + * @param message DescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.DescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this DescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace DescriptorProto { + + /** Properties of an ExtensionRange. */ + interface IExtensionRange { + + /** ExtensionRange start */ + start?: (number|null); + + /** ExtensionRange end */ + end?: (number|null); + + /** ExtensionRange options */ + options?: (google.protobuf.IExtensionRangeOptions|null); + } + + /** Represents an ExtensionRange. */ + class ExtensionRange implements IExtensionRange { + + /** + * Constructs a new ExtensionRange. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.DescriptorProto.IExtensionRange); + + /** ExtensionRange start. */ + public start: number; + + /** ExtensionRange end. */ + public end: number; + + /** ExtensionRange options. */ + public options?: (google.protobuf.IExtensionRangeOptions|null); + + /** + * Creates a new ExtensionRange instance using the specified properties. + * @param [properties] Properties to set + * @returns ExtensionRange instance + */ + public static create(properties?: google.protobuf.DescriptorProto.IExtensionRange): google.protobuf.DescriptorProto.ExtensionRange; + + /** + * Encodes the specified ExtensionRange message. Does not implicitly {@link google.protobuf.DescriptorProto.ExtensionRange.verify|verify} messages. + * @param message ExtensionRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.DescriptorProto.IExtensionRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ExtensionRange message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.ExtensionRange.verify|verify} messages. + * @param message ExtensionRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.DescriptorProto.IExtensionRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an ExtensionRange message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ExtensionRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.DescriptorProto.ExtensionRange; + + /** + * Decodes an ExtensionRange message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ExtensionRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.DescriptorProto.ExtensionRange; + + /** + * Verifies an ExtensionRange message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an ExtensionRange message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ExtensionRange + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.DescriptorProto.ExtensionRange; + + /** + * Creates a plain object from an ExtensionRange message. Also converts values to other types if specified. + * @param message ExtensionRange + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.DescriptorProto.ExtensionRange, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ExtensionRange to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a ReservedRange. */ + interface IReservedRange { + + /** ReservedRange start */ + start?: (number|null); + + /** ReservedRange end */ + end?: (number|null); + } + + /** Represents a ReservedRange. */ + class ReservedRange implements IReservedRange { + + /** + * Constructs a new ReservedRange. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.DescriptorProto.IReservedRange); + + /** ReservedRange start. */ + public start: number; + + /** ReservedRange end. */ + public end: number; + + /** + * Creates a new ReservedRange instance using the specified properties. + * @param [properties] Properties to set + * @returns ReservedRange instance + */ + public static create(properties?: google.protobuf.DescriptorProto.IReservedRange): google.protobuf.DescriptorProto.ReservedRange; + + /** + * Encodes the specified ReservedRange message. Does not implicitly {@link google.protobuf.DescriptorProto.ReservedRange.verify|verify} messages. + * @param message ReservedRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.DescriptorProto.IReservedRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ReservedRange message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.ReservedRange.verify|verify} messages. + * @param message ReservedRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.DescriptorProto.IReservedRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ReservedRange message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.DescriptorProto.ReservedRange; + + /** + * Decodes a ReservedRange message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.DescriptorProto.ReservedRange; + + /** + * Verifies a ReservedRange message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ReservedRange message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ReservedRange + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.DescriptorProto.ReservedRange; + + /** + * Creates a plain object from a ReservedRange message. Also converts values to other types if specified. + * @param message ReservedRange + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.DescriptorProto.ReservedRange, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ReservedRange to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } + + /** Properties of an ExtensionRangeOptions. */ + interface IExtensionRangeOptions { + + /** ExtensionRangeOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + } + + /** Represents an ExtensionRangeOptions. */ + class ExtensionRangeOptions implements IExtensionRangeOptions { + + /** + * Constructs a new ExtensionRangeOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IExtensionRangeOptions); + + /** ExtensionRangeOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new ExtensionRangeOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns ExtensionRangeOptions instance + */ + public static create(properties?: google.protobuf.IExtensionRangeOptions): google.protobuf.ExtensionRangeOptions; + + /** + * Encodes the specified ExtensionRangeOptions message. Does not implicitly {@link google.protobuf.ExtensionRangeOptions.verify|verify} messages. + * @param message ExtensionRangeOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IExtensionRangeOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ExtensionRangeOptions message, length delimited. Does not implicitly {@link google.protobuf.ExtensionRangeOptions.verify|verify} messages. + * @param message ExtensionRangeOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IExtensionRangeOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an ExtensionRangeOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ExtensionRangeOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.ExtensionRangeOptions; + + /** + * Decodes an ExtensionRangeOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ExtensionRangeOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.ExtensionRangeOptions; + + /** + * Verifies an ExtensionRangeOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an ExtensionRangeOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ExtensionRangeOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.ExtensionRangeOptions; + + /** + * Creates a plain object from an ExtensionRangeOptions message. Also converts values to other types if specified. + * @param message ExtensionRangeOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.ExtensionRangeOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ExtensionRangeOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a FieldDescriptorProto. */ + interface IFieldDescriptorProto { + + /** FieldDescriptorProto name */ + name?: (string|null); + + /** FieldDescriptorProto number */ + number?: (number|null); + + /** FieldDescriptorProto label */ + label?: (google.protobuf.FieldDescriptorProto.Label|keyof typeof google.protobuf.FieldDescriptorProto.Label|null); + + /** FieldDescriptorProto type */ + type?: (google.protobuf.FieldDescriptorProto.Type|keyof typeof google.protobuf.FieldDescriptorProto.Type|null); + + /** FieldDescriptorProto typeName */ + typeName?: (string|null); + + /** FieldDescriptorProto extendee */ + extendee?: (string|null); + + /** FieldDescriptorProto defaultValue */ + defaultValue?: (string|null); + + /** FieldDescriptorProto oneofIndex */ + oneofIndex?: (number|null); + + /** FieldDescriptorProto jsonName */ + jsonName?: (string|null); + + /** FieldDescriptorProto options */ + options?: (google.protobuf.IFieldOptions|null); + + /** FieldDescriptorProto proto3Optional */ + proto3Optional?: (boolean|null); + } + + /** Represents a FieldDescriptorProto. */ + class FieldDescriptorProto implements IFieldDescriptorProto { + + /** + * Constructs a new FieldDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFieldDescriptorProto); + + /** FieldDescriptorProto name. */ + public name: string; + + /** FieldDescriptorProto number. */ + public number: number; + + /** FieldDescriptorProto label. */ + public label: (google.protobuf.FieldDescriptorProto.Label|keyof typeof google.protobuf.FieldDescriptorProto.Label); + + /** FieldDescriptorProto type. */ + public type: (google.protobuf.FieldDescriptorProto.Type|keyof typeof google.protobuf.FieldDescriptorProto.Type); + + /** FieldDescriptorProto typeName. */ + public typeName: string; + + /** FieldDescriptorProto extendee. */ + public extendee: string; + + /** FieldDescriptorProto defaultValue. */ + public defaultValue: string; + + /** FieldDescriptorProto oneofIndex. */ + public oneofIndex: number; + + /** FieldDescriptorProto jsonName. */ + public jsonName: string; + + /** FieldDescriptorProto options. */ + public options?: (google.protobuf.IFieldOptions|null); + + /** FieldDescriptorProto proto3Optional. */ + public proto3Optional: boolean; + + /** + * Creates a new FieldDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns FieldDescriptorProto instance + */ + public static create(properties?: google.protobuf.IFieldDescriptorProto): google.protobuf.FieldDescriptorProto; + + /** + * Encodes the specified FieldDescriptorProto message. Does not implicitly {@link google.protobuf.FieldDescriptorProto.verify|verify} messages. + * @param message FieldDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFieldDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FieldDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.FieldDescriptorProto.verify|verify} messages. + * @param message FieldDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFieldDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FieldDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FieldDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FieldDescriptorProto; + + /** + * Decodes a FieldDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FieldDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FieldDescriptorProto; + + /** + * Verifies a FieldDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FieldDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FieldDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FieldDescriptorProto; + + /** + * Creates a plain object from a FieldDescriptorProto message. Also converts values to other types if specified. + * @param message FieldDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FieldDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FieldDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace FieldDescriptorProto { + + /** Type enum. */ + enum Type { + TYPE_DOUBLE = 1, + TYPE_FLOAT = 2, + TYPE_INT64 = 3, + TYPE_UINT64 = 4, + TYPE_INT32 = 5, + TYPE_FIXED64 = 6, + TYPE_FIXED32 = 7, + TYPE_BOOL = 8, + TYPE_STRING = 9, + TYPE_GROUP = 10, + TYPE_MESSAGE = 11, + TYPE_BYTES = 12, + TYPE_UINT32 = 13, + TYPE_ENUM = 14, + TYPE_SFIXED32 = 15, + TYPE_SFIXED64 = 16, + TYPE_SINT32 = 17, + TYPE_SINT64 = 18 + } + + /** Label enum. */ + enum Label { + LABEL_OPTIONAL = 1, + LABEL_REQUIRED = 2, + LABEL_REPEATED = 3 + } + } + + /** Properties of an OneofDescriptorProto. */ + interface IOneofDescriptorProto { + + /** OneofDescriptorProto name */ + name?: (string|null); + + /** OneofDescriptorProto options */ + options?: (google.protobuf.IOneofOptions|null); + } + + /** Represents an OneofDescriptorProto. */ + class OneofDescriptorProto implements IOneofDescriptorProto { + + /** + * Constructs a new OneofDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IOneofDescriptorProto); + + /** OneofDescriptorProto name. */ + public name: string; + + /** OneofDescriptorProto options. */ + public options?: (google.protobuf.IOneofOptions|null); + + /** + * Creates a new OneofDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns OneofDescriptorProto instance + */ + public static create(properties?: google.protobuf.IOneofDescriptorProto): google.protobuf.OneofDescriptorProto; + + /** + * Encodes the specified OneofDescriptorProto message. Does not implicitly {@link google.protobuf.OneofDescriptorProto.verify|verify} messages. + * @param message OneofDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IOneofDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified OneofDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.OneofDescriptorProto.verify|verify} messages. + * @param message OneofDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IOneofDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an OneofDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns OneofDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.OneofDescriptorProto; + + /** + * Decodes an OneofDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns OneofDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.OneofDescriptorProto; + + /** + * Verifies an OneofDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an OneofDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns OneofDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.OneofDescriptorProto; + + /** + * Creates a plain object from an OneofDescriptorProto message. Also converts values to other types if specified. + * @param message OneofDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.OneofDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this OneofDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of an EnumDescriptorProto. */ + interface IEnumDescriptorProto { + + /** EnumDescriptorProto name */ + name?: (string|null); + + /** EnumDescriptorProto value */ + value?: (google.protobuf.IEnumValueDescriptorProto[]|null); + + /** EnumDescriptorProto options */ + options?: (google.protobuf.IEnumOptions|null); + + /** EnumDescriptorProto reservedRange */ + reservedRange?: (google.protobuf.EnumDescriptorProto.IEnumReservedRange[]|null); + + /** EnumDescriptorProto reservedName */ + reservedName?: (string[]|null); + } + + /** Represents an EnumDescriptorProto. */ + class EnumDescriptorProto implements IEnumDescriptorProto { + + /** + * Constructs a new EnumDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEnumDescriptorProto); + + /** EnumDescriptorProto name. */ + public name: string; + + /** EnumDescriptorProto value. */ + public value: google.protobuf.IEnumValueDescriptorProto[]; + + /** EnumDescriptorProto options. */ + public options?: (google.protobuf.IEnumOptions|null); + + /** EnumDescriptorProto reservedRange. */ + public reservedRange: google.protobuf.EnumDescriptorProto.IEnumReservedRange[]; + + /** EnumDescriptorProto reservedName. */ + public reservedName: string[]; + + /** + * Creates a new EnumDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumDescriptorProto instance + */ + public static create(properties?: google.protobuf.IEnumDescriptorProto): google.protobuf.EnumDescriptorProto; + + /** + * Encodes the specified EnumDescriptorProto message. Does not implicitly {@link google.protobuf.EnumDescriptorProto.verify|verify} messages. + * @param message EnumDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEnumDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.EnumDescriptorProto.verify|verify} messages. + * @param message EnumDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEnumDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumDescriptorProto; + + /** + * Decodes an EnumDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumDescriptorProto; + + /** + * Verifies an EnumDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumDescriptorProto; + + /** + * Creates a plain object from an EnumDescriptorProto message. Also converts values to other types if specified. + * @param message EnumDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace EnumDescriptorProto { + + /** Properties of an EnumReservedRange. */ + interface IEnumReservedRange { + + /** EnumReservedRange start */ + start?: (number|null); + + /** EnumReservedRange end */ + end?: (number|null); + } + + /** Represents an EnumReservedRange. */ + class EnumReservedRange implements IEnumReservedRange { + + /** + * Constructs a new EnumReservedRange. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.EnumDescriptorProto.IEnumReservedRange); + + /** EnumReservedRange start. */ + public start: number; + + /** EnumReservedRange end. */ + public end: number; + + /** + * Creates a new EnumReservedRange instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumReservedRange instance + */ + public static create(properties?: google.protobuf.EnumDescriptorProto.IEnumReservedRange): google.protobuf.EnumDescriptorProto.EnumReservedRange; + + /** + * Encodes the specified EnumReservedRange message. Does not implicitly {@link google.protobuf.EnumDescriptorProto.EnumReservedRange.verify|verify} messages. + * @param message EnumReservedRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.EnumDescriptorProto.IEnumReservedRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumReservedRange message, length delimited. Does not implicitly {@link google.protobuf.EnumDescriptorProto.EnumReservedRange.verify|verify} messages. + * @param message EnumReservedRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.EnumDescriptorProto.IEnumReservedRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumReservedRange message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumDescriptorProto.EnumReservedRange; + + /** + * Decodes an EnumReservedRange message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumDescriptorProto.EnumReservedRange; + + /** + * Verifies an EnumReservedRange message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumReservedRange message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumReservedRange + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumDescriptorProto.EnumReservedRange; + + /** + * Creates a plain object from an EnumReservedRange message. Also converts values to other types if specified. + * @param message EnumReservedRange + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumDescriptorProto.EnumReservedRange, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumReservedRange to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } + + /** Properties of an EnumValueDescriptorProto. */ + interface IEnumValueDescriptorProto { + + /** EnumValueDescriptorProto name */ + name?: (string|null); + + /** EnumValueDescriptorProto number */ + number?: (number|null); + + /** EnumValueDescriptorProto options */ + options?: (google.protobuf.IEnumValueOptions|null); + } + + /** Represents an EnumValueDescriptorProto. */ + class EnumValueDescriptorProto implements IEnumValueDescriptorProto { + + /** + * Constructs a new EnumValueDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEnumValueDescriptorProto); + + /** EnumValueDescriptorProto name. */ + public name: string; + + /** EnumValueDescriptorProto number. */ + public number: number; + + /** EnumValueDescriptorProto options. */ + public options?: (google.protobuf.IEnumValueOptions|null); + + /** + * Creates a new EnumValueDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumValueDescriptorProto instance + */ + public static create(properties?: google.protobuf.IEnumValueDescriptorProto): google.protobuf.EnumValueDescriptorProto; + + /** + * Encodes the specified EnumValueDescriptorProto message. Does not implicitly {@link google.protobuf.EnumValueDescriptorProto.verify|verify} messages. + * @param message EnumValueDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEnumValueDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumValueDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.EnumValueDescriptorProto.verify|verify} messages. + * @param message EnumValueDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEnumValueDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumValueDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumValueDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumValueDescriptorProto; + + /** + * Decodes an EnumValueDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumValueDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumValueDescriptorProto; + + /** + * Verifies an EnumValueDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumValueDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumValueDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumValueDescriptorProto; + + /** + * Creates a plain object from an EnumValueDescriptorProto message. Also converts values to other types if specified. + * @param message EnumValueDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumValueDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumValueDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a ServiceDescriptorProto. */ + interface IServiceDescriptorProto { + + /** ServiceDescriptorProto name */ + name?: (string|null); + + /** ServiceDescriptorProto method */ + method?: (google.protobuf.IMethodDescriptorProto[]|null); + + /** ServiceDescriptorProto options */ + options?: (google.protobuf.IServiceOptions|null); + } + + /** Represents a ServiceDescriptorProto. */ + class ServiceDescriptorProto implements IServiceDescriptorProto { + + /** + * Constructs a new ServiceDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IServiceDescriptorProto); + + /** ServiceDescriptorProto name. */ + public name: string; + + /** ServiceDescriptorProto method. */ + public method: google.protobuf.IMethodDescriptorProto[]; + + /** ServiceDescriptorProto options. */ + public options?: (google.protobuf.IServiceOptions|null); + + /** + * Creates a new ServiceDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns ServiceDescriptorProto instance + */ + public static create(properties?: google.protobuf.IServiceDescriptorProto): google.protobuf.ServiceDescriptorProto; + + /** + * Encodes the specified ServiceDescriptorProto message. Does not implicitly {@link google.protobuf.ServiceDescriptorProto.verify|verify} messages. + * @param message ServiceDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IServiceDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ServiceDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.ServiceDescriptorProto.verify|verify} messages. + * @param message ServiceDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IServiceDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ServiceDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ServiceDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.ServiceDescriptorProto; + + /** + * Decodes a ServiceDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ServiceDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.ServiceDescriptorProto; + + /** + * Verifies a ServiceDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ServiceDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ServiceDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.ServiceDescriptorProto; + + /** + * Creates a plain object from a ServiceDescriptorProto message. Also converts values to other types if specified. + * @param message ServiceDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.ServiceDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ServiceDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a MethodDescriptorProto. */ + interface IMethodDescriptorProto { + + /** MethodDescriptorProto name */ + name?: (string|null); + + /** MethodDescriptorProto inputType */ + inputType?: (string|null); + + /** MethodDescriptorProto outputType */ + outputType?: (string|null); + + /** MethodDescriptorProto options */ + options?: (google.protobuf.IMethodOptions|null); + + /** MethodDescriptorProto clientStreaming */ + clientStreaming?: (boolean|null); + + /** MethodDescriptorProto serverStreaming */ + serverStreaming?: (boolean|null); + } + + /** Represents a MethodDescriptorProto. */ + class MethodDescriptorProto implements IMethodDescriptorProto { + + /** + * Constructs a new MethodDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IMethodDescriptorProto); + + /** MethodDescriptorProto name. */ + public name: string; + + /** MethodDescriptorProto inputType. */ + public inputType: string; + + /** MethodDescriptorProto outputType. */ + public outputType: string; + + /** MethodDescriptorProto options. */ + public options?: (google.protobuf.IMethodOptions|null); + + /** MethodDescriptorProto clientStreaming. */ + public clientStreaming: boolean; + + /** MethodDescriptorProto serverStreaming. */ + public serverStreaming: boolean; + + /** + * Creates a new MethodDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns MethodDescriptorProto instance + */ + public static create(properties?: google.protobuf.IMethodDescriptorProto): google.protobuf.MethodDescriptorProto; + + /** + * Encodes the specified MethodDescriptorProto message. Does not implicitly {@link google.protobuf.MethodDescriptorProto.verify|verify} messages. + * @param message MethodDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IMethodDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified MethodDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.MethodDescriptorProto.verify|verify} messages. + * @param message MethodDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IMethodDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a MethodDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns MethodDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.MethodDescriptorProto; + + /** + * Decodes a MethodDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns MethodDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.MethodDescriptorProto; + + /** + * Verifies a MethodDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a MethodDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns MethodDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.MethodDescriptorProto; + + /** + * Creates a plain object from a MethodDescriptorProto message. Also converts values to other types if specified. + * @param message MethodDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.MethodDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this MethodDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a FileOptions. */ + interface IFileOptions { + + /** FileOptions javaPackage */ + javaPackage?: (string|null); + + /** FileOptions javaOuterClassname */ + javaOuterClassname?: (string|null); + + /** FileOptions javaMultipleFiles */ + javaMultipleFiles?: (boolean|null); + + /** FileOptions javaGenerateEqualsAndHash */ + javaGenerateEqualsAndHash?: (boolean|null); + + /** FileOptions javaStringCheckUtf8 */ + javaStringCheckUtf8?: (boolean|null); + + /** FileOptions optimizeFor */ + optimizeFor?: (google.protobuf.FileOptions.OptimizeMode|keyof typeof google.protobuf.FileOptions.OptimizeMode|null); + + /** FileOptions goPackage */ + goPackage?: (string|null); + + /** FileOptions ccGenericServices */ + ccGenericServices?: (boolean|null); + + /** FileOptions javaGenericServices */ + javaGenericServices?: (boolean|null); + + /** FileOptions pyGenericServices */ + pyGenericServices?: (boolean|null); + + /** FileOptions phpGenericServices */ + phpGenericServices?: (boolean|null); + + /** FileOptions deprecated */ + deprecated?: (boolean|null); + + /** FileOptions ccEnableArenas */ + ccEnableArenas?: (boolean|null); + + /** FileOptions objcClassPrefix */ + objcClassPrefix?: (string|null); + + /** FileOptions csharpNamespace */ + csharpNamespace?: (string|null); + + /** FileOptions swiftPrefix */ + swiftPrefix?: (string|null); + + /** FileOptions phpClassPrefix */ + phpClassPrefix?: (string|null); + + /** FileOptions phpNamespace */ + phpNamespace?: (string|null); + + /** FileOptions phpMetadataNamespace */ + phpMetadataNamespace?: (string|null); + + /** FileOptions rubyPackage */ + rubyPackage?: (string|null); + + /** FileOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** FileOptions .google.api.resourceDefinition */ + ".google.api.resourceDefinition"?: (google.api.IResourceDescriptor[]|null); + } + + /** Represents a FileOptions. */ + class FileOptions implements IFileOptions { + + /** + * Constructs a new FileOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFileOptions); + + /** FileOptions javaPackage. */ + public javaPackage: string; + + /** FileOptions javaOuterClassname. */ + public javaOuterClassname: string; + + /** FileOptions javaMultipleFiles. */ + public javaMultipleFiles: boolean; + + /** FileOptions javaGenerateEqualsAndHash. */ + public javaGenerateEqualsAndHash: boolean; + + /** FileOptions javaStringCheckUtf8. */ + public javaStringCheckUtf8: boolean; + + /** FileOptions optimizeFor. */ + public optimizeFor: (google.protobuf.FileOptions.OptimizeMode|keyof typeof google.protobuf.FileOptions.OptimizeMode); + + /** FileOptions goPackage. */ + public goPackage: string; + + /** FileOptions ccGenericServices. */ + public ccGenericServices: boolean; + + /** FileOptions javaGenericServices. */ + public javaGenericServices: boolean; + + /** FileOptions pyGenericServices. */ + public pyGenericServices: boolean; + + /** FileOptions phpGenericServices. */ + public phpGenericServices: boolean; + + /** FileOptions deprecated. */ + public deprecated: boolean; + + /** FileOptions ccEnableArenas. */ + public ccEnableArenas: boolean; + + /** FileOptions objcClassPrefix. */ + public objcClassPrefix: string; + + /** FileOptions csharpNamespace. */ + public csharpNamespace: string; + + /** FileOptions swiftPrefix. */ + public swiftPrefix: string; + + /** FileOptions phpClassPrefix. */ + public phpClassPrefix: string; + + /** FileOptions phpNamespace. */ + public phpNamespace: string; + + /** FileOptions phpMetadataNamespace. */ + public phpMetadataNamespace: string; + + /** FileOptions rubyPackage. */ + public rubyPackage: string; + + /** FileOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new FileOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns FileOptions instance + */ + public static create(properties?: google.protobuf.IFileOptions): google.protobuf.FileOptions; + + /** + * Encodes the specified FileOptions message. Does not implicitly {@link google.protobuf.FileOptions.verify|verify} messages. + * @param message FileOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFileOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FileOptions message, length delimited. Does not implicitly {@link google.protobuf.FileOptions.verify|verify} messages. + * @param message FileOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFileOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FileOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FileOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FileOptions; + + /** + * Decodes a FileOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FileOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FileOptions; + + /** + * Verifies a FileOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FileOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FileOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FileOptions; + + /** + * Creates a plain object from a FileOptions message. Also converts values to other types if specified. + * @param message FileOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FileOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FileOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace FileOptions { + + /** OptimizeMode enum. */ + enum OptimizeMode { + SPEED = 1, + CODE_SIZE = 2, + LITE_RUNTIME = 3 + } + } + + /** Properties of a MessageOptions. */ + interface IMessageOptions { + + /** MessageOptions messageSetWireFormat */ + messageSetWireFormat?: (boolean|null); + + /** MessageOptions noStandardDescriptorAccessor */ + noStandardDescriptorAccessor?: (boolean|null); + + /** MessageOptions deprecated */ + deprecated?: (boolean|null); + + /** MessageOptions mapEntry */ + mapEntry?: (boolean|null); + + /** MessageOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** MessageOptions .google.api.resource */ + ".google.api.resource"?: (google.api.IResourceDescriptor|null); + } + + /** Represents a MessageOptions. */ + class MessageOptions implements IMessageOptions { + + /** + * Constructs a new MessageOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IMessageOptions); + + /** MessageOptions messageSetWireFormat. */ + public messageSetWireFormat: boolean; + + /** MessageOptions noStandardDescriptorAccessor. */ + public noStandardDescriptorAccessor: boolean; + + /** MessageOptions deprecated. */ + public deprecated: boolean; + + /** MessageOptions mapEntry. */ + public mapEntry: boolean; + + /** MessageOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new MessageOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns MessageOptions instance + */ + public static create(properties?: google.protobuf.IMessageOptions): google.protobuf.MessageOptions; + + /** + * Encodes the specified MessageOptions message. Does not implicitly {@link google.protobuf.MessageOptions.verify|verify} messages. + * @param message MessageOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IMessageOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified MessageOptions message, length delimited. Does not implicitly {@link google.protobuf.MessageOptions.verify|verify} messages. + * @param message MessageOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IMessageOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a MessageOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns MessageOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.MessageOptions; + + /** + * Decodes a MessageOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns MessageOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.MessageOptions; + + /** + * Verifies a MessageOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a MessageOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns MessageOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.MessageOptions; + + /** + * Creates a plain object from a MessageOptions message. Also converts values to other types if specified. + * @param message MessageOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.MessageOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this MessageOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a FieldOptions. */ + interface IFieldOptions { + + /** FieldOptions ctype */ + ctype?: (google.protobuf.FieldOptions.CType|keyof typeof google.protobuf.FieldOptions.CType|null); + + /** FieldOptions packed */ + packed?: (boolean|null); + + /** FieldOptions jstype */ + jstype?: (google.protobuf.FieldOptions.JSType|keyof typeof google.protobuf.FieldOptions.JSType|null); + + /** FieldOptions lazy */ + lazy?: (boolean|null); + + /** FieldOptions deprecated */ + deprecated?: (boolean|null); + + /** FieldOptions weak */ + weak?: (boolean|null); + + /** FieldOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** FieldOptions .google.api.fieldBehavior */ + ".google.api.fieldBehavior"?: (google.api.FieldBehavior[]|null); + + /** FieldOptions .google.api.resourceReference */ + ".google.api.resourceReference"?: (google.api.IResourceReference|null); + } + + /** Represents a FieldOptions. */ + class FieldOptions implements IFieldOptions { + + /** + * Constructs a new FieldOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFieldOptions); + + /** FieldOptions ctype. */ + public ctype: (google.protobuf.FieldOptions.CType|keyof typeof google.protobuf.FieldOptions.CType); + + /** FieldOptions packed. */ + public packed: boolean; + + /** FieldOptions jstype. */ + public jstype: (google.protobuf.FieldOptions.JSType|keyof typeof google.protobuf.FieldOptions.JSType); + + /** FieldOptions lazy. */ + public lazy: boolean; + + /** FieldOptions deprecated. */ + public deprecated: boolean; + + /** FieldOptions weak. */ + public weak: boolean; + + /** FieldOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new FieldOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns FieldOptions instance + */ + public static create(properties?: google.protobuf.IFieldOptions): google.protobuf.FieldOptions; + + /** + * Encodes the specified FieldOptions message. Does not implicitly {@link google.protobuf.FieldOptions.verify|verify} messages. + * @param message FieldOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFieldOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FieldOptions message, length delimited. Does not implicitly {@link google.protobuf.FieldOptions.verify|verify} messages. + * @param message FieldOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFieldOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FieldOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FieldOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FieldOptions; + + /** + * Decodes a FieldOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FieldOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FieldOptions; + + /** + * Verifies a FieldOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FieldOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FieldOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FieldOptions; + + /** + * Creates a plain object from a FieldOptions message. Also converts values to other types if specified. + * @param message FieldOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FieldOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FieldOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace FieldOptions { + + /** CType enum. */ + enum CType { + STRING = 0, + CORD = 1, + STRING_PIECE = 2 + } + + /** JSType enum. */ + enum JSType { + JS_NORMAL = 0, + JS_STRING = 1, + JS_NUMBER = 2 + } + } + + /** Properties of an OneofOptions. */ + interface IOneofOptions { + + /** OneofOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + } + + /** Represents an OneofOptions. */ + class OneofOptions implements IOneofOptions { + + /** + * Constructs a new OneofOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IOneofOptions); + + /** OneofOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new OneofOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns OneofOptions instance + */ + public static create(properties?: google.protobuf.IOneofOptions): google.protobuf.OneofOptions; + + /** + * Encodes the specified OneofOptions message. Does not implicitly {@link google.protobuf.OneofOptions.verify|verify} messages. + * @param message OneofOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IOneofOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified OneofOptions message, length delimited. Does not implicitly {@link google.protobuf.OneofOptions.verify|verify} messages. + * @param message OneofOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IOneofOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an OneofOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns OneofOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.OneofOptions; + + /** + * Decodes an OneofOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns OneofOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.OneofOptions; + + /** + * Verifies an OneofOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an OneofOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns OneofOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.OneofOptions; + + /** + * Creates a plain object from an OneofOptions message. Also converts values to other types if specified. + * @param message OneofOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.OneofOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this OneofOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of an EnumOptions. */ + interface IEnumOptions { + + /** EnumOptions allowAlias */ + allowAlias?: (boolean|null); + + /** EnumOptions deprecated */ + deprecated?: (boolean|null); + + /** EnumOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + } + + /** Represents an EnumOptions. */ + class EnumOptions implements IEnumOptions { + + /** + * Constructs a new EnumOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEnumOptions); + + /** EnumOptions allowAlias. */ + public allowAlias: boolean; + + /** EnumOptions deprecated. */ + public deprecated: boolean; + + /** EnumOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new EnumOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumOptions instance + */ + public static create(properties?: google.protobuf.IEnumOptions): google.protobuf.EnumOptions; + + /** + * Encodes the specified EnumOptions message. Does not implicitly {@link google.protobuf.EnumOptions.verify|verify} messages. + * @param message EnumOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEnumOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumOptions message, length delimited. Does not implicitly {@link google.protobuf.EnumOptions.verify|verify} messages. + * @param message EnumOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEnumOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumOptions; + + /** + * Decodes an EnumOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumOptions; + + /** + * Verifies an EnumOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumOptions; + + /** + * Creates a plain object from an EnumOptions message. Also converts values to other types if specified. + * @param message EnumOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of an EnumValueOptions. */ + interface IEnumValueOptions { + + /** EnumValueOptions deprecated */ + deprecated?: (boolean|null); + + /** EnumValueOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + } + + /** Represents an EnumValueOptions. */ + class EnumValueOptions implements IEnumValueOptions { + + /** + * Constructs a new EnumValueOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEnumValueOptions); + + /** EnumValueOptions deprecated. */ + public deprecated: boolean; + + /** EnumValueOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new EnumValueOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumValueOptions instance + */ + public static create(properties?: google.protobuf.IEnumValueOptions): google.protobuf.EnumValueOptions; + + /** + * Encodes the specified EnumValueOptions message. Does not implicitly {@link google.protobuf.EnumValueOptions.verify|verify} messages. + * @param message EnumValueOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEnumValueOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumValueOptions message, length delimited. Does not implicitly {@link google.protobuf.EnumValueOptions.verify|verify} messages. + * @param message EnumValueOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEnumValueOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumValueOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumValueOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumValueOptions; + + /** + * Decodes an EnumValueOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumValueOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumValueOptions; + + /** + * Verifies an EnumValueOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumValueOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumValueOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumValueOptions; + + /** + * Creates a plain object from an EnumValueOptions message. Also converts values to other types if specified. + * @param message EnumValueOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumValueOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumValueOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a ServiceOptions. */ + interface IServiceOptions { + + /** ServiceOptions deprecated */ + deprecated?: (boolean|null); + + /** ServiceOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** ServiceOptions .google.api.defaultHost */ + ".google.api.defaultHost"?: (string|null); + + /** ServiceOptions .google.api.oauthScopes */ + ".google.api.oauthScopes"?: (string|null); + } + + /** Represents a ServiceOptions. */ + class ServiceOptions implements IServiceOptions { + + /** + * Constructs a new ServiceOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IServiceOptions); + + /** ServiceOptions deprecated. */ + public deprecated: boolean; + + /** ServiceOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new ServiceOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns ServiceOptions instance + */ + public static create(properties?: google.protobuf.IServiceOptions): google.protobuf.ServiceOptions; + + /** + * Encodes the specified ServiceOptions message. Does not implicitly {@link google.protobuf.ServiceOptions.verify|verify} messages. + * @param message ServiceOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IServiceOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ServiceOptions message, length delimited. Does not implicitly {@link google.protobuf.ServiceOptions.verify|verify} messages. + * @param message ServiceOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IServiceOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ServiceOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ServiceOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.ServiceOptions; + + /** + * Decodes a ServiceOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ServiceOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.ServiceOptions; + + /** + * Verifies a ServiceOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ServiceOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ServiceOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.ServiceOptions; + + /** + * Creates a plain object from a ServiceOptions message. Also converts values to other types if specified. + * @param message ServiceOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.ServiceOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ServiceOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of a MethodOptions. */ + interface IMethodOptions { + + /** MethodOptions deprecated */ + deprecated?: (boolean|null); + + /** MethodOptions idempotencyLevel */ + idempotencyLevel?: (google.protobuf.MethodOptions.IdempotencyLevel|keyof typeof google.protobuf.MethodOptions.IdempotencyLevel|null); + + /** MethodOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** MethodOptions .google.api.http */ + ".google.api.http"?: (google.api.IHttpRule|null); + + /** MethodOptions .google.api.methodSignature */ + ".google.api.methodSignature"?: (string[]|null); + } + + /** Represents a MethodOptions. */ + class MethodOptions implements IMethodOptions { + + /** + * Constructs a new MethodOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IMethodOptions); + + /** MethodOptions deprecated. */ + public deprecated: boolean; + + /** MethodOptions idempotencyLevel. */ + public idempotencyLevel: (google.protobuf.MethodOptions.IdempotencyLevel|keyof typeof google.protobuf.MethodOptions.IdempotencyLevel); + + /** MethodOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new MethodOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns MethodOptions instance + */ + public static create(properties?: google.protobuf.IMethodOptions): google.protobuf.MethodOptions; + + /** + * Encodes the specified MethodOptions message. Does not implicitly {@link google.protobuf.MethodOptions.verify|verify} messages. + * @param message MethodOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IMethodOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified MethodOptions message, length delimited. Does not implicitly {@link google.protobuf.MethodOptions.verify|verify} messages. + * @param message MethodOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IMethodOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a MethodOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns MethodOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.MethodOptions; + + /** + * Decodes a MethodOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns MethodOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.MethodOptions; + + /** + * Verifies a MethodOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a MethodOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns MethodOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.MethodOptions; + + /** + * Creates a plain object from a MethodOptions message. Also converts values to other types if specified. + * @param message MethodOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.MethodOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this MethodOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace MethodOptions { + + /** IdempotencyLevel enum. */ + enum IdempotencyLevel { + IDEMPOTENCY_UNKNOWN = 0, + NO_SIDE_EFFECTS = 1, + IDEMPOTENT = 2 + } + } + + /** Properties of an UninterpretedOption. */ + interface IUninterpretedOption { + + /** UninterpretedOption name */ + name?: (google.protobuf.UninterpretedOption.INamePart[]|null); + + /** UninterpretedOption identifierValue */ + identifierValue?: (string|null); + + /** UninterpretedOption positiveIntValue */ + positiveIntValue?: (number|Long|string|null); + + /** UninterpretedOption negativeIntValue */ + negativeIntValue?: (number|Long|string|null); + + /** UninterpretedOption doubleValue */ + doubleValue?: (number|null); + + /** UninterpretedOption stringValue */ + stringValue?: (Uint8Array|string|null); + + /** UninterpretedOption aggregateValue */ + aggregateValue?: (string|null); + } + + /** Represents an UninterpretedOption. */ + class UninterpretedOption implements IUninterpretedOption { + + /** + * Constructs a new UninterpretedOption. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IUninterpretedOption); + + /** UninterpretedOption name. */ + public name: google.protobuf.UninterpretedOption.INamePart[]; + + /** UninterpretedOption identifierValue. */ + public identifierValue: string; + + /** UninterpretedOption positiveIntValue. */ + public positiveIntValue: (number|Long|string); + + /** UninterpretedOption negativeIntValue. */ + public negativeIntValue: (number|Long|string); + + /** UninterpretedOption doubleValue. */ + public doubleValue: number; + + /** UninterpretedOption stringValue. */ + public stringValue: (Uint8Array|string); + + /** UninterpretedOption aggregateValue. */ + public aggregateValue: string; + + /** + * Creates a new UninterpretedOption instance using the specified properties. + * @param [properties] Properties to set + * @returns UninterpretedOption instance + */ + public static create(properties?: google.protobuf.IUninterpretedOption): google.protobuf.UninterpretedOption; + + /** + * Encodes the specified UninterpretedOption message. Does not implicitly {@link google.protobuf.UninterpretedOption.verify|verify} messages. + * @param message UninterpretedOption message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IUninterpretedOption, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified UninterpretedOption message, length delimited. Does not implicitly {@link google.protobuf.UninterpretedOption.verify|verify} messages. + * @param message UninterpretedOption message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IUninterpretedOption, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an UninterpretedOption message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns UninterpretedOption + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.UninterpretedOption; + + /** + * Decodes an UninterpretedOption message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns UninterpretedOption + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.UninterpretedOption; + + /** + * Verifies an UninterpretedOption message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an UninterpretedOption message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns UninterpretedOption + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.UninterpretedOption; + + /** + * Creates a plain object from an UninterpretedOption message. Also converts values to other types if specified. + * @param message UninterpretedOption + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.UninterpretedOption, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this UninterpretedOption to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace UninterpretedOption { + + /** Properties of a NamePart. */ + interface INamePart { + + /** NamePart namePart */ + namePart: string; + + /** NamePart isExtension */ + isExtension: boolean; + } + + /** Represents a NamePart. */ + class NamePart implements INamePart { + + /** + * Constructs a new NamePart. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.UninterpretedOption.INamePart); + + /** NamePart namePart. */ + public namePart: string; + + /** NamePart isExtension. */ + public isExtension: boolean; + + /** + * Creates a new NamePart instance using the specified properties. + * @param [properties] Properties to set + * @returns NamePart instance + */ + public static create(properties?: google.protobuf.UninterpretedOption.INamePart): google.protobuf.UninterpretedOption.NamePart; + + /** + * Encodes the specified NamePart message. Does not implicitly {@link google.protobuf.UninterpretedOption.NamePart.verify|verify} messages. + * @param message NamePart message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.UninterpretedOption.INamePart, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified NamePart message, length delimited. Does not implicitly {@link google.protobuf.UninterpretedOption.NamePart.verify|verify} messages. + * @param message NamePart message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.UninterpretedOption.INamePart, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a NamePart message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns NamePart + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.UninterpretedOption.NamePart; + + /** + * Decodes a NamePart message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns NamePart + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.UninterpretedOption.NamePart; + + /** + * Verifies a NamePart message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a NamePart message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns NamePart + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.UninterpretedOption.NamePart; + + /** + * Creates a plain object from a NamePart message. Also converts values to other types if specified. + * @param message NamePart + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.UninterpretedOption.NamePart, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this NamePart to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } + + /** Properties of a SourceCodeInfo. */ + interface ISourceCodeInfo { + + /** SourceCodeInfo location */ + location?: (google.protobuf.SourceCodeInfo.ILocation[]|null); + } + + /** Represents a SourceCodeInfo. */ + class SourceCodeInfo implements ISourceCodeInfo { + + /** + * Constructs a new SourceCodeInfo. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.ISourceCodeInfo); + + /** SourceCodeInfo location. */ + public location: google.protobuf.SourceCodeInfo.ILocation[]; + + /** + * Creates a new SourceCodeInfo instance using the specified properties. + * @param [properties] Properties to set + * @returns SourceCodeInfo instance + */ + public static create(properties?: google.protobuf.ISourceCodeInfo): google.protobuf.SourceCodeInfo; + + /** + * Encodes the specified SourceCodeInfo message. Does not implicitly {@link google.protobuf.SourceCodeInfo.verify|verify} messages. + * @param message SourceCodeInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.ISourceCodeInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified SourceCodeInfo message, length delimited. Does not implicitly {@link google.protobuf.SourceCodeInfo.verify|verify} messages. + * @param message SourceCodeInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.ISourceCodeInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a SourceCodeInfo message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns SourceCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.SourceCodeInfo; + + /** + * Decodes a SourceCodeInfo message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns SourceCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.SourceCodeInfo; + + /** + * Verifies a SourceCodeInfo message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a SourceCodeInfo message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns SourceCodeInfo + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.SourceCodeInfo; + + /** + * Creates a plain object from a SourceCodeInfo message. Also converts values to other types if specified. + * @param message SourceCodeInfo + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.SourceCodeInfo, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this SourceCodeInfo to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace SourceCodeInfo { + + /** Properties of a Location. */ + interface ILocation { + + /** Location path */ + path?: (number[]|null); + + /** Location span */ + span?: (number[]|null); + + /** Location leadingComments */ + leadingComments?: (string|null); + + /** Location trailingComments */ + trailingComments?: (string|null); + + /** Location leadingDetachedComments */ + leadingDetachedComments?: (string[]|null); + } + + /** Represents a Location. */ + class Location implements ILocation { + + /** + * Constructs a new Location. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.SourceCodeInfo.ILocation); + + /** Location path. */ + public path: number[]; + + /** Location span. */ + public span: number[]; + + /** Location leadingComments. */ + public leadingComments: string; + + /** Location trailingComments. */ + public trailingComments: string; + + /** Location leadingDetachedComments. */ + public leadingDetachedComments: string[]; + + /** + * Creates a new Location instance using the specified properties. + * @param [properties] Properties to set + * @returns Location instance + */ + public static create(properties?: google.protobuf.SourceCodeInfo.ILocation): google.protobuf.SourceCodeInfo.Location; + + /** + * Encodes the specified Location message. Does not implicitly {@link google.protobuf.SourceCodeInfo.Location.verify|verify} messages. + * @param message Location message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.SourceCodeInfo.ILocation, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Location message, length delimited. Does not implicitly {@link google.protobuf.SourceCodeInfo.Location.verify|verify} messages. + * @param message Location message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.SourceCodeInfo.ILocation, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Location message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Location + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.SourceCodeInfo.Location; + + /** + * Decodes a Location message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Location + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.SourceCodeInfo.Location; + + /** + * Verifies a Location message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Location message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Location + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.SourceCodeInfo.Location; + + /** + * Creates a plain object from a Location message. Also converts values to other types if specified. + * @param message Location + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.SourceCodeInfo.Location, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Location to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } + + /** Properties of a GeneratedCodeInfo. */ + interface IGeneratedCodeInfo { + + /** GeneratedCodeInfo annotation */ + annotation?: (google.protobuf.GeneratedCodeInfo.IAnnotation[]|null); + } + + /** Represents a GeneratedCodeInfo. */ + class GeneratedCodeInfo implements IGeneratedCodeInfo { + + /** + * Constructs a new GeneratedCodeInfo. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IGeneratedCodeInfo); + + /** GeneratedCodeInfo annotation. */ + public annotation: google.protobuf.GeneratedCodeInfo.IAnnotation[]; + + /** + * Creates a new GeneratedCodeInfo instance using the specified properties. + * @param [properties] Properties to set + * @returns GeneratedCodeInfo instance + */ + public static create(properties?: google.protobuf.IGeneratedCodeInfo): google.protobuf.GeneratedCodeInfo; + + /** + * Encodes the specified GeneratedCodeInfo message. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.verify|verify} messages. + * @param message GeneratedCodeInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IGeneratedCodeInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified GeneratedCodeInfo message, length delimited. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.verify|verify} messages. + * @param message GeneratedCodeInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IGeneratedCodeInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a GeneratedCodeInfo message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns GeneratedCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.GeneratedCodeInfo; + + /** + * Decodes a GeneratedCodeInfo message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns GeneratedCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.GeneratedCodeInfo; + + /** + * Verifies a GeneratedCodeInfo message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a GeneratedCodeInfo message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns GeneratedCodeInfo + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.GeneratedCodeInfo; + + /** + * Creates a plain object from a GeneratedCodeInfo message. Also converts values to other types if specified. + * @param message GeneratedCodeInfo + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.GeneratedCodeInfo, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this GeneratedCodeInfo to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + namespace GeneratedCodeInfo { + + /** Properties of an Annotation. */ + interface IAnnotation { + + /** Annotation path */ + path?: (number[]|null); + + /** Annotation sourceFile */ + sourceFile?: (string|null); + + /** Annotation begin */ + begin?: (number|null); + + /** Annotation end */ + end?: (number|null); + } + + /** Represents an Annotation. */ + class Annotation implements IAnnotation { + + /** + * Constructs a new Annotation. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.GeneratedCodeInfo.IAnnotation); + + /** Annotation path. */ + public path: number[]; + + /** Annotation sourceFile. */ + public sourceFile: string; + + /** Annotation begin. */ + public begin: number; + + /** Annotation end. */ + public end: number; + + /** + * Creates a new Annotation instance using the specified properties. + * @param [properties] Properties to set + * @returns Annotation instance + */ + public static create(properties?: google.protobuf.GeneratedCodeInfo.IAnnotation): google.protobuf.GeneratedCodeInfo.Annotation; + + /** + * Encodes the specified Annotation message. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.Annotation.verify|verify} messages. + * @param message Annotation message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.GeneratedCodeInfo.IAnnotation, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Annotation message, length delimited. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.Annotation.verify|verify} messages. + * @param message Annotation message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.GeneratedCodeInfo.IAnnotation, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an Annotation message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Annotation + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.GeneratedCodeInfo.Annotation; + + /** + * Decodes an Annotation message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Annotation + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.GeneratedCodeInfo.Annotation; + + /** + * Verifies an Annotation message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an Annotation message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Annotation + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.GeneratedCodeInfo.Annotation; + + /** + * Creates a plain object from an Annotation message. Also converts values to other types if specified. + * @param message Annotation + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.GeneratedCodeInfo.Annotation, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Annotation to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } + + /** Properties of a Duration. */ + interface IDuration { + + /** Duration seconds */ + seconds?: (number|Long|string|null); + + /** Duration nanos */ + nanos?: (number|null); + } + + /** Represents a Duration. */ + class Duration implements IDuration { + + /** + * Constructs a new Duration. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IDuration); + + /** Duration seconds. */ + public seconds: (number|Long|string); + + /** Duration nanos. */ + public nanos: number; + + /** + * Creates a new Duration instance using the specified properties. + * @param [properties] Properties to set + * @returns Duration instance + */ + public static create(properties?: google.protobuf.IDuration): google.protobuf.Duration; + + /** + * Encodes the specified Duration message. Does not implicitly {@link google.protobuf.Duration.verify|verify} messages. + * @param message Duration message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IDuration, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Duration message, length delimited. Does not implicitly {@link google.protobuf.Duration.verify|verify} messages. + * @param message Duration message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IDuration, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Duration message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Duration + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.Duration; + + /** + * Decodes a Duration message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Duration + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.Duration; + + /** + * Verifies a Duration message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Duration message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Duration + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.Duration; + + /** + * Creates a plain object from a Duration message. Also converts values to other types if specified. + * @param message Duration + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.Duration, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Duration to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + + /** Properties of an Any. */ + interface IAny { + + /** Any type_url */ + type_url?: (string|null); + + /** Any value */ + value?: (Uint8Array|string|null); + } + + /** Represents an Any. */ + class Any implements IAny { + + /** + * Constructs a new Any. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IAny); + + /** Any type_url. */ + public type_url: string; + + /** Any value. */ + public value: (Uint8Array|string); + + /** + * Creates a new Any instance using the specified properties. + * @param [properties] Properties to set + * @returns Any instance + */ + public static create(properties?: google.protobuf.IAny): google.protobuf.Any; + + /** + * Encodes the specified Any message. Does not implicitly {@link google.protobuf.Any.verify|verify} messages. + * @param message Any message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IAny, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Any message, length delimited. Does not implicitly {@link google.protobuf.Any.verify|verify} messages. + * @param message Any message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IAny, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an Any message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Any + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.Any; + + /** + * Decodes an Any message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Any + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.Any; + + /** + * Verifies an Any message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an Any message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Any + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.Any; + + /** + * Creates a plain object from an Any message. Also converts values to other types if specified. + * @param message Any + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.Any, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Any to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } + + /** Namespace rpc. */ + namespace rpc { + + /** Properties of a Status. */ + interface IStatus { + + /** Status code */ + code?: (number|null); + + /** Status message */ + message?: (string|null); + + /** Status details */ + details?: (google.protobuf.IAny[]|null); + } + + /** Represents a Status. */ + class Status implements IStatus { + + /** + * Constructs a new Status. + * @param [properties] Properties to set + */ + constructor(properties?: google.rpc.IStatus); + + /** Status code. */ + public code: number; + + /** Status message. */ + public message: string; + + /** Status details. */ + public details: google.protobuf.IAny[]; + + /** + * Creates a new Status instance using the specified properties. + * @param [properties] Properties to set + * @returns Status instance + */ + public static create(properties?: google.rpc.IStatus): google.rpc.Status; + + /** + * Encodes the specified Status message. Does not implicitly {@link google.rpc.Status.verify|verify} messages. + * @param message Status message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.rpc.IStatus, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Status message, length delimited. Does not implicitly {@link google.rpc.Status.verify|verify} messages. + * @param message Status message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.rpc.IStatus, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Status message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Status + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.rpc.Status; + + /** + * Decodes a Status message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Status + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.rpc.Status; + + /** + * Verifies a Status message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Status message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Status + */ + public static fromObject(object: { [k: string]: any }): google.rpc.Status; + + /** + * Creates a plain object from a Status message. Also converts values to other types if specified. + * @param message Status + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.rpc.Status, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Status to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + } + } +} diff --git a/packages/google-cloud-apigeeconnect/protos/protos.js b/packages/google-cloud-apigeeconnect/protos/protos.js new file mode 100644 index 00000000000..d3da15b1c09 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/protos/protos.js @@ -0,0 +1,14433 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/*eslint-disable block-scoped-var, id-length, no-control-regex, no-magic-numbers, no-prototype-builtins, no-redeclare, no-shadow, no-var, sort-vars*/ +(function(global, factory) { /* global define, require, module */ + + /* AMD */ if (typeof define === 'function' && define.amd) + define(["protobufjs/minimal"], factory); + + /* CommonJS */ else if (typeof require === 'function' && typeof module === 'object' && module && module.exports) + module.exports = factory(require("google-gax").protobufMinimal); + +})(this, function($protobuf) { + "use strict"; + + // Common aliases + var $Reader = $protobuf.Reader, $Writer = $protobuf.Writer, $util = $protobuf.util; + + // Exported root namespace + var $root = $protobuf.roots._google_cloud_apigee_connect_protos || ($protobuf.roots._google_cloud_apigee_connect_protos = {}); + + $root.google = (function() { + + /** + * Namespace google. + * @exports google + * @namespace + */ + var google = {}; + + google.cloud = (function() { + + /** + * Namespace cloud. + * @memberof google + * @namespace + */ + var cloud = {}; + + cloud.apigeeconnect = (function() { + + /** + * Namespace apigeeconnect. + * @memberof google.cloud + * @namespace + */ + var apigeeconnect = {}; + + apigeeconnect.v1 = (function() { + + /** + * Namespace v1. + * @memberof google.cloud.apigeeconnect + * @namespace + */ + var v1 = {}; + + v1.ConnectionService = (function() { + + /** + * Constructs a new ConnectionService service. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a ConnectionService + * @extends $protobuf.rpc.Service + * @constructor + * @param {$protobuf.RPCImpl} rpcImpl RPC implementation + * @param {boolean} [requestDelimited=false] Whether requests are length-delimited + * @param {boolean} [responseDelimited=false] Whether responses are length-delimited + */ + function ConnectionService(rpcImpl, requestDelimited, responseDelimited) { + $protobuf.rpc.Service.call(this, rpcImpl, requestDelimited, responseDelimited); + } + + (ConnectionService.prototype = Object.create($protobuf.rpc.Service.prototype)).constructor = ConnectionService; + + /** + * Creates new ConnectionService service using the specified rpc implementation. + * @function create + * @memberof google.cloud.apigeeconnect.v1.ConnectionService + * @static + * @param {$protobuf.RPCImpl} rpcImpl RPC implementation + * @param {boolean} [requestDelimited=false] Whether requests are length-delimited + * @param {boolean} [responseDelimited=false] Whether responses are length-delimited + * @returns {ConnectionService} RPC service. Useful where requests and/or responses are streamed. + */ + ConnectionService.create = function create(rpcImpl, requestDelimited, responseDelimited) { + return new this(rpcImpl, requestDelimited, responseDelimited); + }; + + /** + * Callback as used by {@link google.cloud.apigeeconnect.v1.ConnectionService#listConnections}. + * @memberof google.cloud.apigeeconnect.v1.ConnectionService + * @typedef ListConnectionsCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.cloud.apigeeconnect.v1.ListConnectionsResponse} [response] ListConnectionsResponse + */ + + /** + * Calls ListConnections. + * @function listConnections + * @memberof google.cloud.apigeeconnect.v1.ConnectionService + * @instance + * @param {google.cloud.apigeeconnect.v1.IListConnectionsRequest} request ListConnectionsRequest message or plain object + * @param {google.cloud.apigeeconnect.v1.ConnectionService.ListConnectionsCallback} callback Node-style callback called with the error, if any, and ListConnectionsResponse + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.listConnections = function listConnections(request, callback) { + return this.rpcCall(listConnections, $root.google.cloud.apigeeconnect.v1.ListConnectionsRequest, $root.google.cloud.apigeeconnect.v1.ListConnectionsResponse, request, callback); + }, "name", { value: "ListConnections" }); + + /** + * Calls ListConnections. + * @function listConnections + * @memberof google.cloud.apigeeconnect.v1.ConnectionService + * @instance + * @param {google.cloud.apigeeconnect.v1.IListConnectionsRequest} request ListConnectionsRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + return ConnectionService; + })(); + + v1.ListConnectionsRequest = (function() { + + /** + * Properties of a ListConnectionsRequest. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IListConnectionsRequest + * @property {string|null} [parent] ListConnectionsRequest parent + * @property {number|null} [pageSize] ListConnectionsRequest pageSize + * @property {string|null} [pageToken] ListConnectionsRequest pageToken + */ + + /** + * Constructs a new ListConnectionsRequest. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a ListConnectionsRequest. + * @implements IListConnectionsRequest + * @constructor + * @param {google.cloud.apigeeconnect.v1.IListConnectionsRequest=} [properties] Properties to set + */ + function ListConnectionsRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ListConnectionsRequest parent. + * @member {string} parent + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @instance + */ + ListConnectionsRequest.prototype.parent = ""; + + /** + * ListConnectionsRequest pageSize. + * @member {number} pageSize + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @instance + */ + ListConnectionsRequest.prototype.pageSize = 0; + + /** + * ListConnectionsRequest pageToken. + * @member {string} pageToken + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @instance + */ + ListConnectionsRequest.prototype.pageToken = ""; + + /** + * Creates a new ListConnectionsRequest instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IListConnectionsRequest=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.ListConnectionsRequest} ListConnectionsRequest instance + */ + ListConnectionsRequest.create = function create(properties) { + return new ListConnectionsRequest(properties); + }; + + /** + * Encodes the specified ListConnectionsRequest message. Does not implicitly {@link google.cloud.apigeeconnect.v1.ListConnectionsRequest.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IListConnectionsRequest} message ListConnectionsRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ListConnectionsRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.parent != null && Object.hasOwnProperty.call(message, "parent")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.parent); + if (message.pageSize != null && Object.hasOwnProperty.call(message, "pageSize")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.pageSize); + if (message.pageToken != null && Object.hasOwnProperty.call(message, "pageToken")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.pageToken); + return writer; + }; + + /** + * Encodes the specified ListConnectionsRequest message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.ListConnectionsRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IListConnectionsRequest} message ListConnectionsRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ListConnectionsRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ListConnectionsRequest message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.ListConnectionsRequest} ListConnectionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ListConnectionsRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.ListConnectionsRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.parent = reader.string(); + break; + case 2: + message.pageSize = reader.int32(); + break; + case 3: + message.pageToken = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ListConnectionsRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.ListConnectionsRequest} ListConnectionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ListConnectionsRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ListConnectionsRequest message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ListConnectionsRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.parent != null && message.hasOwnProperty("parent")) + if (!$util.isString(message.parent)) + return "parent: string expected"; + if (message.pageSize != null && message.hasOwnProperty("pageSize")) + if (!$util.isInteger(message.pageSize)) + return "pageSize: integer expected"; + if (message.pageToken != null && message.hasOwnProperty("pageToken")) + if (!$util.isString(message.pageToken)) + return "pageToken: string expected"; + return null; + }; + + /** + * Creates a ListConnectionsRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.ListConnectionsRequest} ListConnectionsRequest + */ + ListConnectionsRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.ListConnectionsRequest) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.ListConnectionsRequest(); + if (object.parent != null) + message.parent = String(object.parent); + if (object.pageSize != null) + message.pageSize = object.pageSize | 0; + if (object.pageToken != null) + message.pageToken = String(object.pageToken); + return message; + }; + + /** + * Creates a plain object from a ListConnectionsRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {google.cloud.apigeeconnect.v1.ListConnectionsRequest} message ListConnectionsRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ListConnectionsRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.parent = ""; + object.pageSize = 0; + object.pageToken = ""; + } + if (message.parent != null && message.hasOwnProperty("parent")) + object.parent = message.parent; + if (message.pageSize != null && message.hasOwnProperty("pageSize")) + object.pageSize = message.pageSize; + if (message.pageToken != null && message.hasOwnProperty("pageToken")) + object.pageToken = message.pageToken; + return object; + }; + + /** + * Converts this ListConnectionsRequest to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @instance + * @returns {Object.} JSON object + */ + ListConnectionsRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return ListConnectionsRequest; + })(); + + v1.ListConnectionsResponse = (function() { + + /** + * Properties of a ListConnectionsResponse. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IListConnectionsResponse + * @property {Array.|null} [connections] ListConnectionsResponse connections + * @property {string|null} [nextPageToken] ListConnectionsResponse nextPageToken + */ + + /** + * Constructs a new ListConnectionsResponse. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a ListConnectionsResponse. + * @implements IListConnectionsResponse + * @constructor + * @param {google.cloud.apigeeconnect.v1.IListConnectionsResponse=} [properties] Properties to set + */ + function ListConnectionsResponse(properties) { + this.connections = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ListConnectionsResponse connections. + * @member {Array.} connections + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @instance + */ + ListConnectionsResponse.prototype.connections = $util.emptyArray; + + /** + * ListConnectionsResponse nextPageToken. + * @member {string} nextPageToken + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @instance + */ + ListConnectionsResponse.prototype.nextPageToken = ""; + + /** + * Creates a new ListConnectionsResponse instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IListConnectionsResponse=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.ListConnectionsResponse} ListConnectionsResponse instance + */ + ListConnectionsResponse.create = function create(properties) { + return new ListConnectionsResponse(properties); + }; + + /** + * Encodes the specified ListConnectionsResponse message. Does not implicitly {@link google.cloud.apigeeconnect.v1.ListConnectionsResponse.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IListConnectionsResponse} message ListConnectionsResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ListConnectionsResponse.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.connections != null && message.connections.length) + for (var i = 0; i < message.connections.length; ++i) + $root.google.cloud.apigeeconnect.v1.Connection.encode(message.connections[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + if (message.nextPageToken != null && Object.hasOwnProperty.call(message, "nextPageToken")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.nextPageToken); + return writer; + }; + + /** + * Encodes the specified ListConnectionsResponse message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.ListConnectionsResponse.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IListConnectionsResponse} message ListConnectionsResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ListConnectionsResponse.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ListConnectionsResponse message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.ListConnectionsResponse} ListConnectionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ListConnectionsResponse.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.ListConnectionsResponse(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + if (!(message.connections && message.connections.length)) + message.connections = []; + message.connections.push($root.google.cloud.apigeeconnect.v1.Connection.decode(reader, reader.uint32())); + break; + case 2: + message.nextPageToken = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ListConnectionsResponse message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.ListConnectionsResponse} ListConnectionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ListConnectionsResponse.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ListConnectionsResponse message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ListConnectionsResponse.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.connections != null && message.hasOwnProperty("connections")) { + if (!Array.isArray(message.connections)) + return "connections: array expected"; + for (var i = 0; i < message.connections.length; ++i) { + var error = $root.google.cloud.apigeeconnect.v1.Connection.verify(message.connections[i]); + if (error) + return "connections." + error; + } + } + if (message.nextPageToken != null && message.hasOwnProperty("nextPageToken")) + if (!$util.isString(message.nextPageToken)) + return "nextPageToken: string expected"; + return null; + }; + + /** + * Creates a ListConnectionsResponse message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.ListConnectionsResponse} ListConnectionsResponse + */ + ListConnectionsResponse.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.ListConnectionsResponse) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.ListConnectionsResponse(); + if (object.connections) { + if (!Array.isArray(object.connections)) + throw TypeError(".google.cloud.apigeeconnect.v1.ListConnectionsResponse.connections: array expected"); + message.connections = []; + for (var i = 0; i < object.connections.length; ++i) { + if (typeof object.connections[i] !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.ListConnectionsResponse.connections: object expected"); + message.connections[i] = $root.google.cloud.apigeeconnect.v1.Connection.fromObject(object.connections[i]); + } + } + if (object.nextPageToken != null) + message.nextPageToken = String(object.nextPageToken); + return message; + }; + + /** + * Creates a plain object from a ListConnectionsResponse message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {google.cloud.apigeeconnect.v1.ListConnectionsResponse} message ListConnectionsResponse + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ListConnectionsResponse.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.connections = []; + if (options.defaults) + object.nextPageToken = ""; + if (message.connections && message.connections.length) { + object.connections = []; + for (var j = 0; j < message.connections.length; ++j) + object.connections[j] = $root.google.cloud.apigeeconnect.v1.Connection.toObject(message.connections[j], options); + } + if (message.nextPageToken != null && message.hasOwnProperty("nextPageToken")) + object.nextPageToken = message.nextPageToken; + return object; + }; + + /** + * Converts this ListConnectionsResponse to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @instance + * @returns {Object.} JSON object + */ + ListConnectionsResponse.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return ListConnectionsResponse; + })(); + + v1.Connection = (function() { + + /** + * Properties of a Connection. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IConnection + * @property {string|null} [endpoint] Connection endpoint + * @property {google.cloud.apigeeconnect.v1.ICluster|null} [cluster] Connection cluster + * @property {number|null} [streamCount] Connection streamCount + */ + + /** + * Constructs a new Connection. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a Connection. + * @implements IConnection + * @constructor + * @param {google.cloud.apigeeconnect.v1.IConnection=} [properties] Properties to set + */ + function Connection(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Connection endpoint. + * @member {string} endpoint + * @memberof google.cloud.apigeeconnect.v1.Connection + * @instance + */ + Connection.prototype.endpoint = ""; + + /** + * Connection cluster. + * @member {google.cloud.apigeeconnect.v1.ICluster|null|undefined} cluster + * @memberof google.cloud.apigeeconnect.v1.Connection + * @instance + */ + Connection.prototype.cluster = null; + + /** + * Connection streamCount. + * @member {number} streamCount + * @memberof google.cloud.apigeeconnect.v1.Connection + * @instance + */ + Connection.prototype.streamCount = 0; + + /** + * Creates a new Connection instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {google.cloud.apigeeconnect.v1.IConnection=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.Connection} Connection instance + */ + Connection.create = function create(properties) { + return new Connection(properties); + }; + + /** + * Encodes the specified Connection message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Connection.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {google.cloud.apigeeconnect.v1.IConnection} message Connection message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Connection.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.endpoint != null && Object.hasOwnProperty.call(message, "endpoint")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.endpoint); + if (message.cluster != null && Object.hasOwnProperty.call(message, "cluster")) + $root.google.cloud.apigeeconnect.v1.Cluster.encode(message.cluster, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.streamCount != null && Object.hasOwnProperty.call(message, "streamCount")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.streamCount); + return writer; + }; + + /** + * Encodes the specified Connection message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Connection.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {google.cloud.apigeeconnect.v1.IConnection} message Connection message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Connection.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Connection message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.Connection} Connection + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Connection.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.Connection(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.endpoint = reader.string(); + break; + case 2: + message.cluster = $root.google.cloud.apigeeconnect.v1.Cluster.decode(reader, reader.uint32()); + break; + case 3: + message.streamCount = reader.int32(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Connection message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.Connection} Connection + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Connection.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Connection message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Connection.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.endpoint != null && message.hasOwnProperty("endpoint")) + if (!$util.isString(message.endpoint)) + return "endpoint: string expected"; + if (message.cluster != null && message.hasOwnProperty("cluster")) { + var error = $root.google.cloud.apigeeconnect.v1.Cluster.verify(message.cluster); + if (error) + return "cluster." + error; + } + if (message.streamCount != null && message.hasOwnProperty("streamCount")) + if (!$util.isInteger(message.streamCount)) + return "streamCount: integer expected"; + return null; + }; + + /** + * Creates a Connection message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.Connection} Connection + */ + Connection.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.Connection) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.Connection(); + if (object.endpoint != null) + message.endpoint = String(object.endpoint); + if (object.cluster != null) { + if (typeof object.cluster !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.Connection.cluster: object expected"); + message.cluster = $root.google.cloud.apigeeconnect.v1.Cluster.fromObject(object.cluster); + } + if (object.streamCount != null) + message.streamCount = object.streamCount | 0; + return message; + }; + + /** + * Creates a plain object from a Connection message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {google.cloud.apigeeconnect.v1.Connection} message Connection + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Connection.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.endpoint = ""; + object.cluster = null; + object.streamCount = 0; + } + if (message.endpoint != null && message.hasOwnProperty("endpoint")) + object.endpoint = message.endpoint; + if (message.cluster != null && message.hasOwnProperty("cluster")) + object.cluster = $root.google.cloud.apigeeconnect.v1.Cluster.toObject(message.cluster, options); + if (message.streamCount != null && message.hasOwnProperty("streamCount")) + object.streamCount = message.streamCount; + return object; + }; + + /** + * Converts this Connection to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.Connection + * @instance + * @returns {Object.} JSON object + */ + Connection.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Connection; + })(); + + v1.Cluster = (function() { + + /** + * Properties of a Cluster. + * @memberof google.cloud.apigeeconnect.v1 + * @interface ICluster + * @property {string|null} [name] Cluster name + * @property {string|null} [region] Cluster region + */ + + /** + * Constructs a new Cluster. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a Cluster. + * @implements ICluster + * @constructor + * @param {google.cloud.apigeeconnect.v1.ICluster=} [properties] Properties to set + */ + function Cluster(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Cluster name. + * @member {string} name + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @instance + */ + Cluster.prototype.name = ""; + + /** + * Cluster region. + * @member {string} region + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @instance + */ + Cluster.prototype.region = ""; + + /** + * Creates a new Cluster instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {google.cloud.apigeeconnect.v1.ICluster=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.Cluster} Cluster instance + */ + Cluster.create = function create(properties) { + return new Cluster(properties); + }; + + /** + * Encodes the specified Cluster message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Cluster.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {google.cloud.apigeeconnect.v1.ICluster} message Cluster message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Cluster.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.region != null && Object.hasOwnProperty.call(message, "region")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.region); + return writer; + }; + + /** + * Encodes the specified Cluster message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Cluster.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {google.cloud.apigeeconnect.v1.ICluster} message Cluster message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Cluster.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Cluster message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.Cluster} Cluster + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Cluster.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.Cluster(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 2: + message.region = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Cluster message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.Cluster} Cluster + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Cluster.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Cluster message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Cluster.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.region != null && message.hasOwnProperty("region")) + if (!$util.isString(message.region)) + return "region: string expected"; + return null; + }; + + /** + * Creates a Cluster message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.Cluster} Cluster + */ + Cluster.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.Cluster) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.Cluster(); + if (object.name != null) + message.name = String(object.name); + if (object.region != null) + message.region = String(object.region); + return message; + }; + + /** + * Creates a plain object from a Cluster message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {google.cloud.apigeeconnect.v1.Cluster} message Cluster + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Cluster.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.region = ""; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.region != null && message.hasOwnProperty("region")) + object.region = message.region; + return object; + }; + + /** + * Converts this Cluster to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @instance + * @returns {Object.} JSON object + */ + Cluster.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Cluster; + })(); + + v1.Tether = (function() { + + /** + * Constructs a new Tether service. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a Tether + * @extends $protobuf.rpc.Service + * @constructor + * @param {$protobuf.RPCImpl} rpcImpl RPC implementation + * @param {boolean} [requestDelimited=false] Whether requests are length-delimited + * @param {boolean} [responseDelimited=false] Whether responses are length-delimited + */ + function Tether(rpcImpl, requestDelimited, responseDelimited) { + $protobuf.rpc.Service.call(this, rpcImpl, requestDelimited, responseDelimited); + } + + (Tether.prototype = Object.create($protobuf.rpc.Service.prototype)).constructor = Tether; + + /** + * Creates new Tether service using the specified rpc implementation. + * @function create + * @memberof google.cloud.apigeeconnect.v1.Tether + * @static + * @param {$protobuf.RPCImpl} rpcImpl RPC implementation + * @param {boolean} [requestDelimited=false] Whether requests are length-delimited + * @param {boolean} [responseDelimited=false] Whether responses are length-delimited + * @returns {Tether} RPC service. Useful where requests and/or responses are streamed. + */ + Tether.create = function create(rpcImpl, requestDelimited, responseDelimited) { + return new this(rpcImpl, requestDelimited, responseDelimited); + }; + + /** + * Callback as used by {@link google.cloud.apigeeconnect.v1.Tether#egress}. + * @memberof google.cloud.apigeeconnect.v1.Tether + * @typedef EgressCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.cloud.apigeeconnect.v1.EgressRequest} [response] EgressRequest + */ + + /** + * Calls Egress. + * @function egress + * @memberof google.cloud.apigeeconnect.v1.Tether + * @instance + * @param {google.cloud.apigeeconnect.v1.IEgressResponse} request EgressResponse message or plain object + * @param {google.cloud.apigeeconnect.v1.Tether.EgressCallback} callback Node-style callback called with the error, if any, and EgressRequest + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(Tether.prototype.egress = function egress(request, callback) { + return this.rpcCall(egress, $root.google.cloud.apigeeconnect.v1.EgressResponse, $root.google.cloud.apigeeconnect.v1.EgressRequest, request, callback); + }, "name", { value: "Egress" }); + + /** + * Calls Egress. + * @function egress + * @memberof google.cloud.apigeeconnect.v1.Tether + * @instance + * @param {google.cloud.apigeeconnect.v1.IEgressResponse} request EgressResponse message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + return Tether; + })(); + + v1.EgressRequest = (function() { + + /** + * Properties of an EgressRequest. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IEgressRequest + * @property {string|null} [id] EgressRequest id + * @property {google.cloud.apigeeconnect.v1.IPayload|null} [payload] EgressRequest payload + * @property {google.cloud.apigeeconnect.v1.TetherEndpoint|null} [endpoint] EgressRequest endpoint + * @property {string|null} [project] EgressRequest project + * @property {string|null} [traceId] EgressRequest traceId + * @property {google.protobuf.IDuration|null} [timeout] EgressRequest timeout + */ + + /** + * Constructs a new EgressRequest. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents an EgressRequest. + * @implements IEgressRequest + * @constructor + * @param {google.cloud.apigeeconnect.v1.IEgressRequest=} [properties] Properties to set + */ + function EgressRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EgressRequest id. + * @member {string} id + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @instance + */ + EgressRequest.prototype.id = ""; + + /** + * EgressRequest payload. + * @member {google.cloud.apigeeconnect.v1.IPayload|null|undefined} payload + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @instance + */ + EgressRequest.prototype.payload = null; + + /** + * EgressRequest endpoint. + * @member {google.cloud.apigeeconnect.v1.TetherEndpoint} endpoint + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @instance + */ + EgressRequest.prototype.endpoint = 0; + + /** + * EgressRequest project. + * @member {string} project + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @instance + */ + EgressRequest.prototype.project = ""; + + /** + * EgressRequest traceId. + * @member {string} traceId + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @instance + */ + EgressRequest.prototype.traceId = ""; + + /** + * EgressRequest timeout. + * @member {google.protobuf.IDuration|null|undefined} timeout + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @instance + */ + EgressRequest.prototype.timeout = null; + + /** + * Creates a new EgressRequest instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IEgressRequest=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.EgressRequest} EgressRequest instance + */ + EgressRequest.create = function create(properties) { + return new EgressRequest(properties); + }; + + /** + * Encodes the specified EgressRequest message. Does not implicitly {@link google.cloud.apigeeconnect.v1.EgressRequest.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IEgressRequest} message EgressRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EgressRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.id != null && Object.hasOwnProperty.call(message, "id")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.id); + if (message.payload != null && Object.hasOwnProperty.call(message, "payload")) + $root.google.cloud.apigeeconnect.v1.Payload.encode(message.payload, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.endpoint != null && Object.hasOwnProperty.call(message, "endpoint")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.endpoint); + if (message.project != null && Object.hasOwnProperty.call(message, "project")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.project); + if (message.traceId != null && Object.hasOwnProperty.call(message, "traceId")) + writer.uint32(/* id 5, wireType 2 =*/42).string(message.traceId); + if (message.timeout != null && Object.hasOwnProperty.call(message, "timeout")) + $root.google.protobuf.Duration.encode(message.timeout, writer.uint32(/* id 6, wireType 2 =*/50).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified EgressRequest message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.EgressRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IEgressRequest} message EgressRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EgressRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EgressRequest message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.EgressRequest} EgressRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EgressRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.EgressRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.id = reader.string(); + break; + case 2: + message.payload = $root.google.cloud.apigeeconnect.v1.Payload.decode(reader, reader.uint32()); + break; + case 3: + message.endpoint = reader.int32(); + break; + case 4: + message.project = reader.string(); + break; + case 5: + message.traceId = reader.string(); + break; + case 6: + message.timeout = $root.google.protobuf.Duration.decode(reader, reader.uint32()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EgressRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.EgressRequest} EgressRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EgressRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EgressRequest message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EgressRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.id != null && message.hasOwnProperty("id")) + if (!$util.isString(message.id)) + return "id: string expected"; + if (message.payload != null && message.hasOwnProperty("payload")) { + var error = $root.google.cloud.apigeeconnect.v1.Payload.verify(message.payload); + if (error) + return "payload." + error; + } + if (message.endpoint != null && message.hasOwnProperty("endpoint")) + switch (message.endpoint) { + default: + return "endpoint: enum value expected"; + case 0: + case 1: + case 2: + case 3: + break; + } + if (message.project != null && message.hasOwnProperty("project")) + if (!$util.isString(message.project)) + return "project: string expected"; + if (message.traceId != null && message.hasOwnProperty("traceId")) + if (!$util.isString(message.traceId)) + return "traceId: string expected"; + if (message.timeout != null && message.hasOwnProperty("timeout")) { + var error = $root.google.protobuf.Duration.verify(message.timeout); + if (error) + return "timeout." + error; + } + return null; + }; + + /** + * Creates an EgressRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.EgressRequest} EgressRequest + */ + EgressRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.EgressRequest) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.EgressRequest(); + if (object.id != null) + message.id = String(object.id); + if (object.payload != null) { + if (typeof object.payload !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.EgressRequest.payload: object expected"); + message.payload = $root.google.cloud.apigeeconnect.v1.Payload.fromObject(object.payload); + } + switch (object.endpoint) { + case "TETHER_ENDPOINT_UNSPECIFIED": + case 0: + message.endpoint = 0; + break; + case "APIGEE_MART": + case 1: + message.endpoint = 1; + break; + case "APIGEE_RUNTIME": + case 2: + message.endpoint = 2; + break; + case "APIGEE_MINT_RATING": + case 3: + message.endpoint = 3; + break; + } + if (object.project != null) + message.project = String(object.project); + if (object.traceId != null) + message.traceId = String(object.traceId); + if (object.timeout != null) { + if (typeof object.timeout !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.EgressRequest.timeout: object expected"); + message.timeout = $root.google.protobuf.Duration.fromObject(object.timeout); + } + return message; + }; + + /** + * Creates a plain object from an EgressRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {google.cloud.apigeeconnect.v1.EgressRequest} message EgressRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EgressRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.id = ""; + object.payload = null; + object.endpoint = options.enums === String ? "TETHER_ENDPOINT_UNSPECIFIED" : 0; + object.project = ""; + object.traceId = ""; + object.timeout = null; + } + if (message.id != null && message.hasOwnProperty("id")) + object.id = message.id; + if (message.payload != null && message.hasOwnProperty("payload")) + object.payload = $root.google.cloud.apigeeconnect.v1.Payload.toObject(message.payload, options); + if (message.endpoint != null && message.hasOwnProperty("endpoint")) + object.endpoint = options.enums === String ? $root.google.cloud.apigeeconnect.v1.TetherEndpoint[message.endpoint] : message.endpoint; + if (message.project != null && message.hasOwnProperty("project")) + object.project = message.project; + if (message.traceId != null && message.hasOwnProperty("traceId")) + object.traceId = message.traceId; + if (message.timeout != null && message.hasOwnProperty("timeout")) + object.timeout = $root.google.protobuf.Duration.toObject(message.timeout, options); + return object; + }; + + /** + * Converts this EgressRequest to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @instance + * @returns {Object.} JSON object + */ + EgressRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return EgressRequest; + })(); + + v1.Payload = (function() { + + /** + * Properties of a Payload. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IPayload + * @property {google.cloud.apigeeconnect.v1.IHttpRequest|null} [httpRequest] Payload httpRequest + * @property {google.cloud.apigeeconnect.v1.IStreamInfo|null} [streamInfo] Payload streamInfo + * @property {google.cloud.apigeeconnect.v1.Action|null} [action] Payload action + */ + + /** + * Constructs a new Payload. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a Payload. + * @implements IPayload + * @constructor + * @param {google.cloud.apigeeconnect.v1.IPayload=} [properties] Properties to set + */ + function Payload(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Payload httpRequest. + * @member {google.cloud.apigeeconnect.v1.IHttpRequest|null|undefined} httpRequest + * @memberof google.cloud.apigeeconnect.v1.Payload + * @instance + */ + Payload.prototype.httpRequest = null; + + /** + * Payload streamInfo. + * @member {google.cloud.apigeeconnect.v1.IStreamInfo|null|undefined} streamInfo + * @memberof google.cloud.apigeeconnect.v1.Payload + * @instance + */ + Payload.prototype.streamInfo = null; + + /** + * Payload action. + * @member {google.cloud.apigeeconnect.v1.Action|null|undefined} action + * @memberof google.cloud.apigeeconnect.v1.Payload + * @instance + */ + Payload.prototype.action = null; + + // OneOf field names bound to virtual getters and setters + var $oneOfFields; + + /** + * Payload kind. + * @member {"httpRequest"|"streamInfo"|"action"|undefined} kind + * @memberof google.cloud.apigeeconnect.v1.Payload + * @instance + */ + Object.defineProperty(Payload.prototype, "kind", { + get: $util.oneOfGetter($oneOfFields = ["httpRequest", "streamInfo", "action"]), + set: $util.oneOfSetter($oneOfFields) + }); + + /** + * Creates a new Payload instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {google.cloud.apigeeconnect.v1.IPayload=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.Payload} Payload instance + */ + Payload.create = function create(properties) { + return new Payload(properties); + }; + + /** + * Encodes the specified Payload message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Payload.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {google.cloud.apigeeconnect.v1.IPayload} message Payload message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Payload.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.httpRequest != null && Object.hasOwnProperty.call(message, "httpRequest")) + $root.google.cloud.apigeeconnect.v1.HttpRequest.encode(message.httpRequest, writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + if (message.streamInfo != null && Object.hasOwnProperty.call(message, "streamInfo")) + $root.google.cloud.apigeeconnect.v1.StreamInfo.encode(message.streamInfo, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.action != null && Object.hasOwnProperty.call(message, "action")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.action); + return writer; + }; + + /** + * Encodes the specified Payload message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Payload.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {google.cloud.apigeeconnect.v1.IPayload} message Payload message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Payload.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Payload message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.Payload} Payload + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Payload.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.Payload(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.httpRequest = $root.google.cloud.apigeeconnect.v1.HttpRequest.decode(reader, reader.uint32()); + break; + case 2: + message.streamInfo = $root.google.cloud.apigeeconnect.v1.StreamInfo.decode(reader, reader.uint32()); + break; + case 3: + message.action = reader.int32(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Payload message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.Payload} Payload + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Payload.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Payload message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Payload.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + var properties = {}; + if (message.httpRequest != null && message.hasOwnProperty("httpRequest")) { + properties.kind = 1; + { + var error = $root.google.cloud.apigeeconnect.v1.HttpRequest.verify(message.httpRequest); + if (error) + return "httpRequest." + error; + } + } + if (message.streamInfo != null && message.hasOwnProperty("streamInfo")) { + if (properties.kind === 1) + return "kind: multiple values"; + properties.kind = 1; + { + var error = $root.google.cloud.apigeeconnect.v1.StreamInfo.verify(message.streamInfo); + if (error) + return "streamInfo." + error; + } + } + if (message.action != null && message.hasOwnProperty("action")) { + if (properties.kind === 1) + return "kind: multiple values"; + properties.kind = 1; + switch (message.action) { + default: + return "action: enum value expected"; + case 0: + case 1: + break; + } + } + return null; + }; + + /** + * Creates a Payload message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.Payload} Payload + */ + Payload.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.Payload) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.Payload(); + if (object.httpRequest != null) { + if (typeof object.httpRequest !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.Payload.httpRequest: object expected"); + message.httpRequest = $root.google.cloud.apigeeconnect.v1.HttpRequest.fromObject(object.httpRequest); + } + if (object.streamInfo != null) { + if (typeof object.streamInfo !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.Payload.streamInfo: object expected"); + message.streamInfo = $root.google.cloud.apigeeconnect.v1.StreamInfo.fromObject(object.streamInfo); + } + switch (object.action) { + case "ACTION_UNSPECIFIED": + case 0: + message.action = 0; + break; + case "OPEN_NEW_STREAM": + case 1: + message.action = 1; + break; + } + return message; + }; + + /** + * Creates a plain object from a Payload message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {google.cloud.apigeeconnect.v1.Payload} message Payload + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Payload.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (message.httpRequest != null && message.hasOwnProperty("httpRequest")) { + object.httpRequest = $root.google.cloud.apigeeconnect.v1.HttpRequest.toObject(message.httpRequest, options); + if (options.oneofs) + object.kind = "httpRequest"; + } + if (message.streamInfo != null && message.hasOwnProperty("streamInfo")) { + object.streamInfo = $root.google.cloud.apigeeconnect.v1.StreamInfo.toObject(message.streamInfo, options); + if (options.oneofs) + object.kind = "streamInfo"; + } + if (message.action != null && message.hasOwnProperty("action")) { + object.action = options.enums === String ? $root.google.cloud.apigeeconnect.v1.Action[message.action] : message.action; + if (options.oneofs) + object.kind = "action"; + } + return object; + }; + + /** + * Converts this Payload to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.Payload + * @instance + * @returns {Object.} JSON object + */ + Payload.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Payload; + })(); + + v1.StreamInfo = (function() { + + /** + * Properties of a StreamInfo. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IStreamInfo + * @property {string|null} [id] StreamInfo id + */ + + /** + * Constructs a new StreamInfo. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a StreamInfo. + * @implements IStreamInfo + * @constructor + * @param {google.cloud.apigeeconnect.v1.IStreamInfo=} [properties] Properties to set + */ + function StreamInfo(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * StreamInfo id. + * @member {string} id + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @instance + */ + StreamInfo.prototype.id = ""; + + /** + * Creates a new StreamInfo instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {google.cloud.apigeeconnect.v1.IStreamInfo=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.StreamInfo} StreamInfo instance + */ + StreamInfo.create = function create(properties) { + return new StreamInfo(properties); + }; + + /** + * Encodes the specified StreamInfo message. Does not implicitly {@link google.cloud.apigeeconnect.v1.StreamInfo.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {google.cloud.apigeeconnect.v1.IStreamInfo} message StreamInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + StreamInfo.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.id != null && Object.hasOwnProperty.call(message, "id")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.id); + return writer; + }; + + /** + * Encodes the specified StreamInfo message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.StreamInfo.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {google.cloud.apigeeconnect.v1.IStreamInfo} message StreamInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + StreamInfo.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a StreamInfo message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.StreamInfo} StreamInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + StreamInfo.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.StreamInfo(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.id = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a StreamInfo message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.StreamInfo} StreamInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + StreamInfo.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a StreamInfo message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + StreamInfo.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.id != null && message.hasOwnProperty("id")) + if (!$util.isString(message.id)) + return "id: string expected"; + return null; + }; + + /** + * Creates a StreamInfo message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.StreamInfo} StreamInfo + */ + StreamInfo.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.StreamInfo) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.StreamInfo(); + if (object.id != null) + message.id = String(object.id); + return message; + }; + + /** + * Creates a plain object from a StreamInfo message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {google.cloud.apigeeconnect.v1.StreamInfo} message StreamInfo + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + StreamInfo.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) + object.id = ""; + if (message.id != null && message.hasOwnProperty("id")) + object.id = message.id; + return object; + }; + + /** + * Converts this StreamInfo to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @instance + * @returns {Object.} JSON object + */ + StreamInfo.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return StreamInfo; + })(); + + /** + * Action enum. + * @name google.cloud.apigeeconnect.v1.Action + * @enum {number} + * @property {number} ACTION_UNSPECIFIED=0 ACTION_UNSPECIFIED value + * @property {number} OPEN_NEW_STREAM=1 OPEN_NEW_STREAM value + */ + v1.Action = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "ACTION_UNSPECIFIED"] = 0; + values[valuesById[1] = "OPEN_NEW_STREAM"] = 1; + return values; + })(); + + v1.EgressResponse = (function() { + + /** + * Properties of an EgressResponse. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IEgressResponse + * @property {string|null} [id] EgressResponse id + * @property {google.cloud.apigeeconnect.v1.IHttpResponse|null} [httpResponse] EgressResponse httpResponse + * @property {google.rpc.IStatus|null} [status] EgressResponse status + * @property {string|null} [project] EgressResponse project + * @property {string|null} [traceId] EgressResponse traceId + * @property {google.cloud.apigeeconnect.v1.TetherEndpoint|null} [endpoint] EgressResponse endpoint + * @property {string|null} [name] EgressResponse name + */ + + /** + * Constructs a new EgressResponse. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents an EgressResponse. + * @implements IEgressResponse + * @constructor + * @param {google.cloud.apigeeconnect.v1.IEgressResponse=} [properties] Properties to set + */ + function EgressResponse(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EgressResponse id. + * @member {string} id + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @instance + */ + EgressResponse.prototype.id = ""; + + /** + * EgressResponse httpResponse. + * @member {google.cloud.apigeeconnect.v1.IHttpResponse|null|undefined} httpResponse + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @instance + */ + EgressResponse.prototype.httpResponse = null; + + /** + * EgressResponse status. + * @member {google.rpc.IStatus|null|undefined} status + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @instance + */ + EgressResponse.prototype.status = null; + + /** + * EgressResponse project. + * @member {string} project + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @instance + */ + EgressResponse.prototype.project = ""; + + /** + * EgressResponse traceId. + * @member {string} traceId + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @instance + */ + EgressResponse.prototype.traceId = ""; + + /** + * EgressResponse endpoint. + * @member {google.cloud.apigeeconnect.v1.TetherEndpoint} endpoint + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @instance + */ + EgressResponse.prototype.endpoint = 0; + + /** + * EgressResponse name. + * @member {string} name + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @instance + */ + EgressResponse.prototype.name = ""; + + /** + * Creates a new EgressResponse instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IEgressResponse=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.EgressResponse} EgressResponse instance + */ + EgressResponse.create = function create(properties) { + return new EgressResponse(properties); + }; + + /** + * Encodes the specified EgressResponse message. Does not implicitly {@link google.cloud.apigeeconnect.v1.EgressResponse.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IEgressResponse} message EgressResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EgressResponse.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.id != null && Object.hasOwnProperty.call(message, "id")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.id); + if (message.httpResponse != null && Object.hasOwnProperty.call(message, "httpResponse")) + $root.google.cloud.apigeeconnect.v1.HttpResponse.encode(message.httpResponse, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.status != null && Object.hasOwnProperty.call(message, "status")) + $root.google.rpc.Status.encode(message.status, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + if (message.project != null && Object.hasOwnProperty.call(message, "project")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.project); + if (message.traceId != null && Object.hasOwnProperty.call(message, "traceId")) + writer.uint32(/* id 5, wireType 2 =*/42).string(message.traceId); + if (message.endpoint != null && Object.hasOwnProperty.call(message, "endpoint")) + writer.uint32(/* id 6, wireType 0 =*/48).int32(message.endpoint); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 7, wireType 2 =*/58).string(message.name); + return writer; + }; + + /** + * Encodes the specified EgressResponse message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.EgressResponse.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IEgressResponse} message EgressResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EgressResponse.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EgressResponse message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.EgressResponse} EgressResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EgressResponse.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.EgressResponse(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.id = reader.string(); + break; + case 2: + message.httpResponse = $root.google.cloud.apigeeconnect.v1.HttpResponse.decode(reader, reader.uint32()); + break; + case 3: + message.status = $root.google.rpc.Status.decode(reader, reader.uint32()); + break; + case 4: + message.project = reader.string(); + break; + case 5: + message.traceId = reader.string(); + break; + case 6: + message.endpoint = reader.int32(); + break; + case 7: + message.name = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EgressResponse message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.EgressResponse} EgressResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EgressResponse.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EgressResponse message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EgressResponse.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.id != null && message.hasOwnProperty("id")) + if (!$util.isString(message.id)) + return "id: string expected"; + if (message.httpResponse != null && message.hasOwnProperty("httpResponse")) { + var error = $root.google.cloud.apigeeconnect.v1.HttpResponse.verify(message.httpResponse); + if (error) + return "httpResponse." + error; + } + if (message.status != null && message.hasOwnProperty("status")) { + var error = $root.google.rpc.Status.verify(message.status); + if (error) + return "status." + error; + } + if (message.project != null && message.hasOwnProperty("project")) + if (!$util.isString(message.project)) + return "project: string expected"; + if (message.traceId != null && message.hasOwnProperty("traceId")) + if (!$util.isString(message.traceId)) + return "traceId: string expected"; + if (message.endpoint != null && message.hasOwnProperty("endpoint")) + switch (message.endpoint) { + default: + return "endpoint: enum value expected"; + case 0: + case 1: + case 2: + case 3: + break; + } + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + return null; + }; + + /** + * Creates an EgressResponse message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.EgressResponse} EgressResponse + */ + EgressResponse.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.EgressResponse) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.EgressResponse(); + if (object.id != null) + message.id = String(object.id); + if (object.httpResponse != null) { + if (typeof object.httpResponse !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.EgressResponse.httpResponse: object expected"); + message.httpResponse = $root.google.cloud.apigeeconnect.v1.HttpResponse.fromObject(object.httpResponse); + } + if (object.status != null) { + if (typeof object.status !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.EgressResponse.status: object expected"); + message.status = $root.google.rpc.Status.fromObject(object.status); + } + if (object.project != null) + message.project = String(object.project); + if (object.traceId != null) + message.traceId = String(object.traceId); + switch (object.endpoint) { + case "TETHER_ENDPOINT_UNSPECIFIED": + case 0: + message.endpoint = 0; + break; + case "APIGEE_MART": + case 1: + message.endpoint = 1; + break; + case "APIGEE_RUNTIME": + case 2: + message.endpoint = 2; + break; + case "APIGEE_MINT_RATING": + case 3: + message.endpoint = 3; + break; + } + if (object.name != null) + message.name = String(object.name); + return message; + }; + + /** + * Creates a plain object from an EgressResponse message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {google.cloud.apigeeconnect.v1.EgressResponse} message EgressResponse + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EgressResponse.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.id = ""; + object.httpResponse = null; + object.status = null; + object.project = ""; + object.traceId = ""; + object.endpoint = options.enums === String ? "TETHER_ENDPOINT_UNSPECIFIED" : 0; + object.name = ""; + } + if (message.id != null && message.hasOwnProperty("id")) + object.id = message.id; + if (message.httpResponse != null && message.hasOwnProperty("httpResponse")) + object.httpResponse = $root.google.cloud.apigeeconnect.v1.HttpResponse.toObject(message.httpResponse, options); + if (message.status != null && message.hasOwnProperty("status")) + object.status = $root.google.rpc.Status.toObject(message.status, options); + if (message.project != null && message.hasOwnProperty("project")) + object.project = message.project; + if (message.traceId != null && message.hasOwnProperty("traceId")) + object.traceId = message.traceId; + if (message.endpoint != null && message.hasOwnProperty("endpoint")) + object.endpoint = options.enums === String ? $root.google.cloud.apigeeconnect.v1.TetherEndpoint[message.endpoint] : message.endpoint; + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + return object; + }; + + /** + * Converts this EgressResponse to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @instance + * @returns {Object.} JSON object + */ + EgressResponse.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return EgressResponse; + })(); + + /** + * TetherEndpoint enum. + * @name google.cloud.apigeeconnect.v1.TetherEndpoint + * @enum {number} + * @property {number} TETHER_ENDPOINT_UNSPECIFIED=0 TETHER_ENDPOINT_UNSPECIFIED value + * @property {number} APIGEE_MART=1 APIGEE_MART value + * @property {number} APIGEE_RUNTIME=2 APIGEE_RUNTIME value + * @property {number} APIGEE_MINT_RATING=3 APIGEE_MINT_RATING value + */ + v1.TetherEndpoint = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "TETHER_ENDPOINT_UNSPECIFIED"] = 0; + values[valuesById[1] = "APIGEE_MART"] = 1; + values[valuesById[2] = "APIGEE_RUNTIME"] = 2; + values[valuesById[3] = "APIGEE_MINT_RATING"] = 3; + return values; + })(); + + /** + * Scheme enum. + * @name google.cloud.apigeeconnect.v1.Scheme + * @enum {number} + * @property {number} SCHEME_UNSPECIFIED=0 SCHEME_UNSPECIFIED value + * @property {number} HTTPS=1 HTTPS value + */ + v1.Scheme = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "SCHEME_UNSPECIFIED"] = 0; + values[valuesById[1] = "HTTPS"] = 1; + return values; + })(); + + v1.HttpRequest = (function() { + + /** + * Properties of a HttpRequest. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IHttpRequest + * @property {string|null} [id] HttpRequest id + * @property {string|null} [method] HttpRequest method + * @property {google.cloud.apigeeconnect.v1.IUrl|null} [url] HttpRequest url + * @property {Array.|null} [headers] HttpRequest headers + * @property {Uint8Array|null} [body] HttpRequest body + */ + + /** + * Constructs a new HttpRequest. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a HttpRequest. + * @implements IHttpRequest + * @constructor + * @param {google.cloud.apigeeconnect.v1.IHttpRequest=} [properties] Properties to set + */ + function HttpRequest(properties) { + this.headers = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * HttpRequest id. + * @member {string} id + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @instance + */ + HttpRequest.prototype.id = ""; + + /** + * HttpRequest method. + * @member {string} method + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @instance + */ + HttpRequest.prototype.method = ""; + + /** + * HttpRequest url. + * @member {google.cloud.apigeeconnect.v1.IUrl|null|undefined} url + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @instance + */ + HttpRequest.prototype.url = null; + + /** + * HttpRequest headers. + * @member {Array.} headers + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @instance + */ + HttpRequest.prototype.headers = $util.emptyArray; + + /** + * HttpRequest body. + * @member {Uint8Array} body + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @instance + */ + HttpRequest.prototype.body = $util.newBuffer([]); + + /** + * Creates a new HttpRequest instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IHttpRequest=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.HttpRequest} HttpRequest instance + */ + HttpRequest.create = function create(properties) { + return new HttpRequest(properties); + }; + + /** + * Encodes the specified HttpRequest message. Does not implicitly {@link google.cloud.apigeeconnect.v1.HttpRequest.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IHttpRequest} message HttpRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + HttpRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.id != null && Object.hasOwnProperty.call(message, "id")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.id); + if (message.method != null && Object.hasOwnProperty.call(message, "method")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.method); + if (message.url != null && Object.hasOwnProperty.call(message, "url")) + $root.google.cloud.apigeeconnect.v1.Url.encode(message.url, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + if (message.headers != null && message.headers.length) + for (var i = 0; i < message.headers.length; ++i) + $root.google.cloud.apigeeconnect.v1.Header.encode(message.headers[i], writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.body != null && Object.hasOwnProperty.call(message, "body")) + writer.uint32(/* id 5, wireType 2 =*/42).bytes(message.body); + return writer; + }; + + /** + * Encodes the specified HttpRequest message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.HttpRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {google.cloud.apigeeconnect.v1.IHttpRequest} message HttpRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + HttpRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a HttpRequest message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.HttpRequest} HttpRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + HttpRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.HttpRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.id = reader.string(); + break; + case 2: + message.method = reader.string(); + break; + case 3: + message.url = $root.google.cloud.apigeeconnect.v1.Url.decode(reader, reader.uint32()); + break; + case 4: + if (!(message.headers && message.headers.length)) + message.headers = []; + message.headers.push($root.google.cloud.apigeeconnect.v1.Header.decode(reader, reader.uint32())); + break; + case 5: + message.body = reader.bytes(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a HttpRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.HttpRequest} HttpRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + HttpRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a HttpRequest message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + HttpRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.id != null && message.hasOwnProperty("id")) + if (!$util.isString(message.id)) + return "id: string expected"; + if (message.method != null && message.hasOwnProperty("method")) + if (!$util.isString(message.method)) + return "method: string expected"; + if (message.url != null && message.hasOwnProperty("url")) { + var error = $root.google.cloud.apigeeconnect.v1.Url.verify(message.url); + if (error) + return "url." + error; + } + if (message.headers != null && message.hasOwnProperty("headers")) { + if (!Array.isArray(message.headers)) + return "headers: array expected"; + for (var i = 0; i < message.headers.length; ++i) { + var error = $root.google.cloud.apigeeconnect.v1.Header.verify(message.headers[i]); + if (error) + return "headers." + error; + } + } + if (message.body != null && message.hasOwnProperty("body")) + if (!(message.body && typeof message.body.length === "number" || $util.isString(message.body))) + return "body: buffer expected"; + return null; + }; + + /** + * Creates a HttpRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.HttpRequest} HttpRequest + */ + HttpRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.HttpRequest) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.HttpRequest(); + if (object.id != null) + message.id = String(object.id); + if (object.method != null) + message.method = String(object.method); + if (object.url != null) { + if (typeof object.url !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.HttpRequest.url: object expected"); + message.url = $root.google.cloud.apigeeconnect.v1.Url.fromObject(object.url); + } + if (object.headers) { + if (!Array.isArray(object.headers)) + throw TypeError(".google.cloud.apigeeconnect.v1.HttpRequest.headers: array expected"); + message.headers = []; + for (var i = 0; i < object.headers.length; ++i) { + if (typeof object.headers[i] !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.HttpRequest.headers: object expected"); + message.headers[i] = $root.google.cloud.apigeeconnect.v1.Header.fromObject(object.headers[i]); + } + } + if (object.body != null) + if (typeof object.body === "string") + $util.base64.decode(object.body, message.body = $util.newBuffer($util.base64.length(object.body)), 0); + else if (object.body.length) + message.body = object.body; + return message; + }; + + /** + * Creates a plain object from a HttpRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {google.cloud.apigeeconnect.v1.HttpRequest} message HttpRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + HttpRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.headers = []; + if (options.defaults) { + object.id = ""; + object.method = ""; + object.url = null; + if (options.bytes === String) + object.body = ""; + else { + object.body = []; + if (options.bytes !== Array) + object.body = $util.newBuffer(object.body); + } + } + if (message.id != null && message.hasOwnProperty("id")) + object.id = message.id; + if (message.method != null && message.hasOwnProperty("method")) + object.method = message.method; + if (message.url != null && message.hasOwnProperty("url")) + object.url = $root.google.cloud.apigeeconnect.v1.Url.toObject(message.url, options); + if (message.headers && message.headers.length) { + object.headers = []; + for (var j = 0; j < message.headers.length; ++j) + object.headers[j] = $root.google.cloud.apigeeconnect.v1.Header.toObject(message.headers[j], options); + } + if (message.body != null && message.hasOwnProperty("body")) + object.body = options.bytes === String ? $util.base64.encode(message.body, 0, message.body.length) : options.bytes === Array ? Array.prototype.slice.call(message.body) : message.body; + return object; + }; + + /** + * Converts this HttpRequest to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @instance + * @returns {Object.} JSON object + */ + HttpRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return HttpRequest; + })(); + + v1.Url = (function() { + + /** + * Properties of an Url. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IUrl + * @property {google.cloud.apigeeconnect.v1.Scheme|null} [scheme] Url scheme + * @property {string|null} [host] Url host + * @property {string|null} [path] Url path + */ + + /** + * Constructs a new Url. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents an Url. + * @implements IUrl + * @constructor + * @param {google.cloud.apigeeconnect.v1.IUrl=} [properties] Properties to set + */ + function Url(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Url scheme. + * @member {google.cloud.apigeeconnect.v1.Scheme} scheme + * @memberof google.cloud.apigeeconnect.v1.Url + * @instance + */ + Url.prototype.scheme = 0; + + /** + * Url host. + * @member {string} host + * @memberof google.cloud.apigeeconnect.v1.Url + * @instance + */ + Url.prototype.host = ""; + + /** + * Url path. + * @member {string} path + * @memberof google.cloud.apigeeconnect.v1.Url + * @instance + */ + Url.prototype.path = ""; + + /** + * Creates a new Url instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {google.cloud.apigeeconnect.v1.IUrl=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.Url} Url instance + */ + Url.create = function create(properties) { + return new Url(properties); + }; + + /** + * Encodes the specified Url message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Url.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {google.cloud.apigeeconnect.v1.IUrl} message Url message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Url.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.scheme != null && Object.hasOwnProperty.call(message, "scheme")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.scheme); + if (message.host != null && Object.hasOwnProperty.call(message, "host")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.host); + if (message.path != null && Object.hasOwnProperty.call(message, "path")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.path); + return writer; + }; + + /** + * Encodes the specified Url message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Url.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {google.cloud.apigeeconnect.v1.IUrl} message Url message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Url.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an Url message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.Url} Url + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Url.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.Url(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.scheme = reader.int32(); + break; + case 2: + message.host = reader.string(); + break; + case 3: + message.path = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an Url message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.Url} Url + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Url.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an Url message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Url.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.scheme != null && message.hasOwnProperty("scheme")) + switch (message.scheme) { + default: + return "scheme: enum value expected"; + case 0: + case 1: + break; + } + if (message.host != null && message.hasOwnProperty("host")) + if (!$util.isString(message.host)) + return "host: string expected"; + if (message.path != null && message.hasOwnProperty("path")) + if (!$util.isString(message.path)) + return "path: string expected"; + return null; + }; + + /** + * Creates an Url message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.Url} Url + */ + Url.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.Url) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.Url(); + switch (object.scheme) { + case "SCHEME_UNSPECIFIED": + case 0: + message.scheme = 0; + break; + case "HTTPS": + case 1: + message.scheme = 1; + break; + } + if (object.host != null) + message.host = String(object.host); + if (object.path != null) + message.path = String(object.path); + return message; + }; + + /** + * Creates a plain object from an Url message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {google.cloud.apigeeconnect.v1.Url} message Url + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Url.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.scheme = options.enums === String ? "SCHEME_UNSPECIFIED" : 0; + object.host = ""; + object.path = ""; + } + if (message.scheme != null && message.hasOwnProperty("scheme")) + object.scheme = options.enums === String ? $root.google.cloud.apigeeconnect.v1.Scheme[message.scheme] : message.scheme; + if (message.host != null && message.hasOwnProperty("host")) + object.host = message.host; + if (message.path != null && message.hasOwnProperty("path")) + object.path = message.path; + return object; + }; + + /** + * Converts this Url to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.Url + * @instance + * @returns {Object.} JSON object + */ + Url.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Url; + })(); + + v1.Header = (function() { + + /** + * Properties of a Header. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IHeader + * @property {string|null} [key] Header key + * @property {Array.|null} [values] Header values + */ + + /** + * Constructs a new Header. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a Header. + * @implements IHeader + * @constructor + * @param {google.cloud.apigeeconnect.v1.IHeader=} [properties] Properties to set + */ + function Header(properties) { + this.values = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Header key. + * @member {string} key + * @memberof google.cloud.apigeeconnect.v1.Header + * @instance + */ + Header.prototype.key = ""; + + /** + * Header values. + * @member {Array.} values + * @memberof google.cloud.apigeeconnect.v1.Header + * @instance + */ + Header.prototype.values = $util.emptyArray; + + /** + * Creates a new Header instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {google.cloud.apigeeconnect.v1.IHeader=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.Header} Header instance + */ + Header.create = function create(properties) { + return new Header(properties); + }; + + /** + * Encodes the specified Header message. Does not implicitly {@link google.cloud.apigeeconnect.v1.Header.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {google.cloud.apigeeconnect.v1.IHeader} message Header message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Header.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.key != null && Object.hasOwnProperty.call(message, "key")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.key); + if (message.values != null && message.values.length) + for (var i = 0; i < message.values.length; ++i) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.values[i]); + return writer; + }; + + /** + * Encodes the specified Header message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.Header.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {google.cloud.apigeeconnect.v1.IHeader} message Header message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Header.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Header message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.Header} Header + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Header.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.Header(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.key = reader.string(); + break; + case 2: + if (!(message.values && message.values.length)) + message.values = []; + message.values.push(reader.string()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Header message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.Header} Header + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Header.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Header message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Header.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.key != null && message.hasOwnProperty("key")) + if (!$util.isString(message.key)) + return "key: string expected"; + if (message.values != null && message.hasOwnProperty("values")) { + if (!Array.isArray(message.values)) + return "values: array expected"; + for (var i = 0; i < message.values.length; ++i) + if (!$util.isString(message.values[i])) + return "values: string[] expected"; + } + return null; + }; + + /** + * Creates a Header message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.Header} Header + */ + Header.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.Header) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.Header(); + if (object.key != null) + message.key = String(object.key); + if (object.values) { + if (!Array.isArray(object.values)) + throw TypeError(".google.cloud.apigeeconnect.v1.Header.values: array expected"); + message.values = []; + for (var i = 0; i < object.values.length; ++i) + message.values[i] = String(object.values[i]); + } + return message; + }; + + /** + * Creates a plain object from a Header message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {google.cloud.apigeeconnect.v1.Header} message Header + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Header.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.values = []; + if (options.defaults) + object.key = ""; + if (message.key != null && message.hasOwnProperty("key")) + object.key = message.key; + if (message.values && message.values.length) { + object.values = []; + for (var j = 0; j < message.values.length; ++j) + object.values[j] = message.values[j]; + } + return object; + }; + + /** + * Converts this Header to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.Header + * @instance + * @returns {Object.} JSON object + */ + Header.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Header; + })(); + + v1.HttpResponse = (function() { + + /** + * Properties of a HttpResponse. + * @memberof google.cloud.apigeeconnect.v1 + * @interface IHttpResponse + * @property {string|null} [id] HttpResponse id + * @property {string|null} [status] HttpResponse status + * @property {number|null} [statusCode] HttpResponse statusCode + * @property {Uint8Array|null} [body] HttpResponse body + * @property {Array.|null} [headers] HttpResponse headers + * @property {number|Long|null} [contentLength] HttpResponse contentLength + */ + + /** + * Constructs a new HttpResponse. + * @memberof google.cloud.apigeeconnect.v1 + * @classdesc Represents a HttpResponse. + * @implements IHttpResponse + * @constructor + * @param {google.cloud.apigeeconnect.v1.IHttpResponse=} [properties] Properties to set + */ + function HttpResponse(properties) { + this.headers = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * HttpResponse id. + * @member {string} id + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @instance + */ + HttpResponse.prototype.id = ""; + + /** + * HttpResponse status. + * @member {string} status + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @instance + */ + HttpResponse.prototype.status = ""; + + /** + * HttpResponse statusCode. + * @member {number} statusCode + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @instance + */ + HttpResponse.prototype.statusCode = 0; + + /** + * HttpResponse body. + * @member {Uint8Array} body + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @instance + */ + HttpResponse.prototype.body = $util.newBuffer([]); + + /** + * HttpResponse headers. + * @member {Array.} headers + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @instance + */ + HttpResponse.prototype.headers = $util.emptyArray; + + /** + * HttpResponse contentLength. + * @member {number|Long} contentLength + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @instance + */ + HttpResponse.prototype.contentLength = $util.Long ? $util.Long.fromBits(0,0,false) : 0; + + /** + * Creates a new HttpResponse instance using the specified properties. + * @function create + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IHttpResponse=} [properties] Properties to set + * @returns {google.cloud.apigeeconnect.v1.HttpResponse} HttpResponse instance + */ + HttpResponse.create = function create(properties) { + return new HttpResponse(properties); + }; + + /** + * Encodes the specified HttpResponse message. Does not implicitly {@link google.cloud.apigeeconnect.v1.HttpResponse.verify|verify} messages. + * @function encode + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IHttpResponse} message HttpResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + HttpResponse.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.id != null && Object.hasOwnProperty.call(message, "id")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.id); + if (message.status != null && Object.hasOwnProperty.call(message, "status")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.status); + if (message.statusCode != null && Object.hasOwnProperty.call(message, "statusCode")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.statusCode); + if (message.body != null && Object.hasOwnProperty.call(message, "body")) + writer.uint32(/* id 4, wireType 2 =*/34).bytes(message.body); + if (message.headers != null && message.headers.length) + for (var i = 0; i < message.headers.length; ++i) + $root.google.cloud.apigeeconnect.v1.Header.encode(message.headers[i], writer.uint32(/* id 5, wireType 2 =*/42).fork()).ldelim(); + if (message.contentLength != null && Object.hasOwnProperty.call(message, "contentLength")) + writer.uint32(/* id 6, wireType 0 =*/48).int64(message.contentLength); + return writer; + }; + + /** + * Encodes the specified HttpResponse message, length delimited. Does not implicitly {@link google.cloud.apigeeconnect.v1.HttpResponse.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {google.cloud.apigeeconnect.v1.IHttpResponse} message HttpResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + HttpResponse.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a HttpResponse message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.apigeeconnect.v1.HttpResponse} HttpResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + HttpResponse.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.apigeeconnect.v1.HttpResponse(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.id = reader.string(); + break; + case 2: + message.status = reader.string(); + break; + case 3: + message.statusCode = reader.int32(); + break; + case 4: + message.body = reader.bytes(); + break; + case 5: + if (!(message.headers && message.headers.length)) + message.headers = []; + message.headers.push($root.google.cloud.apigeeconnect.v1.Header.decode(reader, reader.uint32())); + break; + case 6: + message.contentLength = reader.int64(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a HttpResponse message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.apigeeconnect.v1.HttpResponse} HttpResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + HttpResponse.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a HttpResponse message. + * @function verify + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + HttpResponse.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.id != null && message.hasOwnProperty("id")) + if (!$util.isString(message.id)) + return "id: string expected"; + if (message.status != null && message.hasOwnProperty("status")) + if (!$util.isString(message.status)) + return "status: string expected"; + if (message.statusCode != null && message.hasOwnProperty("statusCode")) + if (!$util.isInteger(message.statusCode)) + return "statusCode: integer expected"; + if (message.body != null && message.hasOwnProperty("body")) + if (!(message.body && typeof message.body.length === "number" || $util.isString(message.body))) + return "body: buffer expected"; + if (message.headers != null && message.hasOwnProperty("headers")) { + if (!Array.isArray(message.headers)) + return "headers: array expected"; + for (var i = 0; i < message.headers.length; ++i) { + var error = $root.google.cloud.apigeeconnect.v1.Header.verify(message.headers[i]); + if (error) + return "headers." + error; + } + } + if (message.contentLength != null && message.hasOwnProperty("contentLength")) + if (!$util.isInteger(message.contentLength) && !(message.contentLength && $util.isInteger(message.contentLength.low) && $util.isInteger(message.contentLength.high))) + return "contentLength: integer|Long expected"; + return null; + }; + + /** + * Creates a HttpResponse message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.apigeeconnect.v1.HttpResponse} HttpResponse + */ + HttpResponse.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.apigeeconnect.v1.HttpResponse) + return object; + var message = new $root.google.cloud.apigeeconnect.v1.HttpResponse(); + if (object.id != null) + message.id = String(object.id); + if (object.status != null) + message.status = String(object.status); + if (object.statusCode != null) + message.statusCode = object.statusCode | 0; + if (object.body != null) + if (typeof object.body === "string") + $util.base64.decode(object.body, message.body = $util.newBuffer($util.base64.length(object.body)), 0); + else if (object.body.length) + message.body = object.body; + if (object.headers) { + if (!Array.isArray(object.headers)) + throw TypeError(".google.cloud.apigeeconnect.v1.HttpResponse.headers: array expected"); + message.headers = []; + for (var i = 0; i < object.headers.length; ++i) { + if (typeof object.headers[i] !== "object") + throw TypeError(".google.cloud.apigeeconnect.v1.HttpResponse.headers: object expected"); + message.headers[i] = $root.google.cloud.apigeeconnect.v1.Header.fromObject(object.headers[i]); + } + } + if (object.contentLength != null) + if ($util.Long) + (message.contentLength = $util.Long.fromValue(object.contentLength)).unsigned = false; + else if (typeof object.contentLength === "string") + message.contentLength = parseInt(object.contentLength, 10); + else if (typeof object.contentLength === "number") + message.contentLength = object.contentLength; + else if (typeof object.contentLength === "object") + message.contentLength = new $util.LongBits(object.contentLength.low >>> 0, object.contentLength.high >>> 0).toNumber(); + return message; + }; + + /** + * Creates a plain object from a HttpResponse message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {google.cloud.apigeeconnect.v1.HttpResponse} message HttpResponse + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + HttpResponse.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.headers = []; + if (options.defaults) { + object.id = ""; + object.status = ""; + object.statusCode = 0; + if (options.bytes === String) + object.body = ""; + else { + object.body = []; + if (options.bytes !== Array) + object.body = $util.newBuffer(object.body); + } + if ($util.Long) { + var long = new $util.Long(0, 0, false); + object.contentLength = options.longs === String ? long.toString() : options.longs === Number ? long.toNumber() : long; + } else + object.contentLength = options.longs === String ? "0" : 0; + } + if (message.id != null && message.hasOwnProperty("id")) + object.id = message.id; + if (message.status != null && message.hasOwnProperty("status")) + object.status = message.status; + if (message.statusCode != null && message.hasOwnProperty("statusCode")) + object.statusCode = message.statusCode; + if (message.body != null && message.hasOwnProperty("body")) + object.body = options.bytes === String ? $util.base64.encode(message.body, 0, message.body.length) : options.bytes === Array ? Array.prototype.slice.call(message.body) : message.body; + if (message.headers && message.headers.length) { + object.headers = []; + for (var j = 0; j < message.headers.length; ++j) + object.headers[j] = $root.google.cloud.apigeeconnect.v1.Header.toObject(message.headers[j], options); + } + if (message.contentLength != null && message.hasOwnProperty("contentLength")) + if (typeof message.contentLength === "number") + object.contentLength = options.longs === String ? String(message.contentLength) : message.contentLength; + else + object.contentLength = options.longs === String ? $util.Long.prototype.toString.call(message.contentLength) : options.longs === Number ? new $util.LongBits(message.contentLength.low >>> 0, message.contentLength.high >>> 0).toNumber() : message.contentLength; + return object; + }; + + /** + * Converts this HttpResponse to JSON. + * @function toJSON + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @instance + * @returns {Object.} JSON object + */ + HttpResponse.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return HttpResponse; + })(); + + return v1; + })(); + + return apigeeconnect; + })(); + + return cloud; + })(); + + google.api = (function() { + + /** + * Namespace api. + * @memberof google + * @namespace + */ + var api = {}; + + api.Http = (function() { + + /** + * Properties of a Http. + * @memberof google.api + * @interface IHttp + * @property {Array.|null} [rules] Http rules + * @property {boolean|null} [fullyDecodeReservedExpansion] Http fullyDecodeReservedExpansion + */ + + /** + * Constructs a new Http. + * @memberof google.api + * @classdesc Represents a Http. + * @implements IHttp + * @constructor + * @param {google.api.IHttp=} [properties] Properties to set + */ + function Http(properties) { + this.rules = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Http rules. + * @member {Array.} rules + * @memberof google.api.Http + * @instance + */ + Http.prototype.rules = $util.emptyArray; + + /** + * Http fullyDecodeReservedExpansion. + * @member {boolean} fullyDecodeReservedExpansion + * @memberof google.api.Http + * @instance + */ + Http.prototype.fullyDecodeReservedExpansion = false; + + /** + * Creates a new Http instance using the specified properties. + * @function create + * @memberof google.api.Http + * @static + * @param {google.api.IHttp=} [properties] Properties to set + * @returns {google.api.Http} Http instance + */ + Http.create = function create(properties) { + return new Http(properties); + }; + + /** + * Encodes the specified Http message. Does not implicitly {@link google.api.Http.verify|verify} messages. + * @function encode + * @memberof google.api.Http + * @static + * @param {google.api.IHttp} message Http message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Http.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.rules != null && message.rules.length) + for (var i = 0; i < message.rules.length; ++i) + $root.google.api.HttpRule.encode(message.rules[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + if (message.fullyDecodeReservedExpansion != null && Object.hasOwnProperty.call(message, "fullyDecodeReservedExpansion")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.fullyDecodeReservedExpansion); + return writer; + }; + + /** + * Encodes the specified Http message, length delimited. Does not implicitly {@link google.api.Http.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.Http + * @static + * @param {google.api.IHttp} message Http message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Http.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Http message from the specified reader or buffer. + * @function decode + * @memberof google.api.Http + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.Http} Http + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Http.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.Http(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + if (!(message.rules && message.rules.length)) + message.rules = []; + message.rules.push($root.google.api.HttpRule.decode(reader, reader.uint32())); + break; + case 2: + message.fullyDecodeReservedExpansion = reader.bool(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Http message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.Http + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.Http} Http + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Http.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Http message. + * @function verify + * @memberof google.api.Http + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Http.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.rules != null && message.hasOwnProperty("rules")) { + if (!Array.isArray(message.rules)) + return "rules: array expected"; + for (var i = 0; i < message.rules.length; ++i) { + var error = $root.google.api.HttpRule.verify(message.rules[i]); + if (error) + return "rules." + error; + } + } + if (message.fullyDecodeReservedExpansion != null && message.hasOwnProperty("fullyDecodeReservedExpansion")) + if (typeof message.fullyDecodeReservedExpansion !== "boolean") + return "fullyDecodeReservedExpansion: boolean expected"; + return null; + }; + + /** + * Creates a Http message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.Http + * @static + * @param {Object.} object Plain object + * @returns {google.api.Http} Http + */ + Http.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.Http) + return object; + var message = new $root.google.api.Http(); + if (object.rules) { + if (!Array.isArray(object.rules)) + throw TypeError(".google.api.Http.rules: array expected"); + message.rules = []; + for (var i = 0; i < object.rules.length; ++i) { + if (typeof object.rules[i] !== "object") + throw TypeError(".google.api.Http.rules: object expected"); + message.rules[i] = $root.google.api.HttpRule.fromObject(object.rules[i]); + } + } + if (object.fullyDecodeReservedExpansion != null) + message.fullyDecodeReservedExpansion = Boolean(object.fullyDecodeReservedExpansion); + return message; + }; + + /** + * Creates a plain object from a Http message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.Http + * @static + * @param {google.api.Http} message Http + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Http.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.rules = []; + if (options.defaults) + object.fullyDecodeReservedExpansion = false; + if (message.rules && message.rules.length) { + object.rules = []; + for (var j = 0; j < message.rules.length; ++j) + object.rules[j] = $root.google.api.HttpRule.toObject(message.rules[j], options); + } + if (message.fullyDecodeReservedExpansion != null && message.hasOwnProperty("fullyDecodeReservedExpansion")) + object.fullyDecodeReservedExpansion = message.fullyDecodeReservedExpansion; + return object; + }; + + /** + * Converts this Http to JSON. + * @function toJSON + * @memberof google.api.Http + * @instance + * @returns {Object.} JSON object + */ + Http.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Http; + })(); + + api.HttpRule = (function() { + + /** + * Properties of a HttpRule. + * @memberof google.api + * @interface IHttpRule + * @property {string|null} [selector] HttpRule selector + * @property {string|null} [get] HttpRule get + * @property {string|null} [put] HttpRule put + * @property {string|null} [post] HttpRule post + * @property {string|null} ["delete"] HttpRule delete + * @property {string|null} [patch] HttpRule patch + * @property {google.api.ICustomHttpPattern|null} [custom] HttpRule custom + * @property {string|null} [body] HttpRule body + * @property {string|null} [responseBody] HttpRule responseBody + * @property {Array.|null} [additionalBindings] HttpRule additionalBindings + */ + + /** + * Constructs a new HttpRule. + * @memberof google.api + * @classdesc Represents a HttpRule. + * @implements IHttpRule + * @constructor + * @param {google.api.IHttpRule=} [properties] Properties to set + */ + function HttpRule(properties) { + this.additionalBindings = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * HttpRule selector. + * @member {string} selector + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.selector = ""; + + /** + * HttpRule get. + * @member {string|null|undefined} get + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.get = null; + + /** + * HttpRule put. + * @member {string|null|undefined} put + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.put = null; + + /** + * HttpRule post. + * @member {string|null|undefined} post + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.post = null; + + /** + * HttpRule delete. + * @member {string|null|undefined} delete + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype["delete"] = null; + + /** + * HttpRule patch. + * @member {string|null|undefined} patch + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.patch = null; + + /** + * HttpRule custom. + * @member {google.api.ICustomHttpPattern|null|undefined} custom + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.custom = null; + + /** + * HttpRule body. + * @member {string} body + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.body = ""; + + /** + * HttpRule responseBody. + * @member {string} responseBody + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.responseBody = ""; + + /** + * HttpRule additionalBindings. + * @member {Array.} additionalBindings + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.additionalBindings = $util.emptyArray; + + // OneOf field names bound to virtual getters and setters + var $oneOfFields; + + /** + * HttpRule pattern. + * @member {"get"|"put"|"post"|"delete"|"patch"|"custom"|undefined} pattern + * @memberof google.api.HttpRule + * @instance + */ + Object.defineProperty(HttpRule.prototype, "pattern", { + get: $util.oneOfGetter($oneOfFields = ["get", "put", "post", "delete", "patch", "custom"]), + set: $util.oneOfSetter($oneOfFields) + }); + + /** + * Creates a new HttpRule instance using the specified properties. + * @function create + * @memberof google.api.HttpRule + * @static + * @param {google.api.IHttpRule=} [properties] Properties to set + * @returns {google.api.HttpRule} HttpRule instance + */ + HttpRule.create = function create(properties) { + return new HttpRule(properties); + }; + + /** + * Encodes the specified HttpRule message. Does not implicitly {@link google.api.HttpRule.verify|verify} messages. + * @function encode + * @memberof google.api.HttpRule + * @static + * @param {google.api.IHttpRule} message HttpRule message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + HttpRule.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.selector != null && Object.hasOwnProperty.call(message, "selector")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.selector); + if (message.get != null && Object.hasOwnProperty.call(message, "get")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.get); + if (message.put != null && Object.hasOwnProperty.call(message, "put")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.put); + if (message.post != null && Object.hasOwnProperty.call(message, "post")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.post); + if (message["delete"] != null && Object.hasOwnProperty.call(message, "delete")) + writer.uint32(/* id 5, wireType 2 =*/42).string(message["delete"]); + if (message.patch != null && Object.hasOwnProperty.call(message, "patch")) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.patch); + if (message.body != null && Object.hasOwnProperty.call(message, "body")) + writer.uint32(/* id 7, wireType 2 =*/58).string(message.body); + if (message.custom != null && Object.hasOwnProperty.call(message, "custom")) + $root.google.api.CustomHttpPattern.encode(message.custom, writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.additionalBindings != null && message.additionalBindings.length) + for (var i = 0; i < message.additionalBindings.length; ++i) + $root.google.api.HttpRule.encode(message.additionalBindings[i], writer.uint32(/* id 11, wireType 2 =*/90).fork()).ldelim(); + if (message.responseBody != null && Object.hasOwnProperty.call(message, "responseBody")) + writer.uint32(/* id 12, wireType 2 =*/98).string(message.responseBody); + return writer; + }; + + /** + * Encodes the specified HttpRule message, length delimited. Does not implicitly {@link google.api.HttpRule.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.HttpRule + * @static + * @param {google.api.IHttpRule} message HttpRule message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + HttpRule.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a HttpRule message from the specified reader or buffer. + * @function decode + * @memberof google.api.HttpRule + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.HttpRule} HttpRule + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + HttpRule.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.HttpRule(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.selector = reader.string(); + break; + case 2: + message.get = reader.string(); + break; + case 3: + message.put = reader.string(); + break; + case 4: + message.post = reader.string(); + break; + case 5: + message["delete"] = reader.string(); + break; + case 6: + message.patch = reader.string(); + break; + case 8: + message.custom = $root.google.api.CustomHttpPattern.decode(reader, reader.uint32()); + break; + case 7: + message.body = reader.string(); + break; + case 12: + message.responseBody = reader.string(); + break; + case 11: + if (!(message.additionalBindings && message.additionalBindings.length)) + message.additionalBindings = []; + message.additionalBindings.push($root.google.api.HttpRule.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a HttpRule message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.HttpRule + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.HttpRule} HttpRule + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + HttpRule.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a HttpRule message. + * @function verify + * @memberof google.api.HttpRule + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + HttpRule.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + var properties = {}; + if (message.selector != null && message.hasOwnProperty("selector")) + if (!$util.isString(message.selector)) + return "selector: string expected"; + if (message.get != null && message.hasOwnProperty("get")) { + properties.pattern = 1; + if (!$util.isString(message.get)) + return "get: string expected"; + } + if (message.put != null && message.hasOwnProperty("put")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + if (!$util.isString(message.put)) + return "put: string expected"; + } + if (message.post != null && message.hasOwnProperty("post")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + if (!$util.isString(message.post)) + return "post: string expected"; + } + if (message["delete"] != null && message.hasOwnProperty("delete")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + if (!$util.isString(message["delete"])) + return "delete: string expected"; + } + if (message.patch != null && message.hasOwnProperty("patch")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + if (!$util.isString(message.patch)) + return "patch: string expected"; + } + if (message.custom != null && message.hasOwnProperty("custom")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + { + var error = $root.google.api.CustomHttpPattern.verify(message.custom); + if (error) + return "custom." + error; + } + } + if (message.body != null && message.hasOwnProperty("body")) + if (!$util.isString(message.body)) + return "body: string expected"; + if (message.responseBody != null && message.hasOwnProperty("responseBody")) + if (!$util.isString(message.responseBody)) + return "responseBody: string expected"; + if (message.additionalBindings != null && message.hasOwnProperty("additionalBindings")) { + if (!Array.isArray(message.additionalBindings)) + return "additionalBindings: array expected"; + for (var i = 0; i < message.additionalBindings.length; ++i) { + var error = $root.google.api.HttpRule.verify(message.additionalBindings[i]); + if (error) + return "additionalBindings." + error; + } + } + return null; + }; + + /** + * Creates a HttpRule message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.HttpRule + * @static + * @param {Object.} object Plain object + * @returns {google.api.HttpRule} HttpRule + */ + HttpRule.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.HttpRule) + return object; + var message = new $root.google.api.HttpRule(); + if (object.selector != null) + message.selector = String(object.selector); + if (object.get != null) + message.get = String(object.get); + if (object.put != null) + message.put = String(object.put); + if (object.post != null) + message.post = String(object.post); + if (object["delete"] != null) + message["delete"] = String(object["delete"]); + if (object.patch != null) + message.patch = String(object.patch); + if (object.custom != null) { + if (typeof object.custom !== "object") + throw TypeError(".google.api.HttpRule.custom: object expected"); + message.custom = $root.google.api.CustomHttpPattern.fromObject(object.custom); + } + if (object.body != null) + message.body = String(object.body); + if (object.responseBody != null) + message.responseBody = String(object.responseBody); + if (object.additionalBindings) { + if (!Array.isArray(object.additionalBindings)) + throw TypeError(".google.api.HttpRule.additionalBindings: array expected"); + message.additionalBindings = []; + for (var i = 0; i < object.additionalBindings.length; ++i) { + if (typeof object.additionalBindings[i] !== "object") + throw TypeError(".google.api.HttpRule.additionalBindings: object expected"); + message.additionalBindings[i] = $root.google.api.HttpRule.fromObject(object.additionalBindings[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a HttpRule message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.HttpRule + * @static + * @param {google.api.HttpRule} message HttpRule + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + HttpRule.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.additionalBindings = []; + if (options.defaults) { + object.selector = ""; + object.body = ""; + object.responseBody = ""; + } + if (message.selector != null && message.hasOwnProperty("selector")) + object.selector = message.selector; + if (message.get != null && message.hasOwnProperty("get")) { + object.get = message.get; + if (options.oneofs) + object.pattern = "get"; + } + if (message.put != null && message.hasOwnProperty("put")) { + object.put = message.put; + if (options.oneofs) + object.pattern = "put"; + } + if (message.post != null && message.hasOwnProperty("post")) { + object.post = message.post; + if (options.oneofs) + object.pattern = "post"; + } + if (message["delete"] != null && message.hasOwnProperty("delete")) { + object["delete"] = message["delete"]; + if (options.oneofs) + object.pattern = "delete"; + } + if (message.patch != null && message.hasOwnProperty("patch")) { + object.patch = message.patch; + if (options.oneofs) + object.pattern = "patch"; + } + if (message.body != null && message.hasOwnProperty("body")) + object.body = message.body; + if (message.custom != null && message.hasOwnProperty("custom")) { + object.custom = $root.google.api.CustomHttpPattern.toObject(message.custom, options); + if (options.oneofs) + object.pattern = "custom"; + } + if (message.additionalBindings && message.additionalBindings.length) { + object.additionalBindings = []; + for (var j = 0; j < message.additionalBindings.length; ++j) + object.additionalBindings[j] = $root.google.api.HttpRule.toObject(message.additionalBindings[j], options); + } + if (message.responseBody != null && message.hasOwnProperty("responseBody")) + object.responseBody = message.responseBody; + return object; + }; + + /** + * Converts this HttpRule to JSON. + * @function toJSON + * @memberof google.api.HttpRule + * @instance + * @returns {Object.} JSON object + */ + HttpRule.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return HttpRule; + })(); + + api.CustomHttpPattern = (function() { + + /** + * Properties of a CustomHttpPattern. + * @memberof google.api + * @interface ICustomHttpPattern + * @property {string|null} [kind] CustomHttpPattern kind + * @property {string|null} [path] CustomHttpPattern path + */ + + /** + * Constructs a new CustomHttpPattern. + * @memberof google.api + * @classdesc Represents a CustomHttpPattern. + * @implements ICustomHttpPattern + * @constructor + * @param {google.api.ICustomHttpPattern=} [properties] Properties to set + */ + function CustomHttpPattern(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * CustomHttpPattern kind. + * @member {string} kind + * @memberof google.api.CustomHttpPattern + * @instance + */ + CustomHttpPattern.prototype.kind = ""; + + /** + * CustomHttpPattern path. + * @member {string} path + * @memberof google.api.CustomHttpPattern + * @instance + */ + CustomHttpPattern.prototype.path = ""; + + /** + * Creates a new CustomHttpPattern instance using the specified properties. + * @function create + * @memberof google.api.CustomHttpPattern + * @static + * @param {google.api.ICustomHttpPattern=} [properties] Properties to set + * @returns {google.api.CustomHttpPattern} CustomHttpPattern instance + */ + CustomHttpPattern.create = function create(properties) { + return new CustomHttpPattern(properties); + }; + + /** + * Encodes the specified CustomHttpPattern message. Does not implicitly {@link google.api.CustomHttpPattern.verify|verify} messages. + * @function encode + * @memberof google.api.CustomHttpPattern + * @static + * @param {google.api.ICustomHttpPattern} message CustomHttpPattern message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CustomHttpPattern.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.kind != null && Object.hasOwnProperty.call(message, "kind")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.kind); + if (message.path != null && Object.hasOwnProperty.call(message, "path")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.path); + return writer; + }; + + /** + * Encodes the specified CustomHttpPattern message, length delimited. Does not implicitly {@link google.api.CustomHttpPattern.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.CustomHttpPattern + * @static + * @param {google.api.ICustomHttpPattern} message CustomHttpPattern message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CustomHttpPattern.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a CustomHttpPattern message from the specified reader or buffer. + * @function decode + * @memberof google.api.CustomHttpPattern + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.CustomHttpPattern} CustomHttpPattern + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CustomHttpPattern.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.CustomHttpPattern(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.kind = reader.string(); + break; + case 2: + message.path = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a CustomHttpPattern message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.CustomHttpPattern + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.CustomHttpPattern} CustomHttpPattern + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CustomHttpPattern.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a CustomHttpPattern message. + * @function verify + * @memberof google.api.CustomHttpPattern + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + CustomHttpPattern.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.kind != null && message.hasOwnProperty("kind")) + if (!$util.isString(message.kind)) + return "kind: string expected"; + if (message.path != null && message.hasOwnProperty("path")) + if (!$util.isString(message.path)) + return "path: string expected"; + return null; + }; + + /** + * Creates a CustomHttpPattern message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.CustomHttpPattern + * @static + * @param {Object.} object Plain object + * @returns {google.api.CustomHttpPattern} CustomHttpPattern + */ + CustomHttpPattern.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.CustomHttpPattern) + return object; + var message = new $root.google.api.CustomHttpPattern(); + if (object.kind != null) + message.kind = String(object.kind); + if (object.path != null) + message.path = String(object.path); + return message; + }; + + /** + * Creates a plain object from a CustomHttpPattern message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.CustomHttpPattern + * @static + * @param {google.api.CustomHttpPattern} message CustomHttpPattern + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + CustomHttpPattern.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.kind = ""; + object.path = ""; + } + if (message.kind != null && message.hasOwnProperty("kind")) + object.kind = message.kind; + if (message.path != null && message.hasOwnProperty("path")) + object.path = message.path; + return object; + }; + + /** + * Converts this CustomHttpPattern to JSON. + * @function toJSON + * @memberof google.api.CustomHttpPattern + * @instance + * @returns {Object.} JSON object + */ + CustomHttpPattern.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return CustomHttpPattern; + })(); + + /** + * FieldBehavior enum. + * @name google.api.FieldBehavior + * @enum {number} + * @property {number} FIELD_BEHAVIOR_UNSPECIFIED=0 FIELD_BEHAVIOR_UNSPECIFIED value + * @property {number} OPTIONAL=1 OPTIONAL value + * @property {number} REQUIRED=2 REQUIRED value + * @property {number} OUTPUT_ONLY=3 OUTPUT_ONLY value + * @property {number} INPUT_ONLY=4 INPUT_ONLY value + * @property {number} IMMUTABLE=5 IMMUTABLE value + * @property {number} UNORDERED_LIST=6 UNORDERED_LIST value + */ + api.FieldBehavior = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "FIELD_BEHAVIOR_UNSPECIFIED"] = 0; + values[valuesById[1] = "OPTIONAL"] = 1; + values[valuesById[2] = "REQUIRED"] = 2; + values[valuesById[3] = "OUTPUT_ONLY"] = 3; + values[valuesById[4] = "INPUT_ONLY"] = 4; + values[valuesById[5] = "IMMUTABLE"] = 5; + values[valuesById[6] = "UNORDERED_LIST"] = 6; + return values; + })(); + + api.ResourceDescriptor = (function() { + + /** + * Properties of a ResourceDescriptor. + * @memberof google.api + * @interface IResourceDescriptor + * @property {string|null} [type] ResourceDescriptor type + * @property {Array.|null} [pattern] ResourceDescriptor pattern + * @property {string|null} [nameField] ResourceDescriptor nameField + * @property {google.api.ResourceDescriptor.History|null} [history] ResourceDescriptor history + * @property {string|null} [plural] ResourceDescriptor plural + * @property {string|null} [singular] ResourceDescriptor singular + * @property {Array.|null} [style] ResourceDescriptor style + */ + + /** + * Constructs a new ResourceDescriptor. + * @memberof google.api + * @classdesc Represents a ResourceDescriptor. + * @implements IResourceDescriptor + * @constructor + * @param {google.api.IResourceDescriptor=} [properties] Properties to set + */ + function ResourceDescriptor(properties) { + this.pattern = []; + this.style = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ResourceDescriptor type. + * @member {string} type + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.type = ""; + + /** + * ResourceDescriptor pattern. + * @member {Array.} pattern + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.pattern = $util.emptyArray; + + /** + * ResourceDescriptor nameField. + * @member {string} nameField + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.nameField = ""; + + /** + * ResourceDescriptor history. + * @member {google.api.ResourceDescriptor.History} history + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.history = 0; + + /** + * ResourceDescriptor plural. + * @member {string} plural + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.plural = ""; + + /** + * ResourceDescriptor singular. + * @member {string} singular + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.singular = ""; + + /** + * ResourceDescriptor style. + * @member {Array.} style + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.style = $util.emptyArray; + + /** + * Creates a new ResourceDescriptor instance using the specified properties. + * @function create + * @memberof google.api.ResourceDescriptor + * @static + * @param {google.api.IResourceDescriptor=} [properties] Properties to set + * @returns {google.api.ResourceDescriptor} ResourceDescriptor instance + */ + ResourceDescriptor.create = function create(properties) { + return new ResourceDescriptor(properties); + }; + + /** + * Encodes the specified ResourceDescriptor message. Does not implicitly {@link google.api.ResourceDescriptor.verify|verify} messages. + * @function encode + * @memberof google.api.ResourceDescriptor + * @static + * @param {google.api.IResourceDescriptor} message ResourceDescriptor message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ResourceDescriptor.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.type != null && Object.hasOwnProperty.call(message, "type")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.type); + if (message.pattern != null && message.pattern.length) + for (var i = 0; i < message.pattern.length; ++i) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.pattern[i]); + if (message.nameField != null && Object.hasOwnProperty.call(message, "nameField")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.nameField); + if (message.history != null && Object.hasOwnProperty.call(message, "history")) + writer.uint32(/* id 4, wireType 0 =*/32).int32(message.history); + if (message.plural != null && Object.hasOwnProperty.call(message, "plural")) + writer.uint32(/* id 5, wireType 2 =*/42).string(message.plural); + if (message.singular != null && Object.hasOwnProperty.call(message, "singular")) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.singular); + if (message.style != null && message.style.length) { + writer.uint32(/* id 10, wireType 2 =*/82).fork(); + for (var i = 0; i < message.style.length; ++i) + writer.int32(message.style[i]); + writer.ldelim(); + } + return writer; + }; + + /** + * Encodes the specified ResourceDescriptor message, length delimited. Does not implicitly {@link google.api.ResourceDescriptor.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.ResourceDescriptor + * @static + * @param {google.api.IResourceDescriptor} message ResourceDescriptor message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ResourceDescriptor.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ResourceDescriptor message from the specified reader or buffer. + * @function decode + * @memberof google.api.ResourceDescriptor + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.ResourceDescriptor} ResourceDescriptor + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ResourceDescriptor.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.ResourceDescriptor(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.type = reader.string(); + break; + case 2: + if (!(message.pattern && message.pattern.length)) + message.pattern = []; + message.pattern.push(reader.string()); + break; + case 3: + message.nameField = reader.string(); + break; + case 4: + message.history = reader.int32(); + break; + case 5: + message.plural = reader.string(); + break; + case 6: + message.singular = reader.string(); + break; + case 10: + if (!(message.style && message.style.length)) + message.style = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.style.push(reader.int32()); + } else + message.style.push(reader.int32()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ResourceDescriptor message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.ResourceDescriptor + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.ResourceDescriptor} ResourceDescriptor + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ResourceDescriptor.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ResourceDescriptor message. + * @function verify + * @memberof google.api.ResourceDescriptor + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ResourceDescriptor.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.type != null && message.hasOwnProperty("type")) + if (!$util.isString(message.type)) + return "type: string expected"; + if (message.pattern != null && message.hasOwnProperty("pattern")) { + if (!Array.isArray(message.pattern)) + return "pattern: array expected"; + for (var i = 0; i < message.pattern.length; ++i) + if (!$util.isString(message.pattern[i])) + return "pattern: string[] expected"; + } + if (message.nameField != null && message.hasOwnProperty("nameField")) + if (!$util.isString(message.nameField)) + return "nameField: string expected"; + if (message.history != null && message.hasOwnProperty("history")) + switch (message.history) { + default: + return "history: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.plural != null && message.hasOwnProperty("plural")) + if (!$util.isString(message.plural)) + return "plural: string expected"; + if (message.singular != null && message.hasOwnProperty("singular")) + if (!$util.isString(message.singular)) + return "singular: string expected"; + if (message.style != null && message.hasOwnProperty("style")) { + if (!Array.isArray(message.style)) + return "style: array expected"; + for (var i = 0; i < message.style.length; ++i) + switch (message.style[i]) { + default: + return "style: enum value[] expected"; + case 0: + case 1: + break; + } + } + return null; + }; + + /** + * Creates a ResourceDescriptor message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.ResourceDescriptor + * @static + * @param {Object.} object Plain object + * @returns {google.api.ResourceDescriptor} ResourceDescriptor + */ + ResourceDescriptor.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.ResourceDescriptor) + return object; + var message = new $root.google.api.ResourceDescriptor(); + if (object.type != null) + message.type = String(object.type); + if (object.pattern) { + if (!Array.isArray(object.pattern)) + throw TypeError(".google.api.ResourceDescriptor.pattern: array expected"); + message.pattern = []; + for (var i = 0; i < object.pattern.length; ++i) + message.pattern[i] = String(object.pattern[i]); + } + if (object.nameField != null) + message.nameField = String(object.nameField); + switch (object.history) { + case "HISTORY_UNSPECIFIED": + case 0: + message.history = 0; + break; + case "ORIGINALLY_SINGLE_PATTERN": + case 1: + message.history = 1; + break; + case "FUTURE_MULTI_PATTERN": + case 2: + message.history = 2; + break; + } + if (object.plural != null) + message.plural = String(object.plural); + if (object.singular != null) + message.singular = String(object.singular); + if (object.style) { + if (!Array.isArray(object.style)) + throw TypeError(".google.api.ResourceDescriptor.style: array expected"); + message.style = []; + for (var i = 0; i < object.style.length; ++i) + switch (object.style[i]) { + default: + case "STYLE_UNSPECIFIED": + case 0: + message.style[i] = 0; + break; + case "DECLARATIVE_FRIENDLY": + case 1: + message.style[i] = 1; + break; + } + } + return message; + }; + + /** + * Creates a plain object from a ResourceDescriptor message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.ResourceDescriptor + * @static + * @param {google.api.ResourceDescriptor} message ResourceDescriptor + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ResourceDescriptor.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.pattern = []; + object.style = []; + } + if (options.defaults) { + object.type = ""; + object.nameField = ""; + object.history = options.enums === String ? "HISTORY_UNSPECIFIED" : 0; + object.plural = ""; + object.singular = ""; + } + if (message.type != null && message.hasOwnProperty("type")) + object.type = message.type; + if (message.pattern && message.pattern.length) { + object.pattern = []; + for (var j = 0; j < message.pattern.length; ++j) + object.pattern[j] = message.pattern[j]; + } + if (message.nameField != null && message.hasOwnProperty("nameField")) + object.nameField = message.nameField; + if (message.history != null && message.hasOwnProperty("history")) + object.history = options.enums === String ? $root.google.api.ResourceDescriptor.History[message.history] : message.history; + if (message.plural != null && message.hasOwnProperty("plural")) + object.plural = message.plural; + if (message.singular != null && message.hasOwnProperty("singular")) + object.singular = message.singular; + if (message.style && message.style.length) { + object.style = []; + for (var j = 0; j < message.style.length; ++j) + object.style[j] = options.enums === String ? $root.google.api.ResourceDescriptor.Style[message.style[j]] : message.style[j]; + } + return object; + }; + + /** + * Converts this ResourceDescriptor to JSON. + * @function toJSON + * @memberof google.api.ResourceDescriptor + * @instance + * @returns {Object.} JSON object + */ + ResourceDescriptor.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * History enum. + * @name google.api.ResourceDescriptor.History + * @enum {number} + * @property {number} HISTORY_UNSPECIFIED=0 HISTORY_UNSPECIFIED value + * @property {number} ORIGINALLY_SINGLE_PATTERN=1 ORIGINALLY_SINGLE_PATTERN value + * @property {number} FUTURE_MULTI_PATTERN=2 FUTURE_MULTI_PATTERN value + */ + ResourceDescriptor.History = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "HISTORY_UNSPECIFIED"] = 0; + values[valuesById[1] = "ORIGINALLY_SINGLE_PATTERN"] = 1; + values[valuesById[2] = "FUTURE_MULTI_PATTERN"] = 2; + return values; + })(); + + /** + * Style enum. + * @name google.api.ResourceDescriptor.Style + * @enum {number} + * @property {number} STYLE_UNSPECIFIED=0 STYLE_UNSPECIFIED value + * @property {number} DECLARATIVE_FRIENDLY=1 DECLARATIVE_FRIENDLY value + */ + ResourceDescriptor.Style = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "STYLE_UNSPECIFIED"] = 0; + values[valuesById[1] = "DECLARATIVE_FRIENDLY"] = 1; + return values; + })(); + + return ResourceDescriptor; + })(); + + api.ResourceReference = (function() { + + /** + * Properties of a ResourceReference. + * @memberof google.api + * @interface IResourceReference + * @property {string|null} [type] ResourceReference type + * @property {string|null} [childType] ResourceReference childType + */ + + /** + * Constructs a new ResourceReference. + * @memberof google.api + * @classdesc Represents a ResourceReference. + * @implements IResourceReference + * @constructor + * @param {google.api.IResourceReference=} [properties] Properties to set + */ + function ResourceReference(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ResourceReference type. + * @member {string} type + * @memberof google.api.ResourceReference + * @instance + */ + ResourceReference.prototype.type = ""; + + /** + * ResourceReference childType. + * @member {string} childType + * @memberof google.api.ResourceReference + * @instance + */ + ResourceReference.prototype.childType = ""; + + /** + * Creates a new ResourceReference instance using the specified properties. + * @function create + * @memberof google.api.ResourceReference + * @static + * @param {google.api.IResourceReference=} [properties] Properties to set + * @returns {google.api.ResourceReference} ResourceReference instance + */ + ResourceReference.create = function create(properties) { + return new ResourceReference(properties); + }; + + /** + * Encodes the specified ResourceReference message. Does not implicitly {@link google.api.ResourceReference.verify|verify} messages. + * @function encode + * @memberof google.api.ResourceReference + * @static + * @param {google.api.IResourceReference} message ResourceReference message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ResourceReference.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.type != null && Object.hasOwnProperty.call(message, "type")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.type); + if (message.childType != null && Object.hasOwnProperty.call(message, "childType")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.childType); + return writer; + }; + + /** + * Encodes the specified ResourceReference message, length delimited. Does not implicitly {@link google.api.ResourceReference.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.ResourceReference + * @static + * @param {google.api.IResourceReference} message ResourceReference message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ResourceReference.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ResourceReference message from the specified reader or buffer. + * @function decode + * @memberof google.api.ResourceReference + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.ResourceReference} ResourceReference + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ResourceReference.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.ResourceReference(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.type = reader.string(); + break; + case 2: + message.childType = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ResourceReference message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.ResourceReference + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.ResourceReference} ResourceReference + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ResourceReference.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ResourceReference message. + * @function verify + * @memberof google.api.ResourceReference + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ResourceReference.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.type != null && message.hasOwnProperty("type")) + if (!$util.isString(message.type)) + return "type: string expected"; + if (message.childType != null && message.hasOwnProperty("childType")) + if (!$util.isString(message.childType)) + return "childType: string expected"; + return null; + }; + + /** + * Creates a ResourceReference message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.ResourceReference + * @static + * @param {Object.} object Plain object + * @returns {google.api.ResourceReference} ResourceReference + */ + ResourceReference.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.ResourceReference) + return object; + var message = new $root.google.api.ResourceReference(); + if (object.type != null) + message.type = String(object.type); + if (object.childType != null) + message.childType = String(object.childType); + return message; + }; + + /** + * Creates a plain object from a ResourceReference message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.ResourceReference + * @static + * @param {google.api.ResourceReference} message ResourceReference + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ResourceReference.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.type = ""; + object.childType = ""; + } + if (message.type != null && message.hasOwnProperty("type")) + object.type = message.type; + if (message.childType != null && message.hasOwnProperty("childType")) + object.childType = message.childType; + return object; + }; + + /** + * Converts this ResourceReference to JSON. + * @function toJSON + * @memberof google.api.ResourceReference + * @instance + * @returns {Object.} JSON object + */ + ResourceReference.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return ResourceReference; + })(); + + return api; + })(); + + google.protobuf = (function() { + + /** + * Namespace protobuf. + * @memberof google + * @namespace + */ + var protobuf = {}; + + protobuf.FileDescriptorSet = (function() { + + /** + * Properties of a FileDescriptorSet. + * @memberof google.protobuf + * @interface IFileDescriptorSet + * @property {Array.|null} [file] FileDescriptorSet file + */ + + /** + * Constructs a new FileDescriptorSet. + * @memberof google.protobuf + * @classdesc Represents a FileDescriptorSet. + * @implements IFileDescriptorSet + * @constructor + * @param {google.protobuf.IFileDescriptorSet=} [properties] Properties to set + */ + function FileDescriptorSet(properties) { + this.file = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FileDescriptorSet file. + * @member {Array.} file + * @memberof google.protobuf.FileDescriptorSet + * @instance + */ + FileDescriptorSet.prototype.file = $util.emptyArray; + + /** + * Creates a new FileDescriptorSet instance using the specified properties. + * @function create + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {google.protobuf.IFileDescriptorSet=} [properties] Properties to set + * @returns {google.protobuf.FileDescriptorSet} FileDescriptorSet instance + */ + FileDescriptorSet.create = function create(properties) { + return new FileDescriptorSet(properties); + }; + + /** + * Encodes the specified FileDescriptorSet message. Does not implicitly {@link google.protobuf.FileDescriptorSet.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {google.protobuf.IFileDescriptorSet} message FileDescriptorSet message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileDescriptorSet.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.file != null && message.file.length) + for (var i = 0; i < message.file.length; ++i) + $root.google.protobuf.FileDescriptorProto.encode(message.file[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified FileDescriptorSet message, length delimited. Does not implicitly {@link google.protobuf.FileDescriptorSet.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {google.protobuf.IFileDescriptorSet} message FileDescriptorSet message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileDescriptorSet.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FileDescriptorSet message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FileDescriptorSet} FileDescriptorSet + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileDescriptorSet.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FileDescriptorSet(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + if (!(message.file && message.file.length)) + message.file = []; + message.file.push($root.google.protobuf.FileDescriptorProto.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FileDescriptorSet message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FileDescriptorSet} FileDescriptorSet + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileDescriptorSet.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FileDescriptorSet message. + * @function verify + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FileDescriptorSet.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.file != null && message.hasOwnProperty("file")) { + if (!Array.isArray(message.file)) + return "file: array expected"; + for (var i = 0; i < message.file.length; ++i) { + var error = $root.google.protobuf.FileDescriptorProto.verify(message.file[i]); + if (error) + return "file." + error; + } + } + return null; + }; + + /** + * Creates a FileDescriptorSet message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FileDescriptorSet} FileDescriptorSet + */ + FileDescriptorSet.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FileDescriptorSet) + return object; + var message = new $root.google.protobuf.FileDescriptorSet(); + if (object.file) { + if (!Array.isArray(object.file)) + throw TypeError(".google.protobuf.FileDescriptorSet.file: array expected"); + message.file = []; + for (var i = 0; i < object.file.length; ++i) { + if (typeof object.file[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorSet.file: object expected"); + message.file[i] = $root.google.protobuf.FileDescriptorProto.fromObject(object.file[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a FileDescriptorSet message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {google.protobuf.FileDescriptorSet} message FileDescriptorSet + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FileDescriptorSet.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.file = []; + if (message.file && message.file.length) { + object.file = []; + for (var j = 0; j < message.file.length; ++j) + object.file[j] = $root.google.protobuf.FileDescriptorProto.toObject(message.file[j], options); + } + return object; + }; + + /** + * Converts this FileDescriptorSet to JSON. + * @function toJSON + * @memberof google.protobuf.FileDescriptorSet + * @instance + * @returns {Object.} JSON object + */ + FileDescriptorSet.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return FileDescriptorSet; + })(); + + protobuf.FileDescriptorProto = (function() { + + /** + * Properties of a FileDescriptorProto. + * @memberof google.protobuf + * @interface IFileDescriptorProto + * @property {string|null} [name] FileDescriptorProto name + * @property {string|null} ["package"] FileDescriptorProto package + * @property {Array.|null} [dependency] FileDescriptorProto dependency + * @property {Array.|null} [publicDependency] FileDescriptorProto publicDependency + * @property {Array.|null} [weakDependency] FileDescriptorProto weakDependency + * @property {Array.|null} [messageType] FileDescriptorProto messageType + * @property {Array.|null} [enumType] FileDescriptorProto enumType + * @property {Array.|null} [service] FileDescriptorProto service + * @property {Array.|null} [extension] FileDescriptorProto extension + * @property {google.protobuf.IFileOptions|null} [options] FileDescriptorProto options + * @property {google.protobuf.ISourceCodeInfo|null} [sourceCodeInfo] FileDescriptorProto sourceCodeInfo + * @property {string|null} [syntax] FileDescriptorProto syntax + */ + + /** + * Constructs a new FileDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a FileDescriptorProto. + * @implements IFileDescriptorProto + * @constructor + * @param {google.protobuf.IFileDescriptorProto=} [properties] Properties to set + */ + function FileDescriptorProto(properties) { + this.dependency = []; + this.publicDependency = []; + this.weakDependency = []; + this.messageType = []; + this.enumType = []; + this.service = []; + this.extension = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FileDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.name = ""; + + /** + * FileDescriptorProto package. + * @member {string} package + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype["package"] = ""; + + /** + * FileDescriptorProto dependency. + * @member {Array.} dependency + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.dependency = $util.emptyArray; + + /** + * FileDescriptorProto publicDependency. + * @member {Array.} publicDependency + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.publicDependency = $util.emptyArray; + + /** + * FileDescriptorProto weakDependency. + * @member {Array.} weakDependency + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.weakDependency = $util.emptyArray; + + /** + * FileDescriptorProto messageType. + * @member {Array.} messageType + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.messageType = $util.emptyArray; + + /** + * FileDescriptorProto enumType. + * @member {Array.} enumType + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.enumType = $util.emptyArray; + + /** + * FileDescriptorProto service. + * @member {Array.} service + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.service = $util.emptyArray; + + /** + * FileDescriptorProto extension. + * @member {Array.} extension + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.extension = $util.emptyArray; + + /** + * FileDescriptorProto options. + * @member {google.protobuf.IFileOptions|null|undefined} options + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.options = null; + + /** + * FileDescriptorProto sourceCodeInfo. + * @member {google.protobuf.ISourceCodeInfo|null|undefined} sourceCodeInfo + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.sourceCodeInfo = null; + + /** + * FileDescriptorProto syntax. + * @member {string} syntax + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.syntax = ""; + + /** + * Creates a new FileDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {google.protobuf.IFileDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.FileDescriptorProto} FileDescriptorProto instance + */ + FileDescriptorProto.create = function create(properties) { + return new FileDescriptorProto(properties); + }; + + /** + * Encodes the specified FileDescriptorProto message. Does not implicitly {@link google.protobuf.FileDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {google.protobuf.IFileDescriptorProto} message FileDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message["package"] != null && Object.hasOwnProperty.call(message, "package")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message["package"]); + if (message.dependency != null && message.dependency.length) + for (var i = 0; i < message.dependency.length; ++i) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.dependency[i]); + if (message.messageType != null && message.messageType.length) + for (var i = 0; i < message.messageType.length; ++i) + $root.google.protobuf.DescriptorProto.encode(message.messageType[i], writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.enumType != null && message.enumType.length) + for (var i = 0; i < message.enumType.length; ++i) + $root.google.protobuf.EnumDescriptorProto.encode(message.enumType[i], writer.uint32(/* id 5, wireType 2 =*/42).fork()).ldelim(); + if (message.service != null && message.service.length) + for (var i = 0; i < message.service.length; ++i) + $root.google.protobuf.ServiceDescriptorProto.encode(message.service[i], writer.uint32(/* id 6, wireType 2 =*/50).fork()).ldelim(); + if (message.extension != null && message.extension.length) + for (var i = 0; i < message.extension.length; ++i) + $root.google.protobuf.FieldDescriptorProto.encode(message.extension[i], writer.uint32(/* id 7, wireType 2 =*/58).fork()).ldelim(); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.FileOptions.encode(message.options, writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.sourceCodeInfo != null && Object.hasOwnProperty.call(message, "sourceCodeInfo")) + $root.google.protobuf.SourceCodeInfo.encode(message.sourceCodeInfo, writer.uint32(/* id 9, wireType 2 =*/74).fork()).ldelim(); + if (message.publicDependency != null && message.publicDependency.length) + for (var i = 0; i < message.publicDependency.length; ++i) + writer.uint32(/* id 10, wireType 0 =*/80).int32(message.publicDependency[i]); + if (message.weakDependency != null && message.weakDependency.length) + for (var i = 0; i < message.weakDependency.length; ++i) + writer.uint32(/* id 11, wireType 0 =*/88).int32(message.weakDependency[i]); + if (message.syntax != null && Object.hasOwnProperty.call(message, "syntax")) + writer.uint32(/* id 12, wireType 2 =*/98).string(message.syntax); + return writer; + }; + + /** + * Encodes the specified FileDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.FileDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {google.protobuf.IFileDescriptorProto} message FileDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FileDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FileDescriptorProto} FileDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FileDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 2: + message["package"] = reader.string(); + break; + case 3: + if (!(message.dependency && message.dependency.length)) + message.dependency = []; + message.dependency.push(reader.string()); + break; + case 10: + if (!(message.publicDependency && message.publicDependency.length)) + message.publicDependency = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.publicDependency.push(reader.int32()); + } else + message.publicDependency.push(reader.int32()); + break; + case 11: + if (!(message.weakDependency && message.weakDependency.length)) + message.weakDependency = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.weakDependency.push(reader.int32()); + } else + message.weakDependency.push(reader.int32()); + break; + case 4: + if (!(message.messageType && message.messageType.length)) + message.messageType = []; + message.messageType.push($root.google.protobuf.DescriptorProto.decode(reader, reader.uint32())); + break; + case 5: + if (!(message.enumType && message.enumType.length)) + message.enumType = []; + message.enumType.push($root.google.protobuf.EnumDescriptorProto.decode(reader, reader.uint32())); + break; + case 6: + if (!(message.service && message.service.length)) + message.service = []; + message.service.push($root.google.protobuf.ServiceDescriptorProto.decode(reader, reader.uint32())); + break; + case 7: + if (!(message.extension && message.extension.length)) + message.extension = []; + message.extension.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + case 8: + message.options = $root.google.protobuf.FileOptions.decode(reader, reader.uint32()); + break; + case 9: + message.sourceCodeInfo = $root.google.protobuf.SourceCodeInfo.decode(reader, reader.uint32()); + break; + case 12: + message.syntax = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FileDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FileDescriptorProto} FileDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FileDescriptorProto message. + * @function verify + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FileDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message["package"] != null && message.hasOwnProperty("package")) + if (!$util.isString(message["package"])) + return "package: string expected"; + if (message.dependency != null && message.hasOwnProperty("dependency")) { + if (!Array.isArray(message.dependency)) + return "dependency: array expected"; + for (var i = 0; i < message.dependency.length; ++i) + if (!$util.isString(message.dependency[i])) + return "dependency: string[] expected"; + } + if (message.publicDependency != null && message.hasOwnProperty("publicDependency")) { + if (!Array.isArray(message.publicDependency)) + return "publicDependency: array expected"; + for (var i = 0; i < message.publicDependency.length; ++i) + if (!$util.isInteger(message.publicDependency[i])) + return "publicDependency: integer[] expected"; + } + if (message.weakDependency != null && message.hasOwnProperty("weakDependency")) { + if (!Array.isArray(message.weakDependency)) + return "weakDependency: array expected"; + for (var i = 0; i < message.weakDependency.length; ++i) + if (!$util.isInteger(message.weakDependency[i])) + return "weakDependency: integer[] expected"; + } + if (message.messageType != null && message.hasOwnProperty("messageType")) { + if (!Array.isArray(message.messageType)) + return "messageType: array expected"; + for (var i = 0; i < message.messageType.length; ++i) { + var error = $root.google.protobuf.DescriptorProto.verify(message.messageType[i]); + if (error) + return "messageType." + error; + } + } + if (message.enumType != null && message.hasOwnProperty("enumType")) { + if (!Array.isArray(message.enumType)) + return "enumType: array expected"; + for (var i = 0; i < message.enumType.length; ++i) { + var error = $root.google.protobuf.EnumDescriptorProto.verify(message.enumType[i]); + if (error) + return "enumType." + error; + } + } + if (message.service != null && message.hasOwnProperty("service")) { + if (!Array.isArray(message.service)) + return "service: array expected"; + for (var i = 0; i < message.service.length; ++i) { + var error = $root.google.protobuf.ServiceDescriptorProto.verify(message.service[i]); + if (error) + return "service." + error; + } + } + if (message.extension != null && message.hasOwnProperty("extension")) { + if (!Array.isArray(message.extension)) + return "extension: array expected"; + for (var i = 0; i < message.extension.length; ++i) { + var error = $root.google.protobuf.FieldDescriptorProto.verify(message.extension[i]); + if (error) + return "extension." + error; + } + } + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.FileOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.sourceCodeInfo != null && message.hasOwnProperty("sourceCodeInfo")) { + var error = $root.google.protobuf.SourceCodeInfo.verify(message.sourceCodeInfo); + if (error) + return "sourceCodeInfo." + error; + } + if (message.syntax != null && message.hasOwnProperty("syntax")) + if (!$util.isString(message.syntax)) + return "syntax: string expected"; + return null; + }; + + /** + * Creates a FileDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FileDescriptorProto} FileDescriptorProto + */ + FileDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FileDescriptorProto) + return object; + var message = new $root.google.protobuf.FileDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object["package"] != null) + message["package"] = String(object["package"]); + if (object.dependency) { + if (!Array.isArray(object.dependency)) + throw TypeError(".google.protobuf.FileDescriptorProto.dependency: array expected"); + message.dependency = []; + for (var i = 0; i < object.dependency.length; ++i) + message.dependency[i] = String(object.dependency[i]); + } + if (object.publicDependency) { + if (!Array.isArray(object.publicDependency)) + throw TypeError(".google.protobuf.FileDescriptorProto.publicDependency: array expected"); + message.publicDependency = []; + for (var i = 0; i < object.publicDependency.length; ++i) + message.publicDependency[i] = object.publicDependency[i] | 0; + } + if (object.weakDependency) { + if (!Array.isArray(object.weakDependency)) + throw TypeError(".google.protobuf.FileDescriptorProto.weakDependency: array expected"); + message.weakDependency = []; + for (var i = 0; i < object.weakDependency.length; ++i) + message.weakDependency[i] = object.weakDependency[i] | 0; + } + if (object.messageType) { + if (!Array.isArray(object.messageType)) + throw TypeError(".google.protobuf.FileDescriptorProto.messageType: array expected"); + message.messageType = []; + for (var i = 0; i < object.messageType.length; ++i) { + if (typeof object.messageType[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.messageType: object expected"); + message.messageType[i] = $root.google.protobuf.DescriptorProto.fromObject(object.messageType[i]); + } + } + if (object.enumType) { + if (!Array.isArray(object.enumType)) + throw TypeError(".google.protobuf.FileDescriptorProto.enumType: array expected"); + message.enumType = []; + for (var i = 0; i < object.enumType.length; ++i) { + if (typeof object.enumType[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.enumType: object expected"); + message.enumType[i] = $root.google.protobuf.EnumDescriptorProto.fromObject(object.enumType[i]); + } + } + if (object.service) { + if (!Array.isArray(object.service)) + throw TypeError(".google.protobuf.FileDescriptorProto.service: array expected"); + message.service = []; + for (var i = 0; i < object.service.length; ++i) { + if (typeof object.service[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.service: object expected"); + message.service[i] = $root.google.protobuf.ServiceDescriptorProto.fromObject(object.service[i]); + } + } + if (object.extension) { + if (!Array.isArray(object.extension)) + throw TypeError(".google.protobuf.FileDescriptorProto.extension: array expected"); + message.extension = []; + for (var i = 0; i < object.extension.length; ++i) { + if (typeof object.extension[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.extension: object expected"); + message.extension[i] = $root.google.protobuf.FieldDescriptorProto.fromObject(object.extension[i]); + } + } + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.FileOptions.fromObject(object.options); + } + if (object.sourceCodeInfo != null) { + if (typeof object.sourceCodeInfo !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.sourceCodeInfo: object expected"); + message.sourceCodeInfo = $root.google.protobuf.SourceCodeInfo.fromObject(object.sourceCodeInfo); + } + if (object.syntax != null) + message.syntax = String(object.syntax); + return message; + }; + + /** + * Creates a plain object from a FileDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {google.protobuf.FileDescriptorProto} message FileDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FileDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.dependency = []; + object.messageType = []; + object.enumType = []; + object.service = []; + object.extension = []; + object.publicDependency = []; + object.weakDependency = []; + } + if (options.defaults) { + object.name = ""; + object["package"] = ""; + object.options = null; + object.sourceCodeInfo = null; + object.syntax = ""; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message["package"] != null && message.hasOwnProperty("package")) + object["package"] = message["package"]; + if (message.dependency && message.dependency.length) { + object.dependency = []; + for (var j = 0; j < message.dependency.length; ++j) + object.dependency[j] = message.dependency[j]; + } + if (message.messageType && message.messageType.length) { + object.messageType = []; + for (var j = 0; j < message.messageType.length; ++j) + object.messageType[j] = $root.google.protobuf.DescriptorProto.toObject(message.messageType[j], options); + } + if (message.enumType && message.enumType.length) { + object.enumType = []; + for (var j = 0; j < message.enumType.length; ++j) + object.enumType[j] = $root.google.protobuf.EnumDescriptorProto.toObject(message.enumType[j], options); + } + if (message.service && message.service.length) { + object.service = []; + for (var j = 0; j < message.service.length; ++j) + object.service[j] = $root.google.protobuf.ServiceDescriptorProto.toObject(message.service[j], options); + } + if (message.extension && message.extension.length) { + object.extension = []; + for (var j = 0; j < message.extension.length; ++j) + object.extension[j] = $root.google.protobuf.FieldDescriptorProto.toObject(message.extension[j], options); + } + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.FileOptions.toObject(message.options, options); + if (message.sourceCodeInfo != null && message.hasOwnProperty("sourceCodeInfo")) + object.sourceCodeInfo = $root.google.protobuf.SourceCodeInfo.toObject(message.sourceCodeInfo, options); + if (message.publicDependency && message.publicDependency.length) { + object.publicDependency = []; + for (var j = 0; j < message.publicDependency.length; ++j) + object.publicDependency[j] = message.publicDependency[j]; + } + if (message.weakDependency && message.weakDependency.length) { + object.weakDependency = []; + for (var j = 0; j < message.weakDependency.length; ++j) + object.weakDependency[j] = message.weakDependency[j]; + } + if (message.syntax != null && message.hasOwnProperty("syntax")) + object.syntax = message.syntax; + return object; + }; + + /** + * Converts this FileDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.FileDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + FileDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return FileDescriptorProto; + })(); + + protobuf.DescriptorProto = (function() { + + /** + * Properties of a DescriptorProto. + * @memberof google.protobuf + * @interface IDescriptorProto + * @property {string|null} [name] DescriptorProto name + * @property {Array.|null} [field] DescriptorProto field + * @property {Array.|null} [extension] DescriptorProto extension + * @property {Array.|null} [nestedType] DescriptorProto nestedType + * @property {Array.|null} [enumType] DescriptorProto enumType + * @property {Array.|null} [extensionRange] DescriptorProto extensionRange + * @property {Array.|null} [oneofDecl] DescriptorProto oneofDecl + * @property {google.protobuf.IMessageOptions|null} [options] DescriptorProto options + * @property {Array.|null} [reservedRange] DescriptorProto reservedRange + * @property {Array.|null} [reservedName] DescriptorProto reservedName + */ + + /** + * Constructs a new DescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a DescriptorProto. + * @implements IDescriptorProto + * @constructor + * @param {google.protobuf.IDescriptorProto=} [properties] Properties to set + */ + function DescriptorProto(properties) { + this.field = []; + this.extension = []; + this.nestedType = []; + this.enumType = []; + this.extensionRange = []; + this.oneofDecl = []; + this.reservedRange = []; + this.reservedName = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * DescriptorProto name. + * @member {string} name + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.name = ""; + + /** + * DescriptorProto field. + * @member {Array.} field + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.field = $util.emptyArray; + + /** + * DescriptorProto extension. + * @member {Array.} extension + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.extension = $util.emptyArray; + + /** + * DescriptorProto nestedType. + * @member {Array.} nestedType + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.nestedType = $util.emptyArray; + + /** + * DescriptorProto enumType. + * @member {Array.} enumType + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.enumType = $util.emptyArray; + + /** + * DescriptorProto extensionRange. + * @member {Array.} extensionRange + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.extensionRange = $util.emptyArray; + + /** + * DescriptorProto oneofDecl. + * @member {Array.} oneofDecl + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.oneofDecl = $util.emptyArray; + + /** + * DescriptorProto options. + * @member {google.protobuf.IMessageOptions|null|undefined} options + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.options = null; + + /** + * DescriptorProto reservedRange. + * @member {Array.} reservedRange + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.reservedRange = $util.emptyArray; + + /** + * DescriptorProto reservedName. + * @member {Array.} reservedName + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.reservedName = $util.emptyArray; + + /** + * Creates a new DescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.DescriptorProto + * @static + * @param {google.protobuf.IDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.DescriptorProto} DescriptorProto instance + */ + DescriptorProto.create = function create(properties) { + return new DescriptorProto(properties); + }; + + /** + * Encodes the specified DescriptorProto message. Does not implicitly {@link google.protobuf.DescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.DescriptorProto + * @static + * @param {google.protobuf.IDescriptorProto} message DescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + DescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.field != null && message.field.length) + for (var i = 0; i < message.field.length; ++i) + $root.google.protobuf.FieldDescriptorProto.encode(message.field[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.nestedType != null && message.nestedType.length) + for (var i = 0; i < message.nestedType.length; ++i) + $root.google.protobuf.DescriptorProto.encode(message.nestedType[i], writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + if (message.enumType != null && message.enumType.length) + for (var i = 0; i < message.enumType.length; ++i) + $root.google.protobuf.EnumDescriptorProto.encode(message.enumType[i], writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.extensionRange != null && message.extensionRange.length) + for (var i = 0; i < message.extensionRange.length; ++i) + $root.google.protobuf.DescriptorProto.ExtensionRange.encode(message.extensionRange[i], writer.uint32(/* id 5, wireType 2 =*/42).fork()).ldelim(); + if (message.extension != null && message.extension.length) + for (var i = 0; i < message.extension.length; ++i) + $root.google.protobuf.FieldDescriptorProto.encode(message.extension[i], writer.uint32(/* id 6, wireType 2 =*/50).fork()).ldelim(); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.MessageOptions.encode(message.options, writer.uint32(/* id 7, wireType 2 =*/58).fork()).ldelim(); + if (message.oneofDecl != null && message.oneofDecl.length) + for (var i = 0; i < message.oneofDecl.length; ++i) + $root.google.protobuf.OneofDescriptorProto.encode(message.oneofDecl[i], writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.reservedRange != null && message.reservedRange.length) + for (var i = 0; i < message.reservedRange.length; ++i) + $root.google.protobuf.DescriptorProto.ReservedRange.encode(message.reservedRange[i], writer.uint32(/* id 9, wireType 2 =*/74).fork()).ldelim(); + if (message.reservedName != null && message.reservedName.length) + for (var i = 0; i < message.reservedName.length; ++i) + writer.uint32(/* id 10, wireType 2 =*/82).string(message.reservedName[i]); + return writer; + }; + + /** + * Encodes the specified DescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.DescriptorProto + * @static + * @param {google.protobuf.IDescriptorProto} message DescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + DescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a DescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.DescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.DescriptorProto} DescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + DescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.DescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 2: + if (!(message.field && message.field.length)) + message.field = []; + message.field.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + case 6: + if (!(message.extension && message.extension.length)) + message.extension = []; + message.extension.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + case 3: + if (!(message.nestedType && message.nestedType.length)) + message.nestedType = []; + message.nestedType.push($root.google.protobuf.DescriptorProto.decode(reader, reader.uint32())); + break; + case 4: + if (!(message.enumType && message.enumType.length)) + message.enumType = []; + message.enumType.push($root.google.protobuf.EnumDescriptorProto.decode(reader, reader.uint32())); + break; + case 5: + if (!(message.extensionRange && message.extensionRange.length)) + message.extensionRange = []; + message.extensionRange.push($root.google.protobuf.DescriptorProto.ExtensionRange.decode(reader, reader.uint32())); + break; + case 8: + if (!(message.oneofDecl && message.oneofDecl.length)) + message.oneofDecl = []; + message.oneofDecl.push($root.google.protobuf.OneofDescriptorProto.decode(reader, reader.uint32())); + break; + case 7: + message.options = $root.google.protobuf.MessageOptions.decode(reader, reader.uint32()); + break; + case 9: + if (!(message.reservedRange && message.reservedRange.length)) + message.reservedRange = []; + message.reservedRange.push($root.google.protobuf.DescriptorProto.ReservedRange.decode(reader, reader.uint32())); + break; + case 10: + if (!(message.reservedName && message.reservedName.length)) + message.reservedName = []; + message.reservedName.push(reader.string()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a DescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.DescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.DescriptorProto} DescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + DescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a DescriptorProto message. + * @function verify + * @memberof google.protobuf.DescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + DescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.field != null && message.hasOwnProperty("field")) { + if (!Array.isArray(message.field)) + return "field: array expected"; + for (var i = 0; i < message.field.length; ++i) { + var error = $root.google.protobuf.FieldDescriptorProto.verify(message.field[i]); + if (error) + return "field." + error; + } + } + if (message.extension != null && message.hasOwnProperty("extension")) { + if (!Array.isArray(message.extension)) + return "extension: array expected"; + for (var i = 0; i < message.extension.length; ++i) { + var error = $root.google.protobuf.FieldDescriptorProto.verify(message.extension[i]); + if (error) + return "extension." + error; + } + } + if (message.nestedType != null && message.hasOwnProperty("nestedType")) { + if (!Array.isArray(message.nestedType)) + return "nestedType: array expected"; + for (var i = 0; i < message.nestedType.length; ++i) { + var error = $root.google.protobuf.DescriptorProto.verify(message.nestedType[i]); + if (error) + return "nestedType." + error; + } + } + if (message.enumType != null && message.hasOwnProperty("enumType")) { + if (!Array.isArray(message.enumType)) + return "enumType: array expected"; + for (var i = 0; i < message.enumType.length; ++i) { + var error = $root.google.protobuf.EnumDescriptorProto.verify(message.enumType[i]); + if (error) + return "enumType." + error; + } + } + if (message.extensionRange != null && message.hasOwnProperty("extensionRange")) { + if (!Array.isArray(message.extensionRange)) + return "extensionRange: array expected"; + for (var i = 0; i < message.extensionRange.length; ++i) { + var error = $root.google.protobuf.DescriptorProto.ExtensionRange.verify(message.extensionRange[i]); + if (error) + return "extensionRange." + error; + } + } + if (message.oneofDecl != null && message.hasOwnProperty("oneofDecl")) { + if (!Array.isArray(message.oneofDecl)) + return "oneofDecl: array expected"; + for (var i = 0; i < message.oneofDecl.length; ++i) { + var error = $root.google.protobuf.OneofDescriptorProto.verify(message.oneofDecl[i]); + if (error) + return "oneofDecl." + error; + } + } + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.MessageOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.reservedRange != null && message.hasOwnProperty("reservedRange")) { + if (!Array.isArray(message.reservedRange)) + return "reservedRange: array expected"; + for (var i = 0; i < message.reservedRange.length; ++i) { + var error = $root.google.protobuf.DescriptorProto.ReservedRange.verify(message.reservedRange[i]); + if (error) + return "reservedRange." + error; + } + } + if (message.reservedName != null && message.hasOwnProperty("reservedName")) { + if (!Array.isArray(message.reservedName)) + return "reservedName: array expected"; + for (var i = 0; i < message.reservedName.length; ++i) + if (!$util.isString(message.reservedName[i])) + return "reservedName: string[] expected"; + } + return null; + }; + + /** + * Creates a DescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.DescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.DescriptorProto} DescriptorProto + */ + DescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.DescriptorProto) + return object; + var message = new $root.google.protobuf.DescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.field) { + if (!Array.isArray(object.field)) + throw TypeError(".google.protobuf.DescriptorProto.field: array expected"); + message.field = []; + for (var i = 0; i < object.field.length; ++i) { + if (typeof object.field[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.field: object expected"); + message.field[i] = $root.google.protobuf.FieldDescriptorProto.fromObject(object.field[i]); + } + } + if (object.extension) { + if (!Array.isArray(object.extension)) + throw TypeError(".google.protobuf.DescriptorProto.extension: array expected"); + message.extension = []; + for (var i = 0; i < object.extension.length; ++i) { + if (typeof object.extension[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.extension: object expected"); + message.extension[i] = $root.google.protobuf.FieldDescriptorProto.fromObject(object.extension[i]); + } + } + if (object.nestedType) { + if (!Array.isArray(object.nestedType)) + throw TypeError(".google.protobuf.DescriptorProto.nestedType: array expected"); + message.nestedType = []; + for (var i = 0; i < object.nestedType.length; ++i) { + if (typeof object.nestedType[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.nestedType: object expected"); + message.nestedType[i] = $root.google.protobuf.DescriptorProto.fromObject(object.nestedType[i]); + } + } + if (object.enumType) { + if (!Array.isArray(object.enumType)) + throw TypeError(".google.protobuf.DescriptorProto.enumType: array expected"); + message.enumType = []; + for (var i = 0; i < object.enumType.length; ++i) { + if (typeof object.enumType[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.enumType: object expected"); + message.enumType[i] = $root.google.protobuf.EnumDescriptorProto.fromObject(object.enumType[i]); + } + } + if (object.extensionRange) { + if (!Array.isArray(object.extensionRange)) + throw TypeError(".google.protobuf.DescriptorProto.extensionRange: array expected"); + message.extensionRange = []; + for (var i = 0; i < object.extensionRange.length; ++i) { + if (typeof object.extensionRange[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.extensionRange: object expected"); + message.extensionRange[i] = $root.google.protobuf.DescriptorProto.ExtensionRange.fromObject(object.extensionRange[i]); + } + } + if (object.oneofDecl) { + if (!Array.isArray(object.oneofDecl)) + throw TypeError(".google.protobuf.DescriptorProto.oneofDecl: array expected"); + message.oneofDecl = []; + for (var i = 0; i < object.oneofDecl.length; ++i) { + if (typeof object.oneofDecl[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.oneofDecl: object expected"); + message.oneofDecl[i] = $root.google.protobuf.OneofDescriptorProto.fromObject(object.oneofDecl[i]); + } + } + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.DescriptorProto.options: object expected"); + message.options = $root.google.protobuf.MessageOptions.fromObject(object.options); + } + if (object.reservedRange) { + if (!Array.isArray(object.reservedRange)) + throw TypeError(".google.protobuf.DescriptorProto.reservedRange: array expected"); + message.reservedRange = []; + for (var i = 0; i < object.reservedRange.length; ++i) { + if (typeof object.reservedRange[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.reservedRange: object expected"); + message.reservedRange[i] = $root.google.protobuf.DescriptorProto.ReservedRange.fromObject(object.reservedRange[i]); + } + } + if (object.reservedName) { + if (!Array.isArray(object.reservedName)) + throw TypeError(".google.protobuf.DescriptorProto.reservedName: array expected"); + message.reservedName = []; + for (var i = 0; i < object.reservedName.length; ++i) + message.reservedName[i] = String(object.reservedName[i]); + } + return message; + }; + + /** + * Creates a plain object from a DescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.DescriptorProto + * @static + * @param {google.protobuf.DescriptorProto} message DescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + DescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.field = []; + object.nestedType = []; + object.enumType = []; + object.extensionRange = []; + object.extension = []; + object.oneofDecl = []; + object.reservedRange = []; + object.reservedName = []; + } + if (options.defaults) { + object.name = ""; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.field && message.field.length) { + object.field = []; + for (var j = 0; j < message.field.length; ++j) + object.field[j] = $root.google.protobuf.FieldDescriptorProto.toObject(message.field[j], options); + } + if (message.nestedType && message.nestedType.length) { + object.nestedType = []; + for (var j = 0; j < message.nestedType.length; ++j) + object.nestedType[j] = $root.google.protobuf.DescriptorProto.toObject(message.nestedType[j], options); + } + if (message.enumType && message.enumType.length) { + object.enumType = []; + for (var j = 0; j < message.enumType.length; ++j) + object.enumType[j] = $root.google.protobuf.EnumDescriptorProto.toObject(message.enumType[j], options); + } + if (message.extensionRange && message.extensionRange.length) { + object.extensionRange = []; + for (var j = 0; j < message.extensionRange.length; ++j) + object.extensionRange[j] = $root.google.protobuf.DescriptorProto.ExtensionRange.toObject(message.extensionRange[j], options); + } + if (message.extension && message.extension.length) { + object.extension = []; + for (var j = 0; j < message.extension.length; ++j) + object.extension[j] = $root.google.protobuf.FieldDescriptorProto.toObject(message.extension[j], options); + } + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.MessageOptions.toObject(message.options, options); + if (message.oneofDecl && message.oneofDecl.length) { + object.oneofDecl = []; + for (var j = 0; j < message.oneofDecl.length; ++j) + object.oneofDecl[j] = $root.google.protobuf.OneofDescriptorProto.toObject(message.oneofDecl[j], options); + } + if (message.reservedRange && message.reservedRange.length) { + object.reservedRange = []; + for (var j = 0; j < message.reservedRange.length; ++j) + object.reservedRange[j] = $root.google.protobuf.DescriptorProto.ReservedRange.toObject(message.reservedRange[j], options); + } + if (message.reservedName && message.reservedName.length) { + object.reservedName = []; + for (var j = 0; j < message.reservedName.length; ++j) + object.reservedName[j] = message.reservedName[j]; + } + return object; + }; + + /** + * Converts this DescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.DescriptorProto + * @instance + * @returns {Object.} JSON object + */ + DescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + DescriptorProto.ExtensionRange = (function() { + + /** + * Properties of an ExtensionRange. + * @memberof google.protobuf.DescriptorProto + * @interface IExtensionRange + * @property {number|null} [start] ExtensionRange start + * @property {number|null} [end] ExtensionRange end + * @property {google.protobuf.IExtensionRangeOptions|null} [options] ExtensionRange options + */ + + /** + * Constructs a new ExtensionRange. + * @memberof google.protobuf.DescriptorProto + * @classdesc Represents an ExtensionRange. + * @implements IExtensionRange + * @constructor + * @param {google.protobuf.DescriptorProto.IExtensionRange=} [properties] Properties to set + */ + function ExtensionRange(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ExtensionRange start. + * @member {number} start + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @instance + */ + ExtensionRange.prototype.start = 0; + + /** + * ExtensionRange end. + * @member {number} end + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @instance + */ + ExtensionRange.prototype.end = 0; + + /** + * ExtensionRange options. + * @member {google.protobuf.IExtensionRangeOptions|null|undefined} options + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @instance + */ + ExtensionRange.prototype.options = null; + + /** + * Creates a new ExtensionRange instance using the specified properties. + * @function create + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {google.protobuf.DescriptorProto.IExtensionRange=} [properties] Properties to set + * @returns {google.protobuf.DescriptorProto.ExtensionRange} ExtensionRange instance + */ + ExtensionRange.create = function create(properties) { + return new ExtensionRange(properties); + }; + + /** + * Encodes the specified ExtensionRange message. Does not implicitly {@link google.protobuf.DescriptorProto.ExtensionRange.verify|verify} messages. + * @function encode + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {google.protobuf.DescriptorProto.IExtensionRange} message ExtensionRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ExtensionRange.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.start != null && Object.hasOwnProperty.call(message, "start")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.start); + if (message.end != null && Object.hasOwnProperty.call(message, "end")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.end); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.ExtensionRangeOptions.encode(message.options, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified ExtensionRange message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.ExtensionRange.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {google.protobuf.DescriptorProto.IExtensionRange} message ExtensionRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ExtensionRange.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an ExtensionRange message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.DescriptorProto.ExtensionRange} ExtensionRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ExtensionRange.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.DescriptorProto.ExtensionRange(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.start = reader.int32(); + break; + case 2: + message.end = reader.int32(); + break; + case 3: + message.options = $root.google.protobuf.ExtensionRangeOptions.decode(reader, reader.uint32()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an ExtensionRange message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.DescriptorProto.ExtensionRange} ExtensionRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ExtensionRange.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an ExtensionRange message. + * @function verify + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ExtensionRange.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.start != null && message.hasOwnProperty("start")) + if (!$util.isInteger(message.start)) + return "start: integer expected"; + if (message.end != null && message.hasOwnProperty("end")) + if (!$util.isInteger(message.end)) + return "end: integer expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.ExtensionRangeOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates an ExtensionRange message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.DescriptorProto.ExtensionRange} ExtensionRange + */ + ExtensionRange.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.DescriptorProto.ExtensionRange) + return object; + var message = new $root.google.protobuf.DescriptorProto.ExtensionRange(); + if (object.start != null) + message.start = object.start | 0; + if (object.end != null) + message.end = object.end | 0; + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.DescriptorProto.ExtensionRange.options: object expected"); + message.options = $root.google.protobuf.ExtensionRangeOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from an ExtensionRange message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {google.protobuf.DescriptorProto.ExtensionRange} message ExtensionRange + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ExtensionRange.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.start = 0; + object.end = 0; + object.options = null; + } + if (message.start != null && message.hasOwnProperty("start")) + object.start = message.start; + if (message.end != null && message.hasOwnProperty("end")) + object.end = message.end; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.ExtensionRangeOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this ExtensionRange to JSON. + * @function toJSON + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @instance + * @returns {Object.} JSON object + */ + ExtensionRange.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return ExtensionRange; + })(); + + DescriptorProto.ReservedRange = (function() { + + /** + * Properties of a ReservedRange. + * @memberof google.protobuf.DescriptorProto + * @interface IReservedRange + * @property {number|null} [start] ReservedRange start + * @property {number|null} [end] ReservedRange end + */ + + /** + * Constructs a new ReservedRange. + * @memberof google.protobuf.DescriptorProto + * @classdesc Represents a ReservedRange. + * @implements IReservedRange + * @constructor + * @param {google.protobuf.DescriptorProto.IReservedRange=} [properties] Properties to set + */ + function ReservedRange(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ReservedRange start. + * @member {number} start + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @instance + */ + ReservedRange.prototype.start = 0; + + /** + * ReservedRange end. + * @member {number} end + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @instance + */ + ReservedRange.prototype.end = 0; + + /** + * Creates a new ReservedRange instance using the specified properties. + * @function create + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {google.protobuf.DescriptorProto.IReservedRange=} [properties] Properties to set + * @returns {google.protobuf.DescriptorProto.ReservedRange} ReservedRange instance + */ + ReservedRange.create = function create(properties) { + return new ReservedRange(properties); + }; + + /** + * Encodes the specified ReservedRange message. Does not implicitly {@link google.protobuf.DescriptorProto.ReservedRange.verify|verify} messages. + * @function encode + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {google.protobuf.DescriptorProto.IReservedRange} message ReservedRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ReservedRange.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.start != null && Object.hasOwnProperty.call(message, "start")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.start); + if (message.end != null && Object.hasOwnProperty.call(message, "end")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.end); + return writer; + }; + + /** + * Encodes the specified ReservedRange message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.ReservedRange.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {google.protobuf.DescriptorProto.IReservedRange} message ReservedRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ReservedRange.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ReservedRange message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.DescriptorProto.ReservedRange} ReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ReservedRange.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.DescriptorProto.ReservedRange(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.start = reader.int32(); + break; + case 2: + message.end = reader.int32(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ReservedRange message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.DescriptorProto.ReservedRange} ReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ReservedRange.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ReservedRange message. + * @function verify + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ReservedRange.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.start != null && message.hasOwnProperty("start")) + if (!$util.isInteger(message.start)) + return "start: integer expected"; + if (message.end != null && message.hasOwnProperty("end")) + if (!$util.isInteger(message.end)) + return "end: integer expected"; + return null; + }; + + /** + * Creates a ReservedRange message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.DescriptorProto.ReservedRange} ReservedRange + */ + ReservedRange.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.DescriptorProto.ReservedRange) + return object; + var message = new $root.google.protobuf.DescriptorProto.ReservedRange(); + if (object.start != null) + message.start = object.start | 0; + if (object.end != null) + message.end = object.end | 0; + return message; + }; + + /** + * Creates a plain object from a ReservedRange message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {google.protobuf.DescriptorProto.ReservedRange} message ReservedRange + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ReservedRange.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.start = 0; + object.end = 0; + } + if (message.start != null && message.hasOwnProperty("start")) + object.start = message.start; + if (message.end != null && message.hasOwnProperty("end")) + object.end = message.end; + return object; + }; + + /** + * Converts this ReservedRange to JSON. + * @function toJSON + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @instance + * @returns {Object.} JSON object + */ + ReservedRange.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return ReservedRange; + })(); + + return DescriptorProto; + })(); + + protobuf.ExtensionRangeOptions = (function() { + + /** + * Properties of an ExtensionRangeOptions. + * @memberof google.protobuf + * @interface IExtensionRangeOptions + * @property {Array.|null} [uninterpretedOption] ExtensionRangeOptions uninterpretedOption + */ + + /** + * Constructs a new ExtensionRangeOptions. + * @memberof google.protobuf + * @classdesc Represents an ExtensionRangeOptions. + * @implements IExtensionRangeOptions + * @constructor + * @param {google.protobuf.IExtensionRangeOptions=} [properties] Properties to set + */ + function ExtensionRangeOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ExtensionRangeOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.ExtensionRangeOptions + * @instance + */ + ExtensionRangeOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * Creates a new ExtensionRangeOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {google.protobuf.IExtensionRangeOptions=} [properties] Properties to set + * @returns {google.protobuf.ExtensionRangeOptions} ExtensionRangeOptions instance + */ + ExtensionRangeOptions.create = function create(properties) { + return new ExtensionRangeOptions(properties); + }; + + /** + * Encodes the specified ExtensionRangeOptions message. Does not implicitly {@link google.protobuf.ExtensionRangeOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {google.protobuf.IExtensionRangeOptions} message ExtensionRangeOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ExtensionRangeOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified ExtensionRangeOptions message, length delimited. Does not implicitly {@link google.protobuf.ExtensionRangeOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {google.protobuf.IExtensionRangeOptions} message ExtensionRangeOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ExtensionRangeOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an ExtensionRangeOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.ExtensionRangeOptions} ExtensionRangeOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ExtensionRangeOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.ExtensionRangeOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an ExtensionRangeOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.ExtensionRangeOptions} ExtensionRangeOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ExtensionRangeOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an ExtensionRangeOptions message. + * @function verify + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ExtensionRangeOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + return null; + }; + + /** + * Creates an ExtensionRangeOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.ExtensionRangeOptions} ExtensionRangeOptions + */ + ExtensionRangeOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.ExtensionRangeOptions) + return object; + var message = new $root.google.protobuf.ExtensionRangeOptions(); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.ExtensionRangeOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.ExtensionRangeOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an ExtensionRangeOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {google.protobuf.ExtensionRangeOptions} message ExtensionRangeOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ExtensionRangeOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + return object; + }; + + /** + * Converts this ExtensionRangeOptions to JSON. + * @function toJSON + * @memberof google.protobuf.ExtensionRangeOptions + * @instance + * @returns {Object.} JSON object + */ + ExtensionRangeOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return ExtensionRangeOptions; + })(); + + protobuf.FieldDescriptorProto = (function() { + + /** + * Properties of a FieldDescriptorProto. + * @memberof google.protobuf + * @interface IFieldDescriptorProto + * @property {string|null} [name] FieldDescriptorProto name + * @property {number|null} [number] FieldDescriptorProto number + * @property {google.protobuf.FieldDescriptorProto.Label|null} [label] FieldDescriptorProto label + * @property {google.protobuf.FieldDescriptorProto.Type|null} [type] FieldDescriptorProto type + * @property {string|null} [typeName] FieldDescriptorProto typeName + * @property {string|null} [extendee] FieldDescriptorProto extendee + * @property {string|null} [defaultValue] FieldDescriptorProto defaultValue + * @property {number|null} [oneofIndex] FieldDescriptorProto oneofIndex + * @property {string|null} [jsonName] FieldDescriptorProto jsonName + * @property {google.protobuf.IFieldOptions|null} [options] FieldDescriptorProto options + * @property {boolean|null} [proto3Optional] FieldDescriptorProto proto3Optional + */ + + /** + * Constructs a new FieldDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a FieldDescriptorProto. + * @implements IFieldDescriptorProto + * @constructor + * @param {google.protobuf.IFieldDescriptorProto=} [properties] Properties to set + */ + function FieldDescriptorProto(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FieldDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.name = ""; + + /** + * FieldDescriptorProto number. + * @member {number} number + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.number = 0; + + /** + * FieldDescriptorProto label. + * @member {google.protobuf.FieldDescriptorProto.Label} label + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.label = 1; + + /** + * FieldDescriptorProto type. + * @member {google.protobuf.FieldDescriptorProto.Type} type + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.type = 1; + + /** + * FieldDescriptorProto typeName. + * @member {string} typeName + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.typeName = ""; + + /** + * FieldDescriptorProto extendee. + * @member {string} extendee + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.extendee = ""; + + /** + * FieldDescriptorProto defaultValue. + * @member {string} defaultValue + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.defaultValue = ""; + + /** + * FieldDescriptorProto oneofIndex. + * @member {number} oneofIndex + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.oneofIndex = 0; + + /** + * FieldDescriptorProto jsonName. + * @member {string} jsonName + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.jsonName = ""; + + /** + * FieldDescriptorProto options. + * @member {google.protobuf.IFieldOptions|null|undefined} options + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.options = null; + + /** + * FieldDescriptorProto proto3Optional. + * @member {boolean} proto3Optional + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.proto3Optional = false; + + /** + * Creates a new FieldDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {google.protobuf.IFieldDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.FieldDescriptorProto} FieldDescriptorProto instance + */ + FieldDescriptorProto.create = function create(properties) { + return new FieldDescriptorProto(properties); + }; + + /** + * Encodes the specified FieldDescriptorProto message. Does not implicitly {@link google.protobuf.FieldDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {google.protobuf.IFieldDescriptorProto} message FieldDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.extendee != null && Object.hasOwnProperty.call(message, "extendee")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.extendee); + if (message.number != null && Object.hasOwnProperty.call(message, "number")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.number); + if (message.label != null && Object.hasOwnProperty.call(message, "label")) + writer.uint32(/* id 4, wireType 0 =*/32).int32(message.label); + if (message.type != null && Object.hasOwnProperty.call(message, "type")) + writer.uint32(/* id 5, wireType 0 =*/40).int32(message.type); + if (message.typeName != null && Object.hasOwnProperty.call(message, "typeName")) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.typeName); + if (message.defaultValue != null && Object.hasOwnProperty.call(message, "defaultValue")) + writer.uint32(/* id 7, wireType 2 =*/58).string(message.defaultValue); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.FieldOptions.encode(message.options, writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.oneofIndex != null && Object.hasOwnProperty.call(message, "oneofIndex")) + writer.uint32(/* id 9, wireType 0 =*/72).int32(message.oneofIndex); + if (message.jsonName != null && Object.hasOwnProperty.call(message, "jsonName")) + writer.uint32(/* id 10, wireType 2 =*/82).string(message.jsonName); + if (message.proto3Optional != null && Object.hasOwnProperty.call(message, "proto3Optional")) + writer.uint32(/* id 17, wireType 0 =*/136).bool(message.proto3Optional); + return writer; + }; + + /** + * Encodes the specified FieldDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.FieldDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {google.protobuf.IFieldDescriptorProto} message FieldDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FieldDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FieldDescriptorProto} FieldDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FieldDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 3: + message.number = reader.int32(); + break; + case 4: + message.label = reader.int32(); + break; + case 5: + message.type = reader.int32(); + break; + case 6: + message.typeName = reader.string(); + break; + case 2: + message.extendee = reader.string(); + break; + case 7: + message.defaultValue = reader.string(); + break; + case 9: + message.oneofIndex = reader.int32(); + break; + case 10: + message.jsonName = reader.string(); + break; + case 8: + message.options = $root.google.protobuf.FieldOptions.decode(reader, reader.uint32()); + break; + case 17: + message.proto3Optional = reader.bool(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FieldDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FieldDescriptorProto} FieldDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FieldDescriptorProto message. + * @function verify + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FieldDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.number != null && message.hasOwnProperty("number")) + if (!$util.isInteger(message.number)) + return "number: integer expected"; + if (message.label != null && message.hasOwnProperty("label")) + switch (message.label) { + default: + return "label: enum value expected"; + case 1: + case 2: + case 3: + break; + } + if (message.type != null && message.hasOwnProperty("type")) + switch (message.type) { + default: + return "type: enum value expected"; + case 1: + case 2: + case 3: + case 4: + case 5: + case 6: + case 7: + case 8: + case 9: + case 10: + case 11: + case 12: + case 13: + case 14: + case 15: + case 16: + case 17: + case 18: + break; + } + if (message.typeName != null && message.hasOwnProperty("typeName")) + if (!$util.isString(message.typeName)) + return "typeName: string expected"; + if (message.extendee != null && message.hasOwnProperty("extendee")) + if (!$util.isString(message.extendee)) + return "extendee: string expected"; + if (message.defaultValue != null && message.hasOwnProperty("defaultValue")) + if (!$util.isString(message.defaultValue)) + return "defaultValue: string expected"; + if (message.oneofIndex != null && message.hasOwnProperty("oneofIndex")) + if (!$util.isInteger(message.oneofIndex)) + return "oneofIndex: integer expected"; + if (message.jsonName != null && message.hasOwnProperty("jsonName")) + if (!$util.isString(message.jsonName)) + return "jsonName: string expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.FieldOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.proto3Optional != null && message.hasOwnProperty("proto3Optional")) + if (typeof message.proto3Optional !== "boolean") + return "proto3Optional: boolean expected"; + return null; + }; + + /** + * Creates a FieldDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FieldDescriptorProto} FieldDescriptorProto + */ + FieldDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FieldDescriptorProto) + return object; + var message = new $root.google.protobuf.FieldDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.number != null) + message.number = object.number | 0; + switch (object.label) { + case "LABEL_OPTIONAL": + case 1: + message.label = 1; + break; + case "LABEL_REQUIRED": + case 2: + message.label = 2; + break; + case "LABEL_REPEATED": + case 3: + message.label = 3; + break; + } + switch (object.type) { + case "TYPE_DOUBLE": + case 1: + message.type = 1; + break; + case "TYPE_FLOAT": + case 2: + message.type = 2; + break; + case "TYPE_INT64": + case 3: + message.type = 3; + break; + case "TYPE_UINT64": + case 4: + message.type = 4; + break; + case "TYPE_INT32": + case 5: + message.type = 5; + break; + case "TYPE_FIXED64": + case 6: + message.type = 6; + break; + case "TYPE_FIXED32": + case 7: + message.type = 7; + break; + case "TYPE_BOOL": + case 8: + message.type = 8; + break; + case "TYPE_STRING": + case 9: + message.type = 9; + break; + case "TYPE_GROUP": + case 10: + message.type = 10; + break; + case "TYPE_MESSAGE": + case 11: + message.type = 11; + break; + case "TYPE_BYTES": + case 12: + message.type = 12; + break; + case "TYPE_UINT32": + case 13: + message.type = 13; + break; + case "TYPE_ENUM": + case 14: + message.type = 14; + break; + case "TYPE_SFIXED32": + case 15: + message.type = 15; + break; + case "TYPE_SFIXED64": + case 16: + message.type = 16; + break; + case "TYPE_SINT32": + case 17: + message.type = 17; + break; + case "TYPE_SINT64": + case 18: + message.type = 18; + break; + } + if (object.typeName != null) + message.typeName = String(object.typeName); + if (object.extendee != null) + message.extendee = String(object.extendee); + if (object.defaultValue != null) + message.defaultValue = String(object.defaultValue); + if (object.oneofIndex != null) + message.oneofIndex = object.oneofIndex | 0; + if (object.jsonName != null) + message.jsonName = String(object.jsonName); + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.FieldDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.FieldOptions.fromObject(object.options); + } + if (object.proto3Optional != null) + message.proto3Optional = Boolean(object.proto3Optional); + return message; + }; + + /** + * Creates a plain object from a FieldDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {google.protobuf.FieldDescriptorProto} message FieldDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FieldDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.extendee = ""; + object.number = 0; + object.label = options.enums === String ? "LABEL_OPTIONAL" : 1; + object.type = options.enums === String ? "TYPE_DOUBLE" : 1; + object.typeName = ""; + object.defaultValue = ""; + object.options = null; + object.oneofIndex = 0; + object.jsonName = ""; + object.proto3Optional = false; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.extendee != null && message.hasOwnProperty("extendee")) + object.extendee = message.extendee; + if (message.number != null && message.hasOwnProperty("number")) + object.number = message.number; + if (message.label != null && message.hasOwnProperty("label")) + object.label = options.enums === String ? $root.google.protobuf.FieldDescriptorProto.Label[message.label] : message.label; + if (message.type != null && message.hasOwnProperty("type")) + object.type = options.enums === String ? $root.google.protobuf.FieldDescriptorProto.Type[message.type] : message.type; + if (message.typeName != null && message.hasOwnProperty("typeName")) + object.typeName = message.typeName; + if (message.defaultValue != null && message.hasOwnProperty("defaultValue")) + object.defaultValue = message.defaultValue; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.FieldOptions.toObject(message.options, options); + if (message.oneofIndex != null && message.hasOwnProperty("oneofIndex")) + object.oneofIndex = message.oneofIndex; + if (message.jsonName != null && message.hasOwnProperty("jsonName")) + object.jsonName = message.jsonName; + if (message.proto3Optional != null && message.hasOwnProperty("proto3Optional")) + object.proto3Optional = message.proto3Optional; + return object; + }; + + /** + * Converts this FieldDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.FieldDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + FieldDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Type enum. + * @name google.protobuf.FieldDescriptorProto.Type + * @enum {number} + * @property {number} TYPE_DOUBLE=1 TYPE_DOUBLE value + * @property {number} TYPE_FLOAT=2 TYPE_FLOAT value + * @property {number} TYPE_INT64=3 TYPE_INT64 value + * @property {number} TYPE_UINT64=4 TYPE_UINT64 value + * @property {number} TYPE_INT32=5 TYPE_INT32 value + * @property {number} TYPE_FIXED64=6 TYPE_FIXED64 value + * @property {number} TYPE_FIXED32=7 TYPE_FIXED32 value + * @property {number} TYPE_BOOL=8 TYPE_BOOL value + * @property {number} TYPE_STRING=9 TYPE_STRING value + * @property {number} TYPE_GROUP=10 TYPE_GROUP value + * @property {number} TYPE_MESSAGE=11 TYPE_MESSAGE value + * @property {number} TYPE_BYTES=12 TYPE_BYTES value + * @property {number} TYPE_UINT32=13 TYPE_UINT32 value + * @property {number} TYPE_ENUM=14 TYPE_ENUM value + * @property {number} TYPE_SFIXED32=15 TYPE_SFIXED32 value + * @property {number} TYPE_SFIXED64=16 TYPE_SFIXED64 value + * @property {number} TYPE_SINT32=17 TYPE_SINT32 value + * @property {number} TYPE_SINT64=18 TYPE_SINT64 value + */ + FieldDescriptorProto.Type = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[1] = "TYPE_DOUBLE"] = 1; + values[valuesById[2] = "TYPE_FLOAT"] = 2; + values[valuesById[3] = "TYPE_INT64"] = 3; + values[valuesById[4] = "TYPE_UINT64"] = 4; + values[valuesById[5] = "TYPE_INT32"] = 5; + values[valuesById[6] = "TYPE_FIXED64"] = 6; + values[valuesById[7] = "TYPE_FIXED32"] = 7; + values[valuesById[8] = "TYPE_BOOL"] = 8; + values[valuesById[9] = "TYPE_STRING"] = 9; + values[valuesById[10] = "TYPE_GROUP"] = 10; + values[valuesById[11] = "TYPE_MESSAGE"] = 11; + values[valuesById[12] = "TYPE_BYTES"] = 12; + values[valuesById[13] = "TYPE_UINT32"] = 13; + values[valuesById[14] = "TYPE_ENUM"] = 14; + values[valuesById[15] = "TYPE_SFIXED32"] = 15; + values[valuesById[16] = "TYPE_SFIXED64"] = 16; + values[valuesById[17] = "TYPE_SINT32"] = 17; + values[valuesById[18] = "TYPE_SINT64"] = 18; + return values; + })(); + + /** + * Label enum. + * @name google.protobuf.FieldDescriptorProto.Label + * @enum {number} + * @property {number} LABEL_OPTIONAL=1 LABEL_OPTIONAL value + * @property {number} LABEL_REQUIRED=2 LABEL_REQUIRED value + * @property {number} LABEL_REPEATED=3 LABEL_REPEATED value + */ + FieldDescriptorProto.Label = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[1] = "LABEL_OPTIONAL"] = 1; + values[valuesById[2] = "LABEL_REQUIRED"] = 2; + values[valuesById[3] = "LABEL_REPEATED"] = 3; + return values; + })(); + + return FieldDescriptorProto; + })(); + + protobuf.OneofDescriptorProto = (function() { + + /** + * Properties of an OneofDescriptorProto. + * @memberof google.protobuf + * @interface IOneofDescriptorProto + * @property {string|null} [name] OneofDescriptorProto name + * @property {google.protobuf.IOneofOptions|null} [options] OneofDescriptorProto options + */ + + /** + * Constructs a new OneofDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents an OneofDescriptorProto. + * @implements IOneofDescriptorProto + * @constructor + * @param {google.protobuf.IOneofDescriptorProto=} [properties] Properties to set + */ + function OneofDescriptorProto(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * OneofDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.OneofDescriptorProto + * @instance + */ + OneofDescriptorProto.prototype.name = ""; + + /** + * OneofDescriptorProto options. + * @member {google.protobuf.IOneofOptions|null|undefined} options + * @memberof google.protobuf.OneofDescriptorProto + * @instance + */ + OneofDescriptorProto.prototype.options = null; + + /** + * Creates a new OneofDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {google.protobuf.IOneofDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.OneofDescriptorProto} OneofDescriptorProto instance + */ + OneofDescriptorProto.create = function create(properties) { + return new OneofDescriptorProto(properties); + }; + + /** + * Encodes the specified OneofDescriptorProto message. Does not implicitly {@link google.protobuf.OneofDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {google.protobuf.IOneofDescriptorProto} message OneofDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + OneofDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.OneofOptions.encode(message.options, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified OneofDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.OneofDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {google.protobuf.IOneofDescriptorProto} message OneofDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + OneofDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an OneofDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.OneofDescriptorProto} OneofDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + OneofDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.OneofDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 2: + message.options = $root.google.protobuf.OneofOptions.decode(reader, reader.uint32()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an OneofDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.OneofDescriptorProto} OneofDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + OneofDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an OneofDescriptorProto message. + * @function verify + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + OneofDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.OneofOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates an OneofDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.OneofDescriptorProto} OneofDescriptorProto + */ + OneofDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.OneofDescriptorProto) + return object; + var message = new $root.google.protobuf.OneofDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.OneofDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.OneofOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from an OneofDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {google.protobuf.OneofDescriptorProto} message OneofDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + OneofDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.OneofOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this OneofDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.OneofDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + OneofDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return OneofDescriptorProto; + })(); + + protobuf.EnumDescriptorProto = (function() { + + /** + * Properties of an EnumDescriptorProto. + * @memberof google.protobuf + * @interface IEnumDescriptorProto + * @property {string|null} [name] EnumDescriptorProto name + * @property {Array.|null} [value] EnumDescriptorProto value + * @property {google.protobuf.IEnumOptions|null} [options] EnumDescriptorProto options + * @property {Array.|null} [reservedRange] EnumDescriptorProto reservedRange + * @property {Array.|null} [reservedName] EnumDescriptorProto reservedName + */ + + /** + * Constructs a new EnumDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents an EnumDescriptorProto. + * @implements IEnumDescriptorProto + * @constructor + * @param {google.protobuf.IEnumDescriptorProto=} [properties] Properties to set + */ + function EnumDescriptorProto(properties) { + this.value = []; + this.reservedRange = []; + this.reservedName = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.name = ""; + + /** + * EnumDescriptorProto value. + * @member {Array.} value + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.value = $util.emptyArray; + + /** + * EnumDescriptorProto options. + * @member {google.protobuf.IEnumOptions|null|undefined} options + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.options = null; + + /** + * EnumDescriptorProto reservedRange. + * @member {Array.} reservedRange + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.reservedRange = $util.emptyArray; + + /** + * EnumDescriptorProto reservedName. + * @member {Array.} reservedName + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.reservedName = $util.emptyArray; + + /** + * Creates a new EnumDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {google.protobuf.IEnumDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.EnumDescriptorProto} EnumDescriptorProto instance + */ + EnumDescriptorProto.create = function create(properties) { + return new EnumDescriptorProto(properties); + }; + + /** + * Encodes the specified EnumDescriptorProto message. Does not implicitly {@link google.protobuf.EnumDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {google.protobuf.IEnumDescriptorProto} message EnumDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.value != null && message.value.length) + for (var i = 0; i < message.value.length; ++i) + $root.google.protobuf.EnumValueDescriptorProto.encode(message.value[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.EnumOptions.encode(message.options, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + if (message.reservedRange != null && message.reservedRange.length) + for (var i = 0; i < message.reservedRange.length; ++i) + $root.google.protobuf.EnumDescriptorProto.EnumReservedRange.encode(message.reservedRange[i], writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.reservedName != null && message.reservedName.length) + for (var i = 0; i < message.reservedName.length; ++i) + writer.uint32(/* id 5, wireType 2 =*/42).string(message.reservedName[i]); + return writer; + }; + + /** + * Encodes the specified EnumDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.EnumDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {google.protobuf.IEnumDescriptorProto} message EnumDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumDescriptorProto} EnumDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 2: + if (!(message.value && message.value.length)) + message.value = []; + message.value.push($root.google.protobuf.EnumValueDescriptorProto.decode(reader, reader.uint32())); + break; + case 3: + message.options = $root.google.protobuf.EnumOptions.decode(reader, reader.uint32()); + break; + case 4: + if (!(message.reservedRange && message.reservedRange.length)) + message.reservedRange = []; + message.reservedRange.push($root.google.protobuf.EnumDescriptorProto.EnumReservedRange.decode(reader, reader.uint32())); + break; + case 5: + if (!(message.reservedName && message.reservedName.length)) + message.reservedName = []; + message.reservedName.push(reader.string()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumDescriptorProto} EnumDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumDescriptorProto message. + * @function verify + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.value != null && message.hasOwnProperty("value")) { + if (!Array.isArray(message.value)) + return "value: array expected"; + for (var i = 0; i < message.value.length; ++i) { + var error = $root.google.protobuf.EnumValueDescriptorProto.verify(message.value[i]); + if (error) + return "value." + error; + } + } + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.EnumOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.reservedRange != null && message.hasOwnProperty("reservedRange")) { + if (!Array.isArray(message.reservedRange)) + return "reservedRange: array expected"; + for (var i = 0; i < message.reservedRange.length; ++i) { + var error = $root.google.protobuf.EnumDescriptorProto.EnumReservedRange.verify(message.reservedRange[i]); + if (error) + return "reservedRange." + error; + } + } + if (message.reservedName != null && message.hasOwnProperty("reservedName")) { + if (!Array.isArray(message.reservedName)) + return "reservedName: array expected"; + for (var i = 0; i < message.reservedName.length; ++i) + if (!$util.isString(message.reservedName[i])) + return "reservedName: string[] expected"; + } + return null; + }; + + /** + * Creates an EnumDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumDescriptorProto} EnumDescriptorProto + */ + EnumDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumDescriptorProto) + return object; + var message = new $root.google.protobuf.EnumDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.value) { + if (!Array.isArray(object.value)) + throw TypeError(".google.protobuf.EnumDescriptorProto.value: array expected"); + message.value = []; + for (var i = 0; i < object.value.length; ++i) { + if (typeof object.value[i] !== "object") + throw TypeError(".google.protobuf.EnumDescriptorProto.value: object expected"); + message.value[i] = $root.google.protobuf.EnumValueDescriptorProto.fromObject(object.value[i]); + } + } + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.EnumDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.EnumOptions.fromObject(object.options); + } + if (object.reservedRange) { + if (!Array.isArray(object.reservedRange)) + throw TypeError(".google.protobuf.EnumDescriptorProto.reservedRange: array expected"); + message.reservedRange = []; + for (var i = 0; i < object.reservedRange.length; ++i) { + if (typeof object.reservedRange[i] !== "object") + throw TypeError(".google.protobuf.EnumDescriptorProto.reservedRange: object expected"); + message.reservedRange[i] = $root.google.protobuf.EnumDescriptorProto.EnumReservedRange.fromObject(object.reservedRange[i]); + } + } + if (object.reservedName) { + if (!Array.isArray(object.reservedName)) + throw TypeError(".google.protobuf.EnumDescriptorProto.reservedName: array expected"); + message.reservedName = []; + for (var i = 0; i < object.reservedName.length; ++i) + message.reservedName[i] = String(object.reservedName[i]); + } + return message; + }; + + /** + * Creates a plain object from an EnumDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {google.protobuf.EnumDescriptorProto} message EnumDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.value = []; + object.reservedRange = []; + object.reservedName = []; + } + if (options.defaults) { + object.name = ""; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.value && message.value.length) { + object.value = []; + for (var j = 0; j < message.value.length; ++j) + object.value[j] = $root.google.protobuf.EnumValueDescriptorProto.toObject(message.value[j], options); + } + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.EnumOptions.toObject(message.options, options); + if (message.reservedRange && message.reservedRange.length) { + object.reservedRange = []; + for (var j = 0; j < message.reservedRange.length; ++j) + object.reservedRange[j] = $root.google.protobuf.EnumDescriptorProto.EnumReservedRange.toObject(message.reservedRange[j], options); + } + if (message.reservedName && message.reservedName.length) { + object.reservedName = []; + for (var j = 0; j < message.reservedName.length; ++j) + object.reservedName[j] = message.reservedName[j]; + } + return object; + }; + + /** + * Converts this EnumDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.EnumDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + EnumDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + EnumDescriptorProto.EnumReservedRange = (function() { + + /** + * Properties of an EnumReservedRange. + * @memberof google.protobuf.EnumDescriptorProto + * @interface IEnumReservedRange + * @property {number|null} [start] EnumReservedRange start + * @property {number|null} [end] EnumReservedRange end + */ + + /** + * Constructs a new EnumReservedRange. + * @memberof google.protobuf.EnumDescriptorProto + * @classdesc Represents an EnumReservedRange. + * @implements IEnumReservedRange + * @constructor + * @param {google.protobuf.EnumDescriptorProto.IEnumReservedRange=} [properties] Properties to set + */ + function EnumReservedRange(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumReservedRange start. + * @member {number} start + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @instance + */ + EnumReservedRange.prototype.start = 0; + + /** + * EnumReservedRange end. + * @member {number} end + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @instance + */ + EnumReservedRange.prototype.end = 0; + + /** + * Creates a new EnumReservedRange instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {google.protobuf.EnumDescriptorProto.IEnumReservedRange=} [properties] Properties to set + * @returns {google.protobuf.EnumDescriptorProto.EnumReservedRange} EnumReservedRange instance + */ + EnumReservedRange.create = function create(properties) { + return new EnumReservedRange(properties); + }; + + /** + * Encodes the specified EnumReservedRange message. Does not implicitly {@link google.protobuf.EnumDescriptorProto.EnumReservedRange.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {google.protobuf.EnumDescriptorProto.IEnumReservedRange} message EnumReservedRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumReservedRange.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.start != null && Object.hasOwnProperty.call(message, "start")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.start); + if (message.end != null && Object.hasOwnProperty.call(message, "end")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.end); + return writer; + }; + + /** + * Encodes the specified EnumReservedRange message, length delimited. Does not implicitly {@link google.protobuf.EnumDescriptorProto.EnumReservedRange.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {google.protobuf.EnumDescriptorProto.IEnumReservedRange} message EnumReservedRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumReservedRange.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumReservedRange message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumDescriptorProto.EnumReservedRange} EnumReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumReservedRange.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumDescriptorProto.EnumReservedRange(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.start = reader.int32(); + break; + case 2: + message.end = reader.int32(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumReservedRange message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumDescriptorProto.EnumReservedRange} EnumReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumReservedRange.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumReservedRange message. + * @function verify + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumReservedRange.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.start != null && message.hasOwnProperty("start")) + if (!$util.isInteger(message.start)) + return "start: integer expected"; + if (message.end != null && message.hasOwnProperty("end")) + if (!$util.isInteger(message.end)) + return "end: integer expected"; + return null; + }; + + /** + * Creates an EnumReservedRange message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumDescriptorProto.EnumReservedRange} EnumReservedRange + */ + EnumReservedRange.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumDescriptorProto.EnumReservedRange) + return object; + var message = new $root.google.protobuf.EnumDescriptorProto.EnumReservedRange(); + if (object.start != null) + message.start = object.start | 0; + if (object.end != null) + message.end = object.end | 0; + return message; + }; + + /** + * Creates a plain object from an EnumReservedRange message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {google.protobuf.EnumDescriptorProto.EnumReservedRange} message EnumReservedRange + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumReservedRange.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.start = 0; + object.end = 0; + } + if (message.start != null && message.hasOwnProperty("start")) + object.start = message.start; + if (message.end != null && message.hasOwnProperty("end")) + object.end = message.end; + return object; + }; + + /** + * Converts this EnumReservedRange to JSON. + * @function toJSON + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @instance + * @returns {Object.} JSON object + */ + EnumReservedRange.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return EnumReservedRange; + })(); + + return EnumDescriptorProto; + })(); + + protobuf.EnumValueDescriptorProto = (function() { + + /** + * Properties of an EnumValueDescriptorProto. + * @memberof google.protobuf + * @interface IEnumValueDescriptorProto + * @property {string|null} [name] EnumValueDescriptorProto name + * @property {number|null} [number] EnumValueDescriptorProto number + * @property {google.protobuf.IEnumValueOptions|null} [options] EnumValueDescriptorProto options + */ + + /** + * Constructs a new EnumValueDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents an EnumValueDescriptorProto. + * @implements IEnumValueDescriptorProto + * @constructor + * @param {google.protobuf.IEnumValueDescriptorProto=} [properties] Properties to set + */ + function EnumValueDescriptorProto(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumValueDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.EnumValueDescriptorProto + * @instance + */ + EnumValueDescriptorProto.prototype.name = ""; + + /** + * EnumValueDescriptorProto number. + * @member {number} number + * @memberof google.protobuf.EnumValueDescriptorProto + * @instance + */ + EnumValueDescriptorProto.prototype.number = 0; + + /** + * EnumValueDescriptorProto options. + * @member {google.protobuf.IEnumValueOptions|null|undefined} options + * @memberof google.protobuf.EnumValueDescriptorProto + * @instance + */ + EnumValueDescriptorProto.prototype.options = null; + + /** + * Creates a new EnumValueDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {google.protobuf.IEnumValueDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.EnumValueDescriptorProto} EnumValueDescriptorProto instance + */ + EnumValueDescriptorProto.create = function create(properties) { + return new EnumValueDescriptorProto(properties); + }; + + /** + * Encodes the specified EnumValueDescriptorProto message. Does not implicitly {@link google.protobuf.EnumValueDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {google.protobuf.IEnumValueDescriptorProto} message EnumValueDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumValueDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.number != null && Object.hasOwnProperty.call(message, "number")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.number); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.EnumValueOptions.encode(message.options, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified EnumValueDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.EnumValueDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {google.protobuf.IEnumValueDescriptorProto} message EnumValueDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumValueDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumValueDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumValueDescriptorProto} EnumValueDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumValueDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumValueDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 2: + message.number = reader.int32(); + break; + case 3: + message.options = $root.google.protobuf.EnumValueOptions.decode(reader, reader.uint32()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumValueDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumValueDescriptorProto} EnumValueDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumValueDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumValueDescriptorProto message. + * @function verify + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumValueDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.number != null && message.hasOwnProperty("number")) + if (!$util.isInteger(message.number)) + return "number: integer expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.EnumValueOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates an EnumValueDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumValueDescriptorProto} EnumValueDescriptorProto + */ + EnumValueDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumValueDescriptorProto) + return object; + var message = new $root.google.protobuf.EnumValueDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.number != null) + message.number = object.number | 0; + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.EnumValueDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.EnumValueOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from an EnumValueDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {google.protobuf.EnumValueDescriptorProto} message EnumValueDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumValueDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.number = 0; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.number != null && message.hasOwnProperty("number")) + object.number = message.number; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.EnumValueOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this EnumValueDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.EnumValueDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + EnumValueDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return EnumValueDescriptorProto; + })(); + + protobuf.ServiceDescriptorProto = (function() { + + /** + * Properties of a ServiceDescriptorProto. + * @memberof google.protobuf + * @interface IServiceDescriptorProto + * @property {string|null} [name] ServiceDescriptorProto name + * @property {Array.|null} [method] ServiceDescriptorProto method + * @property {google.protobuf.IServiceOptions|null} [options] ServiceDescriptorProto options + */ + + /** + * Constructs a new ServiceDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a ServiceDescriptorProto. + * @implements IServiceDescriptorProto + * @constructor + * @param {google.protobuf.IServiceDescriptorProto=} [properties] Properties to set + */ + function ServiceDescriptorProto(properties) { + this.method = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ServiceDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.ServiceDescriptorProto + * @instance + */ + ServiceDescriptorProto.prototype.name = ""; + + /** + * ServiceDescriptorProto method. + * @member {Array.} method + * @memberof google.protobuf.ServiceDescriptorProto + * @instance + */ + ServiceDescriptorProto.prototype.method = $util.emptyArray; + + /** + * ServiceDescriptorProto options. + * @member {google.protobuf.IServiceOptions|null|undefined} options + * @memberof google.protobuf.ServiceDescriptorProto + * @instance + */ + ServiceDescriptorProto.prototype.options = null; + + /** + * Creates a new ServiceDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {google.protobuf.IServiceDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.ServiceDescriptorProto} ServiceDescriptorProto instance + */ + ServiceDescriptorProto.create = function create(properties) { + return new ServiceDescriptorProto(properties); + }; + + /** + * Encodes the specified ServiceDescriptorProto message. Does not implicitly {@link google.protobuf.ServiceDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {google.protobuf.IServiceDescriptorProto} message ServiceDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ServiceDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.method != null && message.method.length) + for (var i = 0; i < message.method.length; ++i) + $root.google.protobuf.MethodDescriptorProto.encode(message.method[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.ServiceOptions.encode(message.options, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified ServiceDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.ServiceDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {google.protobuf.IServiceDescriptorProto} message ServiceDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ServiceDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ServiceDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.ServiceDescriptorProto} ServiceDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ServiceDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.ServiceDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 2: + if (!(message.method && message.method.length)) + message.method = []; + message.method.push($root.google.protobuf.MethodDescriptorProto.decode(reader, reader.uint32())); + break; + case 3: + message.options = $root.google.protobuf.ServiceOptions.decode(reader, reader.uint32()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ServiceDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.ServiceDescriptorProto} ServiceDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ServiceDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ServiceDescriptorProto message. + * @function verify + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ServiceDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.method != null && message.hasOwnProperty("method")) { + if (!Array.isArray(message.method)) + return "method: array expected"; + for (var i = 0; i < message.method.length; ++i) { + var error = $root.google.protobuf.MethodDescriptorProto.verify(message.method[i]); + if (error) + return "method." + error; + } + } + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.ServiceOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates a ServiceDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.ServiceDescriptorProto} ServiceDescriptorProto + */ + ServiceDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.ServiceDescriptorProto) + return object; + var message = new $root.google.protobuf.ServiceDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.method) { + if (!Array.isArray(object.method)) + throw TypeError(".google.protobuf.ServiceDescriptorProto.method: array expected"); + message.method = []; + for (var i = 0; i < object.method.length; ++i) { + if (typeof object.method[i] !== "object") + throw TypeError(".google.protobuf.ServiceDescriptorProto.method: object expected"); + message.method[i] = $root.google.protobuf.MethodDescriptorProto.fromObject(object.method[i]); + } + } + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.ServiceDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.ServiceOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from a ServiceDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {google.protobuf.ServiceDescriptorProto} message ServiceDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ServiceDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.method = []; + if (options.defaults) { + object.name = ""; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.method && message.method.length) { + object.method = []; + for (var j = 0; j < message.method.length; ++j) + object.method[j] = $root.google.protobuf.MethodDescriptorProto.toObject(message.method[j], options); + } + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.ServiceOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this ServiceDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.ServiceDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + ServiceDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return ServiceDescriptorProto; + })(); + + protobuf.MethodDescriptorProto = (function() { + + /** + * Properties of a MethodDescriptorProto. + * @memberof google.protobuf + * @interface IMethodDescriptorProto + * @property {string|null} [name] MethodDescriptorProto name + * @property {string|null} [inputType] MethodDescriptorProto inputType + * @property {string|null} [outputType] MethodDescriptorProto outputType + * @property {google.protobuf.IMethodOptions|null} [options] MethodDescriptorProto options + * @property {boolean|null} [clientStreaming] MethodDescriptorProto clientStreaming + * @property {boolean|null} [serverStreaming] MethodDescriptorProto serverStreaming + */ + + /** + * Constructs a new MethodDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a MethodDescriptorProto. + * @implements IMethodDescriptorProto + * @constructor + * @param {google.protobuf.IMethodDescriptorProto=} [properties] Properties to set + */ + function MethodDescriptorProto(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * MethodDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.name = ""; + + /** + * MethodDescriptorProto inputType. + * @member {string} inputType + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.inputType = ""; + + /** + * MethodDescriptorProto outputType. + * @member {string} outputType + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.outputType = ""; + + /** + * MethodDescriptorProto options. + * @member {google.protobuf.IMethodOptions|null|undefined} options + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.options = null; + + /** + * MethodDescriptorProto clientStreaming. + * @member {boolean} clientStreaming + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.clientStreaming = false; + + /** + * MethodDescriptorProto serverStreaming. + * @member {boolean} serverStreaming + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.serverStreaming = false; + + /** + * Creates a new MethodDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {google.protobuf.IMethodDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.MethodDescriptorProto} MethodDescriptorProto instance + */ + MethodDescriptorProto.create = function create(properties) { + return new MethodDescriptorProto(properties); + }; + + /** + * Encodes the specified MethodDescriptorProto message. Does not implicitly {@link google.protobuf.MethodDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {google.protobuf.IMethodDescriptorProto} message MethodDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MethodDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.inputType != null && Object.hasOwnProperty.call(message, "inputType")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.inputType); + if (message.outputType != null && Object.hasOwnProperty.call(message, "outputType")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.outputType); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.MethodOptions.encode(message.options, writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.clientStreaming != null && Object.hasOwnProperty.call(message, "clientStreaming")) + writer.uint32(/* id 5, wireType 0 =*/40).bool(message.clientStreaming); + if (message.serverStreaming != null && Object.hasOwnProperty.call(message, "serverStreaming")) + writer.uint32(/* id 6, wireType 0 =*/48).bool(message.serverStreaming); + return writer; + }; + + /** + * Encodes the specified MethodDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.MethodDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {google.protobuf.IMethodDescriptorProto} message MethodDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MethodDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a MethodDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.MethodDescriptorProto} MethodDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MethodDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.MethodDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.name = reader.string(); + break; + case 2: + message.inputType = reader.string(); + break; + case 3: + message.outputType = reader.string(); + break; + case 4: + message.options = $root.google.protobuf.MethodOptions.decode(reader, reader.uint32()); + break; + case 5: + message.clientStreaming = reader.bool(); + break; + case 6: + message.serverStreaming = reader.bool(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a MethodDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.MethodDescriptorProto} MethodDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MethodDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a MethodDescriptorProto message. + * @function verify + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + MethodDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.inputType != null && message.hasOwnProperty("inputType")) + if (!$util.isString(message.inputType)) + return "inputType: string expected"; + if (message.outputType != null && message.hasOwnProperty("outputType")) + if (!$util.isString(message.outputType)) + return "outputType: string expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.MethodOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.clientStreaming != null && message.hasOwnProperty("clientStreaming")) + if (typeof message.clientStreaming !== "boolean") + return "clientStreaming: boolean expected"; + if (message.serverStreaming != null && message.hasOwnProperty("serverStreaming")) + if (typeof message.serverStreaming !== "boolean") + return "serverStreaming: boolean expected"; + return null; + }; + + /** + * Creates a MethodDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.MethodDescriptorProto} MethodDescriptorProto + */ + MethodDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.MethodDescriptorProto) + return object; + var message = new $root.google.protobuf.MethodDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.inputType != null) + message.inputType = String(object.inputType); + if (object.outputType != null) + message.outputType = String(object.outputType); + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.MethodDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.MethodOptions.fromObject(object.options); + } + if (object.clientStreaming != null) + message.clientStreaming = Boolean(object.clientStreaming); + if (object.serverStreaming != null) + message.serverStreaming = Boolean(object.serverStreaming); + return message; + }; + + /** + * Creates a plain object from a MethodDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {google.protobuf.MethodDescriptorProto} message MethodDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + MethodDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.inputType = ""; + object.outputType = ""; + object.options = null; + object.clientStreaming = false; + object.serverStreaming = false; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.inputType != null && message.hasOwnProperty("inputType")) + object.inputType = message.inputType; + if (message.outputType != null && message.hasOwnProperty("outputType")) + object.outputType = message.outputType; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.MethodOptions.toObject(message.options, options); + if (message.clientStreaming != null && message.hasOwnProperty("clientStreaming")) + object.clientStreaming = message.clientStreaming; + if (message.serverStreaming != null && message.hasOwnProperty("serverStreaming")) + object.serverStreaming = message.serverStreaming; + return object; + }; + + /** + * Converts this MethodDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.MethodDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + MethodDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return MethodDescriptorProto; + })(); + + protobuf.FileOptions = (function() { + + /** + * Properties of a FileOptions. + * @memberof google.protobuf + * @interface IFileOptions + * @property {string|null} [javaPackage] FileOptions javaPackage + * @property {string|null} [javaOuterClassname] FileOptions javaOuterClassname + * @property {boolean|null} [javaMultipleFiles] FileOptions javaMultipleFiles + * @property {boolean|null} [javaGenerateEqualsAndHash] FileOptions javaGenerateEqualsAndHash + * @property {boolean|null} [javaStringCheckUtf8] FileOptions javaStringCheckUtf8 + * @property {google.protobuf.FileOptions.OptimizeMode|null} [optimizeFor] FileOptions optimizeFor + * @property {string|null} [goPackage] FileOptions goPackage + * @property {boolean|null} [ccGenericServices] FileOptions ccGenericServices + * @property {boolean|null} [javaGenericServices] FileOptions javaGenericServices + * @property {boolean|null} [pyGenericServices] FileOptions pyGenericServices + * @property {boolean|null} [phpGenericServices] FileOptions phpGenericServices + * @property {boolean|null} [deprecated] FileOptions deprecated + * @property {boolean|null} [ccEnableArenas] FileOptions ccEnableArenas + * @property {string|null} [objcClassPrefix] FileOptions objcClassPrefix + * @property {string|null} [csharpNamespace] FileOptions csharpNamespace + * @property {string|null} [swiftPrefix] FileOptions swiftPrefix + * @property {string|null} [phpClassPrefix] FileOptions phpClassPrefix + * @property {string|null} [phpNamespace] FileOptions phpNamespace + * @property {string|null} [phpMetadataNamespace] FileOptions phpMetadataNamespace + * @property {string|null} [rubyPackage] FileOptions rubyPackage + * @property {Array.|null} [uninterpretedOption] FileOptions uninterpretedOption + * @property {Array.|null} [".google.api.resourceDefinition"] FileOptions .google.api.resourceDefinition + */ + + /** + * Constructs a new FileOptions. + * @memberof google.protobuf + * @classdesc Represents a FileOptions. + * @implements IFileOptions + * @constructor + * @param {google.protobuf.IFileOptions=} [properties] Properties to set + */ + function FileOptions(properties) { + this.uninterpretedOption = []; + this[".google.api.resourceDefinition"] = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FileOptions javaPackage. + * @member {string} javaPackage + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaPackage = ""; + + /** + * FileOptions javaOuterClassname. + * @member {string} javaOuterClassname + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaOuterClassname = ""; + + /** + * FileOptions javaMultipleFiles. + * @member {boolean} javaMultipleFiles + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaMultipleFiles = false; + + /** + * FileOptions javaGenerateEqualsAndHash. + * @member {boolean} javaGenerateEqualsAndHash + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaGenerateEqualsAndHash = false; + + /** + * FileOptions javaStringCheckUtf8. + * @member {boolean} javaStringCheckUtf8 + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaStringCheckUtf8 = false; + + /** + * FileOptions optimizeFor. + * @member {google.protobuf.FileOptions.OptimizeMode} optimizeFor + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.optimizeFor = 1; + + /** + * FileOptions goPackage. + * @member {string} goPackage + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.goPackage = ""; + + /** + * FileOptions ccGenericServices. + * @member {boolean} ccGenericServices + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.ccGenericServices = false; + + /** + * FileOptions javaGenericServices. + * @member {boolean} javaGenericServices + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaGenericServices = false; + + /** + * FileOptions pyGenericServices. + * @member {boolean} pyGenericServices + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.pyGenericServices = false; + + /** + * FileOptions phpGenericServices. + * @member {boolean} phpGenericServices + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.phpGenericServices = false; + + /** + * FileOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.deprecated = false; + + /** + * FileOptions ccEnableArenas. + * @member {boolean} ccEnableArenas + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.ccEnableArenas = true; + + /** + * FileOptions objcClassPrefix. + * @member {string} objcClassPrefix + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.objcClassPrefix = ""; + + /** + * FileOptions csharpNamespace. + * @member {string} csharpNamespace + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.csharpNamespace = ""; + + /** + * FileOptions swiftPrefix. + * @member {string} swiftPrefix + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.swiftPrefix = ""; + + /** + * FileOptions phpClassPrefix. + * @member {string} phpClassPrefix + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.phpClassPrefix = ""; + + /** + * FileOptions phpNamespace. + * @member {string} phpNamespace + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.phpNamespace = ""; + + /** + * FileOptions phpMetadataNamespace. + * @member {string} phpMetadataNamespace + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.phpMetadataNamespace = ""; + + /** + * FileOptions rubyPackage. + * @member {string} rubyPackage + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.rubyPackage = ""; + + /** + * FileOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * FileOptions .google.api.resourceDefinition. + * @member {Array.} .google.api.resourceDefinition + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype[".google.api.resourceDefinition"] = $util.emptyArray; + + /** + * Creates a new FileOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.FileOptions + * @static + * @param {google.protobuf.IFileOptions=} [properties] Properties to set + * @returns {google.protobuf.FileOptions} FileOptions instance + */ + FileOptions.create = function create(properties) { + return new FileOptions(properties); + }; + + /** + * Encodes the specified FileOptions message. Does not implicitly {@link google.protobuf.FileOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FileOptions + * @static + * @param {google.protobuf.IFileOptions} message FileOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.javaPackage != null && Object.hasOwnProperty.call(message, "javaPackage")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.javaPackage); + if (message.javaOuterClassname != null && Object.hasOwnProperty.call(message, "javaOuterClassname")) + writer.uint32(/* id 8, wireType 2 =*/66).string(message.javaOuterClassname); + if (message.optimizeFor != null && Object.hasOwnProperty.call(message, "optimizeFor")) + writer.uint32(/* id 9, wireType 0 =*/72).int32(message.optimizeFor); + if (message.javaMultipleFiles != null && Object.hasOwnProperty.call(message, "javaMultipleFiles")) + writer.uint32(/* id 10, wireType 0 =*/80).bool(message.javaMultipleFiles); + if (message.goPackage != null && Object.hasOwnProperty.call(message, "goPackage")) + writer.uint32(/* id 11, wireType 2 =*/90).string(message.goPackage); + if (message.ccGenericServices != null && Object.hasOwnProperty.call(message, "ccGenericServices")) + writer.uint32(/* id 16, wireType 0 =*/128).bool(message.ccGenericServices); + if (message.javaGenericServices != null && Object.hasOwnProperty.call(message, "javaGenericServices")) + writer.uint32(/* id 17, wireType 0 =*/136).bool(message.javaGenericServices); + if (message.pyGenericServices != null && Object.hasOwnProperty.call(message, "pyGenericServices")) + writer.uint32(/* id 18, wireType 0 =*/144).bool(message.pyGenericServices); + if (message.javaGenerateEqualsAndHash != null && Object.hasOwnProperty.call(message, "javaGenerateEqualsAndHash")) + writer.uint32(/* id 20, wireType 0 =*/160).bool(message.javaGenerateEqualsAndHash); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 23, wireType 0 =*/184).bool(message.deprecated); + if (message.javaStringCheckUtf8 != null && Object.hasOwnProperty.call(message, "javaStringCheckUtf8")) + writer.uint32(/* id 27, wireType 0 =*/216).bool(message.javaStringCheckUtf8); + if (message.ccEnableArenas != null && Object.hasOwnProperty.call(message, "ccEnableArenas")) + writer.uint32(/* id 31, wireType 0 =*/248).bool(message.ccEnableArenas); + if (message.objcClassPrefix != null && Object.hasOwnProperty.call(message, "objcClassPrefix")) + writer.uint32(/* id 36, wireType 2 =*/290).string(message.objcClassPrefix); + if (message.csharpNamespace != null && Object.hasOwnProperty.call(message, "csharpNamespace")) + writer.uint32(/* id 37, wireType 2 =*/298).string(message.csharpNamespace); + if (message.swiftPrefix != null && Object.hasOwnProperty.call(message, "swiftPrefix")) + writer.uint32(/* id 39, wireType 2 =*/314).string(message.swiftPrefix); + if (message.phpClassPrefix != null && Object.hasOwnProperty.call(message, "phpClassPrefix")) + writer.uint32(/* id 40, wireType 2 =*/322).string(message.phpClassPrefix); + if (message.phpNamespace != null && Object.hasOwnProperty.call(message, "phpNamespace")) + writer.uint32(/* id 41, wireType 2 =*/330).string(message.phpNamespace); + if (message.phpGenericServices != null && Object.hasOwnProperty.call(message, "phpGenericServices")) + writer.uint32(/* id 42, wireType 0 =*/336).bool(message.phpGenericServices); + if (message.phpMetadataNamespace != null && Object.hasOwnProperty.call(message, "phpMetadataNamespace")) + writer.uint32(/* id 44, wireType 2 =*/354).string(message.phpMetadataNamespace); + if (message.rubyPackage != null && Object.hasOwnProperty.call(message, "rubyPackage")) + writer.uint32(/* id 45, wireType 2 =*/362).string(message.rubyPackage); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.resourceDefinition"] != null && message[".google.api.resourceDefinition"].length) + for (var i = 0; i < message[".google.api.resourceDefinition"].length; ++i) + $root.google.api.ResourceDescriptor.encode(message[".google.api.resourceDefinition"][i], writer.uint32(/* id 1053, wireType 2 =*/8426).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified FileOptions message, length delimited. Does not implicitly {@link google.protobuf.FileOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FileOptions + * @static + * @param {google.protobuf.IFileOptions} message FileOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FileOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FileOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FileOptions} FileOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FileOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.javaPackage = reader.string(); + break; + case 8: + message.javaOuterClassname = reader.string(); + break; + case 10: + message.javaMultipleFiles = reader.bool(); + break; + case 20: + message.javaGenerateEqualsAndHash = reader.bool(); + break; + case 27: + message.javaStringCheckUtf8 = reader.bool(); + break; + case 9: + message.optimizeFor = reader.int32(); + break; + case 11: + message.goPackage = reader.string(); + break; + case 16: + message.ccGenericServices = reader.bool(); + break; + case 17: + message.javaGenericServices = reader.bool(); + break; + case 18: + message.pyGenericServices = reader.bool(); + break; + case 42: + message.phpGenericServices = reader.bool(); + break; + case 23: + message.deprecated = reader.bool(); + break; + case 31: + message.ccEnableArenas = reader.bool(); + break; + case 36: + message.objcClassPrefix = reader.string(); + break; + case 37: + message.csharpNamespace = reader.string(); + break; + case 39: + message.swiftPrefix = reader.string(); + break; + case 40: + message.phpClassPrefix = reader.string(); + break; + case 41: + message.phpNamespace = reader.string(); + break; + case 44: + message.phpMetadataNamespace = reader.string(); + break; + case 45: + message.rubyPackage = reader.string(); + break; + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + case 1053: + if (!(message[".google.api.resourceDefinition"] && message[".google.api.resourceDefinition"].length)) + message[".google.api.resourceDefinition"] = []; + message[".google.api.resourceDefinition"].push($root.google.api.ResourceDescriptor.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FileOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FileOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FileOptions} FileOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FileOptions message. + * @function verify + * @memberof google.protobuf.FileOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FileOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.javaPackage != null && message.hasOwnProperty("javaPackage")) + if (!$util.isString(message.javaPackage)) + return "javaPackage: string expected"; + if (message.javaOuterClassname != null && message.hasOwnProperty("javaOuterClassname")) + if (!$util.isString(message.javaOuterClassname)) + return "javaOuterClassname: string expected"; + if (message.javaMultipleFiles != null && message.hasOwnProperty("javaMultipleFiles")) + if (typeof message.javaMultipleFiles !== "boolean") + return "javaMultipleFiles: boolean expected"; + if (message.javaGenerateEqualsAndHash != null && message.hasOwnProperty("javaGenerateEqualsAndHash")) + if (typeof message.javaGenerateEqualsAndHash !== "boolean") + return "javaGenerateEqualsAndHash: boolean expected"; + if (message.javaStringCheckUtf8 != null && message.hasOwnProperty("javaStringCheckUtf8")) + if (typeof message.javaStringCheckUtf8 !== "boolean") + return "javaStringCheckUtf8: boolean expected"; + if (message.optimizeFor != null && message.hasOwnProperty("optimizeFor")) + switch (message.optimizeFor) { + default: + return "optimizeFor: enum value expected"; + case 1: + case 2: + case 3: + break; + } + if (message.goPackage != null && message.hasOwnProperty("goPackage")) + if (!$util.isString(message.goPackage)) + return "goPackage: string expected"; + if (message.ccGenericServices != null && message.hasOwnProperty("ccGenericServices")) + if (typeof message.ccGenericServices !== "boolean") + return "ccGenericServices: boolean expected"; + if (message.javaGenericServices != null && message.hasOwnProperty("javaGenericServices")) + if (typeof message.javaGenericServices !== "boolean") + return "javaGenericServices: boolean expected"; + if (message.pyGenericServices != null && message.hasOwnProperty("pyGenericServices")) + if (typeof message.pyGenericServices !== "boolean") + return "pyGenericServices: boolean expected"; + if (message.phpGenericServices != null && message.hasOwnProperty("phpGenericServices")) + if (typeof message.phpGenericServices !== "boolean") + return "phpGenericServices: boolean expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.ccEnableArenas != null && message.hasOwnProperty("ccEnableArenas")) + if (typeof message.ccEnableArenas !== "boolean") + return "ccEnableArenas: boolean expected"; + if (message.objcClassPrefix != null && message.hasOwnProperty("objcClassPrefix")) + if (!$util.isString(message.objcClassPrefix)) + return "objcClassPrefix: string expected"; + if (message.csharpNamespace != null && message.hasOwnProperty("csharpNamespace")) + if (!$util.isString(message.csharpNamespace)) + return "csharpNamespace: string expected"; + if (message.swiftPrefix != null && message.hasOwnProperty("swiftPrefix")) + if (!$util.isString(message.swiftPrefix)) + return "swiftPrefix: string expected"; + if (message.phpClassPrefix != null && message.hasOwnProperty("phpClassPrefix")) + if (!$util.isString(message.phpClassPrefix)) + return "phpClassPrefix: string expected"; + if (message.phpNamespace != null && message.hasOwnProperty("phpNamespace")) + if (!$util.isString(message.phpNamespace)) + return "phpNamespace: string expected"; + if (message.phpMetadataNamespace != null && message.hasOwnProperty("phpMetadataNamespace")) + if (!$util.isString(message.phpMetadataNamespace)) + return "phpMetadataNamespace: string expected"; + if (message.rubyPackage != null && message.hasOwnProperty("rubyPackage")) + if (!$util.isString(message.rubyPackage)) + return "rubyPackage: string expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.resourceDefinition"] != null && message.hasOwnProperty(".google.api.resourceDefinition")) { + if (!Array.isArray(message[".google.api.resourceDefinition"])) + return ".google.api.resourceDefinition: array expected"; + for (var i = 0; i < message[".google.api.resourceDefinition"].length; ++i) { + var error = $root.google.api.ResourceDescriptor.verify(message[".google.api.resourceDefinition"][i]); + if (error) + return ".google.api.resourceDefinition." + error; + } + } + return null; + }; + + /** + * Creates a FileOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FileOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FileOptions} FileOptions + */ + FileOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FileOptions) + return object; + var message = new $root.google.protobuf.FileOptions(); + if (object.javaPackage != null) + message.javaPackage = String(object.javaPackage); + if (object.javaOuterClassname != null) + message.javaOuterClassname = String(object.javaOuterClassname); + if (object.javaMultipleFiles != null) + message.javaMultipleFiles = Boolean(object.javaMultipleFiles); + if (object.javaGenerateEqualsAndHash != null) + message.javaGenerateEqualsAndHash = Boolean(object.javaGenerateEqualsAndHash); + if (object.javaStringCheckUtf8 != null) + message.javaStringCheckUtf8 = Boolean(object.javaStringCheckUtf8); + switch (object.optimizeFor) { + case "SPEED": + case 1: + message.optimizeFor = 1; + break; + case "CODE_SIZE": + case 2: + message.optimizeFor = 2; + break; + case "LITE_RUNTIME": + case 3: + message.optimizeFor = 3; + break; + } + if (object.goPackage != null) + message.goPackage = String(object.goPackage); + if (object.ccGenericServices != null) + message.ccGenericServices = Boolean(object.ccGenericServices); + if (object.javaGenericServices != null) + message.javaGenericServices = Boolean(object.javaGenericServices); + if (object.pyGenericServices != null) + message.pyGenericServices = Boolean(object.pyGenericServices); + if (object.phpGenericServices != null) + message.phpGenericServices = Boolean(object.phpGenericServices); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.ccEnableArenas != null) + message.ccEnableArenas = Boolean(object.ccEnableArenas); + if (object.objcClassPrefix != null) + message.objcClassPrefix = String(object.objcClassPrefix); + if (object.csharpNamespace != null) + message.csharpNamespace = String(object.csharpNamespace); + if (object.swiftPrefix != null) + message.swiftPrefix = String(object.swiftPrefix); + if (object.phpClassPrefix != null) + message.phpClassPrefix = String(object.phpClassPrefix); + if (object.phpNamespace != null) + message.phpNamespace = String(object.phpNamespace); + if (object.phpMetadataNamespace != null) + message.phpMetadataNamespace = String(object.phpMetadataNamespace); + if (object.rubyPackage != null) + message.rubyPackage = String(object.rubyPackage); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.FileOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.FileOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.resourceDefinition"]) { + if (!Array.isArray(object[".google.api.resourceDefinition"])) + throw TypeError(".google.protobuf.FileOptions..google.api.resourceDefinition: array expected"); + message[".google.api.resourceDefinition"] = []; + for (var i = 0; i < object[".google.api.resourceDefinition"].length; ++i) { + if (typeof object[".google.api.resourceDefinition"][i] !== "object") + throw TypeError(".google.protobuf.FileOptions..google.api.resourceDefinition: object expected"); + message[".google.api.resourceDefinition"][i] = $root.google.api.ResourceDescriptor.fromObject(object[".google.api.resourceDefinition"][i]); + } + } + return message; + }; + + /** + * Creates a plain object from a FileOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FileOptions + * @static + * @param {google.protobuf.FileOptions} message FileOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FileOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.uninterpretedOption = []; + object[".google.api.resourceDefinition"] = []; + } + if (options.defaults) { + object.javaPackage = ""; + object.javaOuterClassname = ""; + object.optimizeFor = options.enums === String ? "SPEED" : 1; + object.javaMultipleFiles = false; + object.goPackage = ""; + object.ccGenericServices = false; + object.javaGenericServices = false; + object.pyGenericServices = false; + object.javaGenerateEqualsAndHash = false; + object.deprecated = false; + object.javaStringCheckUtf8 = false; + object.ccEnableArenas = true; + object.objcClassPrefix = ""; + object.csharpNamespace = ""; + object.swiftPrefix = ""; + object.phpClassPrefix = ""; + object.phpNamespace = ""; + object.phpGenericServices = false; + object.phpMetadataNamespace = ""; + object.rubyPackage = ""; + } + if (message.javaPackage != null && message.hasOwnProperty("javaPackage")) + object.javaPackage = message.javaPackage; + if (message.javaOuterClassname != null && message.hasOwnProperty("javaOuterClassname")) + object.javaOuterClassname = message.javaOuterClassname; + if (message.optimizeFor != null && message.hasOwnProperty("optimizeFor")) + object.optimizeFor = options.enums === String ? $root.google.protobuf.FileOptions.OptimizeMode[message.optimizeFor] : message.optimizeFor; + if (message.javaMultipleFiles != null && message.hasOwnProperty("javaMultipleFiles")) + object.javaMultipleFiles = message.javaMultipleFiles; + if (message.goPackage != null && message.hasOwnProperty("goPackage")) + object.goPackage = message.goPackage; + if (message.ccGenericServices != null && message.hasOwnProperty("ccGenericServices")) + object.ccGenericServices = message.ccGenericServices; + if (message.javaGenericServices != null && message.hasOwnProperty("javaGenericServices")) + object.javaGenericServices = message.javaGenericServices; + if (message.pyGenericServices != null && message.hasOwnProperty("pyGenericServices")) + object.pyGenericServices = message.pyGenericServices; + if (message.javaGenerateEqualsAndHash != null && message.hasOwnProperty("javaGenerateEqualsAndHash")) + object.javaGenerateEqualsAndHash = message.javaGenerateEqualsAndHash; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.javaStringCheckUtf8 != null && message.hasOwnProperty("javaStringCheckUtf8")) + object.javaStringCheckUtf8 = message.javaStringCheckUtf8; + if (message.ccEnableArenas != null && message.hasOwnProperty("ccEnableArenas")) + object.ccEnableArenas = message.ccEnableArenas; + if (message.objcClassPrefix != null && message.hasOwnProperty("objcClassPrefix")) + object.objcClassPrefix = message.objcClassPrefix; + if (message.csharpNamespace != null && message.hasOwnProperty("csharpNamespace")) + object.csharpNamespace = message.csharpNamespace; + if (message.swiftPrefix != null && message.hasOwnProperty("swiftPrefix")) + object.swiftPrefix = message.swiftPrefix; + if (message.phpClassPrefix != null && message.hasOwnProperty("phpClassPrefix")) + object.phpClassPrefix = message.phpClassPrefix; + if (message.phpNamespace != null && message.hasOwnProperty("phpNamespace")) + object.phpNamespace = message.phpNamespace; + if (message.phpGenericServices != null && message.hasOwnProperty("phpGenericServices")) + object.phpGenericServices = message.phpGenericServices; + if (message.phpMetadataNamespace != null && message.hasOwnProperty("phpMetadataNamespace")) + object.phpMetadataNamespace = message.phpMetadataNamespace; + if (message.rubyPackage != null && message.hasOwnProperty("rubyPackage")) + object.rubyPackage = message.rubyPackage; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.resourceDefinition"] && message[".google.api.resourceDefinition"].length) { + object[".google.api.resourceDefinition"] = []; + for (var j = 0; j < message[".google.api.resourceDefinition"].length; ++j) + object[".google.api.resourceDefinition"][j] = $root.google.api.ResourceDescriptor.toObject(message[".google.api.resourceDefinition"][j], options); + } + return object; + }; + + /** + * Converts this FileOptions to JSON. + * @function toJSON + * @memberof google.protobuf.FileOptions + * @instance + * @returns {Object.} JSON object + */ + FileOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * OptimizeMode enum. + * @name google.protobuf.FileOptions.OptimizeMode + * @enum {number} + * @property {number} SPEED=1 SPEED value + * @property {number} CODE_SIZE=2 CODE_SIZE value + * @property {number} LITE_RUNTIME=3 LITE_RUNTIME value + */ + FileOptions.OptimizeMode = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[1] = "SPEED"] = 1; + values[valuesById[2] = "CODE_SIZE"] = 2; + values[valuesById[3] = "LITE_RUNTIME"] = 3; + return values; + })(); + + return FileOptions; + })(); + + protobuf.MessageOptions = (function() { + + /** + * Properties of a MessageOptions. + * @memberof google.protobuf + * @interface IMessageOptions + * @property {boolean|null} [messageSetWireFormat] MessageOptions messageSetWireFormat + * @property {boolean|null} [noStandardDescriptorAccessor] MessageOptions noStandardDescriptorAccessor + * @property {boolean|null} [deprecated] MessageOptions deprecated + * @property {boolean|null} [mapEntry] MessageOptions mapEntry + * @property {Array.|null} [uninterpretedOption] MessageOptions uninterpretedOption + * @property {google.api.IResourceDescriptor|null} [".google.api.resource"] MessageOptions .google.api.resource + */ + + /** + * Constructs a new MessageOptions. + * @memberof google.protobuf + * @classdesc Represents a MessageOptions. + * @implements IMessageOptions + * @constructor + * @param {google.protobuf.IMessageOptions=} [properties] Properties to set + */ + function MessageOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * MessageOptions messageSetWireFormat. + * @member {boolean} messageSetWireFormat + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.messageSetWireFormat = false; + + /** + * MessageOptions noStandardDescriptorAccessor. + * @member {boolean} noStandardDescriptorAccessor + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.noStandardDescriptorAccessor = false; + + /** + * MessageOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.deprecated = false; + + /** + * MessageOptions mapEntry. + * @member {boolean} mapEntry + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.mapEntry = false; + + /** + * MessageOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * MessageOptions .google.api.resource. + * @member {google.api.IResourceDescriptor|null|undefined} .google.api.resource + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype[".google.api.resource"] = null; + + /** + * Creates a new MessageOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.MessageOptions + * @static + * @param {google.protobuf.IMessageOptions=} [properties] Properties to set + * @returns {google.protobuf.MessageOptions} MessageOptions instance + */ + MessageOptions.create = function create(properties) { + return new MessageOptions(properties); + }; + + /** + * Encodes the specified MessageOptions message. Does not implicitly {@link google.protobuf.MessageOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.MessageOptions + * @static + * @param {google.protobuf.IMessageOptions} message MessageOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MessageOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.messageSetWireFormat != null && Object.hasOwnProperty.call(message, "messageSetWireFormat")) + writer.uint32(/* id 1, wireType 0 =*/8).bool(message.messageSetWireFormat); + if (message.noStandardDescriptorAccessor != null && Object.hasOwnProperty.call(message, "noStandardDescriptorAccessor")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.noStandardDescriptorAccessor); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 3, wireType 0 =*/24).bool(message.deprecated); + if (message.mapEntry != null && Object.hasOwnProperty.call(message, "mapEntry")) + writer.uint32(/* id 7, wireType 0 =*/56).bool(message.mapEntry); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.resource"] != null && Object.hasOwnProperty.call(message, ".google.api.resource")) + $root.google.api.ResourceDescriptor.encode(message[".google.api.resource"], writer.uint32(/* id 1053, wireType 2 =*/8426).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified MessageOptions message, length delimited. Does not implicitly {@link google.protobuf.MessageOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.MessageOptions + * @static + * @param {google.protobuf.IMessageOptions} message MessageOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MessageOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a MessageOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.MessageOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.MessageOptions} MessageOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MessageOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.MessageOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.messageSetWireFormat = reader.bool(); + break; + case 2: + message.noStandardDescriptorAccessor = reader.bool(); + break; + case 3: + message.deprecated = reader.bool(); + break; + case 7: + message.mapEntry = reader.bool(); + break; + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + case 1053: + message[".google.api.resource"] = $root.google.api.ResourceDescriptor.decode(reader, reader.uint32()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a MessageOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.MessageOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.MessageOptions} MessageOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MessageOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a MessageOptions message. + * @function verify + * @memberof google.protobuf.MessageOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + MessageOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.messageSetWireFormat != null && message.hasOwnProperty("messageSetWireFormat")) + if (typeof message.messageSetWireFormat !== "boolean") + return "messageSetWireFormat: boolean expected"; + if (message.noStandardDescriptorAccessor != null && message.hasOwnProperty("noStandardDescriptorAccessor")) + if (typeof message.noStandardDescriptorAccessor !== "boolean") + return "noStandardDescriptorAccessor: boolean expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.mapEntry != null && message.hasOwnProperty("mapEntry")) + if (typeof message.mapEntry !== "boolean") + return "mapEntry: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.resource"] != null && message.hasOwnProperty(".google.api.resource")) { + var error = $root.google.api.ResourceDescriptor.verify(message[".google.api.resource"]); + if (error) + return ".google.api.resource." + error; + } + return null; + }; + + /** + * Creates a MessageOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.MessageOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.MessageOptions} MessageOptions + */ + MessageOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.MessageOptions) + return object; + var message = new $root.google.protobuf.MessageOptions(); + if (object.messageSetWireFormat != null) + message.messageSetWireFormat = Boolean(object.messageSetWireFormat); + if (object.noStandardDescriptorAccessor != null) + message.noStandardDescriptorAccessor = Boolean(object.noStandardDescriptorAccessor); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.mapEntry != null) + message.mapEntry = Boolean(object.mapEntry); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.MessageOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.MessageOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.resource"] != null) { + if (typeof object[".google.api.resource"] !== "object") + throw TypeError(".google.protobuf.MessageOptions..google.api.resource: object expected"); + message[".google.api.resource"] = $root.google.api.ResourceDescriptor.fromObject(object[".google.api.resource"]); + } + return message; + }; + + /** + * Creates a plain object from a MessageOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.MessageOptions + * @static + * @param {google.protobuf.MessageOptions} message MessageOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + MessageOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (options.defaults) { + object.messageSetWireFormat = false; + object.noStandardDescriptorAccessor = false; + object.deprecated = false; + object.mapEntry = false; + object[".google.api.resource"] = null; + } + if (message.messageSetWireFormat != null && message.hasOwnProperty("messageSetWireFormat")) + object.messageSetWireFormat = message.messageSetWireFormat; + if (message.noStandardDescriptorAccessor != null && message.hasOwnProperty("noStandardDescriptorAccessor")) + object.noStandardDescriptorAccessor = message.noStandardDescriptorAccessor; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.mapEntry != null && message.hasOwnProperty("mapEntry")) + object.mapEntry = message.mapEntry; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.resource"] != null && message.hasOwnProperty(".google.api.resource")) + object[".google.api.resource"] = $root.google.api.ResourceDescriptor.toObject(message[".google.api.resource"], options); + return object; + }; + + /** + * Converts this MessageOptions to JSON. + * @function toJSON + * @memberof google.protobuf.MessageOptions + * @instance + * @returns {Object.} JSON object + */ + MessageOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return MessageOptions; + })(); + + protobuf.FieldOptions = (function() { + + /** + * Properties of a FieldOptions. + * @memberof google.protobuf + * @interface IFieldOptions + * @property {google.protobuf.FieldOptions.CType|null} [ctype] FieldOptions ctype + * @property {boolean|null} [packed] FieldOptions packed + * @property {google.protobuf.FieldOptions.JSType|null} [jstype] FieldOptions jstype + * @property {boolean|null} [lazy] FieldOptions lazy + * @property {boolean|null} [deprecated] FieldOptions deprecated + * @property {boolean|null} [weak] FieldOptions weak + * @property {Array.|null} [uninterpretedOption] FieldOptions uninterpretedOption + * @property {Array.|null} [".google.api.fieldBehavior"] FieldOptions .google.api.fieldBehavior + * @property {google.api.IResourceReference|null} [".google.api.resourceReference"] FieldOptions .google.api.resourceReference + */ + + /** + * Constructs a new FieldOptions. + * @memberof google.protobuf + * @classdesc Represents a FieldOptions. + * @implements IFieldOptions + * @constructor + * @param {google.protobuf.IFieldOptions=} [properties] Properties to set + */ + function FieldOptions(properties) { + this.uninterpretedOption = []; + this[".google.api.fieldBehavior"] = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FieldOptions ctype. + * @member {google.protobuf.FieldOptions.CType} ctype + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.ctype = 0; + + /** + * FieldOptions packed. + * @member {boolean} packed + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.packed = false; + + /** + * FieldOptions jstype. + * @member {google.protobuf.FieldOptions.JSType} jstype + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.jstype = 0; + + /** + * FieldOptions lazy. + * @member {boolean} lazy + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.lazy = false; + + /** + * FieldOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.deprecated = false; + + /** + * FieldOptions weak. + * @member {boolean} weak + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.weak = false; + + /** + * FieldOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * FieldOptions .google.api.fieldBehavior. + * @member {Array.} .google.api.fieldBehavior + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype[".google.api.fieldBehavior"] = $util.emptyArray; + + /** + * FieldOptions .google.api.resourceReference. + * @member {google.api.IResourceReference|null|undefined} .google.api.resourceReference + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype[".google.api.resourceReference"] = null; + + /** + * Creates a new FieldOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.FieldOptions + * @static + * @param {google.protobuf.IFieldOptions=} [properties] Properties to set + * @returns {google.protobuf.FieldOptions} FieldOptions instance + */ + FieldOptions.create = function create(properties) { + return new FieldOptions(properties); + }; + + /** + * Encodes the specified FieldOptions message. Does not implicitly {@link google.protobuf.FieldOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FieldOptions + * @static + * @param {google.protobuf.IFieldOptions} message FieldOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.ctype != null && Object.hasOwnProperty.call(message, "ctype")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.ctype); + if (message.packed != null && Object.hasOwnProperty.call(message, "packed")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.packed); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 3, wireType 0 =*/24).bool(message.deprecated); + if (message.lazy != null && Object.hasOwnProperty.call(message, "lazy")) + writer.uint32(/* id 5, wireType 0 =*/40).bool(message.lazy); + if (message.jstype != null && Object.hasOwnProperty.call(message, "jstype")) + writer.uint32(/* id 6, wireType 0 =*/48).int32(message.jstype); + if (message.weak != null && Object.hasOwnProperty.call(message, "weak")) + writer.uint32(/* id 10, wireType 0 =*/80).bool(message.weak); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.fieldBehavior"] != null && message[".google.api.fieldBehavior"].length) { + writer.uint32(/* id 1052, wireType 2 =*/8418).fork(); + for (var i = 0; i < message[".google.api.fieldBehavior"].length; ++i) + writer.int32(message[".google.api.fieldBehavior"][i]); + writer.ldelim(); + } + if (message[".google.api.resourceReference"] != null && Object.hasOwnProperty.call(message, ".google.api.resourceReference")) + $root.google.api.ResourceReference.encode(message[".google.api.resourceReference"], writer.uint32(/* id 1055, wireType 2 =*/8442).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified FieldOptions message, length delimited. Does not implicitly {@link google.protobuf.FieldOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FieldOptions + * @static + * @param {google.protobuf.IFieldOptions} message FieldOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FieldOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FieldOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FieldOptions} FieldOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FieldOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.ctype = reader.int32(); + break; + case 2: + message.packed = reader.bool(); + break; + case 6: + message.jstype = reader.int32(); + break; + case 5: + message.lazy = reader.bool(); + break; + case 3: + message.deprecated = reader.bool(); + break; + case 10: + message.weak = reader.bool(); + break; + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + case 1052: + if (!(message[".google.api.fieldBehavior"] && message[".google.api.fieldBehavior"].length)) + message[".google.api.fieldBehavior"] = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message[".google.api.fieldBehavior"].push(reader.int32()); + } else + message[".google.api.fieldBehavior"].push(reader.int32()); + break; + case 1055: + message[".google.api.resourceReference"] = $root.google.api.ResourceReference.decode(reader, reader.uint32()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FieldOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FieldOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FieldOptions} FieldOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FieldOptions message. + * @function verify + * @memberof google.protobuf.FieldOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FieldOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.ctype != null && message.hasOwnProperty("ctype")) + switch (message.ctype) { + default: + return "ctype: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.packed != null && message.hasOwnProperty("packed")) + if (typeof message.packed !== "boolean") + return "packed: boolean expected"; + if (message.jstype != null && message.hasOwnProperty("jstype")) + switch (message.jstype) { + default: + return "jstype: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.lazy != null && message.hasOwnProperty("lazy")) + if (typeof message.lazy !== "boolean") + return "lazy: boolean expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.weak != null && message.hasOwnProperty("weak")) + if (typeof message.weak !== "boolean") + return "weak: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.fieldBehavior"] != null && message.hasOwnProperty(".google.api.fieldBehavior")) { + if (!Array.isArray(message[".google.api.fieldBehavior"])) + return ".google.api.fieldBehavior: array expected"; + for (var i = 0; i < message[".google.api.fieldBehavior"].length; ++i) + switch (message[".google.api.fieldBehavior"][i]) { + default: + return ".google.api.fieldBehavior: enum value[] expected"; + case 0: + case 1: + case 2: + case 3: + case 4: + case 5: + case 6: + break; + } + } + if (message[".google.api.resourceReference"] != null && message.hasOwnProperty(".google.api.resourceReference")) { + var error = $root.google.api.ResourceReference.verify(message[".google.api.resourceReference"]); + if (error) + return ".google.api.resourceReference." + error; + } + return null; + }; + + /** + * Creates a FieldOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FieldOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FieldOptions} FieldOptions + */ + FieldOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FieldOptions) + return object; + var message = new $root.google.protobuf.FieldOptions(); + switch (object.ctype) { + case "STRING": + case 0: + message.ctype = 0; + break; + case "CORD": + case 1: + message.ctype = 1; + break; + case "STRING_PIECE": + case 2: + message.ctype = 2; + break; + } + if (object.packed != null) + message.packed = Boolean(object.packed); + switch (object.jstype) { + case "JS_NORMAL": + case 0: + message.jstype = 0; + break; + case "JS_STRING": + case 1: + message.jstype = 1; + break; + case "JS_NUMBER": + case 2: + message.jstype = 2; + break; + } + if (object.lazy != null) + message.lazy = Boolean(object.lazy); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.weak != null) + message.weak = Boolean(object.weak); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.FieldOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.FieldOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.fieldBehavior"]) { + if (!Array.isArray(object[".google.api.fieldBehavior"])) + throw TypeError(".google.protobuf.FieldOptions..google.api.fieldBehavior: array expected"); + message[".google.api.fieldBehavior"] = []; + for (var i = 0; i < object[".google.api.fieldBehavior"].length; ++i) + switch (object[".google.api.fieldBehavior"][i]) { + default: + case "FIELD_BEHAVIOR_UNSPECIFIED": + case 0: + message[".google.api.fieldBehavior"][i] = 0; + break; + case "OPTIONAL": + case 1: + message[".google.api.fieldBehavior"][i] = 1; + break; + case "REQUIRED": + case 2: + message[".google.api.fieldBehavior"][i] = 2; + break; + case "OUTPUT_ONLY": + case 3: + message[".google.api.fieldBehavior"][i] = 3; + break; + case "INPUT_ONLY": + case 4: + message[".google.api.fieldBehavior"][i] = 4; + break; + case "IMMUTABLE": + case 5: + message[".google.api.fieldBehavior"][i] = 5; + break; + case "UNORDERED_LIST": + case 6: + message[".google.api.fieldBehavior"][i] = 6; + break; + } + } + if (object[".google.api.resourceReference"] != null) { + if (typeof object[".google.api.resourceReference"] !== "object") + throw TypeError(".google.protobuf.FieldOptions..google.api.resourceReference: object expected"); + message[".google.api.resourceReference"] = $root.google.api.ResourceReference.fromObject(object[".google.api.resourceReference"]); + } + return message; + }; + + /** + * Creates a plain object from a FieldOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FieldOptions + * @static + * @param {google.protobuf.FieldOptions} message FieldOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FieldOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.uninterpretedOption = []; + object[".google.api.fieldBehavior"] = []; + } + if (options.defaults) { + object.ctype = options.enums === String ? "STRING" : 0; + object.packed = false; + object.deprecated = false; + object.lazy = false; + object.jstype = options.enums === String ? "JS_NORMAL" : 0; + object.weak = false; + object[".google.api.resourceReference"] = null; + } + if (message.ctype != null && message.hasOwnProperty("ctype")) + object.ctype = options.enums === String ? $root.google.protobuf.FieldOptions.CType[message.ctype] : message.ctype; + if (message.packed != null && message.hasOwnProperty("packed")) + object.packed = message.packed; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.lazy != null && message.hasOwnProperty("lazy")) + object.lazy = message.lazy; + if (message.jstype != null && message.hasOwnProperty("jstype")) + object.jstype = options.enums === String ? $root.google.protobuf.FieldOptions.JSType[message.jstype] : message.jstype; + if (message.weak != null && message.hasOwnProperty("weak")) + object.weak = message.weak; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.fieldBehavior"] && message[".google.api.fieldBehavior"].length) { + object[".google.api.fieldBehavior"] = []; + for (var j = 0; j < message[".google.api.fieldBehavior"].length; ++j) + object[".google.api.fieldBehavior"][j] = options.enums === String ? $root.google.api.FieldBehavior[message[".google.api.fieldBehavior"][j]] : message[".google.api.fieldBehavior"][j]; + } + if (message[".google.api.resourceReference"] != null && message.hasOwnProperty(".google.api.resourceReference")) + object[".google.api.resourceReference"] = $root.google.api.ResourceReference.toObject(message[".google.api.resourceReference"], options); + return object; + }; + + /** + * Converts this FieldOptions to JSON. + * @function toJSON + * @memberof google.protobuf.FieldOptions + * @instance + * @returns {Object.} JSON object + */ + FieldOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * CType enum. + * @name google.protobuf.FieldOptions.CType + * @enum {number} + * @property {number} STRING=0 STRING value + * @property {number} CORD=1 CORD value + * @property {number} STRING_PIECE=2 STRING_PIECE value + */ + FieldOptions.CType = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "STRING"] = 0; + values[valuesById[1] = "CORD"] = 1; + values[valuesById[2] = "STRING_PIECE"] = 2; + return values; + })(); + + /** + * JSType enum. + * @name google.protobuf.FieldOptions.JSType + * @enum {number} + * @property {number} JS_NORMAL=0 JS_NORMAL value + * @property {number} JS_STRING=1 JS_STRING value + * @property {number} JS_NUMBER=2 JS_NUMBER value + */ + FieldOptions.JSType = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "JS_NORMAL"] = 0; + values[valuesById[1] = "JS_STRING"] = 1; + values[valuesById[2] = "JS_NUMBER"] = 2; + return values; + })(); + + return FieldOptions; + })(); + + protobuf.OneofOptions = (function() { + + /** + * Properties of an OneofOptions. + * @memberof google.protobuf + * @interface IOneofOptions + * @property {Array.|null} [uninterpretedOption] OneofOptions uninterpretedOption + */ + + /** + * Constructs a new OneofOptions. + * @memberof google.protobuf + * @classdesc Represents an OneofOptions. + * @implements IOneofOptions + * @constructor + * @param {google.protobuf.IOneofOptions=} [properties] Properties to set + */ + function OneofOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * OneofOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.OneofOptions + * @instance + */ + OneofOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * Creates a new OneofOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.OneofOptions + * @static + * @param {google.protobuf.IOneofOptions=} [properties] Properties to set + * @returns {google.protobuf.OneofOptions} OneofOptions instance + */ + OneofOptions.create = function create(properties) { + return new OneofOptions(properties); + }; + + /** + * Encodes the specified OneofOptions message. Does not implicitly {@link google.protobuf.OneofOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.OneofOptions + * @static + * @param {google.protobuf.IOneofOptions} message OneofOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + OneofOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified OneofOptions message, length delimited. Does not implicitly {@link google.protobuf.OneofOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.OneofOptions + * @static + * @param {google.protobuf.IOneofOptions} message OneofOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + OneofOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an OneofOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.OneofOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.OneofOptions} OneofOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + OneofOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.OneofOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an OneofOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.OneofOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.OneofOptions} OneofOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + OneofOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an OneofOptions message. + * @function verify + * @memberof google.protobuf.OneofOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + OneofOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + return null; + }; + + /** + * Creates an OneofOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.OneofOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.OneofOptions} OneofOptions + */ + OneofOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.OneofOptions) + return object; + var message = new $root.google.protobuf.OneofOptions(); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.OneofOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.OneofOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an OneofOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.OneofOptions + * @static + * @param {google.protobuf.OneofOptions} message OneofOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + OneofOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + return object; + }; + + /** + * Converts this OneofOptions to JSON. + * @function toJSON + * @memberof google.protobuf.OneofOptions + * @instance + * @returns {Object.} JSON object + */ + OneofOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return OneofOptions; + })(); + + protobuf.EnumOptions = (function() { + + /** + * Properties of an EnumOptions. + * @memberof google.protobuf + * @interface IEnumOptions + * @property {boolean|null} [allowAlias] EnumOptions allowAlias + * @property {boolean|null} [deprecated] EnumOptions deprecated + * @property {Array.|null} [uninterpretedOption] EnumOptions uninterpretedOption + */ + + /** + * Constructs a new EnumOptions. + * @memberof google.protobuf + * @classdesc Represents an EnumOptions. + * @implements IEnumOptions + * @constructor + * @param {google.protobuf.IEnumOptions=} [properties] Properties to set + */ + function EnumOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumOptions allowAlias. + * @member {boolean} allowAlias + * @memberof google.protobuf.EnumOptions + * @instance + */ + EnumOptions.prototype.allowAlias = false; + + /** + * EnumOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.EnumOptions + * @instance + */ + EnumOptions.prototype.deprecated = false; + + /** + * EnumOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.EnumOptions + * @instance + */ + EnumOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * Creates a new EnumOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumOptions + * @static + * @param {google.protobuf.IEnumOptions=} [properties] Properties to set + * @returns {google.protobuf.EnumOptions} EnumOptions instance + */ + EnumOptions.create = function create(properties) { + return new EnumOptions(properties); + }; + + /** + * Encodes the specified EnumOptions message. Does not implicitly {@link google.protobuf.EnumOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumOptions + * @static + * @param {google.protobuf.IEnumOptions} message EnumOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.allowAlias != null && Object.hasOwnProperty.call(message, "allowAlias")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.allowAlias); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 3, wireType 0 =*/24).bool(message.deprecated); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified EnumOptions message, length delimited. Does not implicitly {@link google.protobuf.EnumOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumOptions + * @static + * @param {google.protobuf.IEnumOptions} message EnumOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumOptions} EnumOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 2: + message.allowAlias = reader.bool(); + break; + case 3: + message.deprecated = reader.bool(); + break; + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumOptions} EnumOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumOptions message. + * @function verify + * @memberof google.protobuf.EnumOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.allowAlias != null && message.hasOwnProperty("allowAlias")) + if (typeof message.allowAlias !== "boolean") + return "allowAlias: boolean expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + return null; + }; + + /** + * Creates an EnumOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumOptions} EnumOptions + */ + EnumOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumOptions) + return object; + var message = new $root.google.protobuf.EnumOptions(); + if (object.allowAlias != null) + message.allowAlias = Boolean(object.allowAlias); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.EnumOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.EnumOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an EnumOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumOptions + * @static + * @param {google.protobuf.EnumOptions} message EnumOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (options.defaults) { + object.allowAlias = false; + object.deprecated = false; + } + if (message.allowAlias != null && message.hasOwnProperty("allowAlias")) + object.allowAlias = message.allowAlias; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + return object; + }; + + /** + * Converts this EnumOptions to JSON. + * @function toJSON + * @memberof google.protobuf.EnumOptions + * @instance + * @returns {Object.} JSON object + */ + EnumOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return EnumOptions; + })(); + + protobuf.EnumValueOptions = (function() { + + /** + * Properties of an EnumValueOptions. + * @memberof google.protobuf + * @interface IEnumValueOptions + * @property {boolean|null} [deprecated] EnumValueOptions deprecated + * @property {Array.|null} [uninterpretedOption] EnumValueOptions uninterpretedOption + */ + + /** + * Constructs a new EnumValueOptions. + * @memberof google.protobuf + * @classdesc Represents an EnumValueOptions. + * @implements IEnumValueOptions + * @constructor + * @param {google.protobuf.IEnumValueOptions=} [properties] Properties to set + */ + function EnumValueOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumValueOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.EnumValueOptions + * @instance + */ + EnumValueOptions.prototype.deprecated = false; + + /** + * EnumValueOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.EnumValueOptions + * @instance + */ + EnumValueOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * Creates a new EnumValueOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {google.protobuf.IEnumValueOptions=} [properties] Properties to set + * @returns {google.protobuf.EnumValueOptions} EnumValueOptions instance + */ + EnumValueOptions.create = function create(properties) { + return new EnumValueOptions(properties); + }; + + /** + * Encodes the specified EnumValueOptions message. Does not implicitly {@link google.protobuf.EnumValueOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {google.protobuf.IEnumValueOptions} message EnumValueOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumValueOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 1, wireType 0 =*/8).bool(message.deprecated); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified EnumValueOptions message, length delimited. Does not implicitly {@link google.protobuf.EnumValueOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {google.protobuf.IEnumValueOptions} message EnumValueOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumValueOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumValueOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumValueOptions} EnumValueOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumValueOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumValueOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.deprecated = reader.bool(); + break; + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumValueOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumValueOptions} EnumValueOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumValueOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumValueOptions message. + * @function verify + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumValueOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + return null; + }; + + /** + * Creates an EnumValueOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumValueOptions} EnumValueOptions + */ + EnumValueOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumValueOptions) + return object; + var message = new $root.google.protobuf.EnumValueOptions(); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.EnumValueOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.EnumValueOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an EnumValueOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {google.protobuf.EnumValueOptions} message EnumValueOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumValueOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (options.defaults) + object.deprecated = false; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + return object; + }; + + /** + * Converts this EnumValueOptions to JSON. + * @function toJSON + * @memberof google.protobuf.EnumValueOptions + * @instance + * @returns {Object.} JSON object + */ + EnumValueOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return EnumValueOptions; + })(); + + protobuf.ServiceOptions = (function() { + + /** + * Properties of a ServiceOptions. + * @memberof google.protobuf + * @interface IServiceOptions + * @property {boolean|null} [deprecated] ServiceOptions deprecated + * @property {Array.|null} [uninterpretedOption] ServiceOptions uninterpretedOption + * @property {string|null} [".google.api.defaultHost"] ServiceOptions .google.api.defaultHost + * @property {string|null} [".google.api.oauthScopes"] ServiceOptions .google.api.oauthScopes + */ + + /** + * Constructs a new ServiceOptions. + * @memberof google.protobuf + * @classdesc Represents a ServiceOptions. + * @implements IServiceOptions + * @constructor + * @param {google.protobuf.IServiceOptions=} [properties] Properties to set + */ + function ServiceOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ServiceOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.ServiceOptions + * @instance + */ + ServiceOptions.prototype.deprecated = false; + + /** + * ServiceOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.ServiceOptions + * @instance + */ + ServiceOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * ServiceOptions .google.api.defaultHost. + * @member {string} .google.api.defaultHost + * @memberof google.protobuf.ServiceOptions + * @instance + */ + ServiceOptions.prototype[".google.api.defaultHost"] = ""; + + /** + * ServiceOptions .google.api.oauthScopes. + * @member {string} .google.api.oauthScopes + * @memberof google.protobuf.ServiceOptions + * @instance + */ + ServiceOptions.prototype[".google.api.oauthScopes"] = ""; + + /** + * Creates a new ServiceOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.ServiceOptions + * @static + * @param {google.protobuf.IServiceOptions=} [properties] Properties to set + * @returns {google.protobuf.ServiceOptions} ServiceOptions instance + */ + ServiceOptions.create = function create(properties) { + return new ServiceOptions(properties); + }; + + /** + * Encodes the specified ServiceOptions message. Does not implicitly {@link google.protobuf.ServiceOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.ServiceOptions + * @static + * @param {google.protobuf.IServiceOptions} message ServiceOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ServiceOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 33, wireType 0 =*/264).bool(message.deprecated); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.defaultHost"] != null && Object.hasOwnProperty.call(message, ".google.api.defaultHost")) + writer.uint32(/* id 1049, wireType 2 =*/8394).string(message[".google.api.defaultHost"]); + if (message[".google.api.oauthScopes"] != null && Object.hasOwnProperty.call(message, ".google.api.oauthScopes")) + writer.uint32(/* id 1050, wireType 2 =*/8402).string(message[".google.api.oauthScopes"]); + return writer; + }; + + /** + * Encodes the specified ServiceOptions message, length delimited. Does not implicitly {@link google.protobuf.ServiceOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.ServiceOptions + * @static + * @param {google.protobuf.IServiceOptions} message ServiceOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ServiceOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ServiceOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.ServiceOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.ServiceOptions} ServiceOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ServiceOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.ServiceOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 33: + message.deprecated = reader.bool(); + break; + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + case 1049: + message[".google.api.defaultHost"] = reader.string(); + break; + case 1050: + message[".google.api.oauthScopes"] = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ServiceOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.ServiceOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.ServiceOptions} ServiceOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ServiceOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ServiceOptions message. + * @function verify + * @memberof google.protobuf.ServiceOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ServiceOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.defaultHost"] != null && message.hasOwnProperty(".google.api.defaultHost")) + if (!$util.isString(message[".google.api.defaultHost"])) + return ".google.api.defaultHost: string expected"; + if (message[".google.api.oauthScopes"] != null && message.hasOwnProperty(".google.api.oauthScopes")) + if (!$util.isString(message[".google.api.oauthScopes"])) + return ".google.api.oauthScopes: string expected"; + return null; + }; + + /** + * Creates a ServiceOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.ServiceOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.ServiceOptions} ServiceOptions + */ + ServiceOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.ServiceOptions) + return object; + var message = new $root.google.protobuf.ServiceOptions(); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.ServiceOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.ServiceOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.defaultHost"] != null) + message[".google.api.defaultHost"] = String(object[".google.api.defaultHost"]); + if (object[".google.api.oauthScopes"] != null) + message[".google.api.oauthScopes"] = String(object[".google.api.oauthScopes"]); + return message; + }; + + /** + * Creates a plain object from a ServiceOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.ServiceOptions + * @static + * @param {google.protobuf.ServiceOptions} message ServiceOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ServiceOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (options.defaults) { + object.deprecated = false; + object[".google.api.defaultHost"] = ""; + object[".google.api.oauthScopes"] = ""; + } + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.defaultHost"] != null && message.hasOwnProperty(".google.api.defaultHost")) + object[".google.api.defaultHost"] = message[".google.api.defaultHost"]; + if (message[".google.api.oauthScopes"] != null && message.hasOwnProperty(".google.api.oauthScopes")) + object[".google.api.oauthScopes"] = message[".google.api.oauthScopes"]; + return object; + }; + + /** + * Converts this ServiceOptions to JSON. + * @function toJSON + * @memberof google.protobuf.ServiceOptions + * @instance + * @returns {Object.} JSON object + */ + ServiceOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return ServiceOptions; + })(); + + protobuf.MethodOptions = (function() { + + /** + * Properties of a MethodOptions. + * @memberof google.protobuf + * @interface IMethodOptions + * @property {boolean|null} [deprecated] MethodOptions deprecated + * @property {google.protobuf.MethodOptions.IdempotencyLevel|null} [idempotencyLevel] MethodOptions idempotencyLevel + * @property {Array.|null} [uninterpretedOption] MethodOptions uninterpretedOption + * @property {google.api.IHttpRule|null} [".google.api.http"] MethodOptions .google.api.http + * @property {Array.|null} [".google.api.methodSignature"] MethodOptions .google.api.methodSignature + */ + + /** + * Constructs a new MethodOptions. + * @memberof google.protobuf + * @classdesc Represents a MethodOptions. + * @implements IMethodOptions + * @constructor + * @param {google.protobuf.IMethodOptions=} [properties] Properties to set + */ + function MethodOptions(properties) { + this.uninterpretedOption = []; + this[".google.api.methodSignature"] = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * MethodOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype.deprecated = false; + + /** + * MethodOptions idempotencyLevel. + * @member {google.protobuf.MethodOptions.IdempotencyLevel} idempotencyLevel + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype.idempotencyLevel = 0; + + /** + * MethodOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * MethodOptions .google.api.http. + * @member {google.api.IHttpRule|null|undefined} .google.api.http + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype[".google.api.http"] = null; + + /** + * MethodOptions .google.api.methodSignature. + * @member {Array.} .google.api.methodSignature + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype[".google.api.methodSignature"] = $util.emptyArray; + + /** + * Creates a new MethodOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.MethodOptions + * @static + * @param {google.protobuf.IMethodOptions=} [properties] Properties to set + * @returns {google.protobuf.MethodOptions} MethodOptions instance + */ + MethodOptions.create = function create(properties) { + return new MethodOptions(properties); + }; + + /** + * Encodes the specified MethodOptions message. Does not implicitly {@link google.protobuf.MethodOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.MethodOptions + * @static + * @param {google.protobuf.IMethodOptions} message MethodOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MethodOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 33, wireType 0 =*/264).bool(message.deprecated); + if (message.idempotencyLevel != null && Object.hasOwnProperty.call(message, "idempotencyLevel")) + writer.uint32(/* id 34, wireType 0 =*/272).int32(message.idempotencyLevel); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.methodSignature"] != null && message[".google.api.methodSignature"].length) + for (var i = 0; i < message[".google.api.methodSignature"].length; ++i) + writer.uint32(/* id 1051, wireType 2 =*/8410).string(message[".google.api.methodSignature"][i]); + if (message[".google.api.http"] != null && Object.hasOwnProperty.call(message, ".google.api.http")) + $root.google.api.HttpRule.encode(message[".google.api.http"], writer.uint32(/* id 72295728, wireType 2 =*/578365826).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified MethodOptions message, length delimited. Does not implicitly {@link google.protobuf.MethodOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.MethodOptions + * @static + * @param {google.protobuf.IMethodOptions} message MethodOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MethodOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a MethodOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.MethodOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.MethodOptions} MethodOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MethodOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.MethodOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 33: + message.deprecated = reader.bool(); + break; + case 34: + message.idempotencyLevel = reader.int32(); + break; + case 999: + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + case 72295728: + message[".google.api.http"] = $root.google.api.HttpRule.decode(reader, reader.uint32()); + break; + case 1051: + if (!(message[".google.api.methodSignature"] && message[".google.api.methodSignature"].length)) + message[".google.api.methodSignature"] = []; + message[".google.api.methodSignature"].push(reader.string()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a MethodOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.MethodOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.MethodOptions} MethodOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MethodOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a MethodOptions message. + * @function verify + * @memberof google.protobuf.MethodOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + MethodOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.idempotencyLevel != null && message.hasOwnProperty("idempotencyLevel")) + switch (message.idempotencyLevel) { + default: + return "idempotencyLevel: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.http"] != null && message.hasOwnProperty(".google.api.http")) { + var error = $root.google.api.HttpRule.verify(message[".google.api.http"]); + if (error) + return ".google.api.http." + error; + } + if (message[".google.api.methodSignature"] != null && message.hasOwnProperty(".google.api.methodSignature")) { + if (!Array.isArray(message[".google.api.methodSignature"])) + return ".google.api.methodSignature: array expected"; + for (var i = 0; i < message[".google.api.methodSignature"].length; ++i) + if (!$util.isString(message[".google.api.methodSignature"][i])) + return ".google.api.methodSignature: string[] expected"; + } + return null; + }; + + /** + * Creates a MethodOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.MethodOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.MethodOptions} MethodOptions + */ + MethodOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.MethodOptions) + return object; + var message = new $root.google.protobuf.MethodOptions(); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + switch (object.idempotencyLevel) { + case "IDEMPOTENCY_UNKNOWN": + case 0: + message.idempotencyLevel = 0; + break; + case "NO_SIDE_EFFECTS": + case 1: + message.idempotencyLevel = 1; + break; + case "IDEMPOTENT": + case 2: + message.idempotencyLevel = 2; + break; + } + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.MethodOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.MethodOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.http"] != null) { + if (typeof object[".google.api.http"] !== "object") + throw TypeError(".google.protobuf.MethodOptions..google.api.http: object expected"); + message[".google.api.http"] = $root.google.api.HttpRule.fromObject(object[".google.api.http"]); + } + if (object[".google.api.methodSignature"]) { + if (!Array.isArray(object[".google.api.methodSignature"])) + throw TypeError(".google.protobuf.MethodOptions..google.api.methodSignature: array expected"); + message[".google.api.methodSignature"] = []; + for (var i = 0; i < object[".google.api.methodSignature"].length; ++i) + message[".google.api.methodSignature"][i] = String(object[".google.api.methodSignature"][i]); + } + return message; + }; + + /** + * Creates a plain object from a MethodOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.MethodOptions + * @static + * @param {google.protobuf.MethodOptions} message MethodOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + MethodOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.uninterpretedOption = []; + object[".google.api.methodSignature"] = []; + } + if (options.defaults) { + object.deprecated = false; + object.idempotencyLevel = options.enums === String ? "IDEMPOTENCY_UNKNOWN" : 0; + object[".google.api.http"] = null; + } + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.idempotencyLevel != null && message.hasOwnProperty("idempotencyLevel")) + object.idempotencyLevel = options.enums === String ? $root.google.protobuf.MethodOptions.IdempotencyLevel[message.idempotencyLevel] : message.idempotencyLevel; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.methodSignature"] && message[".google.api.methodSignature"].length) { + object[".google.api.methodSignature"] = []; + for (var j = 0; j < message[".google.api.methodSignature"].length; ++j) + object[".google.api.methodSignature"][j] = message[".google.api.methodSignature"][j]; + } + if (message[".google.api.http"] != null && message.hasOwnProperty(".google.api.http")) + object[".google.api.http"] = $root.google.api.HttpRule.toObject(message[".google.api.http"], options); + return object; + }; + + /** + * Converts this MethodOptions to JSON. + * @function toJSON + * @memberof google.protobuf.MethodOptions + * @instance + * @returns {Object.} JSON object + */ + MethodOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * IdempotencyLevel enum. + * @name google.protobuf.MethodOptions.IdempotencyLevel + * @enum {number} + * @property {number} IDEMPOTENCY_UNKNOWN=0 IDEMPOTENCY_UNKNOWN value + * @property {number} NO_SIDE_EFFECTS=1 NO_SIDE_EFFECTS value + * @property {number} IDEMPOTENT=2 IDEMPOTENT value + */ + MethodOptions.IdempotencyLevel = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "IDEMPOTENCY_UNKNOWN"] = 0; + values[valuesById[1] = "NO_SIDE_EFFECTS"] = 1; + values[valuesById[2] = "IDEMPOTENT"] = 2; + return values; + })(); + + return MethodOptions; + })(); + + protobuf.UninterpretedOption = (function() { + + /** + * Properties of an UninterpretedOption. + * @memberof google.protobuf + * @interface IUninterpretedOption + * @property {Array.|null} [name] UninterpretedOption name + * @property {string|null} [identifierValue] UninterpretedOption identifierValue + * @property {number|Long|null} [positiveIntValue] UninterpretedOption positiveIntValue + * @property {number|Long|null} [negativeIntValue] UninterpretedOption negativeIntValue + * @property {number|null} [doubleValue] UninterpretedOption doubleValue + * @property {Uint8Array|null} [stringValue] UninterpretedOption stringValue + * @property {string|null} [aggregateValue] UninterpretedOption aggregateValue + */ + + /** + * Constructs a new UninterpretedOption. + * @memberof google.protobuf + * @classdesc Represents an UninterpretedOption. + * @implements IUninterpretedOption + * @constructor + * @param {google.protobuf.IUninterpretedOption=} [properties] Properties to set + */ + function UninterpretedOption(properties) { + this.name = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * UninterpretedOption name. + * @member {Array.} name + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.name = $util.emptyArray; + + /** + * UninterpretedOption identifierValue. + * @member {string} identifierValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.identifierValue = ""; + + /** + * UninterpretedOption positiveIntValue. + * @member {number|Long} positiveIntValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.positiveIntValue = $util.Long ? $util.Long.fromBits(0,0,true) : 0; + + /** + * UninterpretedOption negativeIntValue. + * @member {number|Long} negativeIntValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.negativeIntValue = $util.Long ? $util.Long.fromBits(0,0,false) : 0; + + /** + * UninterpretedOption doubleValue. + * @member {number} doubleValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.doubleValue = 0; + + /** + * UninterpretedOption stringValue. + * @member {Uint8Array} stringValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.stringValue = $util.newBuffer([]); + + /** + * UninterpretedOption aggregateValue. + * @member {string} aggregateValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.aggregateValue = ""; + + /** + * Creates a new UninterpretedOption instance using the specified properties. + * @function create + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {google.protobuf.IUninterpretedOption=} [properties] Properties to set + * @returns {google.protobuf.UninterpretedOption} UninterpretedOption instance + */ + UninterpretedOption.create = function create(properties) { + return new UninterpretedOption(properties); + }; + + /** + * Encodes the specified UninterpretedOption message. Does not implicitly {@link google.protobuf.UninterpretedOption.verify|verify} messages. + * @function encode + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {google.protobuf.IUninterpretedOption} message UninterpretedOption message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + UninterpretedOption.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && message.name.length) + for (var i = 0; i < message.name.length; ++i) + $root.google.protobuf.UninterpretedOption.NamePart.encode(message.name[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.identifierValue != null && Object.hasOwnProperty.call(message, "identifierValue")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.identifierValue); + if (message.positiveIntValue != null && Object.hasOwnProperty.call(message, "positiveIntValue")) + writer.uint32(/* id 4, wireType 0 =*/32).uint64(message.positiveIntValue); + if (message.negativeIntValue != null && Object.hasOwnProperty.call(message, "negativeIntValue")) + writer.uint32(/* id 5, wireType 0 =*/40).int64(message.negativeIntValue); + if (message.doubleValue != null && Object.hasOwnProperty.call(message, "doubleValue")) + writer.uint32(/* id 6, wireType 1 =*/49).double(message.doubleValue); + if (message.stringValue != null && Object.hasOwnProperty.call(message, "stringValue")) + writer.uint32(/* id 7, wireType 2 =*/58).bytes(message.stringValue); + if (message.aggregateValue != null && Object.hasOwnProperty.call(message, "aggregateValue")) + writer.uint32(/* id 8, wireType 2 =*/66).string(message.aggregateValue); + return writer; + }; + + /** + * Encodes the specified UninterpretedOption message, length delimited. Does not implicitly {@link google.protobuf.UninterpretedOption.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {google.protobuf.IUninterpretedOption} message UninterpretedOption message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + UninterpretedOption.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an UninterpretedOption message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.UninterpretedOption} UninterpretedOption + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + UninterpretedOption.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.UninterpretedOption(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 2: + if (!(message.name && message.name.length)) + message.name = []; + message.name.push($root.google.protobuf.UninterpretedOption.NamePart.decode(reader, reader.uint32())); + break; + case 3: + message.identifierValue = reader.string(); + break; + case 4: + message.positiveIntValue = reader.uint64(); + break; + case 5: + message.negativeIntValue = reader.int64(); + break; + case 6: + message.doubleValue = reader.double(); + break; + case 7: + message.stringValue = reader.bytes(); + break; + case 8: + message.aggregateValue = reader.string(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an UninterpretedOption message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.UninterpretedOption} UninterpretedOption + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + UninterpretedOption.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an UninterpretedOption message. + * @function verify + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + UninterpretedOption.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) { + if (!Array.isArray(message.name)) + return "name: array expected"; + for (var i = 0; i < message.name.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.NamePart.verify(message.name[i]); + if (error) + return "name." + error; + } + } + if (message.identifierValue != null && message.hasOwnProperty("identifierValue")) + if (!$util.isString(message.identifierValue)) + return "identifierValue: string expected"; + if (message.positiveIntValue != null && message.hasOwnProperty("positiveIntValue")) + if (!$util.isInteger(message.positiveIntValue) && !(message.positiveIntValue && $util.isInteger(message.positiveIntValue.low) && $util.isInteger(message.positiveIntValue.high))) + return "positiveIntValue: integer|Long expected"; + if (message.negativeIntValue != null && message.hasOwnProperty("negativeIntValue")) + if (!$util.isInteger(message.negativeIntValue) && !(message.negativeIntValue && $util.isInteger(message.negativeIntValue.low) && $util.isInteger(message.negativeIntValue.high))) + return "negativeIntValue: integer|Long expected"; + if (message.doubleValue != null && message.hasOwnProperty("doubleValue")) + if (typeof message.doubleValue !== "number") + return "doubleValue: number expected"; + if (message.stringValue != null && message.hasOwnProperty("stringValue")) + if (!(message.stringValue && typeof message.stringValue.length === "number" || $util.isString(message.stringValue))) + return "stringValue: buffer expected"; + if (message.aggregateValue != null && message.hasOwnProperty("aggregateValue")) + if (!$util.isString(message.aggregateValue)) + return "aggregateValue: string expected"; + return null; + }; + + /** + * Creates an UninterpretedOption message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.UninterpretedOption} UninterpretedOption + */ + UninterpretedOption.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.UninterpretedOption) + return object; + var message = new $root.google.protobuf.UninterpretedOption(); + if (object.name) { + if (!Array.isArray(object.name)) + throw TypeError(".google.protobuf.UninterpretedOption.name: array expected"); + message.name = []; + for (var i = 0; i < object.name.length; ++i) { + if (typeof object.name[i] !== "object") + throw TypeError(".google.protobuf.UninterpretedOption.name: object expected"); + message.name[i] = $root.google.protobuf.UninterpretedOption.NamePart.fromObject(object.name[i]); + } + } + if (object.identifierValue != null) + message.identifierValue = String(object.identifierValue); + if (object.positiveIntValue != null) + if ($util.Long) + (message.positiveIntValue = $util.Long.fromValue(object.positiveIntValue)).unsigned = true; + else if (typeof object.positiveIntValue === "string") + message.positiveIntValue = parseInt(object.positiveIntValue, 10); + else if (typeof object.positiveIntValue === "number") + message.positiveIntValue = object.positiveIntValue; + else if (typeof object.positiveIntValue === "object") + message.positiveIntValue = new $util.LongBits(object.positiveIntValue.low >>> 0, object.positiveIntValue.high >>> 0).toNumber(true); + if (object.negativeIntValue != null) + if ($util.Long) + (message.negativeIntValue = $util.Long.fromValue(object.negativeIntValue)).unsigned = false; + else if (typeof object.negativeIntValue === "string") + message.negativeIntValue = parseInt(object.negativeIntValue, 10); + else if (typeof object.negativeIntValue === "number") + message.negativeIntValue = object.negativeIntValue; + else if (typeof object.negativeIntValue === "object") + message.negativeIntValue = new $util.LongBits(object.negativeIntValue.low >>> 0, object.negativeIntValue.high >>> 0).toNumber(); + if (object.doubleValue != null) + message.doubleValue = Number(object.doubleValue); + if (object.stringValue != null) + if (typeof object.stringValue === "string") + $util.base64.decode(object.stringValue, message.stringValue = $util.newBuffer($util.base64.length(object.stringValue)), 0); + else if (object.stringValue.length) + message.stringValue = object.stringValue; + if (object.aggregateValue != null) + message.aggregateValue = String(object.aggregateValue); + return message; + }; + + /** + * Creates a plain object from an UninterpretedOption message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {google.protobuf.UninterpretedOption} message UninterpretedOption + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + UninterpretedOption.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.name = []; + if (options.defaults) { + object.identifierValue = ""; + if ($util.Long) { + var long = new $util.Long(0, 0, true); + object.positiveIntValue = options.longs === String ? long.toString() : options.longs === Number ? long.toNumber() : long; + } else + object.positiveIntValue = options.longs === String ? "0" : 0; + if ($util.Long) { + var long = new $util.Long(0, 0, false); + object.negativeIntValue = options.longs === String ? long.toString() : options.longs === Number ? long.toNumber() : long; + } else + object.negativeIntValue = options.longs === String ? "0" : 0; + object.doubleValue = 0; + if (options.bytes === String) + object.stringValue = ""; + else { + object.stringValue = []; + if (options.bytes !== Array) + object.stringValue = $util.newBuffer(object.stringValue); + } + object.aggregateValue = ""; + } + if (message.name && message.name.length) { + object.name = []; + for (var j = 0; j < message.name.length; ++j) + object.name[j] = $root.google.protobuf.UninterpretedOption.NamePart.toObject(message.name[j], options); + } + if (message.identifierValue != null && message.hasOwnProperty("identifierValue")) + object.identifierValue = message.identifierValue; + if (message.positiveIntValue != null && message.hasOwnProperty("positiveIntValue")) + if (typeof message.positiveIntValue === "number") + object.positiveIntValue = options.longs === String ? String(message.positiveIntValue) : message.positiveIntValue; + else + object.positiveIntValue = options.longs === String ? $util.Long.prototype.toString.call(message.positiveIntValue) : options.longs === Number ? new $util.LongBits(message.positiveIntValue.low >>> 0, message.positiveIntValue.high >>> 0).toNumber(true) : message.positiveIntValue; + if (message.negativeIntValue != null && message.hasOwnProperty("negativeIntValue")) + if (typeof message.negativeIntValue === "number") + object.negativeIntValue = options.longs === String ? String(message.negativeIntValue) : message.negativeIntValue; + else + object.negativeIntValue = options.longs === String ? $util.Long.prototype.toString.call(message.negativeIntValue) : options.longs === Number ? new $util.LongBits(message.negativeIntValue.low >>> 0, message.negativeIntValue.high >>> 0).toNumber() : message.negativeIntValue; + if (message.doubleValue != null && message.hasOwnProperty("doubleValue")) + object.doubleValue = options.json && !isFinite(message.doubleValue) ? String(message.doubleValue) : message.doubleValue; + if (message.stringValue != null && message.hasOwnProperty("stringValue")) + object.stringValue = options.bytes === String ? $util.base64.encode(message.stringValue, 0, message.stringValue.length) : options.bytes === Array ? Array.prototype.slice.call(message.stringValue) : message.stringValue; + if (message.aggregateValue != null && message.hasOwnProperty("aggregateValue")) + object.aggregateValue = message.aggregateValue; + return object; + }; + + /** + * Converts this UninterpretedOption to JSON. + * @function toJSON + * @memberof google.protobuf.UninterpretedOption + * @instance + * @returns {Object.} JSON object + */ + UninterpretedOption.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + UninterpretedOption.NamePart = (function() { + + /** + * Properties of a NamePart. + * @memberof google.protobuf.UninterpretedOption + * @interface INamePart + * @property {string} namePart NamePart namePart + * @property {boolean} isExtension NamePart isExtension + */ + + /** + * Constructs a new NamePart. + * @memberof google.protobuf.UninterpretedOption + * @classdesc Represents a NamePart. + * @implements INamePart + * @constructor + * @param {google.protobuf.UninterpretedOption.INamePart=} [properties] Properties to set + */ + function NamePart(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * NamePart namePart. + * @member {string} namePart + * @memberof google.protobuf.UninterpretedOption.NamePart + * @instance + */ + NamePart.prototype.namePart = ""; + + /** + * NamePart isExtension. + * @member {boolean} isExtension + * @memberof google.protobuf.UninterpretedOption.NamePart + * @instance + */ + NamePart.prototype.isExtension = false; + + /** + * Creates a new NamePart instance using the specified properties. + * @function create + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {google.protobuf.UninterpretedOption.INamePart=} [properties] Properties to set + * @returns {google.protobuf.UninterpretedOption.NamePart} NamePart instance + */ + NamePart.create = function create(properties) { + return new NamePart(properties); + }; + + /** + * Encodes the specified NamePart message. Does not implicitly {@link google.protobuf.UninterpretedOption.NamePart.verify|verify} messages. + * @function encode + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {google.protobuf.UninterpretedOption.INamePart} message NamePart message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + NamePart.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + writer.uint32(/* id 1, wireType 2 =*/10).string(message.namePart); + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.isExtension); + return writer; + }; + + /** + * Encodes the specified NamePart message, length delimited. Does not implicitly {@link google.protobuf.UninterpretedOption.NamePart.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {google.protobuf.UninterpretedOption.INamePart} message NamePart message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + NamePart.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a NamePart message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.UninterpretedOption.NamePart} NamePart + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + NamePart.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.UninterpretedOption.NamePart(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.namePart = reader.string(); + break; + case 2: + message.isExtension = reader.bool(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + if (!message.hasOwnProperty("namePart")) + throw $util.ProtocolError("missing required 'namePart'", { instance: message }); + if (!message.hasOwnProperty("isExtension")) + throw $util.ProtocolError("missing required 'isExtension'", { instance: message }); + return message; + }; + + /** + * Decodes a NamePart message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.UninterpretedOption.NamePart} NamePart + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + NamePart.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a NamePart message. + * @function verify + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + NamePart.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (!$util.isString(message.namePart)) + return "namePart: string expected"; + if (typeof message.isExtension !== "boolean") + return "isExtension: boolean expected"; + return null; + }; + + /** + * Creates a NamePart message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.UninterpretedOption.NamePart} NamePart + */ + NamePart.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.UninterpretedOption.NamePart) + return object; + var message = new $root.google.protobuf.UninterpretedOption.NamePart(); + if (object.namePart != null) + message.namePart = String(object.namePart); + if (object.isExtension != null) + message.isExtension = Boolean(object.isExtension); + return message; + }; + + /** + * Creates a plain object from a NamePart message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {google.protobuf.UninterpretedOption.NamePart} message NamePart + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + NamePart.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.namePart = ""; + object.isExtension = false; + } + if (message.namePart != null && message.hasOwnProperty("namePart")) + object.namePart = message.namePart; + if (message.isExtension != null && message.hasOwnProperty("isExtension")) + object.isExtension = message.isExtension; + return object; + }; + + /** + * Converts this NamePart to JSON. + * @function toJSON + * @memberof google.protobuf.UninterpretedOption.NamePart + * @instance + * @returns {Object.} JSON object + */ + NamePart.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return NamePart; + })(); + + return UninterpretedOption; + })(); + + protobuf.SourceCodeInfo = (function() { + + /** + * Properties of a SourceCodeInfo. + * @memberof google.protobuf + * @interface ISourceCodeInfo + * @property {Array.|null} [location] SourceCodeInfo location + */ + + /** + * Constructs a new SourceCodeInfo. + * @memberof google.protobuf + * @classdesc Represents a SourceCodeInfo. + * @implements ISourceCodeInfo + * @constructor + * @param {google.protobuf.ISourceCodeInfo=} [properties] Properties to set + */ + function SourceCodeInfo(properties) { + this.location = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * SourceCodeInfo location. + * @member {Array.} location + * @memberof google.protobuf.SourceCodeInfo + * @instance + */ + SourceCodeInfo.prototype.location = $util.emptyArray; + + /** + * Creates a new SourceCodeInfo instance using the specified properties. + * @function create + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {google.protobuf.ISourceCodeInfo=} [properties] Properties to set + * @returns {google.protobuf.SourceCodeInfo} SourceCodeInfo instance + */ + SourceCodeInfo.create = function create(properties) { + return new SourceCodeInfo(properties); + }; + + /** + * Encodes the specified SourceCodeInfo message. Does not implicitly {@link google.protobuf.SourceCodeInfo.verify|verify} messages. + * @function encode + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {google.protobuf.ISourceCodeInfo} message SourceCodeInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + SourceCodeInfo.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.location != null && message.location.length) + for (var i = 0; i < message.location.length; ++i) + $root.google.protobuf.SourceCodeInfo.Location.encode(message.location[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified SourceCodeInfo message, length delimited. Does not implicitly {@link google.protobuf.SourceCodeInfo.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {google.protobuf.ISourceCodeInfo} message SourceCodeInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + SourceCodeInfo.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a SourceCodeInfo message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.SourceCodeInfo} SourceCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + SourceCodeInfo.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.SourceCodeInfo(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + if (!(message.location && message.location.length)) + message.location = []; + message.location.push($root.google.protobuf.SourceCodeInfo.Location.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a SourceCodeInfo message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.SourceCodeInfo} SourceCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + SourceCodeInfo.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a SourceCodeInfo message. + * @function verify + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + SourceCodeInfo.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.location != null && message.hasOwnProperty("location")) { + if (!Array.isArray(message.location)) + return "location: array expected"; + for (var i = 0; i < message.location.length; ++i) { + var error = $root.google.protobuf.SourceCodeInfo.Location.verify(message.location[i]); + if (error) + return "location." + error; + } + } + return null; + }; + + /** + * Creates a SourceCodeInfo message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.SourceCodeInfo} SourceCodeInfo + */ + SourceCodeInfo.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.SourceCodeInfo) + return object; + var message = new $root.google.protobuf.SourceCodeInfo(); + if (object.location) { + if (!Array.isArray(object.location)) + throw TypeError(".google.protobuf.SourceCodeInfo.location: array expected"); + message.location = []; + for (var i = 0; i < object.location.length; ++i) { + if (typeof object.location[i] !== "object") + throw TypeError(".google.protobuf.SourceCodeInfo.location: object expected"); + message.location[i] = $root.google.protobuf.SourceCodeInfo.Location.fromObject(object.location[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a SourceCodeInfo message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {google.protobuf.SourceCodeInfo} message SourceCodeInfo + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + SourceCodeInfo.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.location = []; + if (message.location && message.location.length) { + object.location = []; + for (var j = 0; j < message.location.length; ++j) + object.location[j] = $root.google.protobuf.SourceCodeInfo.Location.toObject(message.location[j], options); + } + return object; + }; + + /** + * Converts this SourceCodeInfo to JSON. + * @function toJSON + * @memberof google.protobuf.SourceCodeInfo + * @instance + * @returns {Object.} JSON object + */ + SourceCodeInfo.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + SourceCodeInfo.Location = (function() { + + /** + * Properties of a Location. + * @memberof google.protobuf.SourceCodeInfo + * @interface ILocation + * @property {Array.|null} [path] Location path + * @property {Array.|null} [span] Location span + * @property {string|null} [leadingComments] Location leadingComments + * @property {string|null} [trailingComments] Location trailingComments + * @property {Array.|null} [leadingDetachedComments] Location leadingDetachedComments + */ + + /** + * Constructs a new Location. + * @memberof google.protobuf.SourceCodeInfo + * @classdesc Represents a Location. + * @implements ILocation + * @constructor + * @param {google.protobuf.SourceCodeInfo.ILocation=} [properties] Properties to set + */ + function Location(properties) { + this.path = []; + this.span = []; + this.leadingDetachedComments = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Location path. + * @member {Array.} path + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.path = $util.emptyArray; + + /** + * Location span. + * @member {Array.} span + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.span = $util.emptyArray; + + /** + * Location leadingComments. + * @member {string} leadingComments + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.leadingComments = ""; + + /** + * Location trailingComments. + * @member {string} trailingComments + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.trailingComments = ""; + + /** + * Location leadingDetachedComments. + * @member {Array.} leadingDetachedComments + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.leadingDetachedComments = $util.emptyArray; + + /** + * Creates a new Location instance using the specified properties. + * @function create + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {google.protobuf.SourceCodeInfo.ILocation=} [properties] Properties to set + * @returns {google.protobuf.SourceCodeInfo.Location} Location instance + */ + Location.create = function create(properties) { + return new Location(properties); + }; + + /** + * Encodes the specified Location message. Does not implicitly {@link google.protobuf.SourceCodeInfo.Location.verify|verify} messages. + * @function encode + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {google.protobuf.SourceCodeInfo.ILocation} message Location message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Location.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.path != null && message.path.length) { + writer.uint32(/* id 1, wireType 2 =*/10).fork(); + for (var i = 0; i < message.path.length; ++i) + writer.int32(message.path[i]); + writer.ldelim(); + } + if (message.span != null && message.span.length) { + writer.uint32(/* id 2, wireType 2 =*/18).fork(); + for (var i = 0; i < message.span.length; ++i) + writer.int32(message.span[i]); + writer.ldelim(); + } + if (message.leadingComments != null && Object.hasOwnProperty.call(message, "leadingComments")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.leadingComments); + if (message.trailingComments != null && Object.hasOwnProperty.call(message, "trailingComments")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.trailingComments); + if (message.leadingDetachedComments != null && message.leadingDetachedComments.length) + for (var i = 0; i < message.leadingDetachedComments.length; ++i) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.leadingDetachedComments[i]); + return writer; + }; + + /** + * Encodes the specified Location message, length delimited. Does not implicitly {@link google.protobuf.SourceCodeInfo.Location.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {google.protobuf.SourceCodeInfo.ILocation} message Location message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Location.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Location message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.SourceCodeInfo.Location} Location + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Location.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.SourceCodeInfo.Location(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + if (!(message.path && message.path.length)) + message.path = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.path.push(reader.int32()); + } else + message.path.push(reader.int32()); + break; + case 2: + if (!(message.span && message.span.length)) + message.span = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.span.push(reader.int32()); + } else + message.span.push(reader.int32()); + break; + case 3: + message.leadingComments = reader.string(); + break; + case 4: + message.trailingComments = reader.string(); + break; + case 6: + if (!(message.leadingDetachedComments && message.leadingDetachedComments.length)) + message.leadingDetachedComments = []; + message.leadingDetachedComments.push(reader.string()); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Location message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.SourceCodeInfo.Location} Location + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Location.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Location message. + * @function verify + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Location.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.path != null && message.hasOwnProperty("path")) { + if (!Array.isArray(message.path)) + return "path: array expected"; + for (var i = 0; i < message.path.length; ++i) + if (!$util.isInteger(message.path[i])) + return "path: integer[] expected"; + } + if (message.span != null && message.hasOwnProperty("span")) { + if (!Array.isArray(message.span)) + return "span: array expected"; + for (var i = 0; i < message.span.length; ++i) + if (!$util.isInteger(message.span[i])) + return "span: integer[] expected"; + } + if (message.leadingComments != null && message.hasOwnProperty("leadingComments")) + if (!$util.isString(message.leadingComments)) + return "leadingComments: string expected"; + if (message.trailingComments != null && message.hasOwnProperty("trailingComments")) + if (!$util.isString(message.trailingComments)) + return "trailingComments: string expected"; + if (message.leadingDetachedComments != null && message.hasOwnProperty("leadingDetachedComments")) { + if (!Array.isArray(message.leadingDetachedComments)) + return "leadingDetachedComments: array expected"; + for (var i = 0; i < message.leadingDetachedComments.length; ++i) + if (!$util.isString(message.leadingDetachedComments[i])) + return "leadingDetachedComments: string[] expected"; + } + return null; + }; + + /** + * Creates a Location message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.SourceCodeInfo.Location} Location + */ + Location.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.SourceCodeInfo.Location) + return object; + var message = new $root.google.protobuf.SourceCodeInfo.Location(); + if (object.path) { + if (!Array.isArray(object.path)) + throw TypeError(".google.protobuf.SourceCodeInfo.Location.path: array expected"); + message.path = []; + for (var i = 0; i < object.path.length; ++i) + message.path[i] = object.path[i] | 0; + } + if (object.span) { + if (!Array.isArray(object.span)) + throw TypeError(".google.protobuf.SourceCodeInfo.Location.span: array expected"); + message.span = []; + for (var i = 0; i < object.span.length; ++i) + message.span[i] = object.span[i] | 0; + } + if (object.leadingComments != null) + message.leadingComments = String(object.leadingComments); + if (object.trailingComments != null) + message.trailingComments = String(object.trailingComments); + if (object.leadingDetachedComments) { + if (!Array.isArray(object.leadingDetachedComments)) + throw TypeError(".google.protobuf.SourceCodeInfo.Location.leadingDetachedComments: array expected"); + message.leadingDetachedComments = []; + for (var i = 0; i < object.leadingDetachedComments.length; ++i) + message.leadingDetachedComments[i] = String(object.leadingDetachedComments[i]); + } + return message; + }; + + /** + * Creates a plain object from a Location message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {google.protobuf.SourceCodeInfo.Location} message Location + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Location.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.path = []; + object.span = []; + object.leadingDetachedComments = []; + } + if (options.defaults) { + object.leadingComments = ""; + object.trailingComments = ""; + } + if (message.path && message.path.length) { + object.path = []; + for (var j = 0; j < message.path.length; ++j) + object.path[j] = message.path[j]; + } + if (message.span && message.span.length) { + object.span = []; + for (var j = 0; j < message.span.length; ++j) + object.span[j] = message.span[j]; + } + if (message.leadingComments != null && message.hasOwnProperty("leadingComments")) + object.leadingComments = message.leadingComments; + if (message.trailingComments != null && message.hasOwnProperty("trailingComments")) + object.trailingComments = message.trailingComments; + if (message.leadingDetachedComments && message.leadingDetachedComments.length) { + object.leadingDetachedComments = []; + for (var j = 0; j < message.leadingDetachedComments.length; ++j) + object.leadingDetachedComments[j] = message.leadingDetachedComments[j]; + } + return object; + }; + + /** + * Converts this Location to JSON. + * @function toJSON + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + * @returns {Object.} JSON object + */ + Location.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Location; + })(); + + return SourceCodeInfo; + })(); + + protobuf.GeneratedCodeInfo = (function() { + + /** + * Properties of a GeneratedCodeInfo. + * @memberof google.protobuf + * @interface IGeneratedCodeInfo + * @property {Array.|null} [annotation] GeneratedCodeInfo annotation + */ + + /** + * Constructs a new GeneratedCodeInfo. + * @memberof google.protobuf + * @classdesc Represents a GeneratedCodeInfo. + * @implements IGeneratedCodeInfo + * @constructor + * @param {google.protobuf.IGeneratedCodeInfo=} [properties] Properties to set + */ + function GeneratedCodeInfo(properties) { + this.annotation = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * GeneratedCodeInfo annotation. + * @member {Array.} annotation + * @memberof google.protobuf.GeneratedCodeInfo + * @instance + */ + GeneratedCodeInfo.prototype.annotation = $util.emptyArray; + + /** + * Creates a new GeneratedCodeInfo instance using the specified properties. + * @function create + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {google.protobuf.IGeneratedCodeInfo=} [properties] Properties to set + * @returns {google.protobuf.GeneratedCodeInfo} GeneratedCodeInfo instance + */ + GeneratedCodeInfo.create = function create(properties) { + return new GeneratedCodeInfo(properties); + }; + + /** + * Encodes the specified GeneratedCodeInfo message. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.verify|verify} messages. + * @function encode + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {google.protobuf.IGeneratedCodeInfo} message GeneratedCodeInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GeneratedCodeInfo.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.annotation != null && message.annotation.length) + for (var i = 0; i < message.annotation.length; ++i) + $root.google.protobuf.GeneratedCodeInfo.Annotation.encode(message.annotation[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified GeneratedCodeInfo message, length delimited. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {google.protobuf.IGeneratedCodeInfo} message GeneratedCodeInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GeneratedCodeInfo.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a GeneratedCodeInfo message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.GeneratedCodeInfo} GeneratedCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GeneratedCodeInfo.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.GeneratedCodeInfo(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + if (!(message.annotation && message.annotation.length)) + message.annotation = []; + message.annotation.push($root.google.protobuf.GeneratedCodeInfo.Annotation.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a GeneratedCodeInfo message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.GeneratedCodeInfo} GeneratedCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GeneratedCodeInfo.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a GeneratedCodeInfo message. + * @function verify + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + GeneratedCodeInfo.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.annotation != null && message.hasOwnProperty("annotation")) { + if (!Array.isArray(message.annotation)) + return "annotation: array expected"; + for (var i = 0; i < message.annotation.length; ++i) { + var error = $root.google.protobuf.GeneratedCodeInfo.Annotation.verify(message.annotation[i]); + if (error) + return "annotation." + error; + } + } + return null; + }; + + /** + * Creates a GeneratedCodeInfo message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.GeneratedCodeInfo} GeneratedCodeInfo + */ + GeneratedCodeInfo.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.GeneratedCodeInfo) + return object; + var message = new $root.google.protobuf.GeneratedCodeInfo(); + if (object.annotation) { + if (!Array.isArray(object.annotation)) + throw TypeError(".google.protobuf.GeneratedCodeInfo.annotation: array expected"); + message.annotation = []; + for (var i = 0; i < object.annotation.length; ++i) { + if (typeof object.annotation[i] !== "object") + throw TypeError(".google.protobuf.GeneratedCodeInfo.annotation: object expected"); + message.annotation[i] = $root.google.protobuf.GeneratedCodeInfo.Annotation.fromObject(object.annotation[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a GeneratedCodeInfo message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {google.protobuf.GeneratedCodeInfo} message GeneratedCodeInfo + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + GeneratedCodeInfo.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.annotation = []; + if (message.annotation && message.annotation.length) { + object.annotation = []; + for (var j = 0; j < message.annotation.length; ++j) + object.annotation[j] = $root.google.protobuf.GeneratedCodeInfo.Annotation.toObject(message.annotation[j], options); + } + return object; + }; + + /** + * Converts this GeneratedCodeInfo to JSON. + * @function toJSON + * @memberof google.protobuf.GeneratedCodeInfo + * @instance + * @returns {Object.} JSON object + */ + GeneratedCodeInfo.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + GeneratedCodeInfo.Annotation = (function() { + + /** + * Properties of an Annotation. + * @memberof google.protobuf.GeneratedCodeInfo + * @interface IAnnotation + * @property {Array.|null} [path] Annotation path + * @property {string|null} [sourceFile] Annotation sourceFile + * @property {number|null} [begin] Annotation begin + * @property {number|null} [end] Annotation end + */ + + /** + * Constructs a new Annotation. + * @memberof google.protobuf.GeneratedCodeInfo + * @classdesc Represents an Annotation. + * @implements IAnnotation + * @constructor + * @param {google.protobuf.GeneratedCodeInfo.IAnnotation=} [properties] Properties to set + */ + function Annotation(properties) { + this.path = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Annotation path. + * @member {Array.} path + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.path = $util.emptyArray; + + /** + * Annotation sourceFile. + * @member {string} sourceFile + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.sourceFile = ""; + + /** + * Annotation begin. + * @member {number} begin + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.begin = 0; + + /** + * Annotation end. + * @member {number} end + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.end = 0; + + /** + * Creates a new Annotation instance using the specified properties. + * @function create + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {google.protobuf.GeneratedCodeInfo.IAnnotation=} [properties] Properties to set + * @returns {google.protobuf.GeneratedCodeInfo.Annotation} Annotation instance + */ + Annotation.create = function create(properties) { + return new Annotation(properties); + }; + + /** + * Encodes the specified Annotation message. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.Annotation.verify|verify} messages. + * @function encode + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {google.protobuf.GeneratedCodeInfo.IAnnotation} message Annotation message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Annotation.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.path != null && message.path.length) { + writer.uint32(/* id 1, wireType 2 =*/10).fork(); + for (var i = 0; i < message.path.length; ++i) + writer.int32(message.path[i]); + writer.ldelim(); + } + if (message.sourceFile != null && Object.hasOwnProperty.call(message, "sourceFile")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.sourceFile); + if (message.begin != null && Object.hasOwnProperty.call(message, "begin")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.begin); + if (message.end != null && Object.hasOwnProperty.call(message, "end")) + writer.uint32(/* id 4, wireType 0 =*/32).int32(message.end); + return writer; + }; + + /** + * Encodes the specified Annotation message, length delimited. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.Annotation.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {google.protobuf.GeneratedCodeInfo.IAnnotation} message Annotation message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Annotation.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an Annotation message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.GeneratedCodeInfo.Annotation} Annotation + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Annotation.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.GeneratedCodeInfo.Annotation(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + if (!(message.path && message.path.length)) + message.path = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.path.push(reader.int32()); + } else + message.path.push(reader.int32()); + break; + case 2: + message.sourceFile = reader.string(); + break; + case 3: + message.begin = reader.int32(); + break; + case 4: + message.end = reader.int32(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an Annotation message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.GeneratedCodeInfo.Annotation} Annotation + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Annotation.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an Annotation message. + * @function verify + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Annotation.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.path != null && message.hasOwnProperty("path")) { + if (!Array.isArray(message.path)) + return "path: array expected"; + for (var i = 0; i < message.path.length; ++i) + if (!$util.isInteger(message.path[i])) + return "path: integer[] expected"; + } + if (message.sourceFile != null && message.hasOwnProperty("sourceFile")) + if (!$util.isString(message.sourceFile)) + return "sourceFile: string expected"; + if (message.begin != null && message.hasOwnProperty("begin")) + if (!$util.isInteger(message.begin)) + return "begin: integer expected"; + if (message.end != null && message.hasOwnProperty("end")) + if (!$util.isInteger(message.end)) + return "end: integer expected"; + return null; + }; + + /** + * Creates an Annotation message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.GeneratedCodeInfo.Annotation} Annotation + */ + Annotation.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.GeneratedCodeInfo.Annotation) + return object; + var message = new $root.google.protobuf.GeneratedCodeInfo.Annotation(); + if (object.path) { + if (!Array.isArray(object.path)) + throw TypeError(".google.protobuf.GeneratedCodeInfo.Annotation.path: array expected"); + message.path = []; + for (var i = 0; i < object.path.length; ++i) + message.path[i] = object.path[i] | 0; + } + if (object.sourceFile != null) + message.sourceFile = String(object.sourceFile); + if (object.begin != null) + message.begin = object.begin | 0; + if (object.end != null) + message.end = object.end | 0; + return message; + }; + + /** + * Creates a plain object from an Annotation message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {google.protobuf.GeneratedCodeInfo.Annotation} message Annotation + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Annotation.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.path = []; + if (options.defaults) { + object.sourceFile = ""; + object.begin = 0; + object.end = 0; + } + if (message.path && message.path.length) { + object.path = []; + for (var j = 0; j < message.path.length; ++j) + object.path[j] = message.path[j]; + } + if (message.sourceFile != null && message.hasOwnProperty("sourceFile")) + object.sourceFile = message.sourceFile; + if (message.begin != null && message.hasOwnProperty("begin")) + object.begin = message.begin; + if (message.end != null && message.hasOwnProperty("end")) + object.end = message.end; + return object; + }; + + /** + * Converts this Annotation to JSON. + * @function toJSON + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + * @returns {Object.} JSON object + */ + Annotation.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Annotation; + })(); + + return GeneratedCodeInfo; + })(); + + protobuf.Duration = (function() { + + /** + * Properties of a Duration. + * @memberof google.protobuf + * @interface IDuration + * @property {number|Long|null} [seconds] Duration seconds + * @property {number|null} [nanos] Duration nanos + */ + + /** + * Constructs a new Duration. + * @memberof google.protobuf + * @classdesc Represents a Duration. + * @implements IDuration + * @constructor + * @param {google.protobuf.IDuration=} [properties] Properties to set + */ + function Duration(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Duration seconds. + * @member {number|Long} seconds + * @memberof google.protobuf.Duration + * @instance + */ + Duration.prototype.seconds = $util.Long ? $util.Long.fromBits(0,0,false) : 0; + + /** + * Duration nanos. + * @member {number} nanos + * @memberof google.protobuf.Duration + * @instance + */ + Duration.prototype.nanos = 0; + + /** + * Creates a new Duration instance using the specified properties. + * @function create + * @memberof google.protobuf.Duration + * @static + * @param {google.protobuf.IDuration=} [properties] Properties to set + * @returns {google.protobuf.Duration} Duration instance + */ + Duration.create = function create(properties) { + return new Duration(properties); + }; + + /** + * Encodes the specified Duration message. Does not implicitly {@link google.protobuf.Duration.verify|verify} messages. + * @function encode + * @memberof google.protobuf.Duration + * @static + * @param {google.protobuf.IDuration} message Duration message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Duration.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.seconds != null && Object.hasOwnProperty.call(message, "seconds")) + writer.uint32(/* id 1, wireType 0 =*/8).int64(message.seconds); + if (message.nanos != null && Object.hasOwnProperty.call(message, "nanos")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.nanos); + return writer; + }; + + /** + * Encodes the specified Duration message, length delimited. Does not implicitly {@link google.protobuf.Duration.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.Duration + * @static + * @param {google.protobuf.IDuration} message Duration message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Duration.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Duration message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.Duration + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.Duration} Duration + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Duration.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.Duration(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.seconds = reader.int64(); + break; + case 2: + message.nanos = reader.int32(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Duration message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.Duration + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.Duration} Duration + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Duration.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Duration message. + * @function verify + * @memberof google.protobuf.Duration + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Duration.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.seconds != null && message.hasOwnProperty("seconds")) + if (!$util.isInteger(message.seconds) && !(message.seconds && $util.isInteger(message.seconds.low) && $util.isInteger(message.seconds.high))) + return "seconds: integer|Long expected"; + if (message.nanos != null && message.hasOwnProperty("nanos")) + if (!$util.isInteger(message.nanos)) + return "nanos: integer expected"; + return null; + }; + + /** + * Creates a Duration message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.Duration + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.Duration} Duration + */ + Duration.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.Duration) + return object; + var message = new $root.google.protobuf.Duration(); + if (object.seconds != null) + if ($util.Long) + (message.seconds = $util.Long.fromValue(object.seconds)).unsigned = false; + else if (typeof object.seconds === "string") + message.seconds = parseInt(object.seconds, 10); + else if (typeof object.seconds === "number") + message.seconds = object.seconds; + else if (typeof object.seconds === "object") + message.seconds = new $util.LongBits(object.seconds.low >>> 0, object.seconds.high >>> 0).toNumber(); + if (object.nanos != null) + message.nanos = object.nanos | 0; + return message; + }; + + /** + * Creates a plain object from a Duration message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.Duration + * @static + * @param {google.protobuf.Duration} message Duration + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Duration.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + if ($util.Long) { + var long = new $util.Long(0, 0, false); + object.seconds = options.longs === String ? long.toString() : options.longs === Number ? long.toNumber() : long; + } else + object.seconds = options.longs === String ? "0" : 0; + object.nanos = 0; + } + if (message.seconds != null && message.hasOwnProperty("seconds")) + if (typeof message.seconds === "number") + object.seconds = options.longs === String ? String(message.seconds) : message.seconds; + else + object.seconds = options.longs === String ? $util.Long.prototype.toString.call(message.seconds) : options.longs === Number ? new $util.LongBits(message.seconds.low >>> 0, message.seconds.high >>> 0).toNumber() : message.seconds; + if (message.nanos != null && message.hasOwnProperty("nanos")) + object.nanos = message.nanos; + return object; + }; + + /** + * Converts this Duration to JSON. + * @function toJSON + * @memberof google.protobuf.Duration + * @instance + * @returns {Object.} JSON object + */ + Duration.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Duration; + })(); + + protobuf.Any = (function() { + + /** + * Properties of an Any. + * @memberof google.protobuf + * @interface IAny + * @property {string|null} [type_url] Any type_url + * @property {Uint8Array|null} [value] Any value + */ + + /** + * Constructs a new Any. + * @memberof google.protobuf + * @classdesc Represents an Any. + * @implements IAny + * @constructor + * @param {google.protobuf.IAny=} [properties] Properties to set + */ + function Any(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Any type_url. + * @member {string} type_url + * @memberof google.protobuf.Any + * @instance + */ + Any.prototype.type_url = ""; + + /** + * Any value. + * @member {Uint8Array} value + * @memberof google.protobuf.Any + * @instance + */ + Any.prototype.value = $util.newBuffer([]); + + /** + * Creates a new Any instance using the specified properties. + * @function create + * @memberof google.protobuf.Any + * @static + * @param {google.protobuf.IAny=} [properties] Properties to set + * @returns {google.protobuf.Any} Any instance + */ + Any.create = function create(properties) { + return new Any(properties); + }; + + /** + * Encodes the specified Any message. Does not implicitly {@link google.protobuf.Any.verify|verify} messages. + * @function encode + * @memberof google.protobuf.Any + * @static + * @param {google.protobuf.IAny} message Any message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Any.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.type_url != null && Object.hasOwnProperty.call(message, "type_url")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.type_url); + if (message.value != null && Object.hasOwnProperty.call(message, "value")) + writer.uint32(/* id 2, wireType 2 =*/18).bytes(message.value); + return writer; + }; + + /** + * Encodes the specified Any message, length delimited. Does not implicitly {@link google.protobuf.Any.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.Any + * @static + * @param {google.protobuf.IAny} message Any message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Any.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an Any message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.Any + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.Any} Any + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Any.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.Any(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.type_url = reader.string(); + break; + case 2: + message.value = reader.bytes(); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an Any message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.Any + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.Any} Any + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Any.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an Any message. + * @function verify + * @memberof google.protobuf.Any + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Any.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.type_url != null && message.hasOwnProperty("type_url")) + if (!$util.isString(message.type_url)) + return "type_url: string expected"; + if (message.value != null && message.hasOwnProperty("value")) + if (!(message.value && typeof message.value.length === "number" || $util.isString(message.value))) + return "value: buffer expected"; + return null; + }; + + /** + * Creates an Any message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.Any + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.Any} Any + */ + Any.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.Any) + return object; + var message = new $root.google.protobuf.Any(); + if (object.type_url != null) + message.type_url = String(object.type_url); + if (object.value != null) + if (typeof object.value === "string") + $util.base64.decode(object.value, message.value = $util.newBuffer($util.base64.length(object.value)), 0); + else if (object.value.length) + message.value = object.value; + return message; + }; + + /** + * Creates a plain object from an Any message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.Any + * @static + * @param {google.protobuf.Any} message Any + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Any.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.type_url = ""; + if (options.bytes === String) + object.value = ""; + else { + object.value = []; + if (options.bytes !== Array) + object.value = $util.newBuffer(object.value); + } + } + if (message.type_url != null && message.hasOwnProperty("type_url")) + object.type_url = message.type_url; + if (message.value != null && message.hasOwnProperty("value")) + object.value = options.bytes === String ? $util.base64.encode(message.value, 0, message.value.length) : options.bytes === Array ? Array.prototype.slice.call(message.value) : message.value; + return object; + }; + + /** + * Converts this Any to JSON. + * @function toJSON + * @memberof google.protobuf.Any + * @instance + * @returns {Object.} JSON object + */ + Any.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Any; + })(); + + return protobuf; + })(); + + google.rpc = (function() { + + /** + * Namespace rpc. + * @memberof google + * @namespace + */ + var rpc = {}; + + rpc.Status = (function() { + + /** + * Properties of a Status. + * @memberof google.rpc + * @interface IStatus + * @property {number|null} [code] Status code + * @property {string|null} [message] Status message + * @property {Array.|null} [details] Status details + */ + + /** + * Constructs a new Status. + * @memberof google.rpc + * @classdesc Represents a Status. + * @implements IStatus + * @constructor + * @param {google.rpc.IStatus=} [properties] Properties to set + */ + function Status(properties) { + this.details = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Status code. + * @member {number} code + * @memberof google.rpc.Status + * @instance + */ + Status.prototype.code = 0; + + /** + * Status message. + * @member {string} message + * @memberof google.rpc.Status + * @instance + */ + Status.prototype.message = ""; + + /** + * Status details. + * @member {Array.} details + * @memberof google.rpc.Status + * @instance + */ + Status.prototype.details = $util.emptyArray; + + /** + * Creates a new Status instance using the specified properties. + * @function create + * @memberof google.rpc.Status + * @static + * @param {google.rpc.IStatus=} [properties] Properties to set + * @returns {google.rpc.Status} Status instance + */ + Status.create = function create(properties) { + return new Status(properties); + }; + + /** + * Encodes the specified Status message. Does not implicitly {@link google.rpc.Status.verify|verify} messages. + * @function encode + * @memberof google.rpc.Status + * @static + * @param {google.rpc.IStatus} message Status message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Status.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.code != null && Object.hasOwnProperty.call(message, "code")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.code); + if (message.message != null && Object.hasOwnProperty.call(message, "message")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.message); + if (message.details != null && message.details.length) + for (var i = 0; i < message.details.length; ++i) + $root.google.protobuf.Any.encode(message.details[i], writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified Status message, length delimited. Does not implicitly {@link google.rpc.Status.verify|verify} messages. + * @function encodeDelimited + * @memberof google.rpc.Status + * @static + * @param {google.rpc.IStatus} message Status message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Status.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Status message from the specified reader or buffer. + * @function decode + * @memberof google.rpc.Status + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.rpc.Status} Status + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Status.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.rpc.Status(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: + message.code = reader.int32(); + break; + case 2: + message.message = reader.string(); + break; + case 3: + if (!(message.details && message.details.length)) + message.details = []; + message.details.push($root.google.protobuf.Any.decode(reader, reader.uint32())); + break; + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Status message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.rpc.Status + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.rpc.Status} Status + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Status.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Status message. + * @function verify + * @memberof google.rpc.Status + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Status.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.code != null && message.hasOwnProperty("code")) + if (!$util.isInteger(message.code)) + return "code: integer expected"; + if (message.message != null && message.hasOwnProperty("message")) + if (!$util.isString(message.message)) + return "message: string expected"; + if (message.details != null && message.hasOwnProperty("details")) { + if (!Array.isArray(message.details)) + return "details: array expected"; + for (var i = 0; i < message.details.length; ++i) { + var error = $root.google.protobuf.Any.verify(message.details[i]); + if (error) + return "details." + error; + } + } + return null; + }; + + /** + * Creates a Status message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.rpc.Status + * @static + * @param {Object.} object Plain object + * @returns {google.rpc.Status} Status + */ + Status.fromObject = function fromObject(object) { + if (object instanceof $root.google.rpc.Status) + return object; + var message = new $root.google.rpc.Status(); + if (object.code != null) + message.code = object.code | 0; + if (object.message != null) + message.message = String(object.message); + if (object.details) { + if (!Array.isArray(object.details)) + throw TypeError(".google.rpc.Status.details: array expected"); + message.details = []; + for (var i = 0; i < object.details.length; ++i) { + if (typeof object.details[i] !== "object") + throw TypeError(".google.rpc.Status.details: object expected"); + message.details[i] = $root.google.protobuf.Any.fromObject(object.details[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a Status message. Also converts values to other types if specified. + * @function toObject + * @memberof google.rpc.Status + * @static + * @param {google.rpc.Status} message Status + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Status.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.details = []; + if (options.defaults) { + object.code = 0; + object.message = ""; + } + if (message.code != null && message.hasOwnProperty("code")) + object.code = message.code; + if (message.message != null && message.hasOwnProperty("message")) + object.message = message.message; + if (message.details && message.details.length) { + object.details = []; + for (var j = 0; j < message.details.length; ++j) + object.details[j] = $root.google.protobuf.Any.toObject(message.details[j], options); + } + return object; + }; + + /** + * Converts this Status to JSON. + * @function toJSON + * @memberof google.rpc.Status + * @instance + * @returns {Object.} JSON object + */ + Status.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + return Status; + })(); + + return rpc; + })(); + + return google; + })(); + + return $root; +}); diff --git a/packages/google-cloud-apigeeconnect/protos/protos.json b/packages/google-cloud-apigeeconnect/protos/protos.json new file mode 100644 index 00000000000..a1d9e2de184 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/protos/protos.json @@ -0,0 +1,1487 @@ +{ + "nested": { + "google": { + "nested": { + "cloud": { + "nested": { + "apigeeconnect": { + "nested": { + "v1": { + "options": { + "csharp_namespace": "Google.Cloud.ApigeeConnect.V1", + "go_package": "google.golang.org/genproto/googleapis/cloud/apigeeconnect/v1;apigeeconnect", + "java_multiple_files": true, + "java_outer_classname": "TetherProto", + "java_package": "com.google.cloud.apigeeconnect.v1", + "php_namespace": "Google\\Cloud\\ApigeeConnect\\V1", + "ruby_package": "Google::Cloud::ApigeeConnect::V1", + "(google.api.resource_definition).type": "apigeeconnect.googleapis.com/Endpoint", + "(google.api.resource_definition).pattern": "projects/{project}/endpoints/{endpoint}" + }, + "nested": { + "ConnectionService": { + "options": { + "(google.api.default_host)": "apigeeconnect.googleapis.com", + "(google.api.oauth_scopes)": "https://www.googleapis.com/auth/cloud-platform" + }, + "methods": { + "ListConnections": { + "requestType": "ListConnectionsRequest", + "responseType": "ListConnectionsResponse", + "options": { + "(google.api.http).get": "/v1/{parent=projects/*/endpoints/*}/connections", + "(google.api.method_signature)": "parent" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "get": "/v1/{parent=projects/*/endpoints/*}/connections" + } + }, + { + "(google.api.method_signature)": "parent" + } + ] + } + } + }, + "ListConnectionsRequest": { + "fields": { + "parent": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "apigeeconnect.googleapis.com/Endpoint" + } + }, + "pageSize": { + "type": "int32", + "id": 2 + }, + "pageToken": { + "type": "string", + "id": 3 + } + } + }, + "ListConnectionsResponse": { + "fields": { + "connections": { + "rule": "repeated", + "type": "Connection", + "id": 1 + }, + "nextPageToken": { + "type": "string", + "id": 2 + } + } + }, + "Connection": { + "fields": { + "endpoint": { + "type": "string", + "id": 1 + }, + "cluster": { + "type": "Cluster", + "id": 2 + }, + "streamCount": { + "type": "int32", + "id": 3 + } + } + }, + "Cluster": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "region": { + "type": "string", + "id": 2 + } + } + }, + "Tether": { + "options": { + "(google.api.default_host)": "apigeeconnect.googleapis.com", + "(google.api.oauth_scopes)": "https://www.googleapis.com/auth/cloud-platform" + }, + "methods": { + "Egress": { + "requestType": "EgressResponse", + "requestStream": true, + "responseType": "EgressRequest", + "responseStream": true + } + } + }, + "EgressRequest": { + "fields": { + "id": { + "type": "string", + "id": 1 + }, + "payload": { + "type": "Payload", + "id": 2 + }, + "endpoint": { + "type": "TetherEndpoint", + "id": 3 + }, + "project": { + "type": "string", + "id": 4 + }, + "traceId": { + "type": "string", + "id": 5 + }, + "timeout": { + "type": "google.protobuf.Duration", + "id": 6 + } + } + }, + "Payload": { + "oneofs": { + "kind": { + "oneof": [ + "httpRequest", + "streamInfo", + "action" + ] + } + }, + "fields": { + "httpRequest": { + "type": "HttpRequest", + "id": 1 + }, + "streamInfo": { + "type": "StreamInfo", + "id": 2 + }, + "action": { + "type": "Action", + "id": 3 + } + } + }, + "StreamInfo": { + "fields": { + "id": { + "type": "string", + "id": 1 + } + } + }, + "Action": { + "values": { + "ACTION_UNSPECIFIED": 0, + "OPEN_NEW_STREAM": 1 + } + }, + "EgressResponse": { + "fields": { + "id": { + "type": "string", + "id": 1 + }, + "httpResponse": { + "type": "HttpResponse", + "id": 2 + }, + "status": { + "type": "google.rpc.Status", + "id": 3 + }, + "project": { + "type": "string", + "id": 4 + }, + "traceId": { + "type": "string", + "id": 5 + }, + "endpoint": { + "type": "TetherEndpoint", + "id": 6 + }, + "name": { + "type": "string", + "id": 7 + } + } + }, + "TetherEndpoint": { + "values": { + "TETHER_ENDPOINT_UNSPECIFIED": 0, + "APIGEE_MART": 1, + "APIGEE_RUNTIME": 2, + "APIGEE_MINT_RATING": 3 + } + }, + "Scheme": { + "values": { + "SCHEME_UNSPECIFIED": 0, + "HTTPS": 1 + } + }, + "HttpRequest": { + "fields": { + "id": { + "type": "string", + "id": 1 + }, + "method": { + "type": "string", + "id": 2 + }, + "url": { + "type": "Url", + "id": 3 + }, + "headers": { + "rule": "repeated", + "type": "Header", + "id": 4 + }, + "body": { + "type": "bytes", + "id": 5 + } + } + }, + "Url": { + "fields": { + "scheme": { + "type": "Scheme", + "id": 1 + }, + "host": { + "type": "string", + "id": 2 + }, + "path": { + "type": "string", + "id": 3 + } + } + }, + "Header": { + "fields": { + "key": { + "type": "string", + "id": 1 + }, + "values": { + "rule": "repeated", + "type": "string", + "id": 2 + } + } + }, + "HttpResponse": { + "fields": { + "id": { + "type": "string", + "id": 1 + }, + "status": { + "type": "string", + "id": 2 + }, + "statusCode": { + "type": "int32", + "id": 3 + }, + "body": { + "type": "bytes", + "id": 4 + }, + "headers": { + "rule": "repeated", + "type": "Header", + "id": 5 + }, + "contentLength": { + "type": "int64", + "id": 6 + } + } + } + } + } + } + } + } + }, + "api": { + "options": { + "go_package": "google.golang.org/genproto/googleapis/api/annotations;annotations", + "java_multiple_files": true, + "java_outer_classname": "ResourceProto", + "java_package": "com.google.api", + "objc_class_prefix": "GAPI", + "cc_enable_arenas": true + }, + "nested": { + "http": { + "type": "HttpRule", + "id": 72295728, + "extend": "google.protobuf.MethodOptions" + }, + "Http": { + "fields": { + "rules": { + "rule": "repeated", + "type": "HttpRule", + "id": 1 + }, + "fullyDecodeReservedExpansion": { + "type": "bool", + "id": 2 + } + } + }, + "HttpRule": { + "oneofs": { + "pattern": { + "oneof": [ + "get", + "put", + "post", + "delete", + "patch", + "custom" + ] + } + }, + "fields": { + "selector": { + "type": "string", + "id": 1 + }, + "get": { + "type": "string", + "id": 2 + }, + "put": { + "type": "string", + "id": 3 + }, + "post": { + "type": "string", + "id": 4 + }, + "delete": { + "type": "string", + "id": 5 + }, + "patch": { + "type": "string", + "id": 6 + }, + "custom": { + "type": "CustomHttpPattern", + "id": 8 + }, + "body": { + "type": "string", + "id": 7 + }, + "responseBody": { + "type": "string", + "id": 12 + }, + "additionalBindings": { + "rule": "repeated", + "type": "HttpRule", + "id": 11 + } + } + }, + "CustomHttpPattern": { + "fields": { + "kind": { + "type": "string", + "id": 1 + }, + "path": { + "type": "string", + "id": 2 + } + } + }, + "methodSignature": { + "rule": "repeated", + "type": "string", + "id": 1051, + "extend": "google.protobuf.MethodOptions" + }, + "defaultHost": { + "type": "string", + "id": 1049, + "extend": "google.protobuf.ServiceOptions" + }, + "oauthScopes": { + "type": "string", + "id": 1050, + "extend": "google.protobuf.ServiceOptions" + }, + "fieldBehavior": { + "rule": "repeated", + "type": "google.api.FieldBehavior", + "id": 1052, + "extend": "google.protobuf.FieldOptions" + }, + "FieldBehavior": { + "values": { + "FIELD_BEHAVIOR_UNSPECIFIED": 0, + "OPTIONAL": 1, + "REQUIRED": 2, + "OUTPUT_ONLY": 3, + "INPUT_ONLY": 4, + "IMMUTABLE": 5, + "UNORDERED_LIST": 6 + } + }, + "resourceReference": { + "type": "google.api.ResourceReference", + "id": 1055, + "extend": "google.protobuf.FieldOptions" + }, + "resourceDefinition": { + "rule": "repeated", + "type": "google.api.ResourceDescriptor", + "id": 1053, + "extend": "google.protobuf.FileOptions" + }, + "resource": { + "type": "google.api.ResourceDescriptor", + "id": 1053, + "extend": "google.protobuf.MessageOptions" + }, + "ResourceDescriptor": { + "fields": { + "type": { + "type": "string", + "id": 1 + }, + "pattern": { + "rule": "repeated", + "type": "string", + "id": 2 + }, + "nameField": { + "type": "string", + "id": 3 + }, + "history": { + "type": "History", + "id": 4 + }, + "plural": { + "type": "string", + "id": 5 + }, + "singular": { + "type": "string", + "id": 6 + }, + "style": { + "rule": "repeated", + "type": "Style", + "id": 10 + } + }, + "nested": { + "History": { + "values": { + "HISTORY_UNSPECIFIED": 0, + "ORIGINALLY_SINGLE_PATTERN": 1, + "FUTURE_MULTI_PATTERN": 2 + } + }, + "Style": { + "values": { + "STYLE_UNSPECIFIED": 0, + "DECLARATIVE_FRIENDLY": 1 + } + } + } + }, + "ResourceReference": { + "fields": { + "type": { + "type": "string", + "id": 1 + }, + "childType": { + "type": "string", + "id": 2 + } + } + } + } + }, + "protobuf": { + "options": { + "go_package": "google.golang.org/protobuf/types/descriptorpb", + "java_package": "com.google.protobuf", + "java_outer_classname": "DescriptorProtos", + "csharp_namespace": "Google.Protobuf.Reflection", + "objc_class_prefix": "GPB", + "cc_enable_arenas": true, + "optimize_for": "SPEED" + }, + "nested": { + "FileDescriptorSet": { + "fields": { + "file": { + "rule": "repeated", + "type": "FileDescriptorProto", + "id": 1 + } + } + }, + "FileDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "package": { + "type": "string", + "id": 2 + }, + "dependency": { + "rule": "repeated", + "type": "string", + "id": 3 + }, + "publicDependency": { + "rule": "repeated", + "type": "int32", + "id": 10, + "options": { + "packed": false + } + }, + "weakDependency": { + "rule": "repeated", + "type": "int32", + "id": 11, + "options": { + "packed": false + } + }, + "messageType": { + "rule": "repeated", + "type": "DescriptorProto", + "id": 4 + }, + "enumType": { + "rule": "repeated", + "type": "EnumDescriptorProto", + "id": 5 + }, + "service": { + "rule": "repeated", + "type": "ServiceDescriptorProto", + "id": 6 + }, + "extension": { + "rule": "repeated", + "type": "FieldDescriptorProto", + "id": 7 + }, + "options": { + "type": "FileOptions", + "id": 8 + }, + "sourceCodeInfo": { + "type": "SourceCodeInfo", + "id": 9 + }, + "syntax": { + "type": "string", + "id": 12 + } + } + }, + "DescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "field": { + "rule": "repeated", + "type": "FieldDescriptorProto", + "id": 2 + }, + "extension": { + "rule": "repeated", + "type": "FieldDescriptorProto", + "id": 6 + }, + "nestedType": { + "rule": "repeated", + "type": "DescriptorProto", + "id": 3 + }, + "enumType": { + "rule": "repeated", + "type": "EnumDescriptorProto", + "id": 4 + }, + "extensionRange": { + "rule": "repeated", + "type": "ExtensionRange", + "id": 5 + }, + "oneofDecl": { + "rule": "repeated", + "type": "OneofDescriptorProto", + "id": 8 + }, + "options": { + "type": "MessageOptions", + "id": 7 + }, + "reservedRange": { + "rule": "repeated", + "type": "ReservedRange", + "id": 9 + }, + "reservedName": { + "rule": "repeated", + "type": "string", + "id": 10 + } + }, + "nested": { + "ExtensionRange": { + "fields": { + "start": { + "type": "int32", + "id": 1 + }, + "end": { + "type": "int32", + "id": 2 + }, + "options": { + "type": "ExtensionRangeOptions", + "id": 3 + } + } + }, + "ReservedRange": { + "fields": { + "start": { + "type": "int32", + "id": 1 + }, + "end": { + "type": "int32", + "id": 2 + } + } + } + } + }, + "ExtensionRangeOptions": { + "fields": { + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ] + }, + "FieldDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "number": { + "type": "int32", + "id": 3 + }, + "label": { + "type": "Label", + "id": 4 + }, + "type": { + "type": "Type", + "id": 5 + }, + "typeName": { + "type": "string", + "id": 6 + }, + "extendee": { + "type": "string", + "id": 2 + }, + "defaultValue": { + "type": "string", + "id": 7 + }, + "oneofIndex": { + "type": "int32", + "id": 9 + }, + "jsonName": { + "type": "string", + "id": 10 + }, + "options": { + "type": "FieldOptions", + "id": 8 + }, + "proto3Optional": { + "type": "bool", + "id": 17 + } + }, + "nested": { + "Type": { + "values": { + "TYPE_DOUBLE": 1, + "TYPE_FLOAT": 2, + "TYPE_INT64": 3, + "TYPE_UINT64": 4, + "TYPE_INT32": 5, + "TYPE_FIXED64": 6, + "TYPE_FIXED32": 7, + "TYPE_BOOL": 8, + "TYPE_STRING": 9, + "TYPE_GROUP": 10, + "TYPE_MESSAGE": 11, + "TYPE_BYTES": 12, + "TYPE_UINT32": 13, + "TYPE_ENUM": 14, + "TYPE_SFIXED32": 15, + "TYPE_SFIXED64": 16, + "TYPE_SINT32": 17, + "TYPE_SINT64": 18 + } + }, + "Label": { + "values": { + "LABEL_OPTIONAL": 1, + "LABEL_REQUIRED": 2, + "LABEL_REPEATED": 3 + } + } + } + }, + "OneofDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "options": { + "type": "OneofOptions", + "id": 2 + } + } + }, + "EnumDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "value": { + "rule": "repeated", + "type": "EnumValueDescriptorProto", + "id": 2 + }, + "options": { + "type": "EnumOptions", + "id": 3 + }, + "reservedRange": { + "rule": "repeated", + "type": "EnumReservedRange", + "id": 4 + }, + "reservedName": { + "rule": "repeated", + "type": "string", + "id": 5 + } + }, + "nested": { + "EnumReservedRange": { + "fields": { + "start": { + "type": "int32", + "id": 1 + }, + "end": { + "type": "int32", + "id": 2 + } + } + } + } + }, + "EnumValueDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "number": { + "type": "int32", + "id": 2 + }, + "options": { + "type": "EnumValueOptions", + "id": 3 + } + } + }, + "ServiceDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "method": { + "rule": "repeated", + "type": "MethodDescriptorProto", + "id": 2 + }, + "options": { + "type": "ServiceOptions", + "id": 3 + } + } + }, + "MethodDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "inputType": { + "type": "string", + "id": 2 + }, + "outputType": { + "type": "string", + "id": 3 + }, + "options": { + "type": "MethodOptions", + "id": 4 + }, + "clientStreaming": { + "type": "bool", + "id": 5, + "options": { + "default": false + } + }, + "serverStreaming": { + "type": "bool", + "id": 6, + "options": { + "default": false + } + } + } + }, + "FileOptions": { + "fields": { + "javaPackage": { + "type": "string", + "id": 1 + }, + "javaOuterClassname": { + "type": "string", + "id": 8 + }, + "javaMultipleFiles": { + "type": "bool", + "id": 10, + "options": { + "default": false + } + }, + "javaGenerateEqualsAndHash": { + "type": "bool", + "id": 20, + "options": { + "deprecated": true + } + }, + "javaStringCheckUtf8": { + "type": "bool", + "id": 27, + "options": { + "default": false + } + }, + "optimizeFor": { + "type": "OptimizeMode", + "id": 9, + "options": { + "default": "SPEED" + } + }, + "goPackage": { + "type": "string", + "id": 11 + }, + "ccGenericServices": { + "type": "bool", + "id": 16, + "options": { + "default": false + } + }, + "javaGenericServices": { + "type": "bool", + "id": 17, + "options": { + "default": false + } + }, + "pyGenericServices": { + "type": "bool", + "id": 18, + "options": { + "default": false + } + }, + "phpGenericServices": { + "type": "bool", + "id": 42, + "options": { + "default": false + } + }, + "deprecated": { + "type": "bool", + "id": 23, + "options": { + "default": false + } + }, + "ccEnableArenas": { + "type": "bool", + "id": 31, + "options": { + "default": true + } + }, + "objcClassPrefix": { + "type": "string", + "id": 36 + }, + "csharpNamespace": { + "type": "string", + "id": 37 + }, + "swiftPrefix": { + "type": "string", + "id": 39 + }, + "phpClassPrefix": { + "type": "string", + "id": 40 + }, + "phpNamespace": { + "type": "string", + "id": 41 + }, + "phpMetadataNamespace": { + "type": "string", + "id": 44 + }, + "rubyPackage": { + "type": "string", + "id": 45 + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "reserved": [ + [ + 38, + 38 + ] + ], + "nested": { + "OptimizeMode": { + "values": { + "SPEED": 1, + "CODE_SIZE": 2, + "LITE_RUNTIME": 3 + } + } + } + }, + "MessageOptions": { + "fields": { + "messageSetWireFormat": { + "type": "bool", + "id": 1, + "options": { + "default": false + } + }, + "noStandardDescriptorAccessor": { + "type": "bool", + "id": 2, + "options": { + "default": false + } + }, + "deprecated": { + "type": "bool", + "id": 3, + "options": { + "default": false + } + }, + "mapEntry": { + "type": "bool", + "id": 7 + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "reserved": [ + [ + 8, + 8 + ], + [ + 9, + 9 + ] + ] + }, + "FieldOptions": { + "fields": { + "ctype": { + "type": "CType", + "id": 1, + "options": { + "default": "STRING" + } + }, + "packed": { + "type": "bool", + "id": 2 + }, + "jstype": { + "type": "JSType", + "id": 6, + "options": { + "default": "JS_NORMAL" + } + }, + "lazy": { + "type": "bool", + "id": 5, + "options": { + "default": false + } + }, + "deprecated": { + "type": "bool", + "id": 3, + "options": { + "default": false + } + }, + "weak": { + "type": "bool", + "id": 10, + "options": { + "default": false + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "reserved": [ + [ + 4, + 4 + ] + ], + "nested": { + "CType": { + "values": { + "STRING": 0, + "CORD": 1, + "STRING_PIECE": 2 + } + }, + "JSType": { + "values": { + "JS_NORMAL": 0, + "JS_STRING": 1, + "JS_NUMBER": 2 + } + } + } + }, + "OneofOptions": { + "fields": { + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ] + }, + "EnumOptions": { + "fields": { + "allowAlias": { + "type": "bool", + "id": 2 + }, + "deprecated": { + "type": "bool", + "id": 3, + "options": { + "default": false + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "reserved": [ + [ + 5, + 5 + ] + ] + }, + "EnumValueOptions": { + "fields": { + "deprecated": { + "type": "bool", + "id": 1, + "options": { + "default": false + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ] + }, + "ServiceOptions": { + "fields": { + "deprecated": { + "type": "bool", + "id": 33, + "options": { + "default": false + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ] + }, + "MethodOptions": { + "fields": { + "deprecated": { + "type": "bool", + "id": 33, + "options": { + "default": false + } + }, + "idempotencyLevel": { + "type": "IdempotencyLevel", + "id": 34, + "options": { + "default": "IDEMPOTENCY_UNKNOWN" + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "nested": { + "IdempotencyLevel": { + "values": { + "IDEMPOTENCY_UNKNOWN": 0, + "NO_SIDE_EFFECTS": 1, + "IDEMPOTENT": 2 + } + } + } + }, + "UninterpretedOption": { + "fields": { + "name": { + "rule": "repeated", + "type": "NamePart", + "id": 2 + }, + "identifierValue": { + "type": "string", + "id": 3 + }, + "positiveIntValue": { + "type": "uint64", + "id": 4 + }, + "negativeIntValue": { + "type": "int64", + "id": 5 + }, + "doubleValue": { + "type": "double", + "id": 6 + }, + "stringValue": { + "type": "bytes", + "id": 7 + }, + "aggregateValue": { + "type": "string", + "id": 8 + } + }, + "nested": { + "NamePart": { + "fields": { + "namePart": { + "rule": "required", + "type": "string", + "id": 1 + }, + "isExtension": { + "rule": "required", + "type": "bool", + "id": 2 + } + } + } + } + }, + "SourceCodeInfo": { + "fields": { + "location": { + "rule": "repeated", + "type": "Location", + "id": 1 + } + }, + "nested": { + "Location": { + "fields": { + "path": { + "rule": "repeated", + "type": "int32", + "id": 1 + }, + "span": { + "rule": "repeated", + "type": "int32", + "id": 2 + }, + "leadingComments": { + "type": "string", + "id": 3 + }, + "trailingComments": { + "type": "string", + "id": 4 + }, + "leadingDetachedComments": { + "rule": "repeated", + "type": "string", + "id": 6 + } + } + } + } + }, + "GeneratedCodeInfo": { + "fields": { + "annotation": { + "rule": "repeated", + "type": "Annotation", + "id": 1 + } + }, + "nested": { + "Annotation": { + "fields": { + "path": { + "rule": "repeated", + "type": "int32", + "id": 1 + }, + "sourceFile": { + "type": "string", + "id": 2 + }, + "begin": { + "type": "int32", + "id": 3 + }, + "end": { + "type": "int32", + "id": 4 + } + } + } + } + }, + "Duration": { + "fields": { + "seconds": { + "type": "int64", + "id": 1 + }, + "nanos": { + "type": "int32", + "id": 2 + } + } + }, + "Any": { + "fields": { + "type_url": { + "type": "string", + "id": 1 + }, + "value": { + "type": "bytes", + "id": 2 + } + } + } + } + }, + "rpc": { + "options": { + "cc_enable_arenas": true, + "go_package": "google.golang.org/genproto/googleapis/rpc/status;status", + "java_multiple_files": true, + "java_outer_classname": "StatusProto", + "java_package": "com.google.rpc", + "objc_class_prefix": "RPC" + }, + "nested": { + "Status": { + "fields": { + "code": { + "type": "int32", + "id": 1 + }, + "message": { + "type": "string", + "id": 2 + }, + "details": { + "rule": "repeated", + "type": "google.protobuf.Any", + "id": 3 + } + } + } + } + } + } + } + } +} \ No newline at end of file diff --git a/packages/google-cloud-apigeeconnect/samples/README.md b/packages/google-cloud-apigeeconnect/samples/README.md new file mode 100644 index 00000000000..5f286957e50 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/samples/README.md @@ -0,0 +1,50 @@ +[//]: # "This README.md file is auto-generated, all changes to this file will be lost." +[//]: # "To regenerate it, use `python -m synthtool`." +Google Cloud Platform logo + +# [Apigee Connect API: Node.js Samples](https://github.com/googleapis/nodejs-apigee-connect) + +[![Open in Cloud Shell][shell_img]][shell_link] + + + +## Table of Contents + +* [Before you begin](#before-you-begin) +* [Samples](#samples) + * [Quickstart](#quickstart) + +## Before you begin + +Before running the samples, make sure you've followed the steps outlined in +[Using the client library](https://github.com/googleapis/nodejs-apigee-connect#using-the-client-library). + +`cd samples` + +`npm install` + +`cd ..` + +## Samples + + + +### Quickstart + +View the [source code](https://github.com/googleapis/nodejs-apigee-connect/blob/master/samples/quickstart.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/nodejs-apigee-connect&page=editor&open_in_editor=samples/quickstart.js,samples/README.md) + +__Usage:__ + + +`node samples/quickstart.js` + + + + + + +[shell_img]: https://gstatic.com/cloudssh/images/open-btn.png +[shell_link]: https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/nodejs-apigee-connect&page=editor&open_in_editor=samples/README.md +[product-docs]: https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect/ diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json new file mode 100644 index 00000000000..1ad246a5934 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -0,0 +1,23 @@ +{ + "name": "nodejs-apigee-connect", + "private": true, + "license": "Apache-2.0", + "author": "Google LLC", + "engines": { + "node": ">=10" + }, + "files": [ + "*.js" + ], + "scripts": { + "test": "c8 mocha --timeout 600000 test/*.js" + }, + "dependencies": { + "@google-cloud/apigee-connect": "^0.1.0" + }, + "devDependencies": { + "c8": "^7.1.0", + "chai": "^4.2.0", + "mocha": "^8.0.0" + } +} diff --git a/packages/google-cloud-apigeeconnect/samples/quickstart.js b/packages/google-cloud-apigeeconnect/samples/quickstart.js new file mode 100644 index 00000000000..3f8927c4dc9 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/samples/quickstart.js @@ -0,0 +1,50 @@ +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +'use strict'; + +async function main() { + + // [START nodejs_apigee_connect_quickstart] + // Imports the Google Cloud client library + + // remove this line after package is released + // eslint-disable-next-line node/no-missing-require + const {TetherClient} = require('@google-cloud/apigee-connect'); + + // TODO(developer): replace with your prefered project ID. + // const projectId = 'my-project' + + // Creates a client + // eslint-disable-next-line no-unused-vars + const client = new {TetherClient}(); + + //TODO(library generator): write the actual function you will be testing + async function doSomething() { + console.log('DPE! Change this code so that it shows how to use the library! See comments below on structure.') + // const [thing] = await client.methodName({ + // }); + // console.info(thing); + } + doSomething(); + // [END nodejs_apigee_connect_quickstart] +} + +main(...process.argv.slice(2)).catch(err => { + console.error(err.message); + process.exitCode = 1; +}); +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); diff --git a/packages/google-cloud-apigeeconnect/samples/test/quickstart.js b/packages/google-cloud-apigeeconnect/samples/test/quickstart.js new file mode 100644 index 00000000000..30ef83a7397 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/samples/test/quickstart.js @@ -0,0 +1,53 @@ +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +'use strict'; + +const path = require('path'); +const cp = require('child_process'); +const {before, describe, it} = require('mocha'); +// eslint-disable-next-line node/no-missing-require +const {TetherClient} = require('@google-cloud/apigee-connect'); +// eslint-disable-next-line no-unused-vars, node/no-missing-require +const {assert} = require('chai'); + +const execSync = cmd => cp.execSync(cmd, {encoding: 'utf-8'}); + +const cwd = path.join(__dirname, '..'); + +const client = new {TetherClient}(); + +describe('Quickstart', () => { + //TODO: remove this if not using the projectId + // eslint-disable-next-line no-unused-vars + let projectId; + + before(async () => { + // eslint-disable-next-line no-unused-vars + projectId = await client.getProjectId(); + }); + + it('should run quickstart', async () => { + //TODO: remove this line + // eslint-disable-next-line no-unused-vars + const stdout = execSync( + `node ./quickstart.js`, + {cwd} + ); + //assert(stdout, stdout !== null); + }); +}); diff --git a/packages/google-cloud-apigeeconnect/src/index.ts b/packages/google-cloud-apigeeconnect/src/index.ts new file mode 100644 index 00000000000..f035d28c288 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/index.ts @@ -0,0 +1,29 @@ +// Copyright 2020 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by synthtool. ** +// ** https://github.com/googleapis/synthtool ** +// ** All changes to this file may be overwritten. ** + +import * as v1 from './v1'; + +const ConnectionServiceClient = v1.ConnectionServiceClient; +type ConnectionServiceClient = v1.ConnectionServiceClient; +const TetherClient = v1.TetherClient; +type TetherClient = v1.TetherClient; + +export {v1, ConnectionServiceClient, TetherClient}; +export default {v1, ConnectionServiceClient, TetherClient}; +import * as protos from '../protos/protos'; +export {protos}; diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts new file mode 100644 index 00000000000..4abf491bc0f --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -0,0 +1,569 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +/* global window */ +import * as gax from 'google-gax'; +import { + Callback, + CallOptions, + Descriptors, + ClientOptions, + PaginationCallback, + GaxCall, +} from 'google-gax'; + +import {Transform} from 'stream'; +import {RequestType} from 'google-gax/build/src/apitypes'; +import * as protos from '../../protos/protos'; +import jsonProtos = require('../../protos/protos.json'); +/** + * Client JSON configuration object, loaded from + * `src/v1/connection_service_client_config.json`. + * This file defines retry strategy and timeouts for all API methods in this library. + */ +import * as gapicConfig from './connection_service_client_config.json'; + +const version = require('../../../package.json').version; + +/** + * Service Interface for the Apigee Connect connection management APIs. + * @class + * @memberof v1 + */ +export class ConnectionServiceClient { + private _terminated = false; + private _opts: ClientOptions; + private _gaxModule: typeof gax | typeof gax.fallback; + private _gaxGrpc: gax.GrpcClient | gax.fallback.GrpcClient; + private _protos: {}; + private _defaults: {[method: string]: gax.CallSettings}; + auth: gax.GoogleAuth; + descriptors: Descriptors = { + page: {}, + stream: {}, + longrunning: {}, + batching: {}, + }; + innerApiCalls: {[name: string]: Function}; + pathTemplates: {[name: string]: gax.PathTemplate}; + connectionServiceStub?: Promise<{[name: string]: Function}>; + + /** + * Construct an instance of ConnectionServiceClient. + * + * @param {object} [options] - The configuration object. + * The options accepted by the constructor are described in detail + * in [this document](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#creating-the-client-instance). + * The common options are: + * @param {object} [options.credentials] - Credentials object. + * @param {string} [options.credentials.client_email] + * @param {string} [options.credentials.private_key] + * @param {string} [options.email] - Account email address. Required when + * using a .pem or .p12 keyFilename. + * @param {string} [options.keyFilename] - Full path to the a .json, .pem, or + * .p12 key downloaded from the Google Developers Console. If you provide + * a path to a JSON file, the projectId option below is not necessary. + * NOTE: .pem and .p12 require you to specify options.email as well. + * @param {number} [options.port] - The port on which to connect to + * the remote host. + * @param {string} [options.projectId] - The project ID from the Google + * Developer's Console, e.g. 'grape-spaceship-123'. We will also check + * the environment variable GCLOUD_PROJECT for your project ID. If your + * app is running in an environment which supports + * {@link https://developers.google.com/identity/protocols/application-default-credentials Application Default Credentials}, + * your project ID will be detected automatically. + * @param {string} [options.apiEndpoint] - The domain name of the + * API remote host. + * @param {gax.ClientConfig} [options.clientConfig] - Client configuration override. + * Follows the structure of {@link gapicConfig}. + * @param {boolean} [options.fallback] - Use HTTP fallback mode. + * In fallback mode, a special browser-compatible transport implementation is used + * instead of gRPC transport. In browser context (if the `window` object is defined) + * the fallback mode is enabled automatically; set `options.fallback` to `false` + * if you need to override this behavior. + */ + constructor(opts?: ClientOptions) { + // Ensure that options include all the required fields. + const staticMembers = this.constructor as typeof ConnectionServiceClient; + const servicePath = + opts?.servicePath || opts?.apiEndpoint || staticMembers.servicePath; + const port = opts?.port || staticMembers.port; + const clientConfig = opts?.clientConfig ?? {}; + const fallback = + opts?.fallback ?? + (typeof window !== 'undefined' && typeof window?.fetch === 'function'); + opts = Object.assign({servicePath, port, clientConfig, fallback}, opts); + + // If scopes are unset in options and we're connecting to a non-default endpoint, set scopes just in case. + if (servicePath !== staticMembers.servicePath && !('scopes' in opts)) { + opts['scopes'] = staticMembers.scopes; + } + + // Choose either gRPC or proto-over-HTTP implementation of google-gax. + this._gaxModule = opts.fallback ? gax.fallback : gax; + + // Create a `gaxGrpc` object, with any grpc-specific options sent to the client. + this._gaxGrpc = new this._gaxModule.GrpcClient(opts); + + // Save options to use in initialize() method. + this._opts = opts; + + // Save the auth object to the client, for use by other methods. + this.auth = this._gaxGrpc.auth as gax.GoogleAuth; + + // Set the default scopes in auth client if needed. + if (servicePath === staticMembers.servicePath) { + this.auth.defaultScopes = staticMembers.scopes; + } + + // Determine the client header string. + const clientHeader = [`gax/${this._gaxModule.version}`, `gapic/${version}`]; + if (typeof process !== 'undefined' && 'versions' in process) { + clientHeader.push(`gl-node/${process.versions.node}`); + } else { + clientHeader.push(`gl-web/${this._gaxModule.version}`); + } + if (!opts.fallback) { + clientHeader.push(`grpc/${this._gaxGrpc.grpcVersion}`); + } else if (opts.fallback === 'rest') { + clientHeader.push(`rest/${this._gaxGrpc.grpcVersion}`); + } + if (opts.libName && opts.libVersion) { + clientHeader.push(`${opts.libName}/${opts.libVersion}`); + } + // Load the applicable protos. + this._protos = this._gaxGrpc.loadProtoJSON(jsonProtos); + + // This API contains "path templates"; forward-slash-separated + // identifiers to uniquely identify resources within the API. + // Create useful helper objects for these. + this.pathTemplates = { + endpointPathTemplate: new this._gaxModule.PathTemplate( + 'projects/{project}/endpoints/{endpoint}' + ), + }; + + // Some of the methods on this service return "paged" results, + // (e.g. 50 results at a time, with tokens to get subsequent + // pages). Denote the keys used for pagination and results. + this.descriptors.page = { + listConnections: new this._gaxModule.PageDescriptor( + 'pageToken', + 'nextPageToken', + 'connections' + ), + }; + + // Put together the default options sent with requests. + this._defaults = this._gaxGrpc.constructSettings( + 'google.cloud.apigeeconnect.v1.ConnectionService', + gapicConfig as gax.ClientConfig, + opts.clientConfig || {}, + {'x-goog-api-client': clientHeader.join(' ')} + ); + + // Set up a dictionary of "inner API calls"; the core implementation + // of calling the API is handled in `google-gax`, with this code + // merely providing the destination and request information. + this.innerApiCalls = {}; + } + + /** + * Initialize the client. + * Performs asynchronous operations (such as authentication) and prepares the client. + * This function will be called automatically when any class method is called for the + * first time, but if you need to initialize it before calling an actual method, + * feel free to call initialize() directly. + * + * You can await on this method if you want to make sure the client is initialized. + * + * @returns {Promise} A promise that resolves to an authenticated service stub. + */ + initialize() { + // If the client stub promise is already initialized, return immediately. + if (this.connectionServiceStub) { + return this.connectionServiceStub; + } + + // Put together the "service stub" for + // google.cloud.apigeeconnect.v1.ConnectionService. + this.connectionServiceStub = this._gaxGrpc.createStub( + this._opts.fallback + ? (this._protos as protobuf.Root).lookupService( + 'google.cloud.apigeeconnect.v1.ConnectionService' + ) + : // eslint-disable-next-line @typescript-eslint/no-explicit-any + (this._protos as any).google.cloud.apigeeconnect.v1.ConnectionService, + this._opts + ) as Promise<{[method: string]: Function}>; + + // Iterate over each of the methods that the service provides + // and create an API call method for each. + const connectionServiceStubMethods = ['listConnections']; + for (const methodName of connectionServiceStubMethods) { + const callPromise = this.connectionServiceStub.then( + stub => + (...args: Array<{}>) => { + if (this._terminated) { + return Promise.reject('The client has already been closed.'); + } + const func = stub[methodName]; + return func.apply(stub, args); + }, + (err: Error | null | undefined) => () => { + throw err; + } + ); + + const descriptor = this.descriptors.page[methodName] || undefined; + const apiCall = this._gaxModule.createApiCall( + callPromise, + this._defaults[methodName], + descriptor + ); + + this.innerApiCalls[methodName] = apiCall; + } + + return this.connectionServiceStub; + } + + /** + * The DNS address for this API service. + * @returns {string} The DNS address for this service. + */ + static get servicePath() { + return 'apigeeconnect.googleapis.com'; + } + + /** + * The DNS address for this API service - same as servicePath(), + * exists for compatibility reasons. + * @returns {string} The DNS address for this service. + */ + static get apiEndpoint() { + return 'apigeeconnect.googleapis.com'; + } + + /** + * The port for this API service. + * @returns {number} The default port for this service. + */ + static get port() { + return 443; + } + + /** + * The scopes needed to make gRPC calls for every method defined + * in this service. + * @returns {string[]} List of default scopes. + */ + static get scopes() { + return ['https://www.googleapis.com/auth/cloud-platform']; + } + + getProjectId(): Promise; + getProjectId(callback: Callback): void; + /** + * Return the project ID used by this class. + * @returns {Promise} A promise that resolves to string containing the project ID. + */ + getProjectId( + callback?: Callback + ): Promise | void { + if (callback) { + this.auth.getProjectId(callback); + return; + } + return this.auth.getProjectId(); + } + + // ------------------- + // -- Service calls -- + // ------------------- + + listConnections( + request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + options?: CallOptions + ): Promise< + [ + protos.google.cloud.apigeeconnect.v1.IConnection[], + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest | null, + protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + ] + >; + listConnections( + request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + options: CallOptions, + callback: PaginationCallback< + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + | protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.apigeeconnect.v1.IConnection + > + ): void; + listConnections( + request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + callback: PaginationCallback< + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + | protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.apigeeconnect.v1.IConnection + > + ): void; + /** + * Lists connections that are currently active for the given Apigee Connect + * endpoint. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.parent + * Required. Parent name of the form: + * `projects/{project_number or project_id}/endpoints/{endpoint}`. + * @param {number} request.pageSize + * The maximum number of connections to return. The service may return fewer + * than this value. If unspecified, at most 100 connections will be returned. + * The maximum value is 1000; values above 1000 will be coerced to 1000. + * @param {string} request.pageToken + * A page token, received from a previous `ListConnections` call. + * Provide this to retrieve the subsequent page. + * + * When paginating, all other parameters provided to `ListConnections` must + * match the call that provided the page token. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is Array of [Connection]{@link google.cloud.apigeeconnect.v1.Connection}. + * The client library will perform auto-pagination by default: it will call the API as many + * times as needed and will merge results from all the pages into this array. + * Note that it can affect your quota. + * We recommend using `listConnectionsAsync()` + * method described below for async iteration which you can stop as needed. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#auto-pagination) + * for more details and examples. + */ + listConnections( + request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + optionsOrCallback?: + | CallOptions + | PaginationCallback< + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + | protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.apigeeconnect.v1.IConnection + >, + callback?: PaginationCallback< + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + | protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.apigeeconnect.v1.IConnection + > + ): Promise< + [ + protos.google.cloud.apigeeconnect.v1.IConnection[], + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest | null, + protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + gax.routingHeader.fromParams({ + parent: request.parent || '', + }); + this.initialize(); + return this.innerApiCalls.listConnections(request, options, callback); + } + + /** + * Equivalent to `method.name.toCamelCase()`, but returns a NodeJS Stream object. + * @param {Object} request + * The request object that will be sent. + * @param {string} request.parent + * Required. Parent name of the form: + * `projects/{project_number or project_id}/endpoints/{endpoint}`. + * @param {number} request.pageSize + * The maximum number of connections to return. The service may return fewer + * than this value. If unspecified, at most 100 connections will be returned. + * The maximum value is 1000; values above 1000 will be coerced to 1000. + * @param {string} request.pageToken + * A page token, received from a previous `ListConnections` call. + * Provide this to retrieve the subsequent page. + * + * When paginating, all other parameters provided to `ListConnections` must + * match the call that provided the page token. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Stream} + * An object stream which emits an object representing [Connection]{@link google.cloud.apigeeconnect.v1.Connection} on 'data' event. + * The client library will perform auto-pagination by default: it will call the API as many + * times as needed. Note that it can affect your quota. + * We recommend using `listConnectionsAsync()` + * method described below for async iteration which you can stop as needed. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#auto-pagination) + * for more details and examples. + */ + listConnectionsStream( + request?: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + options?: CallOptions + ): Transform { + request = request || {}; + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + gax.routingHeader.fromParams({ + parent: request.parent || '', + }); + const callSettings = new gax.CallSettings(options); + this.initialize(); + return this.descriptors.page.listConnections.createStream( + this.innerApiCalls.listConnections as gax.GaxCall, + request, + callSettings + ); + } + + /** + * Equivalent to `listConnections`, but returns an iterable object. + * + * `for`-`await`-`of` syntax is used with the iterable to get response elements on-demand. + * @param {Object} request + * The request object that will be sent. + * @param {string} request.parent + * Required. Parent name of the form: + * `projects/{project_number or project_id}/endpoints/{endpoint}`. + * @param {number} request.pageSize + * The maximum number of connections to return. The service may return fewer + * than this value. If unspecified, at most 100 connections will be returned. + * The maximum value is 1000; values above 1000 will be coerced to 1000. + * @param {string} request.pageToken + * A page token, received from a previous `ListConnections` call. + * Provide this to retrieve the subsequent page. + * + * When paginating, all other parameters provided to `ListConnections` must + * match the call that provided the page token. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Object} + * An iterable Object that allows [async iteration](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Iteration_protocols). + * When you iterate the returned iterable, each element will be an object representing + * [Connection]{@link google.cloud.apigeeconnect.v1.Connection}. The API will be called under the hood as needed, once per the page, + * so you can stop the iteration when you don't need more results. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#auto-pagination) + * for more details and examples. + * @example + * const iterable = client.listConnectionsAsync(request); + * for await (const response of iterable) { + * // process response + * } + */ + listConnectionsAsync( + request?: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + options?: CallOptions + ): AsyncIterable { + request = request || {}; + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + gax.routingHeader.fromParams({ + parent: request.parent || '', + }); + options = options || {}; + const callSettings = new gax.CallSettings(options); + this.initialize(); + return this.descriptors.page.listConnections.asyncIterate( + this.innerApiCalls['listConnections'] as GaxCall, + request as unknown as RequestType, + callSettings + ) as AsyncIterable; + } + // -------------------- + // -- Path templates -- + // -------------------- + + /** + * Return a fully-qualified endpoint resource name string. + * + * @param {string} project + * @param {string} endpoint + * @returns {string} Resource name string. + */ + endpointPath(project: string, endpoint: string) { + return this.pathTemplates.endpointPathTemplate.render({ + project: project, + endpoint: endpoint, + }); + } + + /** + * Parse the project from Endpoint resource. + * + * @param {string} endpointName + * A fully-qualified path representing Endpoint resource. + * @returns {string} A string representing the project. + */ + matchProjectFromEndpointName(endpointName: string) { + return this.pathTemplates.endpointPathTemplate.match(endpointName).project; + } + + /** + * Parse the endpoint from Endpoint resource. + * + * @param {string} endpointName + * A fully-qualified path representing Endpoint resource. + * @returns {string} A string representing the endpoint. + */ + matchEndpointFromEndpointName(endpointName: string) { + return this.pathTemplates.endpointPathTemplate.match(endpointName).endpoint; + } + + /** + * Terminate the gRPC channel and close the client. + * + * The client will no longer be usable and all future behavior is undefined. + * @returns {Promise} A promise that resolves when the client is closed. + */ + close(): Promise { + this.initialize(); + if (!this._terminated) { + return this.connectionServiceStub!.then(stub => { + this._terminated = true; + stub.close(); + }); + } + return Promise.resolve(); + } +} diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client_config.json b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client_config.json new file mode 100644 index 00000000000..082991850a1 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client_config.json @@ -0,0 +1,44 @@ +{ + "interfaces": { + "google.cloud.apigeeconnect.v1.ConnectionService": { + "retry_codes": { + "non_idempotent": [], + "idempotent": [ + "DEADLINE_EXCEEDED", + "UNAVAILABLE" + ], + "unknown_unavailable": [ + "UNKNOWN", + "UNAVAILABLE" + ] + }, + "retry_params": { + "default": { + "initial_retry_delay_millis": 100, + "retry_delay_multiplier": 1.3, + "max_retry_delay_millis": 60000, + "initial_rpc_timeout_millis": 60000, + "rpc_timeout_multiplier": 1, + "max_rpc_timeout_millis": 60000, + "total_timeout_millis": 600000 + }, + "01d6d956b4dadd7e38ee9dec12ed8720e6e6f90c": { + "initial_retry_delay_millis": 1000, + "retry_delay_multiplier": 1.3, + "max_retry_delay_millis": 60000, + "initial_rpc_timeout_millis": 60000, + "rpc_timeout_multiplier": 1, + "max_rpc_timeout_millis": 60000, + "total_timeout_millis": 600000 + } + }, + "methods": { + "ListConnections": { + "timeout_millis": 60000, + "retry_codes_name": "unknown_unavailable", + "retry_params_name": "01d6d956b4dadd7e38ee9dec12ed8720e6e6f90c" + } + } + } + } +} diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_proto_list.json b/packages/google-cloud-apigeeconnect/src/v1/connection_service_proto_list.json new file mode 100644 index 00000000000..565d8bcff6b --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_proto_list.json @@ -0,0 +1,4 @@ +[ + "../../protos/google/cloud/apigeeconnect/v1/connection.proto", + "../../protos/google/cloud/apigeeconnect/v1/tether.proto" +] diff --git a/packages/google-cloud-apigeeconnect/src/v1/gapic_metadata.json b/packages/google-cloud-apigeeconnect/src/v1/gapic_metadata.json new file mode 100644 index 00000000000..8efa1078582 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/v1/gapic_metadata.json @@ -0,0 +1,55 @@ +{ + "schema": "1.0", + "comment": "This file maps proto services/RPCs to the corresponding library clients/methods", + "language": "typescript", + "protoPackage": "google.cloud.apigeeconnect.v1", + "libraryPackage": "@google-cloud/apigeeconnect", + "services": { + "ConnectionService": { + "clients": { + "grpc": { + "libraryClient": "ConnectionServiceClient", + "rpcs": { + "ListConnections": { + "methods": [ + "listConnections", + "listConnectionsStream", + "listConnectionsAsync" + ] + } + } + }, + "grpc-fallback": { + "libraryClient": "ConnectionServiceClient", + "rpcs": { + "ListConnections": { + "methods": [ + "listConnections", + "listConnectionsStream", + "listConnectionsAsync" + ] + } + } + } + } + }, + "Tether": { + "clients": { + "grpc": { + "libraryClient": "TetherClient", + "rpcs": { + "Egress": { + "methods": [ + "egress" + ] + } + } + }, + "grpc-fallback": { + "libraryClient": "TetherClient", + "rpcs": {} + } + } + } + } +} diff --git a/packages/google-cloud-apigeeconnect/src/v1/index.ts b/packages/google-cloud-apigeeconnect/src/v1/index.ts new file mode 100644 index 00000000000..d7874445933 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/v1/index.ts @@ -0,0 +1,20 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +export {ConnectionServiceClient} from './connection_service_client'; +export {TetherClient} from './tether_client'; diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts new file mode 100644 index 00000000000..ed01c0818a1 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -0,0 +1,326 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +/* global window */ +import * as gax from 'google-gax'; +import {Callback, CallOptions, Descriptors, ClientOptions} from 'google-gax'; + +import * as protos from '../../protos/protos'; +import jsonProtos = require('../../protos/protos.json'); +/** + * Client JSON configuration object, loaded from + * `src/v1/tether_client_config.json`. + * This file defines retry strategy and timeouts for all API methods in this library. + */ +import * as gapicConfig from './tether_client_config.json'; + +const version = require('../../../package.json').version; + +/** + * Tether provides a way for the control plane to send HTTP API requests to + * services in data planes that runs in a remote datacenter without + * requiring customers to open firewalls on their runtime plane. + * @class + * @memberof v1 + */ +export class TetherClient { + private _terminated = false; + private _opts: ClientOptions; + private _gaxModule: typeof gax | typeof gax.fallback; + private _gaxGrpc: gax.GrpcClient | gax.fallback.GrpcClient; + private _protos: {}; + private _defaults: {[method: string]: gax.CallSettings}; + auth: gax.GoogleAuth; + descriptors: Descriptors = { + page: {}, + stream: {}, + longrunning: {}, + batching: {}, + }; + innerApiCalls: {[name: string]: Function}; + tetherStub?: Promise<{[name: string]: Function}>; + + /** + * Construct an instance of TetherClient. + * + * @param {object} [options] - The configuration object. + * The options accepted by the constructor are described in detail + * in [this document](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#creating-the-client-instance). + * The common options are: + * @param {object} [options.credentials] - Credentials object. + * @param {string} [options.credentials.client_email] + * @param {string} [options.credentials.private_key] + * @param {string} [options.email] - Account email address. Required when + * using a .pem or .p12 keyFilename. + * @param {string} [options.keyFilename] - Full path to the a .json, .pem, or + * .p12 key downloaded from the Google Developers Console. If you provide + * a path to a JSON file, the projectId option below is not necessary. + * NOTE: .pem and .p12 require you to specify options.email as well. + * @param {number} [options.port] - The port on which to connect to + * the remote host. + * @param {string} [options.projectId] - The project ID from the Google + * Developer's Console, e.g. 'grape-spaceship-123'. We will also check + * the environment variable GCLOUD_PROJECT for your project ID. If your + * app is running in an environment which supports + * {@link https://developers.google.com/identity/protocols/application-default-credentials Application Default Credentials}, + * your project ID will be detected automatically. + * @param {string} [options.apiEndpoint] - The domain name of the + * API remote host. + * @param {gax.ClientConfig} [options.clientConfig] - Client configuration override. + * Follows the structure of {@link gapicConfig}. + * @param {boolean} [options.fallback] - Use HTTP fallback mode. + * In fallback mode, a special browser-compatible transport implementation is used + * instead of gRPC transport. In browser context (if the `window` object is defined) + * the fallback mode is enabled automatically; set `options.fallback` to `false` + * if you need to override this behavior. + */ + constructor(opts?: ClientOptions) { + // Ensure that options include all the required fields. + const staticMembers = this.constructor as typeof TetherClient; + const servicePath = + opts?.servicePath || opts?.apiEndpoint || staticMembers.servicePath; + const port = opts?.port || staticMembers.port; + const clientConfig = opts?.clientConfig ?? {}; + const fallback = + opts?.fallback ?? + (typeof window !== 'undefined' && typeof window?.fetch === 'function'); + opts = Object.assign({servicePath, port, clientConfig, fallback}, opts); + + // If scopes are unset in options and we're connecting to a non-default endpoint, set scopes just in case. + if (servicePath !== staticMembers.servicePath && !('scopes' in opts)) { + opts['scopes'] = staticMembers.scopes; + } + + // Choose either gRPC or proto-over-HTTP implementation of google-gax. + this._gaxModule = opts.fallback ? gax.fallback : gax; + + // Create a `gaxGrpc` object, with any grpc-specific options sent to the client. + this._gaxGrpc = new this._gaxModule.GrpcClient(opts); + + // Save options to use in initialize() method. + this._opts = opts; + + // Save the auth object to the client, for use by other methods. + this.auth = this._gaxGrpc.auth as gax.GoogleAuth; + + // Set the default scopes in auth client if needed. + if (servicePath === staticMembers.servicePath) { + this.auth.defaultScopes = staticMembers.scopes; + } + + // Determine the client header string. + const clientHeader = [`gax/${this._gaxModule.version}`, `gapic/${version}`]; + if (typeof process !== 'undefined' && 'versions' in process) { + clientHeader.push(`gl-node/${process.versions.node}`); + } else { + clientHeader.push(`gl-web/${this._gaxModule.version}`); + } + if (!opts.fallback) { + clientHeader.push(`grpc/${this._gaxGrpc.grpcVersion}`); + } else if (opts.fallback === 'rest') { + clientHeader.push(`rest/${this._gaxGrpc.grpcVersion}`); + } + if (opts.libName && opts.libVersion) { + clientHeader.push(`${opts.libName}/${opts.libVersion}`); + } + // Load the applicable protos. + this._protos = this._gaxGrpc.loadProtoJSON(jsonProtos); + + // Some of the methods on this service provide streaming responses. + // Provide descriptors for these. + this.descriptors.stream = { + egress: new this._gaxModule.StreamDescriptor( + gax.StreamType.BIDI_STREAMING + ), + }; + + // Put together the default options sent with requests. + this._defaults = this._gaxGrpc.constructSettings( + 'google.cloud.apigeeconnect.v1.Tether', + gapicConfig as gax.ClientConfig, + opts.clientConfig || {}, + {'x-goog-api-client': clientHeader.join(' ')} + ); + + // Set up a dictionary of "inner API calls"; the core implementation + // of calling the API is handled in `google-gax`, with this code + // merely providing the destination and request information. + this.innerApiCalls = {}; + } + + /** + * Initialize the client. + * Performs asynchronous operations (such as authentication) and prepares the client. + * This function will be called automatically when any class method is called for the + * first time, but if you need to initialize it before calling an actual method, + * feel free to call initialize() directly. + * + * You can await on this method if you want to make sure the client is initialized. + * + * @returns {Promise} A promise that resolves to an authenticated service stub. + */ + initialize() { + // If the client stub promise is already initialized, return immediately. + if (this.tetherStub) { + return this.tetherStub; + } + + // Put together the "service stub" for + // google.cloud.apigeeconnect.v1.Tether. + this.tetherStub = this._gaxGrpc.createStub( + this._opts.fallback + ? (this._protos as protobuf.Root).lookupService( + 'google.cloud.apigeeconnect.v1.Tether' + ) + : // eslint-disable-next-line @typescript-eslint/no-explicit-any + (this._protos as any).google.cloud.apigeeconnect.v1.Tether, + this._opts + ) as Promise<{[method: string]: Function}>; + + // Iterate over each of the methods that the service provides + // and create an API call method for each. + const tetherStubMethods = ['egress']; + for (const methodName of tetherStubMethods) { + const callPromise = this.tetherStub.then( + stub => + (...args: Array<{}>) => { + if (this._terminated) { + return Promise.reject('The client has already been closed.'); + } + const func = stub[methodName]; + return func.apply(stub, args); + }, + (err: Error | null | undefined) => () => { + throw err; + } + ); + + const descriptor = this.descriptors.stream[methodName] || undefined; + const apiCall = this._gaxModule.createApiCall( + callPromise, + this._defaults[methodName], + descriptor + ); + + this.innerApiCalls[methodName] = apiCall; + } + + return this.tetherStub; + } + + /** + * The DNS address for this API service. + * @returns {string} The DNS address for this service. + */ + static get servicePath() { + return 'apigeeconnect.googleapis.com'; + } + + /** + * The DNS address for this API service - same as servicePath(), + * exists for compatibility reasons. + * @returns {string} The DNS address for this service. + */ + static get apiEndpoint() { + return 'apigeeconnect.googleapis.com'; + } + + /** + * The port for this API service. + * @returns {number} The default port for this service. + */ + static get port() { + return 443; + } + + /** + * The scopes needed to make gRPC calls for every method defined + * in this service. + * @returns {string[]} List of default scopes. + */ + static get scopes() { + return ['https://www.googleapis.com/auth/cloud-platform']; + } + + getProjectId(): Promise; + getProjectId(callback: Callback): void; + /** + * Return the project ID used by this class. + * @returns {Promise} A promise that resolves to string containing the project ID. + */ + getProjectId( + callback?: Callback + ): Promise | void { + if (callback) { + this.auth.getProjectId(callback); + return; + } + return this.auth.getProjectId(); + } + + // ------------------- + // -- Service calls -- + // ------------------- + + /** + * Egress streams egress requests and responses. Logically, this is not + * actually a streaming request, but uses streaming as a mechanism to flip + * the client-server relationship of gRPC so that the server can act as a + * client. + * The listener, the RPC server, accepts connections from the dialer, + * the RPC client. + * The listener streams http requests and the dialer streams http responses. + * + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Stream} + * An object stream which is both readable and writable. It accepts objects + * representing [EgressResponse]{@link google.cloud.apigeeconnect.v1.EgressResponse} for write() method, and + * will emit objects representing [EgressRequest]{@link google.cloud.apigeeconnect.v1.EgressRequest} on 'data' event asynchronously. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#bi-directional-streaming) + * for more details and examples. + * @example + * const stream = client.egress(); + * stream.on('data', (response) => { ... }); + * stream.on('end', () => { ... }); + * stream.write(request); + * stream.end(); + */ + egress(options?: CallOptions): gax.CancellableStream { + this.initialize(); + return this.innerApiCalls.egress(options); + } + + /** + * Terminate the gRPC channel and close the client. + * + * The client will no longer be usable and all future behavior is undefined. + * @returns {Promise} A promise that resolves when the client is closed. + */ + close(): Promise { + this.initialize(); + if (!this._terminated) { + return this.tetherStub!.then(stub => { + this._terminated = true; + stub.close(); + }); + } + return Promise.resolve(); + } +} diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client_config.json b/packages/google-cloud-apigeeconnect/src/v1/tether_client_config.json new file mode 100644 index 00000000000..819b2372b8b --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client_config.json @@ -0,0 +1,30 @@ +{ + "interfaces": { + "google.cloud.apigeeconnect.v1.Tether": { + "retry_codes": { + "non_idempotent": [], + "idempotent": [ + "DEADLINE_EXCEEDED", + "UNAVAILABLE" + ] + }, + "retry_params": { + "default": { + "initial_retry_delay_millis": 100, + "retry_delay_multiplier": 1.3, + "max_retry_delay_millis": 60000, + "initial_rpc_timeout_millis": 60000, + "rpc_timeout_multiplier": 1, + "max_rpc_timeout_millis": 60000, + "total_timeout_millis": 600000 + } + }, + "methods": { + "Egress": { + "retry_codes_name": "non_idempotent", + "retry_params_name": "default" + } + } + } + } +} diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_proto_list.json b/packages/google-cloud-apigeeconnect/src/v1/tether_proto_list.json new file mode 100644 index 00000000000..565d8bcff6b --- /dev/null +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_proto_list.json @@ -0,0 +1,4 @@ +[ + "../../protos/google/cloud/apigeeconnect/v1/connection.proto", + "../../protos/google/cloud/apigeeconnect/v1/tether.proto" +] diff --git a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js new file mode 100644 index 00000000000..0e0bb98863d --- /dev/null +++ b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js @@ -0,0 +1,27 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +/* eslint-disable node/no-missing-require, no-unused-vars */ +const apigeeconnect = require('@google-cloud/apigeeconnect'); + +function main() { + const connectionServiceClient = new apigeeconnect.ConnectionServiceClient(); + const tetherClient = new apigeeconnect.TetherClient(); +} + +main(); diff --git a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts new file mode 100644 index 00000000000..f7d9ac1442a --- /dev/null +++ b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts @@ -0,0 +1,41 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +import { + ConnectionServiceClient, + TetherClient, +} from '@google-cloud/apigeeconnect'; + +// check that the client class type name can be used +function doStuffWithConnectionServiceClient(client: ConnectionServiceClient) { + client.close(); +} +function doStuffWithTetherClient(client: TetherClient) { + client.close(); +} + +function main() { + // check that the client instance can be created + const connectionServiceClient = new ConnectionServiceClient(); + doStuffWithConnectionServiceClient(connectionServiceClient); + // check that the client instance can be created + const tetherClient = new TetherClient(); + doStuffWithTetherClient(tetherClient); +} + +main(); diff --git a/packages/google-cloud-apigeeconnect/system-test/install.ts b/packages/google-cloud-apigeeconnect/system-test/install.ts new file mode 100644 index 00000000000..d2d61c0396f --- /dev/null +++ b/packages/google-cloud-apigeeconnect/system-test/install.ts @@ -0,0 +1,51 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +import {packNTest} from 'pack-n-play'; +import {readFileSync} from 'fs'; +import {describe, it} from 'mocha'; + +describe('📦 pack-n-play test', () => { + it('TypeScript code', async function () { + this.timeout(300000); + const options = { + packageDir: process.cwd(), + sample: { + description: 'TypeScript user can use the type definitions', + ts: readFileSync( + './system-test/fixtures/sample/src/index.ts' + ).toString(), + }, + }; + await packNTest(options); + }); + + it('JavaScript code', async function () { + this.timeout(300000); + const options = { + packageDir: process.cwd(), + sample: { + description: 'JavaScript user can use the library', + ts: readFileSync( + './system-test/fixtures/sample/src/index.js' + ).toString(), + }, + }; + await packNTest(options); + }); +}); diff --git a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts new file mode 100644 index 00000000000..b87ce7ff3dd --- /dev/null +++ b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts @@ -0,0 +1,554 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +import * as protos from '../protos/protos'; +import * as assert from 'assert'; +import * as sinon from 'sinon'; +import {SinonStub} from 'sinon'; +import {describe, it} from 'mocha'; +import * as connectionserviceModule from '../src'; + +import {PassThrough} from 'stream'; + +import {protobuf} from 'google-gax'; + +function generateSampleMessage(instance: T) { + const filledObject = ( + instance.constructor as typeof protobuf.Message + ).toObject(instance as protobuf.Message, {defaults: true}); + return (instance.constructor as typeof protobuf.Message).fromObject( + filledObject + ) as T; +} + +function stubSimpleCall(response?: ResponseType, error?: Error) { + return error + ? sinon.stub().rejects(error) + : sinon.stub().resolves([response]); +} + +function stubSimpleCallWithCallback( + response?: ResponseType, + error?: Error +) { + return error + ? sinon.stub().callsArgWith(2, error) + : sinon.stub().callsArgWith(2, null, response); +} + +function stubPageStreamingCall( + responses?: ResponseType[], + error?: Error +) { + const pagingStub = sinon.stub(); + if (responses) { + for (let i = 0; i < responses.length; ++i) { + pagingStub.onCall(i).callsArgWith(2, null, responses[i]); + } + } + const transformStub = error + ? sinon.stub().callsArgWith(2, error) + : pagingStub; + const mockStream = new PassThrough({ + objectMode: true, + transform: transformStub, + }); + // trigger as many responses as needed + if (responses) { + for (let i = 0; i < responses.length; ++i) { + setImmediate(() => { + mockStream.write({}); + }); + } + setImmediate(() => { + mockStream.end(); + }); + } else { + setImmediate(() => { + mockStream.write({}); + }); + setImmediate(() => { + mockStream.end(); + }); + } + return sinon.stub().returns(mockStream); +} + +function stubAsyncIterationCall( + responses?: ResponseType[], + error?: Error +) { + let counter = 0; + const asyncIterable = { + [Symbol.asyncIterator]() { + return { + async next() { + if (error) { + return Promise.reject(error); + } + if (counter >= responses!.length) { + return Promise.resolve({done: true, value: undefined}); + } + return Promise.resolve({done: false, value: responses![counter++]}); + }, + }; + }, + }; + return sinon.stub().returns(asyncIterable); +} + +describe('v1.ConnectionServiceClient', () => { + it('has servicePath', () => { + const servicePath = + connectionserviceModule.v1.ConnectionServiceClient.servicePath; + assert(servicePath); + }); + + it('has apiEndpoint', () => { + const apiEndpoint = + connectionserviceModule.v1.ConnectionServiceClient.apiEndpoint; + assert(apiEndpoint); + }); + + it('has port', () => { + const port = connectionserviceModule.v1.ConnectionServiceClient.port; + assert(port); + assert(typeof port === 'number'); + }); + + it('should create a client with no option', () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient(); + assert(client); + }); + + it('should create a client with gRPC fallback', () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + fallback: true, + }); + assert(client); + }); + + it('has initialize method and supports deferred initialization', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.connectionServiceStub, undefined); + await client.initialize(); + assert(client.connectionServiceStub); + }); + + it('has close method', () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.close(); + }); + + it('has getProjectId method', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon.stub().resolves(fakeProjectId); + const result = await client.getProjectId(); + assert.strictEqual(result, fakeProjectId); + assert((client.auth.getProjectId as SinonStub).calledWithExactly()); + }); + + it('has getProjectId method with callback', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon + .stub() + .callsArgWith(0, null, fakeProjectId); + const promise = new Promise((resolve, reject) => { + client.getProjectId((err?: Error | null, projectId?: string | null) => { + if (err) { + reject(err); + } else { + resolve(projectId); + } + }); + }); + const result = await promise; + assert.strictEqual(result, fakeProjectId); + }); + + describe('listConnections', () => { + it('invokes listConnections without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() + ); + request.parent = ''; + const expectedHeaderRequestParams = 'parent='; + const expectedOptions = { + otherArgs: { + headers: { + 'x-goog-request-params': expectedHeaderRequestParams, + }, + }, + }; + const expectedResponse = [ + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + ]; + client.innerApiCalls.listConnections = stubSimpleCall(expectedResponse); + const [response] = await client.listConnections(request); + assert.deepStrictEqual(response, expectedResponse); + assert( + (client.innerApiCalls.listConnections as SinonStub) + .getCall(0) + .calledWith(request, expectedOptions, undefined) + ); + }); + + it('invokes listConnections without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() + ); + request.parent = ''; + const expectedHeaderRequestParams = 'parent='; + const expectedOptions = { + otherArgs: { + headers: { + 'x-goog-request-params': expectedHeaderRequestParams, + }, + }, + }; + const expectedResponse = [ + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + ]; + client.innerApiCalls.listConnections = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.listConnections( + request, + ( + err?: Error | null, + result?: protos.google.cloud.apigeeconnect.v1.IConnection[] | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + assert( + (client.innerApiCalls.listConnections as SinonStub) + .getCall(0) + .calledWith(request, expectedOptions /*, callback defined above */) + ); + }); + + it('invokes listConnections with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() + ); + request.parent = ''; + const expectedHeaderRequestParams = 'parent='; + const expectedOptions = { + otherArgs: { + headers: { + 'x-goog-request-params': expectedHeaderRequestParams, + }, + }, + }; + const expectedError = new Error('expected'); + client.innerApiCalls.listConnections = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.listConnections(request), expectedError); + assert( + (client.innerApiCalls.listConnections as SinonStub) + .getCall(0) + .calledWith(request, expectedOptions, undefined) + ); + }); + + it('invokes listConnectionsStream without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() + ); + request.parent = ''; + const expectedHeaderRequestParams = 'parent='; + const expectedResponse = [ + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + ]; + client.descriptors.page.listConnections.createStream = + stubPageStreamingCall(expectedResponse); + const stream = client.listConnectionsStream(request); + const promise = new Promise((resolve, reject) => { + const responses: protos.google.cloud.apigeeconnect.v1.Connection[] = []; + stream.on( + 'data', + (response: protos.google.cloud.apigeeconnect.v1.Connection) => { + responses.push(response); + } + ); + stream.on('end', () => { + resolve(responses); + }); + stream.on('error', (err: Error) => { + reject(err); + }); + }); + const responses = await promise; + assert.deepStrictEqual(responses, expectedResponse); + assert( + (client.descriptors.page.listConnections.createStream as SinonStub) + .getCall(0) + .calledWith(client.innerApiCalls.listConnections, request) + ); + assert.strictEqual( + ( + client.descriptors.page.listConnections.createStream as SinonStub + ).getCall(0).args[2].otherArgs.headers['x-goog-request-params'], + expectedHeaderRequestParams + ); + }); + + it('invokes listConnectionsStream with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() + ); + request.parent = ''; + const expectedHeaderRequestParams = 'parent='; + const expectedError = new Error('expected'); + client.descriptors.page.listConnections.createStream = + stubPageStreamingCall(undefined, expectedError); + const stream = client.listConnectionsStream(request); + const promise = new Promise((resolve, reject) => { + const responses: protos.google.cloud.apigeeconnect.v1.Connection[] = []; + stream.on( + 'data', + (response: protos.google.cloud.apigeeconnect.v1.Connection) => { + responses.push(response); + } + ); + stream.on('end', () => { + resolve(responses); + }); + stream.on('error', (err: Error) => { + reject(err); + }); + }); + await assert.rejects(promise, expectedError); + assert( + (client.descriptors.page.listConnections.createStream as SinonStub) + .getCall(0) + .calledWith(client.innerApiCalls.listConnections, request) + ); + assert.strictEqual( + ( + client.descriptors.page.listConnections.createStream as SinonStub + ).getCall(0).args[2].otherArgs.headers['x-goog-request-params'], + expectedHeaderRequestParams + ); + }); + + it('uses async iteration with listConnections without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() + ); + request.parent = ''; + const expectedHeaderRequestParams = 'parent='; + const expectedResponse = [ + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.Connection() + ), + ]; + client.descriptors.page.listConnections.asyncIterate = + stubAsyncIterationCall(expectedResponse); + const responses: protos.google.cloud.apigeeconnect.v1.IConnection[] = []; + const iterable = client.listConnectionsAsync(request); + for await (const resource of iterable) { + responses.push(resource!); + } + assert.deepStrictEqual(responses, expectedResponse); + assert.deepStrictEqual( + ( + client.descriptors.page.listConnections.asyncIterate as SinonStub + ).getCall(0).args[1], + request + ); + assert.strictEqual( + ( + client.descriptors.page.listConnections.asyncIterate as SinonStub + ).getCall(0).args[2].otherArgs.headers['x-goog-request-params'], + expectedHeaderRequestParams + ); + }); + + it('uses async iteration with listConnections with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() + ); + request.parent = ''; + const expectedHeaderRequestParams = 'parent='; + const expectedError = new Error('expected'); + client.descriptors.page.listConnections.asyncIterate = + stubAsyncIterationCall(undefined, expectedError); + const iterable = client.listConnectionsAsync(request); + await assert.rejects(async () => { + const responses: protos.google.cloud.apigeeconnect.v1.IConnection[] = + []; + for await (const resource of iterable) { + responses.push(resource!); + } + }); + assert.deepStrictEqual( + ( + client.descriptors.page.listConnections.asyncIterate as SinonStub + ).getCall(0).args[1], + request + ); + assert.strictEqual( + ( + client.descriptors.page.listConnections.asyncIterate as SinonStub + ).getCall(0).args[2].otherArgs.headers['x-goog-request-params'], + expectedHeaderRequestParams + ); + }); + }); + + describe('Path templates', () => { + describe('endpoint', () => { + const fakePath = '/rendered/path/endpoint'; + const expectedParameters = { + project: 'projectValue', + endpoint: 'endpointValue', + }; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + client.pathTemplates.endpointPathTemplate.render = sinon + .stub() + .returns(fakePath); + client.pathTemplates.endpointPathTemplate.match = sinon + .stub() + .returns(expectedParameters); + + it('endpointPath', () => { + const result = client.endpointPath('projectValue', 'endpointValue'); + assert.strictEqual(result, fakePath); + assert( + (client.pathTemplates.endpointPathTemplate.render as SinonStub) + .getCall(-1) + .calledWith(expectedParameters) + ); + }); + + it('matchProjectFromEndpointName', () => { + const result = client.matchProjectFromEndpointName(fakePath); + assert.strictEqual(result, 'projectValue'); + assert( + (client.pathTemplates.endpointPathTemplate.match as SinonStub) + .getCall(-1) + .calledWith(fakePath) + ); + }); + + it('matchEndpointFromEndpointName', () => { + const result = client.matchEndpointFromEndpointName(fakePath); + assert.strictEqual(result, 'endpointValue'); + assert( + (client.pathTemplates.endpointPathTemplate.match as SinonStub) + .getCall(-1) + .calledWith(fakePath) + ); + }); + }); + }); +}); diff --git a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts new file mode 100644 index 00000000000..0c246d91be5 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts @@ -0,0 +1,217 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +import * as protos from '../protos/protos'; +import * as assert from 'assert'; +import * as sinon from 'sinon'; +import {SinonStub} from 'sinon'; +import {describe, it} from 'mocha'; +import * as tetherModule from '../src'; + +import {PassThrough} from 'stream'; + +import {protobuf} from 'google-gax'; + +function generateSampleMessage(instance: T) { + const filledObject = ( + instance.constructor as typeof protobuf.Message + ).toObject(instance as protobuf.Message, {defaults: true}); + return (instance.constructor as typeof protobuf.Message).fromObject( + filledObject + ) as T; +} + +function stubBidiStreamingCall( + response?: ResponseType, + error?: Error +) { + const transformStub = error + ? sinon.stub().callsArgWith(2, error) + : sinon.stub().callsArgWith(2, null, response); + const mockStream = new PassThrough({ + objectMode: true, + transform: transformStub, + }); + return sinon.stub().returns(mockStream); +} + +describe('v1.TetherClient', () => { + it('has servicePath', () => { + const servicePath = tetherModule.v1.TetherClient.servicePath; + assert(servicePath); + }); + + it('has apiEndpoint', () => { + const apiEndpoint = tetherModule.v1.TetherClient.apiEndpoint; + assert(apiEndpoint); + }); + + it('has port', () => { + const port = tetherModule.v1.TetherClient.port; + assert(port); + assert(typeof port === 'number'); + }); + + it('should create a client with no option', () => { + const client = new tetherModule.v1.TetherClient(); + assert(client); + }); + + it('should create a client with gRPC fallback', () => { + const client = new tetherModule.v1.TetherClient({ + fallback: true, + }); + assert(client); + }); + + it('has initialize method and supports deferred initialization', async () => { + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.tetherStub, undefined); + await client.initialize(); + assert(client.tetherStub); + }); + + it('has close method', () => { + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.close(); + }); + + it('has getProjectId method', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon.stub().resolves(fakeProjectId); + const result = await client.getProjectId(); + assert.strictEqual(result, fakeProjectId); + assert((client.auth.getProjectId as SinonStub).calledWithExactly()); + }); + + it('has getProjectId method with callback', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon + .stub() + .callsArgWith(0, null, fakeProjectId); + const promise = new Promise((resolve, reject) => { + client.getProjectId((err?: Error | null, projectId?: string | null) => { + if (err) { + reject(err); + } else { + resolve(projectId); + } + }); + }); + const result = await promise; + assert.strictEqual(result, fakeProjectId); + }); + + describe('egress', () => { + it('invokes egress without error', async () => { + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.EgressResponse() + ); + const expectedResponse = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.EgressRequest() + ); + client.innerApiCalls.egress = stubBidiStreamingCall(expectedResponse); + const stream = client.egress(); + const promise = new Promise((resolve, reject) => { + stream.on( + 'data', + (response: protos.google.cloud.apigeeconnect.v1.EgressRequest) => { + resolve(response); + } + ); + stream.on('error', (err: Error) => { + reject(err); + }); + stream.write(request); + stream.end(); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + assert( + (client.innerApiCalls.egress as SinonStub) + .getCall(0) + .calledWithExactly(undefined) + ); + assert.deepStrictEqual( + ((stream as unknown as PassThrough)._transform as SinonStub).getCall(0) + .args[0], + request + ); + }); + + it('invokes egress with error', async () => { + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.apigeeconnect.v1.EgressResponse() + ); + const expectedError = new Error('expected'); + client.innerApiCalls.egress = stubBidiStreamingCall( + undefined, + expectedError + ); + const stream = client.egress(); + const promise = new Promise((resolve, reject) => { + stream.on( + 'data', + (response: protos.google.cloud.apigeeconnect.v1.EgressRequest) => { + resolve(response); + } + ); + stream.on('error', (err: Error) => { + reject(err); + }); + stream.write(request); + stream.end(); + }); + await assert.rejects(promise, expectedError); + assert( + (client.innerApiCalls.egress as SinonStub) + .getCall(0) + .calledWithExactly(undefined) + ); + assert.deepStrictEqual( + ((stream as unknown as PassThrough)._transform as SinonStub).getCall(0) + .args[0], + request + ); + }); + }); +}); diff --git a/packages/google-cloud-apigeeconnect/tsconfig.json b/packages/google-cloud-apigeeconnect/tsconfig.json new file mode 100644 index 00000000000..c78f1c884ef --- /dev/null +++ b/packages/google-cloud-apigeeconnect/tsconfig.json @@ -0,0 +1,19 @@ +{ + "extends": "./node_modules/gts/tsconfig-google.json", + "compilerOptions": { + "rootDir": ".", + "outDir": "build", + "resolveJsonModule": true, + "lib": [ + "es2018", + "dom" + ] + }, + "include": [ + "src/*.ts", + "src/**/*.ts", + "test/*.ts", + "test/**/*.ts", + "system-test/*.ts" + ] +} diff --git a/packages/google-cloud-apigeeconnect/webpack.config.js b/packages/google-cloud-apigeeconnect/webpack.config.js new file mode 100644 index 00000000000..96ac8cbfca7 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/webpack.config.js @@ -0,0 +1,64 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +const path = require('path'); + +module.exports = { + entry: './src/index.ts', + output: { + library: 'ConnectionService', + filename: './connection-service.js', + }, + node: { + child_process: 'empty', + fs: 'empty', + crypto: 'empty', + }, + resolve: { + alias: { + '../../../package.json': path.resolve(__dirname, 'package.json'), + }, + extensions: ['.js', '.json', '.ts'], + }, + module: { + rules: [ + { + test: /\.tsx?$/, + use: 'ts-loader', + exclude: /node_modules/, + }, + { + test: /node_modules[\\/]@grpc[\\/]grpc-js/, + use: 'null-loader', + }, + { + test: /node_modules[\\/]grpc/, + use: 'null-loader', + }, + { + test: /node_modules[\\/]retry-request/, + use: 'null-loader', + }, + { + test: /node_modules[\\/]https?-proxy-agent/, + use: 'null-loader', + }, + { + test: /node_modules[\\/]gtoken/, + use: 'null-loader', + }, + ], + }, + mode: 'production', +}; From fd3ee2c13e15346f5c24b1861cf40f328af23ec1 Mon Sep 17 00:00:00 2001 From: sofisl <55454395+sofisl@users.noreply.github.com> Date: Thu, 10 Jun 2021 14:03:28 -0500 Subject: [PATCH 03/63] feat: add initial samples and tests (#5) * feat: add initial samples and tests --- packages/google-cloud-apigeeconnect/.jsdoc.js | 2 +- .../linkinator.config.json | 2 +- .../google-cloud-apigeeconnect/package.json | 2 +- .../samples/quickstart.js | 20 +++++++++---------- .../samples/test/quickstart.js | 15 ++++++-------- .../system-test/fixtures/sample/src/index.js | 2 +- .../system-test/fixtures/sample/src/index.ts | 2 +- 7 files changed, 20 insertions(+), 25 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/.jsdoc.js b/packages/google-cloud-apigeeconnect/.jsdoc.js index 2a7e82331b0..274d626bbfa 100644 --- a/packages/google-cloud-apigeeconnect/.jsdoc.js +++ b/packages/google-cloud-apigeeconnect/.jsdoc.js @@ -43,7 +43,7 @@ module.exports = { copyright: 'Copyright 2021 Google LLC', includeDate: false, sourceFiles: false, - systemName: '@google-cloud/apigeeconnect', + systemName: '@google-cloud/apigee-connect', theme: 'lumen', default: { outputSourceFiles: false diff --git a/packages/google-cloud-apigeeconnect/linkinator.config.json b/packages/google-cloud-apigeeconnect/linkinator.config.json index 0947c2e0e5b..36e8eebc086 100644 --- a/packages/google-cloud-apigeeconnect/linkinator.config.json +++ b/packages/google-cloud-apigeeconnect/linkinator.config.json @@ -1 +1 @@ -{"recurse":true,"skip":["https://codecov.io/gh/googleapis/","www.googleapis.com","img.shields.io"],"silent":true,"concurrency":10} \ No newline at end of file +{"recurse":true,"skip":["https://github.com/googleapis/nodejs-apigee-connect/blob/master/CHANGELOG.md", "https://codecov.io/gh/googleapis/","www.googleapis.com","img.shields.io"],"silent":true,"concurrency":10} \ No newline at end of file diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 6716bf66fdf..e3d6c0c1198 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -2,7 +2,7 @@ "name": "@google-cloud/apigee-connect", "version": "0.1.0", "description": "apigeeconnect client for Node.js", - "repository": "googleapis/googleapis/nodejs-apigee-connect", + "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", "author": "Google LLC", "main": "build/src/index.js", diff --git a/packages/google-cloud-apigeeconnect/samples/quickstart.js b/packages/google-cloud-apigeeconnect/samples/quickstart.js index 3f8927c4dc9..4befd2c734e 100644 --- a/packages/google-cloud-apigeeconnect/samples/quickstart.js +++ b/packages/google-cloud-apigeeconnect/samples/quickstart.js @@ -13,30 +13,28 @@ 'use strict'; -async function main() { - +async function main(projectId, endpoint) { // [START nodejs_apigee_connect_quickstart] // Imports the Google Cloud client library // remove this line after package is released // eslint-disable-next-line node/no-missing-require - const {TetherClient} = require('@google-cloud/apigee-connect'); + const {ConnectionServiceClient} = require('@google-cloud/apigee-connect'); // TODO(developer): replace with your prefered project ID. // const projectId = 'my-project' // Creates a client // eslint-disable-next-line no-unused-vars - const client = new {TetherClient}(); + const client = new ConnectionServiceClient(); - //TODO(library generator): write the actual function you will be testing - async function doSomething() { - console.log('DPE! Change this code so that it shows how to use the library! See comments below on structure.') - // const [thing] = await client.methodName({ - // }); - // console.info(thing); + async function listConnections() { + const connections = await client.listConnections({ + parent: `projects/${projectId}/endpoints/${endpoint}`, + }); + console.info(connections); } - doSomething(); + listConnections(); // [END nodejs_apigee_connect_quickstart] } diff --git a/packages/google-cloud-apigeeconnect/samples/test/quickstart.js b/packages/google-cloud-apigeeconnect/samples/test/quickstart.js index 30ef83a7397..6e9f23090c0 100644 --- a/packages/google-cloud-apigeeconnect/samples/test/quickstart.js +++ b/packages/google-cloud-apigeeconnect/samples/test/quickstart.js @@ -29,10 +29,10 @@ const execSync = cmd => cp.execSync(cmd, {encoding: 'utf-8'}); const cwd = path.join(__dirname, '..'); -const client = new {TetherClient}(); +const client = new TetherClient(); describe('Quickstart', () => { - //TODO: remove this if not using the projectId + //TODO: remove this if not using the projectId // eslint-disable-next-line no-unused-vars let projectId; @@ -42,12 +42,9 @@ describe('Quickstart', () => { }); it('should run quickstart', async () => { - //TODO: remove this line - // eslint-disable-next-line no-unused-vars - const stdout = execSync( - `node ./quickstart.js`, - {cwd} - ); - //assert(stdout, stdout !== null); + const stdout = execSync(`node ./quickstart.js ${projectId} apigee_mart`, { + cwd, + }); + assert.match(stdout, /\[\]/); }); }); diff --git a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js index 0e0bb98863d..d763f9e83f4 100644 --- a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js +++ b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js @@ -17,7 +17,7 @@ // ** All changes to this file may be overwritten. ** /* eslint-disable node/no-missing-require, no-unused-vars */ -const apigeeconnect = require('@google-cloud/apigeeconnect'); +const apigeeconnect = require('@google-cloud/apigee-connect'); function main() { const connectionServiceClient = new apigeeconnect.ConnectionServiceClient(); diff --git a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts index f7d9ac1442a..64cd2e5f269 100644 --- a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts +++ b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts @@ -19,7 +19,7 @@ import { ConnectionServiceClient, TetherClient, -} from '@google-cloud/apigeeconnect'; +} from '@google-cloud/apigee-connect'; // check that the client class type name can be used function doStuffWithConnectionServiceClient(client: ConnectionServiceClient) { From bb96d54373fcc225f58792c53020f35d8c6c5b3a Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Thu, 10 Jun 2021 14:29:47 -0500 Subject: [PATCH 04/63] build: add auto-approve to Node libraries (#1100) (#7) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * build: add auto-approve to Node libraries (#1100) * build: add auto-approve to Node libraries Co-authored-by: Benjamin E. Coe Source-Link: https://github.com/googleapis/synthtool/commit/5cae043787729a908ed0cab28ca27baf9acee3c4 Post-Processor: gcr.io/repo-automation-bots/owlbot-nodejs:latest@sha256:65aa68f2242c172345d7c1e780bced839bfdc344955d6aa460aa63b4481d93e5 * 🦉 Updates from OwlBot * 🦉 Updates from OwlBot * 🦉 Updates from OwlBot Co-authored-by: Owl Bot Co-authored-by: Benjamin E. Coe Co-authored-by: sofisl <55454395+sofisl@users.noreply.github.com> --- packages/google-cloud-apigeeconnect/README.md | 19 +++++++++---------- 1 file changed, 9 insertions(+), 10 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md index 0b7134e4725..82b4120ffac 100644 --- a/packages/google-cloud-apigeeconnect/README.md +++ b/packages/google-cloud-apigeeconnect/README.md @@ -62,23 +62,22 @@ npm install @google-cloud/apigee-connect // remove this line after package is released // eslint-disable-next-line node/no-missing-require -const {TetherClient} = require('@google-cloud/apigee-connect'); +const {ConnectionServiceClient} = require('@google-cloud/apigee-connect'); // TODO(developer): replace with your prefered project ID. // const projectId = 'my-project' // Creates a client // eslint-disable-next-line no-unused-vars -const client = new {TetherClient}(); - -//TODO(library generator): write the actual function you will be testing -async function doSomething() { - console.log('DPE! Change this code so that it shows how to use the library! See comments below on structure.') - // const [thing] = await client.methodName({ - // }); - // console.info(thing); +const client = new ConnectionServiceClient(); + +async function listConnections() { + const connections = await client.listConnections({ + parent: `projects/${projectId}/endpoints/${endpoint}`, + }); + console.info(connections); } -doSomething(); +listConnections(); ``` From ba960b67456fe0887a672ce8ea9825ff622fdfb0 Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Thu, 10 Jun 2021 22:08:09 +0200 Subject: [PATCH 05/63] chore(deps): update dependency sinon to v11 (#3) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![WhiteSource Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [sinon](https://sinonjs.org/) ([source](https://togithub.com/sinonjs/sinon)) | [`^10.0.0` -> `^11.0.0`](https://renovatebot.com/diffs/npm/sinon/10.0.0/11.1.1) | [![age](https://badges.renovateapi.com/packages/npm/sinon/11.1.1/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/sinon/11.1.1/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/sinon/11.1.1/compatibility-slim/10.0.0)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/sinon/11.1.1/confidence-slim/10.0.0)](https://docs.renovatebot.com/merge-confidence/) | --- ### Release Notes
sinonjs/sinon ### [`v11.1.1`](https://togithub.com/sinonjs/sinon/blob/master/CHANGELOG.md#​1111--2021-05-26) [Compare Source](https://togithub.com/sinonjs/sinon/compare/v11.1.0...v11.1.1) \================== - Fix [#​2379](https://togithub.com/sinonjs/sinon/issues/2379) by using v7 of supports-color ### [`v11.1.0`](https://togithub.com/sinonjs/sinon/blob/master/CHANGELOG.md#​1110--2021-05-25) [Compare Source](https://togithub.com/sinonjs/sinon/compare/v11.0.0...v11.1.0) \================== - Add sinon.promise() implementation ([#​2369](https://togithub.com/sinonjs/sinon/issues/2369)) - Set wrappedMethod on getters/setters ([#​2378](https://togithub.com/sinonjs/sinon/issues/2378)) - \[Docs] Update fake-server usage & descriptions ([#​2365](https://togithub.com/sinonjs/sinon/issues/2365)) - Fake docs improvement ([#​2360](https://togithub.com/sinonjs/sinon/issues/2360)) - Update nise to 5.1.0 (fixed [#​2318](https://togithub.com/sinonjs/sinon/issues/2318)) ### [`v11.0.0`](https://togithub.com/sinonjs/sinon/blob/master/CHANGELOG.md#​1100--2021-05-24) [Compare Source](https://togithub.com/sinonjs/sinon/compare/v10.0.1...v11.0.0) \================== - Explicitly use samsam 6.0.2 with fix for [#​2345](https://togithub.com/sinonjs/sinon/issues/2345) - Update most packages ([#​2371](https://togithub.com/sinonjs/sinon/issues/2371)) - Update compatibility docs ([#​2366](https://togithub.com/sinonjs/sinon/issues/2366)) - Update packages (includes breaking fake-timers change, see [#​2352](https://togithub.com/sinonjs/sinon/issues/2352)) - Warn of potential memory leaks ([#​2357](https://togithub.com/sinonjs/sinon/issues/2357)) - Fix clock test errors ### [`v10.0.1`](https://togithub.com/sinonjs/sinon/blob/master/CHANGELOG.md#​1001--2021-04-08) [Compare Source](https://togithub.com/sinonjs/sinon/compare/v10.0.0...v10.0.1) \================== - Upgrade sinon components (bumps y18n to 4.0.1) - Bump y18n from 4.0.0 to 4.0.1
--- ### Configuration 📅 **Schedule**: "after 9am and before 3pm" (UTC). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, check this box. --- This PR has been generated by [WhiteSource Renovate](https://renovate.whitesourcesoftware.com). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index e3d6c0c1198..f503ed7bf6c 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -54,7 +54,7 @@ "mocha": "^8.4.0", "null-loader": "^4.0.1", "pack-n-play": "^1.0.0-2", - "sinon": "^10.0.0", + "sinon": "^11.0.0", "ts-loader": "^9.1.2", "typescript": "^4.2.4", "webpack": "^5.36.2", From 5d251b31f8d8f9f68123ff0316d6483a8aa36d68 Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Thu, 17 Jun 2021 17:48:44 -0400 Subject: [PATCH 06/63] chore: release 1.0.0 (#1) Co-authored-by: release-please[bot] <55107282+release-please[bot]@users.noreply.github.com> --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 10 ++++++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- .../google-cloud-apigeeconnect/samples/package.json | 2 +- 3 files changed, 12 insertions(+), 2 deletions(-) create mode 100644 packages/google-cloud-apigeeconnect/CHANGELOG.md diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md new file mode 100644 index 00000000000..509e4a6e406 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -0,0 +1,10 @@ +# Changelog + +## 1.0.0 (2021-06-11) + + +### Features + +* add initial samples and tests ([#5](https://www.github.com/googleapis/nodejs-apigee-connect/issues/5)) ([56b55ff](https://www.github.com/googleapis/nodejs-apigee-connect/commit/56b55ffb36d0dabc92019489aa5e3918ae7db239)) +* initial samples and tests ([c6cb308](https://www.github.com/googleapis/nodejs-apigee-connect/commit/c6cb3085da868309b1b62db342df940e31ce9685)) +* initial stub of library ([e48651a](https://www.github.com/googleapis/nodejs-apigee-connect/commit/e48651af7d82e064311353a4871d84299c867a43)) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index f503ed7bf6c..af3c8edf8b9 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "0.1.0", + "version": "1.0.0", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 1ad246a5934..85d49f4d804 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^0.1.0" + "@google-cloud/apigee-connect": "^1.0.0" }, "devDependencies": { "c8": "^7.1.0", From be522caaa064cb94994b253baadfec6e257829e0 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Sun, 27 Jun 2021 10:24:00 -0700 Subject: [PATCH 07/63] build(nodejs): name should be @google-cloud/apigee-connect (#12) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * build(nodejs): name should be @google-cloud/apigee-connect PiperOrigin-RevId: 381518921 Source-Link: https://github.com/googleapis/googleapis/commit/8b4a440aa7de03da4d1f3c38d593d2f0baf82857 Source-Link: https://github.com/googleapis/googleapis-gen/commit/7babedbfc65e69a97a70179436bfddd4cf159339 * 🦉 Updates from OwlBot See https://github.com/googleapis/repo-automation-bots/blob/master/packages/owl-bot/README.md Co-authored-by: Owl Bot --- .../google-cloud-apigeeconnect/linkinator.config.json | 11 ++++++++++- .../src/v1/connection_service_client.ts | 4 ++-- .../src/v1/gapic_metadata.json | 2 +- 3 files changed, 13 insertions(+), 4 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/linkinator.config.json b/packages/google-cloud-apigeeconnect/linkinator.config.json index 36e8eebc086..29a223b6db6 100644 --- a/packages/google-cloud-apigeeconnect/linkinator.config.json +++ b/packages/google-cloud-apigeeconnect/linkinator.config.json @@ -1 +1,10 @@ -{"recurse":true,"skip":["https://github.com/googleapis/nodejs-apigee-connect/blob/master/CHANGELOG.md", "https://codecov.io/gh/googleapis/","www.googleapis.com","img.shields.io"],"silent":true,"concurrency":10} \ No newline at end of file +{ + "recurse": true, + "skip": [ + "https://codecov.io/gh/googleapis/", + "www.googleapis.com", + "img.shields.io" + ], + "silent": true, + "concurrency": 10 +} diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index 4abf491bc0f..8f52736a04c 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -298,7 +298,7 @@ export class ConnectionServiceClient { // ------------------- listConnections( - request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + request?: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, options?: CallOptions ): Promise< [ @@ -361,7 +361,7 @@ export class ConnectionServiceClient { * for more details and examples. */ listConnections( - request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + request?: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, optionsOrCallback?: | CallOptions | PaginationCallback< diff --git a/packages/google-cloud-apigeeconnect/src/v1/gapic_metadata.json b/packages/google-cloud-apigeeconnect/src/v1/gapic_metadata.json index 8efa1078582..9409782c42c 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/gapic_metadata.json +++ b/packages/google-cloud-apigeeconnect/src/v1/gapic_metadata.json @@ -3,7 +3,7 @@ "comment": "This file maps proto services/RPCs to the corresponding library clients/methods", "language": "typescript", "protoPackage": "google.cloud.apigeeconnect.v1", - "libraryPackage": "@google-cloud/apigeeconnect", + "libraryPackage": "@google-cloud/apigee-connect", "services": { "ConnectionService": { "clients": { From 306667279becf0bc1386e66cc3f36c6ba6a0c8a0 Mon Sep 17 00:00:00 2001 From: "Benjamin E. Coe" Date: Thu, 1 Jul 2021 12:01:13 -0400 Subject: [PATCH 08/63] fix(deps): require google-gax v2.17.0 (#13) --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index af3c8edf8b9..ce932181f56 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -39,7 +39,7 @@ "prelint": "cd samples; npm link ../; npm i" }, "dependencies": { - "google-gax": "^2.12.0" + "google-gax": "^2.17.0" }, "devDependencies": { "@types/mocha": "^8.2.2", From e85c16b8d9f4840170f690ff22d7ce0fcfe3f8ce Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Thu, 1 Jul 2021 16:06:13 +0000 Subject: [PATCH 09/63] chore: release 1.0.1 (#15) :robot: I have created a release \*beep\* \*boop\* --- ### [1.0.1](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.0...v1.0.1) (2021-07-01) ### Bug Fixes * **deps:** require google-gax v2.17.0 ([#13](https://www.github.com/googleapis/nodejs-apigee-connect/issues/13)) ([1bca993](https://www.github.com/googleapis/nodejs-apigee-connect/commit/1bca99349c29d064d516606b39d29791d7e88023)) --- This PR was generated with [Release Please](https://github.com/googleapis/release-please). See [documentation](https://github.com/googleapis/release-please#release-please). --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 3 files changed, 9 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index 509e4a6e406..6d0ed1a9d2b 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,12 @@ # Changelog +### [1.0.1](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.0...v1.0.1) (2021-07-01) + + +### Bug Fixes + +* **deps:** require google-gax v2.17.0 ([#13](https://www.github.com/googleapis/nodejs-apigee-connect/issues/13)) ([1bca993](https://www.github.com/googleapis/nodejs-apigee-connect/commit/1bca99349c29d064d516606b39d29791d7e88023)) + ## 1.0.0 (2021-06-11) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index ce932181f56..ef2a64301cd 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "1.0.0", + "version": "1.0.1", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 85d49f4d804..957aa6d749a 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^1.0.0" + "@google-cloud/apigee-connect": "^1.0.1" }, "devDependencies": { "c8": "^7.1.0", From d283e7d73e6207fc230fd16ef4f1259b66135efe Mon Sep 17 00:00:00 2001 From: "Benjamin E. Coe" Date: Mon, 12 Jul 2021 17:48:15 -0400 Subject: [PATCH 10/63] fix(deps): google-gax v2.17.1 (#16) --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index ef2a64301cd..0d8c83d51f8 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -39,7 +39,7 @@ "prelint": "cd samples; npm link ../; npm i" }, "dependencies": { - "google-gax": "^2.17.0" + "google-gax": "^2.17.1" }, "devDependencies": { "@types/mocha": "^8.2.2", From 97e20fd49370b565f42b429fa4cb3e4f20d52aae Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Tue, 13 Jul 2021 15:39:52 -0700 Subject: [PATCH 11/63] chore: release 1.0.2 (#17) Co-authored-by: release-please[bot] <55107282+release-please[bot]@users.noreply.github.com> --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 3 files changed, 9 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index 6d0ed1a9d2b..ac8731b6a71 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,12 @@ # Changelog +### [1.0.2](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.1...v1.0.2) (2021-07-12) + + +### Bug Fixes + +* **deps:** google-gax v2.17.1 ([#16](https://www.github.com/googleapis/nodejs-apigee-connect/issues/16)) ([3de4e43](https://www.github.com/googleapis/nodejs-apigee-connect/commit/3de4e4319f720357f1bfc4ab7acc5e50281f1f6d)) + ### [1.0.1](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.0...v1.0.1) (2021-07-01) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 0d8c83d51f8..ee9b451c355 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "1.0.1", + "version": "1.0.2", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 957aa6d749a..e57c2aa1d31 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^1.0.1" + "@google-cloud/apigee-connect": "^1.0.2" }, "devDependencies": { "c8": "^7.1.0", From 18bcacc4f05164cc652e1f71cedfbbbea125ff05 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Fri, 16 Jul 2021 19:10:31 +0000 Subject: [PATCH 12/63] fix: Updating WORKSPACE files to use the newest version of the Typescript generator. (#18) Also removing the explicit generator tag for the IAMPolicy mixin for the kms and pubsub APIS as the generator will now read it from the .yaml file. PiperOrigin-RevId: 385101839 Source-Link: https://github.com/googleapis/googleapis/commit/80f404215a9346259db760d80d0671f28c433453 Source-Link: https://github.com/googleapis/googleapis-gen/commit/d3509d2520fb8db862129633f1cf8406d17454e1 --- .../src/v1/connection_service_client.ts | 11 ++++++++++- .../src/v1/tether_client.ts | 11 ++++++++++- 2 files changed, 20 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index 8f52736a04c..8587e99749e 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -48,6 +48,7 @@ const version = require('../../../package.json').version; export class ConnectionServiceClient { private _terminated = false; private _opts: ClientOptions; + private _providedCustomServicePath: boolean; private _gaxModule: typeof gax | typeof gax.fallback; private _gaxGrpc: gax.GrpcClient | gax.fallback.GrpcClient; private _protos: {}; @@ -59,6 +60,7 @@ export class ConnectionServiceClient { longrunning: {}, batching: {}, }; + warn: (code: string, message: string, warnType?: string) => void; innerApiCalls: {[name: string]: Function}; pathTemplates: {[name: string]: gax.PathTemplate}; connectionServiceStub?: Promise<{[name: string]: Function}>; @@ -102,6 +104,9 @@ export class ConnectionServiceClient { const staticMembers = this.constructor as typeof ConnectionServiceClient; const servicePath = opts?.servicePath || opts?.apiEndpoint || staticMembers.servicePath; + this._providedCustomServicePath = !!( + opts?.servicePath || opts?.apiEndpoint + ); const port = opts?.port || staticMembers.port; const clientConfig = opts?.clientConfig ?? {}; const fallback = @@ -181,6 +186,9 @@ export class ConnectionServiceClient { // of calling the API is handled in `google-gax`, with this code // merely providing the destination and request information. this.innerApiCalls = {}; + + // Add a warn function to the client constructor so it can be easily tested. + this.warn = gax.warn; } /** @@ -209,7 +217,8 @@ export class ConnectionServiceClient { ) : // eslint-disable-next-line @typescript-eslint/no-explicit-any (this._protos as any).google.cloud.apigeeconnect.v1.ConnectionService, - this._opts + this._opts, + this._providedCustomServicePath ) as Promise<{[method: string]: Function}>; // Iterate over each of the methods that the service provides diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index ed01c0818a1..409eab2cdcf 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -41,6 +41,7 @@ const version = require('../../../package.json').version; export class TetherClient { private _terminated = false; private _opts: ClientOptions; + private _providedCustomServicePath: boolean; private _gaxModule: typeof gax | typeof gax.fallback; private _gaxGrpc: gax.GrpcClient | gax.fallback.GrpcClient; private _protos: {}; @@ -52,6 +53,7 @@ export class TetherClient { longrunning: {}, batching: {}, }; + warn: (code: string, message: string, warnType?: string) => void; innerApiCalls: {[name: string]: Function}; tetherStub?: Promise<{[name: string]: Function}>; @@ -94,6 +96,9 @@ export class TetherClient { const staticMembers = this.constructor as typeof TetherClient; const servicePath = opts?.servicePath || opts?.apiEndpoint || staticMembers.servicePath; + this._providedCustomServicePath = !!( + opts?.servicePath || opts?.apiEndpoint + ); const port = opts?.port || staticMembers.port; const clientConfig = opts?.clientConfig ?? {}; const fallback = @@ -161,6 +166,9 @@ export class TetherClient { // of calling the API is handled in `google-gax`, with this code // merely providing the destination and request information. this.innerApiCalls = {}; + + // Add a warn function to the client constructor so it can be easily tested. + this.warn = gax.warn; } /** @@ -189,7 +197,8 @@ export class TetherClient { ) : // eslint-disable-next-line @typescript-eslint/no-explicit-any (this._protos as any).google.cloud.apigeeconnect.v1.Tether, - this._opts + this._opts, + this._providedCustomServicePath ) as Promise<{[method: string]: Function}>; // Iterate over each of the methods that the service provides From a44d75563007d22306bf2a90ef4f9be7c0990b4e Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Fri, 16 Jul 2021 13:05:40 -0700 Subject: [PATCH 13/63] chore: release 1.0.3 (#19) Co-authored-by: release-please[bot] <55107282+release-please[bot]@users.noreply.github.com> --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 3 files changed, 9 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index ac8731b6a71..26e9141886d 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,12 @@ # Changelog +### [1.0.3](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.2...v1.0.3) (2021-07-16) + + +### Bug Fixes + +* Updating WORKSPACE files to use the newest version of the Typescript generator. ([#18](https://www.github.com/googleapis/nodejs-apigee-connect/issues/18)) ([a1ec264](https://www.github.com/googleapis/nodejs-apigee-connect/commit/a1ec26422107c2e78ddb45aa89827db052017a54)) + ### [1.0.2](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.1...v1.0.2) (2021-07-12) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index ee9b451c355..28560815953 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "1.0.2", + "version": "1.0.3", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index e57c2aa1d31..9843aa10199 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^1.0.2" + "@google-cloud/apigee-connect": "^1.0.3" }, "devDependencies": { "c8": "^7.1.0", From 81f6eb270eaa509af7b3707cf2395a525df7aabb Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Sat, 17 Jul 2021 01:42:22 +0000 Subject: [PATCH 14/63] chore: release 1.0.3 (#20) :robot: I have created a release \*beep\* \*boop\* --- ### [1.0.3](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.2...v1.0.3) (2021-07-16) ### Bug Fixes * Updating WORKSPACE files to use the newest version of the Typescript generator. ([#18](https://www.github.com/googleapis/nodejs-apigee-connect/issues/18)) ([a1ec264](https://www.github.com/googleapis/nodejs-apigee-connect/commit/a1ec26422107c2e78ddb45aa89827db052017a54)) --- This PR was generated with [Release Please](https://github.com/googleapis/release-please). See [documentation](https://github.com/googleapis/release-please#release-please). --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ 1 file changed, 7 insertions(+) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index 26e9141886d..ea1b6b6db9a 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -3,6 +3,13 @@ ### [1.0.3](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.2...v1.0.3) (2021-07-16) +### Bug Fixes + +* Updating WORKSPACE files to use the newest version of the Typescript generator. ([#18](https://www.github.com/googleapis/nodejs-apigee-connect/issues/18)) ([a1ec264](https://www.github.com/googleapis/nodejs-apigee-connect/commit/a1ec26422107c2e78ddb45aa89827db052017a54)) + +### [1.0.3](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.2...v1.0.3) (2021-07-16) + + ### Bug Fixes * Updating WORKSPACE files to use the newest version of the Typescript generator. ([#18](https://www.github.com/googleapis/nodejs-apigee-connect/issues/18)) ([a1ec264](https://www.github.com/googleapis/nodejs-apigee-connect/commit/a1ec26422107c2e78ddb45aa89827db052017a54)) From 97a1461d93eb1cff178b6366cd6d8a6d538d1872 Mon Sep 17 00:00:00 2001 From: "F. Hinkelmann" Date: Wed, 4 Aug 2021 16:02:24 -0400 Subject: [PATCH 15/63] chore(nodejs): update client ref docs link in metadata (#26) --- packages/google-cloud-apigeeconnect/.repo-metadata.json | 3 +-- packages/google-cloud-apigeeconnect/README.md | 2 +- 2 files changed, 2 insertions(+), 3 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/.repo-metadata.json b/packages/google-cloud-apigeeconnect/.repo-metadata.json index 52508522d81..cdf29bdd680 100644 --- a/packages/google-cloud-apigeeconnect/.repo-metadata.json +++ b/packages/google-cloud-apigeeconnect/.repo-metadata.json @@ -2,7 +2,7 @@ "name": "apigeeconnect", "name_pretty": "Apigee Connect API", "product_documentation": "https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect/", - "client_documentation": "https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect", + "client_documentation": "https://cloud.google.com/nodejs/docs/reference/apigee-connect/latest", "issue_tracker": "https://github.com/googleapis/nodejs-apigee-connect/issues", "release_level": "BETA", "language": "nodejs", @@ -12,4 +12,3 @@ "default_version": "v1", "requires_billing": true } - diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md index 82b4120ffac..362dfc2be61 100644 --- a/packages/google-cloud-apigeeconnect/README.md +++ b/packages/google-cloud-apigeeconnect/README.md @@ -146,7 +146,7 @@ Apache Version 2.0 See [LICENSE](https://github.com/googleapis/nodejs-apigee-connect/blob/master/LICENSE) -[client-docs]: https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect +[client-docs]: https://cloud.google.com/nodejs/docs/reference/apigee-connect/latest [product-docs]: https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect/ [shell_img]: https://gstatic.com/cloudssh/images/open-btn.png [projects]: https://console.cloud.google.com/project From b1b13068ea4b5133df43459eb4c757a809f3d5ab Mon Sep 17 00:00:00 2001 From: sofisl <55454395+sofisl@users.noreply.github.com> Date: Mon, 9 Aug 2021 16:32:15 -0700 Subject: [PATCH 16/63] fix(build): migrate to using main branch (#28) --- packages/google-cloud-apigeeconnect/README.md | 16 ++++++++-------- .../google-cloud-apigeeconnect/samples/README.md | 2 +- 2 files changed, 9 insertions(+), 9 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md index 362dfc2be61..3ccce097759 100644 --- a/packages/google-cloud-apigeeconnect/README.md +++ b/packages/google-cloud-apigeeconnect/README.md @@ -6,7 +6,7 @@ [![release level](https://img.shields.io/badge/release%20level-beta-yellow.svg?style=flat)](https://cloud.google.com/terms/launch-stages) [![npm version](https://img.shields.io/npm/v/@google-cloud/apigee-connect.svg)](https://www.npmjs.org/package/@google-cloud/apigee-connect) -[![codecov](https://img.shields.io/codecov/c/github/googleapis/nodejs-apigee-connect/master.svg?style=flat)](https://codecov.io/gh/googleapis/nodejs-apigee-connect) +[![codecov](https://img.shields.io/codecov/c/github/googleapis/nodejs-apigee-connect/main.svg?style=flat)](https://codecov.io/gh/googleapis/nodejs-apigee-connect) @@ -15,7 +15,7 @@ apigeeconnect client for Node.js A comprehensive list of changes in each version may be found in -[the CHANGELOG](https://github.com/googleapis/nodejs-apigee-connect/blob/master/CHANGELOG.md). +[the CHANGELOG](https://github.com/googleapis/nodejs-apigee-connect/blob/main/CHANGELOG.md). * [Apigee Connect API Node.js Client API Reference][client-docs] * [Apigee Connect API Documentation][product-docs] @@ -85,11 +85,11 @@ listConnections(); ## Samples -Samples are in the [`samples/`](https://github.com/googleapis/nodejs-apigee-connect/tree/master/samples) directory. Each sample's `README.md` has instructions for running its sample. +Samples are in the [`samples/`](https://github.com/googleapis/nodejs-apigee-connect/tree/main/samples) directory. Each sample's `README.md` has instructions for running its sample. | Sample | Source Code | Try it | | --------------------------- | --------------------------------- | ------ | -| Quickstart | [source code](https://github.com/googleapis/nodejs-apigee-connect/blob/master/samples/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/nodejs-apigee-connect&page=editor&open_in_editor=samples/quickstart.js,samples/README.md) | +| Quickstart | [source code](https://github.com/googleapis/nodejs-apigee-connect/blob/main/samples/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/nodejs-apigee-connect&page=editor&open_in_editor=samples/quickstart.js,samples/README.md) | @@ -132,19 +132,19 @@ More Information: [Google Cloud Platform Launch Stages][launch_stages] ## Contributing -Contributions welcome! See the [Contributing Guide](https://github.com/googleapis/nodejs-apigee-connect/blob/master/CONTRIBUTING.md). +Contributions welcome! See the [Contributing Guide](https://github.com/googleapis/nodejs-apigee-connect/blob/main/CONTRIBUTING.md). Please note that this `README.md`, the `samples/README.md`, and a variety of configuration files in this repository (including `.nycrc` and `tsconfig.json`) are generated from a central template. To edit one of these files, make an edit -to its template in this -[directory](https://github.com/googleapis/synthtool/tree/master/synthtool/gcp/templates/node_library). +to its templates in +[directory](https://github.com/googleapis/synthtool). ## License Apache Version 2.0 -See [LICENSE](https://github.com/googleapis/nodejs-apigee-connect/blob/master/LICENSE) +See [LICENSE](https://github.com/googleapis/nodejs-apigee-connect/blob/main/LICENSE) [client-docs]: https://cloud.google.com/nodejs/docs/reference/apigee-connect/latest [product-docs]: https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect/ diff --git a/packages/google-cloud-apigeeconnect/samples/README.md b/packages/google-cloud-apigeeconnect/samples/README.md index 5f286957e50..21aee0b0153 100644 --- a/packages/google-cloud-apigeeconnect/samples/README.md +++ b/packages/google-cloud-apigeeconnect/samples/README.md @@ -31,7 +31,7 @@ Before running the samples, make sure you've followed the steps outlined in ### Quickstart -View the [source code](https://github.com/googleapis/nodejs-apigee-connect/blob/master/samples/quickstart.js). +View the [source code](https://github.com/googleapis/nodejs-apigee-connect/blob/main/samples/quickstart.js). [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/nodejs-apigee-connect&page=editor&open_in_editor=samples/quickstart.js,samples/README.md) From 4ea60b58b752aa50535efcd711b5b45db53e268d Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Mon, 9 Aug 2021 23:38:27 +0000 Subject: [PATCH 17/63] chore: release 1.0.4 (#29) :robot: I have created a release \*beep\* \*boop\* --- ### [1.0.4](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.3...v1.0.4) (2021-08-09) ### Bug Fixes * **build:** migrate to using main branch ([#28](https://www.github.com/googleapis/nodejs-apigee-connect/issues/28)) ([dfcbe26](https://www.github.com/googleapis/nodejs-apigee-connect/commit/dfcbe2672c024a574e2fc1d60b8d668bbdf074b9)) --- This PR was generated with [Release Please](https://github.com/googleapis/release-please). See [documentation](https://github.com/googleapis/release-please#release-please). --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 3 files changed, 9 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index ea1b6b6db9a..f79b885cd4c 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,12 @@ # Changelog +### [1.0.4](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.3...v1.0.4) (2021-08-09) + + +### Bug Fixes + +* **build:** migrate to using main branch ([#28](https://www.github.com/googleapis/nodejs-apigee-connect/issues/28)) ([dfcbe26](https://www.github.com/googleapis/nodejs-apigee-connect/commit/dfcbe2672c024a574e2fc1d60b8d668bbdf074b9)) + ### [1.0.3](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.2...v1.0.3) (2021-07-16) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 28560815953..848b43a34a8 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "1.0.3", + "version": "1.0.4", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 9843aa10199..2e539843131 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^1.0.3" + "@google-cloud/apigee-connect": "^1.0.4" }, "devDependencies": { "c8": "^7.1.0", From f898b044d0a897a74e6bfbbc567a04815776642b Mon Sep 17 00:00:00 2001 From: "Benjamin E. Coe" Date: Mon, 16 Aug 2021 22:42:42 -0400 Subject: [PATCH 18/63] fix(deps): google-gax v2.24.1 (#30) --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 848b43a34a8..1c3f7918fc9 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -39,7 +39,7 @@ "prelint": "cd samples; npm link ../; npm i" }, "dependencies": { - "google-gax": "^2.17.1" + "google-gax": "^2.24.1" }, "devDependencies": { "@types/mocha": "^8.2.2", From b3a45d760698f89335326fa7297df2ef3711a2a8 Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Tue, 17 Aug 2021 17:20:26 +0000 Subject: [PATCH 19/63] chore: release 1.0.5 (#31) :robot: I have created a release \*beep\* \*boop\* --- ### [1.0.5](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.4...v1.0.5) (2021-08-17) ### Bug Fixes * **deps:** google-gax v2.24.1 ([#30](https://www.github.com/googleapis/nodejs-apigee-connect/issues/30)) ([72f263f](https://www.github.com/googleapis/nodejs-apigee-connect/commit/72f263f19d5490a83f963fcd071d0485678c0ba5)) --- This PR was generated with [Release Please](https://github.com/googleapis/release-please). See [documentation](https://github.com/googleapis/release-please#release-please). --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 3 files changed, 9 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index f79b885cd4c..881051ecd30 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,12 @@ # Changelog +### [1.0.5](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.4...v1.0.5) (2021-08-17) + + +### Bug Fixes + +* **deps:** google-gax v2.24.1 ([#30](https://www.github.com/googleapis/nodejs-apigee-connect/issues/30)) ([72f263f](https://www.github.com/googleapis/nodejs-apigee-connect/commit/72f263f19d5490a83f963fcd071d0485678c0ba5)) + ### [1.0.4](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.3...v1.0.4) (2021-08-09) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 1c3f7918fc9..a4d6618fc3c 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "1.0.4", + "version": "1.0.5", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 2e539843131..81d43aae286 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^1.0.4" + "@google-cloud/apigee-connect": "^1.0.5" }, "devDependencies": { "c8": "^7.1.0", From 52e7845123a0033a227a7942493fbb9d02be6606 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Mon, 23 Aug 2021 18:32:15 +0000 Subject: [PATCH 20/63] feat: turns on self-signed JWT feature flag (#32) - [ ] Regenerate this pull request now. PiperOrigin-RevId: 392067151 Source-Link: https://github.com/googleapis/googleapis/commit/06345f7b95c4b4a3ffe4303f1f2984ccc304b2e0 Source-Link: https://github.com/googleapis/googleapis-gen/commit/95882b37970e41e4cd51b22fa507cfd46dc7c4b6 --- .../src/v1/connection_service_client.ts | 6 ++++++ packages/google-cloud-apigeeconnect/src/v1/tether_client.ts | 6 ++++++ 2 files changed, 12 insertions(+) diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index 8587e99749e..61e8508d46a 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -131,6 +131,12 @@ export class ConnectionServiceClient { // Save the auth object to the client, for use by other methods. this.auth = this._gaxGrpc.auth as gax.GoogleAuth; + // Set useJWTAccessWithScope on the auth object. + this.auth.useJWTAccessWithScope = true; + + // Set defaultServicePath on the auth object. + this.auth.defaultServicePath = staticMembers.servicePath; + // Set the default scopes in auth client if needed. if (servicePath === staticMembers.servicePath) { this.auth.defaultScopes = staticMembers.scopes; diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index 409eab2cdcf..66c10614870 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -123,6 +123,12 @@ export class TetherClient { // Save the auth object to the client, for use by other methods. this.auth = this._gaxGrpc.auth as gax.GoogleAuth; + // Set useJWTAccessWithScope on the auth object. + this.auth.useJWTAccessWithScope = true; + + // Set defaultServicePath on the auth object. + this.auth.defaultServicePath = staticMembers.servicePath; + // Set the default scopes in auth client if needed. if (servicePath === staticMembers.servicePath) { this.auth.defaultScopes = staticMembers.scopes; From e6cb14871f836d8633c41f59e37dbe54ff58bd3f Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Tue, 24 Aug 2021 08:34:43 -0700 Subject: [PATCH 21/63] chore: release 1.1.0 (#33) Co-authored-by: release-please[bot] <55107282+release-please[bot]@users.noreply.github.com> --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 3 files changed, 9 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index 881051ecd30..3dc71ddd68d 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,12 @@ # Changelog +## [1.1.0](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.5...v1.1.0) (2021-08-23) + + +### Features + +* turns on self-signed JWT feature flag ([#32](https://www.github.com/googleapis/nodejs-apigee-connect/issues/32)) ([429964d](https://www.github.com/googleapis/nodejs-apigee-connect/commit/429964d038693cb16d37a3d2d23f79be3b73d1a0)) + ### [1.0.5](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.4...v1.0.5) (2021-08-17) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index a4d6618fc3c..1c613fc1d61 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "1.0.5", + "version": "1.1.0", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 81d43aae286..26de30a716d 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^1.0.5" + "@google-cloud/apigee-connect": "^1.1.0" }, "devDependencies": { "c8": "^7.1.0", From d98988fa4605db61702a6ee4b994e90f4dbaeebc Mon Sep 17 00:00:00 2001 From: Justin Beckwith Date: Wed, 25 Aug 2021 11:13:46 -0700 Subject: [PATCH 22/63] fix: flag the module as GA (#34) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * fix: flag the module as GA * 🦉 Updates from OwlBot See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md * Update .repo-metadata.json * 🦉 Updates from OwlBot See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md Co-authored-by: Owl Bot --- packages/google-cloud-apigeeconnect/.repo-metadata.json | 2 +- packages/google-cloud-apigeeconnect/README.md | 8 +++++++- 2 files changed, 8 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/.repo-metadata.json b/packages/google-cloud-apigeeconnect/.repo-metadata.json index cdf29bdd680..4e9bbea9985 100644 --- a/packages/google-cloud-apigeeconnect/.repo-metadata.json +++ b/packages/google-cloud-apigeeconnect/.repo-metadata.json @@ -4,7 +4,7 @@ "product_documentation": "https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect/", "client_documentation": "https://cloud.google.com/nodejs/docs/reference/apigee-connect/latest", "issue_tracker": "https://github.com/googleapis/nodejs-apigee-connect/issues", - "release_level": "BETA", + "release_level": "ga", "language": "nodejs", "repo": "googleapis/nodejs-apigee-connect", "distribution_name": "@google-cloud/apigee-connect", diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md index 3ccce097759..a5143768654 100644 --- a/packages/google-cloud-apigeeconnect/README.md +++ b/packages/google-cloud-apigeeconnect/README.md @@ -4,7 +4,7 @@ # [Apigee Connect API: Node.js Client](https://github.com/googleapis/nodejs-apigee-connect) -[![release level](https://img.shields.io/badge/release%20level-beta-yellow.svg?style=flat)](https://cloud.google.com/terms/launch-stages) +[![release level](https://img.shields.io/badge/release%20level-general%20availability%20%28GA%29-brightgreen.svg?style=flat)](https://cloud.google.com/terms/launch-stages) [![npm version](https://img.shields.io/npm/v/@google-cloud/apigee-connect.svg)](https://www.npmjs.org/package/@google-cloud/apigee-connect) [![codecov](https://img.shields.io/codecov/c/github/googleapis/nodejs-apigee-connect/main.svg?style=flat)](https://codecov.io/gh/googleapis/nodejs-apigee-connect) @@ -122,6 +122,12 @@ _Legacy Node.js versions are supported as a best effort:_ This library follows [Semantic Versioning](http://semver.org/). +This library is considered to be **General Availability (GA)**. This means it +is stable; the code surface will not change in backwards-incompatible ways +unless absolutely necessary (e.g. because of critical security issues) or with +an extensive deprecation period. Issues and requests against **GA** libraries +are addressed with the highest priority. + From a48f98e9047234ec5b42010ff7c2fb58fbb45251 Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Wed, 25 Aug 2021 18:24:13 +0000 Subject: [PATCH 23/63] chore: release 1.1.1 (#35) :robot: I have created a release \*beep\* \*boop\* --- ### [1.1.1](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.1.0...v1.1.1) (2021-08-25) ### Bug Fixes * flag the module as GA ([#34](https://www.github.com/googleapis/nodejs-apigee-connect/issues/34)) ([911bec0](https://www.github.com/googleapis/nodejs-apigee-connect/commit/911bec0d826a12212ce0527acf7398eef3dea1e6)) --- This PR was generated with [Release Please](https://github.com/googleapis/release-please). See [documentation](https://github.com/googleapis/release-please#release-please). --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 3 files changed, 9 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index 3dc71ddd68d..6483562624c 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,12 @@ # Changelog +### [1.1.1](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.1.0...v1.1.1) (2021-08-25) + + +### Bug Fixes + +* flag the module as GA ([#34](https://www.github.com/googleapis/nodejs-apigee-connect/issues/34)) ([911bec0](https://www.github.com/googleapis/nodejs-apigee-connect/commit/911bec0d826a12212ce0527acf7398eef3dea1e6)) + ## [1.1.0](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.0.5...v1.1.0) (2021-08-23) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 1c613fc1d61..78d96d2f470 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "1.1.0", + "version": "1.1.1", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 26de30a716d..390a8ab5860 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^1.1.0" + "@google-cloud/apigee-connect": "^1.1.1" }, "devDependencies": { "c8": "^7.1.0", From da035db6e9169b9dde60da154510465df6deb238 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Thu, 14 Oct 2021 00:45:25 +0000 Subject: [PATCH 24/63] build(node): update deps used during postprocessing (#1243) (#43) --- .../google-cloud-apigeeconnect/protos/protos.d.ts | 3 ++- .../google-cloud-apigeeconnect/protos/protos.js | 7 +++++++ .../google-cloud-apigeeconnect/protos/protos.json | 15 ++++++++++++++- 3 files changed, 23 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/protos/protos.d.ts b/packages/google-cloud-apigeeconnect/protos/protos.d.ts index 63e7874d58f..a7f0720afc8 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.d.ts +++ b/packages/google-cloud-apigeeconnect/protos/protos.d.ts @@ -1758,7 +1758,8 @@ export namespace google { OUTPUT_ONLY = 3, INPUT_ONLY = 4, IMMUTABLE = 5, - UNORDERED_LIST = 6 + UNORDERED_LIST = 6, + NON_EMPTY_DEFAULT = 7 } /** Properties of a ResourceDescriptor. */ diff --git a/packages/google-cloud-apigeeconnect/protos/protos.js b/packages/google-cloud-apigeeconnect/protos/protos.js index d3da15b1c09..f0520ba69e2 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.js +++ b/packages/google-cloud-apigeeconnect/protos/protos.js @@ -4374,6 +4374,7 @@ * @property {number} INPUT_ONLY=4 INPUT_ONLY value * @property {number} IMMUTABLE=5 IMMUTABLE value * @property {number} UNORDERED_LIST=6 UNORDERED_LIST value + * @property {number} NON_EMPTY_DEFAULT=7 NON_EMPTY_DEFAULT value */ api.FieldBehavior = (function() { var valuesById = {}, values = Object.create(valuesById); @@ -4384,6 +4385,7 @@ values[valuesById[4] = "INPUT_ONLY"] = 4; values[valuesById[5] = "IMMUTABLE"] = 5; values[valuesById[6] = "UNORDERED_LIST"] = 6; + values[valuesById[7] = "NON_EMPTY_DEFAULT"] = 7; return values; })(); @@ -10552,6 +10554,7 @@ case 4: case 5: case 6: + case 7: break; } } @@ -10656,6 +10659,10 @@ case 6: message[".google.api.fieldBehavior"][i] = 6; break; + case "NON_EMPTY_DEFAULT": + case 7: + message[".google.api.fieldBehavior"][i] = 7; + break; } } if (object[".google.api.resourceReference"] != null) { diff --git a/packages/google-cloud-apigeeconnect/protos/protos.json b/packages/google-cloud-apigeeconnect/protos/protos.json index a1d9e2de184..85d4d1cf459 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.json +++ b/packages/google-cloud-apigeeconnect/protos/protos.json @@ -449,7 +449,8 @@ "OUTPUT_ONLY": 3, "INPUT_ONLY": 4, "IMMUTABLE": 5, - "UNORDERED_LIST": 6 + "UNORDERED_LIST": 6, + "NON_EMPTY_DEFAULT": 7 } }, "resourceReference": { @@ -1092,6 +1093,18 @@ ] ], "reserved": [ + [ + 4, + 4 + ], + [ + 5, + 5 + ], + [ + 6, + 6 + ], [ 8, 8 From d789c42433e4526ac72f217a692b8b82092ee94a Mon Sep 17 00:00:00 2001 From: "F. Hinkelmann" Date: Thu, 21 Oct 2021 11:30:50 -0400 Subject: [PATCH 25/63] chore(cloud-rad): delete api-extractor config (#45) --- .../api-extractor.json | 369 ------------------ 1 file changed, 369 deletions(-) delete mode 100644 packages/google-cloud-apigeeconnect/api-extractor.json diff --git a/packages/google-cloud-apigeeconnect/api-extractor.json b/packages/google-cloud-apigeeconnect/api-extractor.json deleted file mode 100644 index de228294b23..00000000000 --- a/packages/google-cloud-apigeeconnect/api-extractor.json +++ /dev/null @@ -1,369 +0,0 @@ -/** - * Config file for API Extractor. For more info, please visit: https://api-extractor.com - */ -{ - "$schema": "https://developer.microsoft.com/json-schemas/api-extractor/v7/api-extractor.schema.json", - - /** - * Optionally specifies another JSON config file that this file extends from. This provides a way for - * standard settings to be shared across multiple projects. - * - * If the path starts with "./" or "../", the path is resolved relative to the folder of the file that contains - * the "extends" field. Otherwise, the first path segment is interpreted as an NPM package name, and will be - * resolved using NodeJS require(). - * - * SUPPORTED TOKENS: none - * DEFAULT VALUE: "" - */ - // "extends": "./shared/api-extractor-base.json" - // "extends": "my-package/include/api-extractor-base.json" - - /** - * Determines the "" token that can be used with other config file settings. The project folder - * typically contains the tsconfig.json and package.json config files, but the path is user-defined. - * - * The path is resolved relative to the folder of the config file that contains the setting. - * - * The default value for "projectFolder" is the token "", which means the folder is determined by traversing - * parent folders, starting from the folder containing api-extractor.json, and stopping at the first folder - * that contains a tsconfig.json file. If a tsconfig.json file cannot be found in this way, then an error - * will be reported. - * - * SUPPORTED TOKENS: - * DEFAULT VALUE: "" - */ - // "projectFolder": "..", - - /** - * (REQUIRED) Specifies the .d.ts file to be used as the starting point for analysis. API Extractor - * analyzes the symbols exported by this module. - * - * The file extension must be ".d.ts" and not ".ts". - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * SUPPORTED TOKENS: , , - */ - "mainEntryPointFilePath": "/protos/protos.d.ts", - - /** - * A list of NPM package names whose exports should be treated as part of this package. - * - * For example, suppose that Webpack is used to generate a distributed bundle for the project "library1", - * and another NPM package "library2" is embedded in this bundle. Some types from library2 may become part - * of the exported API for library1, but by default API Extractor would generate a .d.ts rollup that explicitly - * imports library2. To avoid this, we can specify: - * - * "bundledPackages": [ "library2" ], - * - * This would direct API Extractor to embed those types directly in the .d.ts rollup, as if they had been - * local files for library1. - */ - "bundledPackages": [ ], - - /** - * Determines how the TypeScript compiler engine will be invoked by API Extractor. - */ - "compiler": { - /** - * Specifies the path to the tsconfig.json file to be used by API Extractor when analyzing the project. - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * Note: This setting will be ignored if "overrideTsconfig" is used. - * - * SUPPORTED TOKENS: , , - * DEFAULT VALUE: "/tsconfig.json" - */ - // "tsconfigFilePath": "/tsconfig.json", - - /** - * Provides a compiler configuration that will be used instead of reading the tsconfig.json file from disk. - * The object must conform to the TypeScript tsconfig schema: - * - * http://json.schemastore.org/tsconfig - * - * If omitted, then the tsconfig.json file will be read from the "projectFolder". - * - * DEFAULT VALUE: no overrideTsconfig section - */ - // "overrideTsconfig": { - // . . . - // } - - /** - * This option causes the compiler to be invoked with the --skipLibCheck option. This option is not recommended - * and may cause API Extractor to produce incomplete or incorrect declarations, but it may be required when - * dependencies contain declarations that are incompatible with the TypeScript engine that API Extractor uses - * for its analysis. Where possible, the underlying issue should be fixed rather than relying on skipLibCheck. - * - * DEFAULT VALUE: false - */ - // "skipLibCheck": true, - }, - - /** - * Configures how the API report file (*.api.md) will be generated. - */ - "apiReport": { - /** - * (REQUIRED) Whether to generate an API report. - */ - "enabled": true, - - /** - * The filename for the API report files. It will be combined with "reportFolder" or "reportTempFolder" to produce - * a full file path. - * - * The file extension should be ".api.md", and the string should not contain a path separator such as "\" or "/". - * - * SUPPORTED TOKENS: , - * DEFAULT VALUE: ".api.md" - */ - // "reportFileName": ".api.md", - - /** - * Specifies the folder where the API report file is written. The file name portion is determined by - * the "reportFileName" setting. - * - * The API report file is normally tracked by Git. Changes to it can be used to trigger a branch policy, - * e.g. for an API review. - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * SUPPORTED TOKENS: , , - * DEFAULT VALUE: "/etc/" - */ - // "reportFolder": "/etc/", - - /** - * Specifies the folder where the temporary report file is written. The file name portion is determined by - * the "reportFileName" setting. - * - * After the temporary file is written to disk, it is compared with the file in the "reportFolder". - * If they are different, a production build will fail. - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * SUPPORTED TOKENS: , , - * DEFAULT VALUE: "/temp/" - */ - // "reportTempFolder": "/temp/" - }, - - /** - * Configures how the doc model file (*.api.json) will be generated. - */ - "docModel": { - /** - * (REQUIRED) Whether to generate a doc model file. - */ - "enabled": true, - - /** - * The output path for the doc model file. The file extension should be ".api.json". - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * SUPPORTED TOKENS: , , - * DEFAULT VALUE: "/temp/.api.json" - */ - // "apiJsonFilePath": "/temp/.api.json" - }, - - /** - * Configures how the .d.ts rollup file will be generated. - */ - "dtsRollup": { - /** - * (REQUIRED) Whether to generate the .d.ts rollup file. - */ - "enabled": true, - - /** - * Specifies the output path for a .d.ts rollup file to be generated without any trimming. - * This file will include all declarations that are exported by the main entry point. - * - * If the path is an empty string, then this file will not be written. - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * SUPPORTED TOKENS: , , - * DEFAULT VALUE: "/dist/.d.ts" - */ - // "untrimmedFilePath": "/dist/.d.ts", - - /** - * Specifies the output path for a .d.ts rollup file to be generated with trimming for a "beta" release. - * This file will include only declarations that are marked as "@public" or "@beta". - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * SUPPORTED TOKENS: , , - * DEFAULT VALUE: "" - */ - // "betaTrimmedFilePath": "/dist/-beta.d.ts", - - - /** - * Specifies the output path for a .d.ts rollup file to be generated with trimming for a "public" release. - * This file will include only declarations that are marked as "@public". - * - * If the path is an empty string, then this file will not be written. - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * SUPPORTED TOKENS: , , - * DEFAULT VALUE: "" - */ - // "publicTrimmedFilePath": "/dist/-public.d.ts", - - /** - * When a declaration is trimmed, by default it will be replaced by a code comment such as - * "Excluded from this release type: exampleMember". Set "omitTrimmingComments" to true to remove the - * declaration completely. - * - * DEFAULT VALUE: false - */ - // "omitTrimmingComments": true - }, - - /** - * Configures how the tsdoc-metadata.json file will be generated. - */ - "tsdocMetadata": { - /** - * Whether to generate the tsdoc-metadata.json file. - * - * DEFAULT VALUE: true - */ - // "enabled": true, - - /** - * Specifies where the TSDoc metadata file should be written. - * - * The path is resolved relative to the folder of the config file that contains the setting; to change this, - * prepend a folder token such as "". - * - * The default value is "", which causes the path to be automatically inferred from the "tsdocMetadata", - * "typings" or "main" fields of the project's package.json. If none of these fields are set, the lookup - * falls back to "tsdoc-metadata.json" in the package folder. - * - * SUPPORTED TOKENS: , , - * DEFAULT VALUE: "" - */ - // "tsdocMetadataFilePath": "/dist/tsdoc-metadata.json" - }, - - /** - * Specifies what type of newlines API Extractor should use when writing output files. By default, the output files - * will be written with Windows-style newlines. To use POSIX-style newlines, specify "lf" instead. - * To use the OS's default newline kind, specify "os". - * - * DEFAULT VALUE: "crlf" - */ - // "newlineKind": "crlf", - - /** - * Configures how API Extractor reports error and warning messages produced during analysis. - * - * There are three sources of messages: compiler messages, API Extractor messages, and TSDoc messages. - */ - "messages": { - /** - * Configures handling of diagnostic messages reported by the TypeScript compiler engine while analyzing - * the input .d.ts files. - * - * TypeScript message identifiers start with "TS" followed by an integer. For example: "TS2551" - * - * DEFAULT VALUE: A single "default" entry with logLevel=warning. - */ - "compilerMessageReporting": { - /** - * Configures the default routing for messages that don't match an explicit rule in this table. - */ - "default": { - /** - * Specifies whether the message should be written to the the tool's output log. Note that - * the "addToApiReportFile" property may supersede this option. - * - * Possible values: "error", "warning", "none" - * - * Errors cause the build to fail and return a nonzero exit code. Warnings cause a production build fail - * and return a nonzero exit code. For a non-production build (e.g. when "api-extractor run" includes - * the "--local" option), the warning is displayed but the build will not fail. - * - * DEFAULT VALUE: "warning" - */ - "logLevel": "warning", - - /** - * When addToApiReportFile is true: If API Extractor is configured to write an API report file (.api.md), - * then the message will be written inside that file; otherwise, the message is instead logged according to - * the "logLevel" option. - * - * DEFAULT VALUE: false - */ - // "addToApiReportFile": false - }, - - // "TS2551": { - // "logLevel": "warning", - // "addToApiReportFile": true - // }, - // - // . . . - }, - - /** - * Configures handling of messages reported by API Extractor during its analysis. - * - * API Extractor message identifiers start with "ae-". For example: "ae-extra-release-tag" - * - * DEFAULT VALUE: See api-extractor-defaults.json for the complete table of extractorMessageReporting mappings - */ - "extractorMessageReporting": { - "default": { - "logLevel": "warning", - // "addToApiReportFile": false - }, - - // "ae-extra-release-tag": { - // "logLevel": "warning", - // "addToApiReportFile": true - // }, - // - // . . . - }, - - /** - * Configures handling of messages reported by the TSDoc parser when analyzing code comments. - * - * TSDoc message identifiers start with "tsdoc-". For example: "tsdoc-link-tag-unescaped-text" - * - * DEFAULT VALUE: A single "default" entry with logLevel=warning. - */ - "tsdocMessageReporting": { - "default": { - "logLevel": "warning", - // "addToApiReportFile": false - } - - // "tsdoc-link-tag-unescaped-text": { - // "logLevel": "warning", - // "addToApiReportFile": true - // }, - // - // . . . - } - } - -} From d9f1b9db67c50386417e5a7d3aecda772556cab2 Mon Sep 17 00:00:00 2001 From: Takashi Matsuo Date: Wed, 27 Oct 2021 11:26:18 -0700 Subject: [PATCH 26/63] chore: fix the wrong post processor image (#47) --- packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml b/packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml index 1765fd1063f..fbd5ccda969 100644 --- a/packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml +++ b/packages/google-cloud-apigeeconnect/.github/.OwlBot.yaml @@ -12,7 +12,7 @@ # See the License for the specific language governing permissions and # limitations under the License. docker: - image: gcr.io/repo-automation-bots/owlbot-nodejs:latest + image: gcr.io/cloud-devrel-public-resources/owlbot-nodejs:latest deep-remove-regex: - /owl-bot-staging From e07d2dbdc07dc9a00450ff2a4b76a33ca2d71579 Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Wed, 27 Oct 2021 21:30:24 +0200 Subject: [PATCH 27/63] chore(deps): update dependency @types/node to v16 (#46) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![WhiteSource Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [@types/node](https://togithub.com/DefinitelyTyped/DefinitelyTyped) | [`^14.14.44` -> `^16.0.0`](https://renovatebot.com/diffs/npm/@types%2fnode/14.17.32/16.11.6) | [![age](https://badges.renovateapi.com/packages/npm/@types%2fnode/16.11.6/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/@types%2fnode/16.11.6/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/@types%2fnode/16.11.6/compatibility-slim/14.17.32)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/@types%2fnode/16.11.6/confidence-slim/14.17.32)](https://docs.renovatebot.com/merge-confidence/) | --- ### Configuration 📅 **Schedule**: "after 9am and before 3pm" (UTC). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, click this checkbox. --- This PR has been generated by [WhiteSource Renovate](https://renovate.whitesourcesoftware.com). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 78d96d2f470..603b85b059a 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -43,7 +43,7 @@ }, "devDependencies": { "@types/mocha": "^8.2.2", - "@types/node": "^14.14.44", + "@types/node": "^16.0.0", "@types/sinon": "^10.0.0", "c8": "^7.7.2", "gts": "^3.1.0", From 5f9cbde2a1d2c5136e2436135e3f6cf882bb9493 Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Thu, 4 Nov 2021 20:42:29 +0100 Subject: [PATCH 28/63] chore(deps): update dependency sinon to v12 (#48) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![WhiteSource Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [sinon](https://sinonjs.org/) ([source](https://togithub.com/sinonjs/sinon)) | [`^11.0.0` -> `^12.0.0`](https://renovatebot.com/diffs/npm/sinon/11.1.2/12.0.1) | [![age](https://badges.renovateapi.com/packages/npm/sinon/12.0.1/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/sinon/12.0.1/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/sinon/12.0.1/compatibility-slim/11.1.2)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/sinon/12.0.1/confidence-slim/11.1.2)](https://docs.renovatebot.com/merge-confidence/) | --- ### Release Notes
sinonjs/sinon ### [`v12.0.1`](https://togithub.com/sinonjs/sinon/blob/master/CHANGES.md#​1201) [Compare Source](https://togithub.com/sinonjs/sinon/compare/v12.0.0...v12.0.1) - [`3f598221`](https://togithub.com/sinonjs/sinon/commit/3f598221045904681f2b3b3ba1df617ed5e230e3) Fix issue with npm unlink for npm version > 6 (Carl-Erik Kopseng) > 'npm unlink' would implicitly unlink the current dir > until version 7, which requires an argument - [`51417a38`](https://togithub.com/sinonjs/sinon/commit/51417a38111eeeb7cd14338bfb762cc2df487e1b) Fix bundling of cjs module ([#​2412](https://togithub.com/sinonjs/sinon/issues/2412)) (Julian Grinblat) > - Fix bundling of cjs module > > - Run prettier *Released by [Carl-Erik Kopseng](https://togithub.com/fatso83) on 2021-11-04.* #### 12.0.0 ### [`v12.0.0`](https://togithub.com/sinonjs/sinon/compare/v11.1.2...v12.0.0) [Compare Source](https://togithub.com/sinonjs/sinon/compare/v11.1.2...v12.0.0)
--- ### Configuration 📅 **Schedule**: "after 9am and before 3pm" (UTC). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, click this checkbox. --- This PR has been generated by [WhiteSource Renovate](https://renovate.whitesourcesoftware.com). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 603b85b059a..08f5590572f 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -54,7 +54,7 @@ "mocha": "^8.4.0", "null-loader": "^4.0.1", "pack-n-play": "^1.0.0-2", - "sinon": "^11.0.0", + "sinon": "^12.0.0", "ts-loader": "^9.1.2", "typescript": "^4.2.4", "webpack": "^5.36.2", From 0fc6ad860502a6e7170ef8697ba12b10006c77b4 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Thu, 11 Nov 2021 16:01:05 -0800 Subject: [PATCH 29/63] docs(samples): add example tags to generated samples (#49) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * docs(samples): add example tags to generated samples PiperOrigin-RevId: 408439482 Source-Link: https://github.com/googleapis/googleapis/commit/b9f61843dc80c7c285fc34fd3a40aae55082c2b9 Source-Link: https://github.com/googleapis/googleapis-gen/commit/eb888bc214efc7bf43bf4634b470254565a659a5 Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiZWI4ODhiYzIxNGVmYzdiZjQzYmY0NjM0YjQ3MDI1NDU2NWE2NTlhNSJ9 * 🦉 Updates from OwlBot See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md Co-authored-by: Owl Bot --- .../linkinator.config.json | 2 +- .../v1/connection_service.list_connections.js | 68 +++++++++++++++ .../samples/generated/v1/tether.egress.js | 87 +++++++++++++++++++ .../src/v1/connection_service_client.ts | 76 ++++++++-------- .../src/v1/tether_client.ts | 8 +- 5 files changed, 195 insertions(+), 46 deletions(-) create mode 100644 packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js create mode 100644 packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js diff --git a/packages/google-cloud-apigeeconnect/linkinator.config.json b/packages/google-cloud-apigeeconnect/linkinator.config.json index 29a223b6db6..0121dfa684f 100644 --- a/packages/google-cloud-apigeeconnect/linkinator.config.json +++ b/packages/google-cloud-apigeeconnect/linkinator.config.json @@ -6,5 +6,5 @@ "img.shields.io" ], "silent": true, - "concurrency": 10 + "concurrency": 5 } diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js b/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js new file mode 100644 index 00000000000..65fad4ddc44 --- /dev/null +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js @@ -0,0 +1,68 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +'use strict'; + +function main(parent) { + // [START apigeeconnect_v1_generated_ConnectionService_ListConnections_async] + /** + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * Required. Parent name of the form: + * `projects/{project_number or project_id}/endpoints/{endpoint}`. + */ + // const parent = 'abc123' + /** + * The maximum number of connections to return. The service may return fewer + * than this value. If unspecified, at most 100 connections will be returned. + * The maximum value is 1000; values above 1000 will be coerced to 1000. + */ + // const pageSize = 1234 + /** + * A page token, received from a previous `ListConnections` call. + * Provide this to retrieve the subsequent page. + * When paginating, all other parameters provided to `ListConnections` must + * match the call that provided the page token. + */ + // const pageToken = 'abc123' + + // Imports the Apigeeconnect library + const {ConnectionServiceClient} = require('@google-cloud/apigee-connect').v1; + + // Instantiates a client + const apigeeconnectClient = new ConnectionServiceClient(); + + async function callListConnections() { + // Construct request + const request = { + parent, + }; + + // Run request + const iterable = await apigeeconnectClient.listConnectionsAsync(request); + for await (const response of iterable) { + console.log(response); + } + } + + callListConnections(); + // [END apigeeconnect_v1_generated_ConnectionService_ListConnections_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js b/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js new file mode 100644 index 00000000000..604f5a9aa3b --- /dev/null +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js @@ -0,0 +1,87 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +'use strict'; + +function main() { + // [START apigeeconnect_v1_generated_Tether_Egress_async] + /** + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * Unique identifier for the response. Matches the EgressRequest's id. + */ + // const id = 'abc123' + /** + * HttpResponse. + */ + // const httpResponse = {} + /** + * Errors from application when handling the http request. + */ + // const status = {} + /** + * GCP Project. + * Format: `projects/{project_number}`. + */ + // const project = 'my-project' + /** + * Unique identifier for clients to trace their request/response. Matches the + * EgressRequest's trace id + */ + // const traceId = 'abc123' + /** + * Tether Endpoint. + */ + // const endpoint = {} + /** + * Name is the full resource path of endpoint. + * Format: `projects/{project_number or project_id}/endpoints/{endpoint}` + */ + // const name = 'abc123' + + // Imports the Apigeeconnect library + const {TetherClient} = require('@google-cloud/apigee-connect').v1; + + // Instantiates a client + const apigeeconnectClient = new TetherClient(); + + async function callEgress() { + // Construct request + const request = {}; + + // Run request + const stream = await apigeeconnectClient.egress(); + stream.on('data', response => { + console.log(response); + }); + stream.on('error', err => { + throw err; + }); + stream.on('end', () => { + /* API call completed */ + }); + stream.write(request); + stream.end(); + } + + callEgress(); + // [END apigeeconnect_v1_generated_Tether_Egress_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index 61e8508d46a..95b57657d86 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -312,37 +312,6 @@ export class ConnectionServiceClient { // -- Service calls -- // ------------------- - listConnections( - request?: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, - options?: CallOptions - ): Promise< - [ - protos.google.cloud.apigeeconnect.v1.IConnection[], - protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest | null, - protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse - ] - >; - listConnections( - request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, - options: CallOptions, - callback: PaginationCallback< - protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, - | protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse - | null - | undefined, - protos.google.cloud.apigeeconnect.v1.IConnection - > - ): void; - listConnections( - request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, - callback: PaginationCallback< - protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, - | protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse - | null - | undefined, - protos.google.cloud.apigeeconnect.v1.IConnection - > - ): void; /** * Lists connections that are currently active for the given Apigee Connect * endpoint. @@ -375,6 +344,37 @@ export class ConnectionServiceClient { * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#auto-pagination) * for more details and examples. */ + listConnections( + request?: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + options?: CallOptions + ): Promise< + [ + protos.google.cloud.apigeeconnect.v1.IConnection[], + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest | null, + protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + ] + >; + listConnections( + request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + options: CallOptions, + callback: PaginationCallback< + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + | protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.apigeeconnect.v1.IConnection + > + ): void; + listConnections( + request: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + callback: PaginationCallback< + protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, + | protos.google.cloud.apigeeconnect.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.apigeeconnect.v1.IConnection + > + ): void; listConnections( request?: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, optionsOrCallback?: @@ -460,7 +460,8 @@ export class ConnectionServiceClient { gax.routingHeader.fromParams({ parent: request.parent || '', }); - const callSettings = new gax.CallSettings(options); + const defaultCallSettings = this._defaults['listConnections']; + const callSettings = defaultCallSettings.merge(options); this.initialize(); return this.descriptors.page.listConnections.createStream( this.innerApiCalls.listConnections as gax.GaxCall, @@ -498,11 +499,8 @@ export class ConnectionServiceClient { * Please see the * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#auto-pagination) * for more details and examples. - * @example - * const iterable = client.listConnectionsAsync(request); - * for await (const response of iterable) { - * // process response - * } + * @example include:samples/generated/v1/connection_service.list_connections.js + * region_tag:apigeeconnect_v1_generated_ConnectionService_ListConnections_async */ listConnectionsAsync( request?: protos.google.cloud.apigeeconnect.v1.IListConnectionsRequest, @@ -516,8 +514,8 @@ export class ConnectionServiceClient { gax.routingHeader.fromParams({ parent: request.parent || '', }); - options = options || {}; - const callSettings = new gax.CallSettings(options); + const defaultCallSettings = this._defaults['listConnections']; + const callSettings = defaultCallSettings.merge(options); this.initialize(); return this.descriptors.page.listConnections.asyncIterate( this.innerApiCalls['listConnections'] as GaxCall, diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index 66c10614870..84ccb6fd0ba 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -310,12 +310,8 @@ export class TetherClient { * Please see the * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#bi-directional-streaming) * for more details and examples. - * @example - * const stream = client.egress(); - * stream.on('data', (response) => { ... }); - * stream.on('end', () => { ... }); - * stream.write(request); - * stream.end(); + * @example include:samples/generated/v1/tether.egress.js + * region_tag:apigeeconnect_v1_generated_Tether_Egress_async */ egress(options?: CallOptions): gax.CancellableStream { this.initialize(); From 346b7891ec59a14c39fd2babb23fc0fc2baff022 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Fri, 10 Dec 2021 21:18:21 +0000 Subject: [PATCH 30/63] build: add generated samples to .eslintignore (#50) --- packages/google-cloud-apigeeconnect/.eslintignore | 1 + 1 file changed, 1 insertion(+) diff --git a/packages/google-cloud-apigeeconnect/.eslintignore b/packages/google-cloud-apigeeconnect/.eslintignore index 9340ad9b86d..ea5b04aebe6 100644 --- a/packages/google-cloud-apigeeconnect/.eslintignore +++ b/packages/google-cloud-apigeeconnect/.eslintignore @@ -4,3 +4,4 @@ test/fixtures build/ docs/ protos/ +samples/generated/ From 4a52cabf4495a41b5a09b7f4cdfd2eab69d57daf Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Wed, 29 Dec 2021 21:36:34 +0000 Subject: [PATCH 31/63] docs(node): support "stable"/"preview" release level (#1312) (#53) --- packages/google-cloud-apigeeconnect/README.md | 2 ++ 1 file changed, 2 insertions(+) diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md index a5143768654..64dd8f14c89 100644 --- a/packages/google-cloud-apigeeconnect/README.md +++ b/packages/google-cloud-apigeeconnect/README.md @@ -132,6 +132,8 @@ are addressed with the highest priority. + + More Information: [Google Cloud Platform Launch Stages][launch_stages] [launch_stages]: https://cloud.google.com/terms/launch-stages From 3b048f5c5f6a966924d91f6b12087cde405f1503 Mon Sep 17 00:00:00 2001 From: Anthonios Partheniou Date: Thu, 30 Dec 2021 11:39:02 -0500 Subject: [PATCH 32/63] chore: add api_shortname and library_type to repo metadata (#52) --- packages/google-cloud-apigeeconnect/.repo-metadata.json | 6 ++++-- packages/google-cloud-apigeeconnect/README.md | 9 ++++----- 2 files changed, 8 insertions(+), 7 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/.repo-metadata.json b/packages/google-cloud-apigeeconnect/.repo-metadata.json index 4e9bbea9985..e31d2d7f822 100644 --- a/packages/google-cloud-apigeeconnect/.repo-metadata.json +++ b/packages/google-cloud-apigeeconnect/.repo-metadata.json @@ -4,11 +4,13 @@ "product_documentation": "https://cloud.google.com/apigee/docs/hybrid/v1.3/apigee-connect/", "client_documentation": "https://cloud.google.com/nodejs/docs/reference/apigee-connect/latest", "issue_tracker": "https://github.com/googleapis/nodejs-apigee-connect/issues", - "release_level": "ga", + "release_level": "stable", "language": "nodejs", "repo": "googleapis/nodejs-apigee-connect", "distribution_name": "@google-cloud/apigee-connect", "api_id": "apigeeconnect.googleapis.com", "default_version": "v1", - "requires_billing": true + "requires_billing": true, + "api_shortname": "apigeeconnect", + "library_type": "GAPIC_AUTO" } diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md index 64dd8f14c89..a468f9478ea 100644 --- a/packages/google-cloud-apigeeconnect/README.md +++ b/packages/google-cloud-apigeeconnect/README.md @@ -4,7 +4,7 @@ # [Apigee Connect API: Node.js Client](https://github.com/googleapis/nodejs-apigee-connect) -[![release level](https://img.shields.io/badge/release%20level-general%20availability%20%28GA%29-brightgreen.svg?style=flat)](https://cloud.google.com/terms/launch-stages) + [![npm version](https://img.shields.io/npm/v/@google-cloud/apigee-connect.svg)](https://www.npmjs.org/package/@google-cloud/apigee-connect) [![codecov](https://img.shields.io/codecov/c/github/googleapis/nodejs-apigee-connect/main.svg?style=flat)](https://codecov.io/gh/googleapis/nodejs-apigee-connect) @@ -122,10 +122,10 @@ _Legacy Node.js versions are supported as a best effort:_ This library follows [Semantic Versioning](http://semver.org/). -This library is considered to be **General Availability (GA)**. This means it -is stable; the code surface will not change in backwards-incompatible ways + +This library is considered to be **stable**. The code surface will not change in backwards-incompatible ways unless absolutely necessary (e.g. because of critical security issues) or with -an extensive deprecation period. Issues and requests against **GA** libraries +an extensive deprecation period. Issues and requests against **stable** libraries are addressed with the highest priority. @@ -133,7 +133,6 @@ are addressed with the highest priority. - More Information: [Google Cloud Platform Launch Stages][launch_stages] [launch_stages]: https://cloud.google.com/terms/launch-stages From 2119c40dc93cea9967e9b65ff4bf33fc22fa2ab2 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Thu, 30 Dec 2021 23:20:15 +0000 Subject: [PATCH 33/63] docs(badges): tweak badge to use new preview/stable language (#1314) (#55) --- packages/google-cloud-apigeeconnect/README.md | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md index a468f9478ea..efede4ae2dd 100644 --- a/packages/google-cloud-apigeeconnect/README.md +++ b/packages/google-cloud-apigeeconnect/README.md @@ -4,9 +4,8 @@ # [Apigee Connect API: Node.js Client](https://github.com/googleapis/nodejs-apigee-connect) - +[![release level](https://img.shields.io/badge/release%20level-stable-brightgreen.svg?style=flat)](https://cloud.google.com/terms/launch-stages) [![npm version](https://img.shields.io/npm/v/@google-cloud/apigee-connect.svg)](https://www.npmjs.org/package/@google-cloud/apigee-connect) -[![codecov](https://img.shields.io/codecov/c/github/googleapis/nodejs-apigee-connect/main.svg?style=flat)](https://codecov.io/gh/googleapis/nodejs-apigee-connect) From 52db24492fdbfedabc60d6a3f8f9d09e402de3ee Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Tue, 11 Jan 2022 10:40:39 -0800 Subject: [PATCH 34/63] test(nodejs): remove 15 add 16 (#1322) (#57) Source-Link: https://github.com/googleapis/synthtool/commit/6981da4f29c0ae3dd783d58f1be5ab222d6a5642 Post-Processor: gcr.io/cloud-devrel-public-resources/owlbot-nodejs:latest@sha256:3563b6b264989c4f5aa31a3682e4df36c95756cfef275d3201508947cbfc511e Co-authored-by: Owl Bot --- packages/google-cloud-apigeeconnect/protos/protos.d.ts | 2 +- packages/google-cloud-apigeeconnect/protos/protos.js | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/protos/protos.d.ts b/packages/google-cloud-apigeeconnect/protos/protos.d.ts index a7f0720afc8..3f2ea95d519 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.d.ts +++ b/packages/google-cloud-apigeeconnect/protos/protos.d.ts @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. diff --git a/packages/google-cloud-apigeeconnect/protos/protos.js b/packages/google-cloud-apigeeconnect/protos/protos.js index f0520ba69e2..a4d2d02b2be 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.js +++ b/packages/google-cloud-apigeeconnect/protos/protos.js @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. From a5cec71531a371d5555a10b87be677fcf21293cb Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Thu, 20 Jan 2022 00:41:01 -0800 Subject: [PATCH 35/63] build: update copyright year to 2022 (#59) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * chore(deps): upgrade gapic-generator-java to 2.4.1 PiperOrigin-RevId: 422607515 Source-Link: https://github.com/googleapis/googleapis/commit/ba2ffd6fe6642e28b4fed2ffae217b4c5f084034 Source-Link: https://github.com/googleapis/googleapis-gen/commit/73ba4add239a619da567ffbd4e5730fdd6de04d3 Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiNzNiYTRhZGQyMzlhNjE5ZGE1NjdmZmJkNGU1NzMwZmRkNmRlMDRkMyJ9 * 🦉 Updates from OwlBot See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md Co-authored-by: Owl Bot --- packages/google-cloud-apigeeconnect/.jsdoc.js | 4 ++-- .../v1/connection_service.list_connections.js | 3 ++- .../samples/generated/v1/tether.egress.js | 18 +++++++----------- .../src/v1/connection_service_client.ts | 2 +- .../google-cloud-apigeeconnect/src/v1/index.ts | 2 +- .../src/v1/tether_client.ts | 2 +- .../system-test/fixtures/sample/src/index.js | 2 +- .../system-test/fixtures/sample/src/index.ts | 2 +- .../system-test/install.ts | 2 +- .../test/gapic_connection_service_v1.ts | 2 +- .../test/gapic_tether_v1.ts | 2 +- 11 files changed, 19 insertions(+), 22 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/.jsdoc.js b/packages/google-cloud-apigeeconnect/.jsdoc.js index 274d626bbfa..ccdcaed96a7 100644 --- a/packages/google-cloud-apigeeconnect/.jsdoc.js +++ b/packages/google-cloud-apigeeconnect/.jsdoc.js @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. @@ -40,7 +40,7 @@ module.exports = { includePattern: '\\.js$' }, templates: { - copyright: 'Copyright 2021 Google LLC', + copyright: 'Copyright 2022 Google LLC', includeDate: false, sourceFiles: false, systemName: '@google-cloud/apigee-connect', diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js b/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js index 65fad4ddc44..2160d736eda 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js @@ -12,6 +12,7 @@ // See the License for the specific language governing permissions and // limitations under the License. + 'use strict'; function main(parent) { @@ -53,7 +54,7 @@ function main(parent) { // Run request const iterable = await apigeeconnectClient.listConnectionsAsync(request); for await (const response of iterable) { - console.log(response); + console.log(response); } } diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js b/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js index 604f5a9aa3b..a45de3d27df 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js @@ -12,6 +12,7 @@ // See the License for the specific language governing permissions and // limitations under the License. + 'use strict'; function main() { @@ -59,21 +60,16 @@ function main() { async function callEgress() { // Construct request - const request = {}; + const request = { + }; // Run request const stream = await apigeeconnectClient.egress(); - stream.on('data', response => { - console.log(response); - }); - stream.on('error', err => { - throw err; - }); - stream.on('end', () => { - /* API call completed */ - }); + stream.on('data', (response) => { console.log(response) }); + stream.on('error', (err) => { throw(err) }); + stream.on('end', () => { /* API call completed */ }); stream.write(request); - stream.end(); + stream.end(); } callEgress(); diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index 95b57657d86..90dce56e7cc 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. diff --git a/packages/google-cloud-apigeeconnect/src/v1/index.ts b/packages/google-cloud-apigeeconnect/src/v1/index.ts index d7874445933..5e02047c0c8 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/index.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/index.ts @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index 84ccb6fd0ba..f6a4bdf800b 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. diff --git a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js index d763f9e83f4..814bc449ab9 100644 --- a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js +++ b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.js @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. diff --git a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts index 64cd2e5f269..88c4db10336 100644 --- a/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts +++ b/packages/google-cloud-apigeeconnect/system-test/fixtures/sample/src/index.ts @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. diff --git a/packages/google-cloud-apigeeconnect/system-test/install.ts b/packages/google-cloud-apigeeconnect/system-test/install.ts index d2d61c0396f..6dd1eaadafa 100644 --- a/packages/google-cloud-apigeeconnect/system-test/install.ts +++ b/packages/google-cloud-apigeeconnect/system-test/install.ts @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. diff --git a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts index b87ce7ff3dd..e329f9f762b 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. diff --git a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts index 0c246d91be5..d4ec3608ca5 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts @@ -1,4 +1,4 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. From fe9b3e96bf52745451aa86ba8462f852f2ad3f54 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Wed, 26 Jan 2022 19:52:50 +0000 Subject: [PATCH 36/63] chore: update v2.12.0 gapic-generator-typescript (#61) - [ ] Regenerate this pull request now. Committer: @summer-ji-eng PiperOrigin-RevId: 424244721 Source-Link: https://github.com/googleapis/googleapis/commit/4b6b01f507ebc3df95fdf8e1d76b0ae0ae33e52c Source-Link: https://github.com/googleapis/googleapis-gen/commit/8ac83fba606d008c7e8a42e7d55b6596ec4be35f Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiOGFjODNmYmE2MDZkMDA4YzdlOGE0MmU3ZDU1YjY1OTZlYzRiZTM1ZiJ9 --- .../google-cloud-apigeeconnect/linkinator.config.json | 10 ++++++++-- .../google-cloud-apigeeconnect/src/v1/tether_client.ts | 2 +- .../google-cloud-apigeeconnect/test/gapic_tether_v1.ts | 8 ++------ 3 files changed, 11 insertions(+), 9 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/linkinator.config.json b/packages/google-cloud-apigeeconnect/linkinator.config.json index 0121dfa684f..befd23c8633 100644 --- a/packages/google-cloud-apigeeconnect/linkinator.config.json +++ b/packages/google-cloud-apigeeconnect/linkinator.config.json @@ -3,8 +3,14 @@ "skip": [ "https://codecov.io/gh/googleapis/", "www.googleapis.com", - "img.shields.io" + "img.shields.io", + "https://console.cloud.google.com/cloudshell", + "https://support.google.com" ], "silent": true, - "concurrency": 5 + "concurrency": 5, + "retry": true, + "retryErrors": true, + "retryErrorsCount": 5, + "retryErrorsJitter": 3000 } diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index f6a4bdf800b..8d58f6e678f 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -315,7 +315,7 @@ export class TetherClient { */ egress(options?: CallOptions): gax.CancellableStream { this.initialize(); - return this.innerApiCalls.egress(options); + return this.innerApiCalls.egress(null, options); } /** diff --git a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts index d4ec3608ca5..b29db8e4f48 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts @@ -162,9 +162,7 @@ describe('v1.TetherClient', () => { const response = await promise; assert.deepStrictEqual(response, expectedResponse); assert( - (client.innerApiCalls.egress as SinonStub) - .getCall(0) - .calledWithExactly(undefined) + (client.innerApiCalls.egress as SinonStub).getCall(0).calledWith(null) ); assert.deepStrictEqual( ((stream as unknown as PassThrough)._transform as SinonStub).getCall(0) @@ -203,9 +201,7 @@ describe('v1.TetherClient', () => { }); await assert.rejects(promise, expectedError); assert( - (client.innerApiCalls.egress as SinonStub) - .getCall(0) - .calledWithExactly(undefined) + (client.innerApiCalls.egress as SinonStub).getCall(0).calledWith(null) ); assert.deepStrictEqual( ((stream as unknown as PassThrough)._transform as SinonStub).getCall(0) From 58b2b4cb086292057b0e797886e4ae4cc250060a Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Mon, 31 Jan 2022 23:28:46 +0100 Subject: [PATCH 37/63] chore(deps): update dependency sinon to v13 (#63) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![WhiteSource Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [sinon](https://sinonjs.org/) ([source](https://togithub.com/sinonjs/sinon)) | [`^12.0.0` -> `^13.0.0`](https://renovatebot.com/diffs/npm/sinon/12.0.1/13.0.0) | [![age](https://badges.renovateapi.com/packages/npm/sinon/13.0.0/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/sinon/13.0.0/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/sinon/13.0.0/compatibility-slim/12.0.1)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/sinon/13.0.0/confidence-slim/12.0.1)](https://docs.renovatebot.com/merge-confidence/) | --- ### Release Notes
sinonjs/sinon ### [`v13.0.0`](https://togithub.com/sinonjs/sinon/blob/HEAD/CHANGES.md#​1300) [Compare Source](https://togithub.com/sinonjs/sinon/compare/v12.0.1...v13.0.0) - [`cf3d6c0c`](https://togithub.com/sinonjs/sinon/commit/cf3d6c0cd9689c0ee673b3daa8bf9abd70304392) Upgrade packages ([#​2431](https://togithub.com/sinonjs/sinon/issues/2431)) (Carl-Erik Kopseng) > - Update all @​sinonjs/ packages > > - Upgrade to fake-timers 9 > > - chore: ensure always using latest LTS release - [`41710467`](https://togithub.com/sinonjs/sinon/commit/417104670d575e96a1b645ea40ce763afa76fb1b) Adjust deploy scripts to archive old releases in a separate branch, move existing releases out of master ([#​2426](https://togithub.com/sinonjs/sinon/issues/2426)) (Joel Bradshaw) > Co-authored-by: Carl-Erik Kopseng - [`c80a7266`](https://togithub.com/sinonjs/sinon/commit/c80a72660e89d88b08275eff1028ecb9e26fd8e9) Bump node-fetch from 2.6.1 to 2.6.7 ([#​2430](https://togithub.com/sinonjs/sinon/issues/2430)) (dependabot\[bot]) > Co-authored-by: dependabot\[bot] <49699333+dependabot\[bot][@​users](https://togithub.com/users).noreply.github.com> - [`a00f14a9`](https://togithub.com/sinonjs/sinon/commit/a00f14a97dbe8c65afa89674e16ad73fc7d2fdc0) Add explicit export for `./*` ([#​2413](https://togithub.com/sinonjs/sinon/issues/2413)) (なつき) - [`b82ca7ad`](https://togithub.com/sinonjs/sinon/commit/b82ca7ad9b1add59007771f65a18ee34415de8ca) Bump cached-path-relative from 1.0.2 to 1.1.0 ([#​2428](https://togithub.com/sinonjs/sinon/issues/2428)) (dependabot\[bot]) - [`a9ea1427`](https://togithub.com/sinonjs/sinon/commit/a9ea142716c094ef3c432ecc4089f8207b8dd8b6) Add documentation for assert.calledOnceWithMatch ([#​2424](https://togithub.com/sinonjs/sinon/issues/2424)) (Mathias Schreck) - [`1d5ab86b`](https://togithub.com/sinonjs/sinon/commit/1d5ab86ba60e50dd69593ffed2bffd4b8faa0d38) Be more general in stripping off stack frames to fix Firefox tests ([#​2425](https://togithub.com/sinonjs/sinon/issues/2425)) (Joel Bradshaw) - [`56b06129`](https://togithub.com/sinonjs/sinon/commit/56b06129e223eae690265c37b1113067e2b31bdc) Check call count type ([#​2410](https://togithub.com/sinonjs/sinon/issues/2410)) (Joel Bradshaw) - [`7863e2df`](https://togithub.com/sinonjs/sinon/commit/7863e2dfdbda79e0a32e42af09e6539fc2f2b80f) Fix [#​2414](https://togithub.com/sinonjs/sinon/issues/2414): make Sinon available on homepage (Carl-Erik Kopseng) - [`fabaabdd`](https://togithub.com/sinonjs/sinon/commit/fabaabdda82f39a7f5b75b55bd56cf77b1cd4a8f) Bump nokogiri from 1.11.4 to 1.13.1 ([#​2423](https://togithub.com/sinonjs/sinon/issues/2423)) (dependabot\[bot]) - [`dbc0fbd2`](https://togithub.com/sinonjs/sinon/commit/dbc0fbd263c8419fa47f9c3b20cf47890a242d21) Bump shelljs from 0.8.4 to 0.8.5 ([#​2422](https://togithub.com/sinonjs/sinon/issues/2422)) (dependabot\[bot]) - [`fb8b3d72`](https://togithub.com/sinonjs/sinon/commit/fb8b3d72a85dc8fb0547f859baf3f03a22a039f7) Run Prettier (Carl-Erik Kopseng) - [`12a45939`](https://togithub.com/sinonjs/sinon/commit/12a45939e9b047b6d3663fe55f2eb383ec63c4e1) Fix 2377: Throw error when trying to stub non-configurable or non-writable properties ([#​2417](https://togithub.com/sinonjs/sinon/issues/2417)) (Stuart Dotson) > Fixes issue [#​2377](https://togithub.com/sinonjs/sinon/issues/2377) by throwing an error when trying to stub non-configurable or non-writable properties *Released by [Carl-Erik Kopseng](https://togithub.com/fatso83) on 2022-01-28.*
--- ### Configuration 📅 **Schedule**: "after 9am and before 3pm" (UTC). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, click this checkbox. --- This PR has been generated by [WhiteSource Renovate](https://renovate.whitesourcesoftware.com). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 08f5590572f..425fa5277db 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -54,7 +54,7 @@ "mocha": "^8.4.0", "null-loader": "^4.0.1", "pack-n-play": "^1.0.0-2", - "sinon": "^12.0.0", + "sinon": "^13.0.0", "ts-loader": "^9.1.2", "typescript": "^4.2.4", "webpack": "^5.36.2", From af9409906c2151b75e4661901b237d84361f5070 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Thu, 3 Feb 2022 22:06:32 +0000 Subject: [PATCH 38/63] docs(nodejs): version support policy edits (#1346) (#65) --- packages/google-cloud-apigeeconnect/README.md | 24 +++++++++---------- 1 file changed, 12 insertions(+), 12 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/README.md b/packages/google-cloud-apigeeconnect/README.md index efede4ae2dd..f02d4d2f0e7 100644 --- a/packages/google-cloud-apigeeconnect/README.md +++ b/packages/google-cloud-apigeeconnect/README.md @@ -100,21 +100,21 @@ also contains samples. Our client libraries follow the [Node.js release schedule](https://nodejs.org/en/about/releases/). Libraries are compatible with all current _active_ and _maintenance_ versions of Node.js. +If you are using an end-of-life version of Node.js, we recommend that you update +as soon as possible to an actively supported LTS version. -Client libraries targeting some end-of-life versions of Node.js are available, and -can be installed via npm [dist-tags](https://docs.npmjs.com/cli/dist-tag). -The dist-tags follow the naming convention `legacy-(version)`. - -_Legacy Node.js versions are supported as a best effort:_ +Google's client libraries support legacy versions of Node.js runtimes on a +best-efforts basis with the following warnings: -* Legacy versions will not be tested in continuous integration. -* Some security patches may not be able to be backported. -* Dependencies will not be kept up-to-date, and features will not be backported. +* Legacy versions are not tested in continuous integration. +* Some security patches and features cannot be backported. +* Dependencies cannot be kept up-to-date. -#### Legacy tags available - -* `legacy-8`: install client libraries from this dist-tag for versions - compatible with Node.js 8. +Client libraries targeting some end-of-life versions of Node.js are available, and +can be installed through npm [dist-tags](https://docs.npmjs.com/cli/dist-tag). +The dist-tags follow the naming convention `legacy-(version)`. +For example, `npm install @google-cloud/apigee-connect@legacy-8` installs client libraries +for versions compatible with Node.js 8. ## Versioning From c30a7ba51362b374323e182be9606916b8e15566 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Fri, 18 Feb 2022 02:02:53 +0000 Subject: [PATCH 39/63] docs(samples): include metadata file, add exclusions for samples to handwritten libraries (#66) - [ ] Regenerate this pull request now. PiperOrigin-RevId: 429395631 Source-Link: https://github.com/googleapis/googleapis/commit/84594b35af0c38efcd6967e8179d801702ad96ff Source-Link: https://github.com/googleapis/googleapis-gen/commit/ed74f970fd82914874e6b27b04763cfa66bafe9b Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiZWQ3NGY5NzBmZDgyOTE0ODc0ZTZiMjdiMDQ3NjNjZmE2NmJhZmU5YiJ9 --- .../v1/connection_service.list_connections.js | 9 +- ...etadata.google.cloud.apigeeconnect.v1.json | 127 ++++++++++++++++++ .../samples/generated/v1/tether.egress.js | 9 +- .../src/v1/connection_service_client.ts | 5 +- .../src/v1/tether_client.ts | 26 +++- .../test/gapic_connection_service_v1.ts | 19 ++- .../test/gapic_tether_v1.ts | 19 ++- 7 files changed, 198 insertions(+), 16 deletions(-) create mode 100644 packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js b/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js index 2160d736eda..18c3a90350a 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js @@ -1,16 +1,21 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // -// http://www.apache.org/licenses/LICENSE-2.0 +// https://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + 'use strict'; diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json new file mode 100644 index 00000000000..b769958e5ee --- /dev/null +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json @@ -0,0 +1,127 @@ +{ + "clientLibrary": { + "name": "nodejs-apigeeconnect", + "version": "0.1.0", + "language": "TYPESCRIPT", + "apis": [ + { + "id": "google.cloud.apigeeconnect.v1", + "version": "v1" + } + ] + }, + "snippets": [ + { + "regionTag": "apigeeconnect_v1_generated_ConnectionService_ListConnections_async", + "title": "ConnectionService listConnections Sample", + "origin": "API_DEFINITION", + "description": " Lists connections that are currently active for the given Apigee Connect endpoint.", + "canonical": true, + "file": "connection_service.list_connections.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 66, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "ListConnections", + "fullName": "google.cloud.apigeeconnect.v1.ConnectionService.ListConnections", + "async": true, + "parameters": [ + { + "name": "parent", + "type": "TYPE_STRING" + }, + { + "name": "page_size", + "type": "TYPE_INT32" + }, + { + "name": "page_token", + "type": "TYPE_STRING" + } + ], + "resultType": ".google.cloud.apigeeconnect.v1.ListConnectionsResponse", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.apigeeconnect.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "ListConnections", + "fullName": "google.cloud.apigeeconnect.v1.ConnectionService.ListConnections", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.apigeeconnect.v1.ConnectionService" + } + } + } + }, + { + "regionTag": "apigeeconnect_v1_generated_Tether_Egress_async", + "title": "ConnectionService egress Sample", + "origin": "API_DEFINITION", + "description": " Egress streams egress requests and responses. Logically, this is not actually a streaming request, but uses streaming as a mechanism to flip the client-server relationship of gRPC so that the server can act as a client. The listener, the RPC server, accepts connections from the dialer, the RPC client. The listener streams http requests and the dialer streams http responses.", + "canonical": true, + "file": "tether.egress.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 80, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "Egress", + "fullName": "google.cloud.apigeeconnect.v1.Tether.Egress", + "async": true, + "parameters": [ + { + "name": "id", + "type": "TYPE_STRING" + }, + { + "name": "http_response", + "type": ".google.cloud.apigeeconnect.v1.HttpResponse" + }, + { + "name": "status", + "type": ".google.rpc.Status" + }, + { + "name": "project", + "type": "TYPE_STRING" + }, + { + "name": "trace_id", + "type": "TYPE_STRING" + }, + { + "name": "endpoint", + "type": ".google.cloud.apigeeconnect.v1.TetherEndpoint" + }, + { + "name": "name", + "type": "TYPE_STRING" + } + ], + "resultType": ".google.cloud.apigeeconnect.v1.EgressRequest", + "client": { + "shortName": "TetherClient", + "fullName": "google.cloud.apigeeconnect.v1.TetherClient" + }, + "method": { + "shortName": "Egress", + "fullName": "google.cloud.apigeeconnect.v1.Tether.Egress", + "service": { + "shortName": "Tether", + "fullName": "google.cloud.apigeeconnect.v1.Tether" + } + } + } + } + ] +} diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js b/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js index a45de3d27df..86b73462427 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js @@ -1,16 +1,21 @@ -// Copyright 2021 Google LLC +// Copyright 2022 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // -// http://www.apache.org/licenses/LICENSE-2.0 +// https://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + 'use strict'; diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index 90dce56e7cc..45335f0a819 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -570,9 +570,8 @@ export class ConnectionServiceClient { * @returns {Promise} A promise that resolves when the client is closed. */ close(): Promise { - this.initialize(); - if (!this._terminated) { - return this.connectionServiceStub!.then(stub => { + if (this.connectionServiceStub && !this._terminated) { + return this.connectionServiceStub.then(stub => { this._terminated = true; stub.close(); }); diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index 8d58f6e678f..9fb2f09ae6f 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -18,8 +18,15 @@ /* global window */ import * as gax from 'google-gax'; -import {Callback, CallOptions, Descriptors, ClientOptions} from 'google-gax'; - +import { + Callback, + CallOptions, + Descriptors, + ClientOptions, + GoogleError, +} from 'google-gax'; + +import {PassThrough} from 'stream'; import * as protos from '../../protos/protos'; import jsonProtos = require('../../protos/protos.json'); /** @@ -215,6 +222,16 @@ export class TetherClient { stub => (...args: Array<{}>) => { if (this._terminated) { + if (methodName in this.descriptors.stream) { + const stream = new PassThrough(); + setImmediate(() => { + stream.emit( + 'error', + new GoogleError('The client has already been closed.') + ); + }); + return stream; + } return Promise.reject('The client has already been closed.'); } const func = stub[methodName]; @@ -325,9 +342,8 @@ export class TetherClient { * @returns {Promise} A promise that resolves when the client is closed. */ close(): Promise { - this.initialize(); - if (!this._terminated) { - return this.tetherStub!.then(stub => { + if (this.tetherStub && !this._terminated) { + return this.tetherStub.then(stub => { this._terminated = true; stub.close(); }); diff --git a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts index e329f9f762b..de8b0be20a2 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts @@ -153,12 +153,27 @@ describe('v1.ConnectionServiceClient', () => { assert(client.connectionServiceStub); }); - it('has close method', () => { + it('has close method for the initialized client', done => { const client = new connectionserviceModule.v1.ConnectionServiceClient({ credentials: {client_email: 'bogus', private_key: 'bogus'}, projectId: 'bogus', }); - client.close(); + client.initialize(); + assert(client.connectionServiceStub); + client.close().then(() => { + done(); + }); + }); + + it('has close method for the non-initialized client', done => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.connectionServiceStub, undefined); + client.close().then(() => { + done(); + }); }); it('has getProjectId method', async () => { diff --git a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts index b29db8e4f48..4a47f629303 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts @@ -89,12 +89,27 @@ describe('v1.TetherClient', () => { assert(client.tetherStub); }); - it('has close method', () => { + it('has close method for the initialized client', done => { const client = new tetherModule.v1.TetherClient({ credentials: {client_email: 'bogus', private_key: 'bogus'}, projectId: 'bogus', }); - client.close(); + client.initialize(); + assert(client.tetherStub); + client.close().then(() => { + done(); + }); + }); + + it('has close method for the non-initialized client', done => { + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.tetherStub, undefined); + client.close().then(() => { + done(); + }); }); it('has getProjectId method', async () => { From d5e91d5e5a8dbde55d7ccb1a1249477c66d5884c Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Wed, 20 Apr 2022 18:24:16 +0000 Subject: [PATCH 40/63] build(node): update client library version in samples metadata (#1356) (#76) * build(node): add feat in node post-processor to add client library version number in snippet metadata Co-authored-by: Benjamin E. Coe Source-Link: https://github.com/googleapis/synthtool/commit/d337b88dd1494365183718a2de0b7b4056b6fdfe Post-Processor: gcr.io/cloud-devrel-public-resources/owlbot-nodejs:latest@sha256:d106724ad2a96daa1b8d88de101ba50bdb30b8df62ffa0aa2b451d93b4556641 --- ...etadata.google.cloud.apigeeconnect.v1.json | 244 +++++++++--------- 1 file changed, 122 insertions(+), 122 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json index b769958e5ee..cc34cc74b4a 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json @@ -1,127 +1,127 @@ { - "clientLibrary": { - "name": "nodejs-apigeeconnect", - "version": "0.1.0", - "language": "TYPESCRIPT", - "apis": [ - { - "id": "google.cloud.apigeeconnect.v1", - "version": "v1" - } - ] - }, - "snippets": [ - { - "regionTag": "apigeeconnect_v1_generated_ConnectionService_ListConnections_async", - "title": "ConnectionService listConnections Sample", - "origin": "API_DEFINITION", - "description": " Lists connections that are currently active for the given Apigee Connect endpoint.", - "canonical": true, - "file": "connection_service.list_connections.js", - "language": "JAVASCRIPT", - "segments": [ - { - "start": 25, - "end": 66, - "type": "FULL" - } - ], - "clientMethod": { - "shortName": "ListConnections", - "fullName": "google.cloud.apigeeconnect.v1.ConnectionService.ListConnections", - "async": true, - "parameters": [ - { - "name": "parent", - "type": "TYPE_STRING" - }, - { - "name": "page_size", - "type": "TYPE_INT32" - }, - { - "name": "page_token", - "type": "TYPE_STRING" - } - ], - "resultType": ".google.cloud.apigeeconnect.v1.ListConnectionsResponse", - "client": { - "shortName": "ConnectionServiceClient", - "fullName": "google.cloud.apigeeconnect.v1.ConnectionServiceClient" - }, - "method": { - "shortName": "ListConnections", - "fullName": "google.cloud.apigeeconnect.v1.ConnectionService.ListConnections", - "service": { - "shortName": "ConnectionService", - "fullName": "google.cloud.apigeeconnect.v1.ConnectionService" - } - } - } + "clientLibrary": { + "name": "nodejs-apigeeconnect", + "version": "1.1.1", + "language": "TYPESCRIPT", + "apis": [ + { + "id": "google.cloud.apigeeconnect.v1", + "version": "v1" + } + ] }, - { - "regionTag": "apigeeconnect_v1_generated_Tether_Egress_async", - "title": "ConnectionService egress Sample", - "origin": "API_DEFINITION", - "description": " Egress streams egress requests and responses. Logically, this is not actually a streaming request, but uses streaming as a mechanism to flip the client-server relationship of gRPC so that the server can act as a client. The listener, the RPC server, accepts connections from the dialer, the RPC client. The listener streams http requests and the dialer streams http responses.", - "canonical": true, - "file": "tether.egress.js", - "language": "JAVASCRIPT", - "segments": [ + "snippets": [ { - "start": 25, - "end": 80, - "type": "FULL" - } - ], - "clientMethod": { - "shortName": "Egress", - "fullName": "google.cloud.apigeeconnect.v1.Tether.Egress", - "async": true, - "parameters": [ - { - "name": "id", - "type": "TYPE_STRING" - }, - { - "name": "http_response", - "type": ".google.cloud.apigeeconnect.v1.HttpResponse" - }, - { - "name": "status", - "type": ".google.rpc.Status" - }, - { - "name": "project", - "type": "TYPE_STRING" - }, - { - "name": "trace_id", - "type": "TYPE_STRING" - }, - { - "name": "endpoint", - "type": ".google.cloud.apigeeconnect.v1.TetherEndpoint" - }, - { - "name": "name", - "type": "TYPE_STRING" - } - ], - "resultType": ".google.cloud.apigeeconnect.v1.EgressRequest", - "client": { - "shortName": "TetherClient", - "fullName": "google.cloud.apigeeconnect.v1.TetherClient" + "regionTag": "apigeeconnect_v1_generated_ConnectionService_ListConnections_async", + "title": "ConnectionService listConnections Sample", + "origin": "API_DEFINITION", + "description": " Lists connections that are currently active for the given Apigee Connect endpoint.", + "canonical": true, + "file": "connection_service.list_connections.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 66, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "ListConnections", + "fullName": "google.cloud.apigeeconnect.v1.ConnectionService.ListConnections", + "async": true, + "parameters": [ + { + "name": "parent", + "type": "TYPE_STRING" + }, + { + "name": "page_size", + "type": "TYPE_INT32" + }, + { + "name": "page_token", + "type": "TYPE_STRING" + } + ], + "resultType": ".google.cloud.apigeeconnect.v1.ListConnectionsResponse", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.apigeeconnect.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "ListConnections", + "fullName": "google.cloud.apigeeconnect.v1.ConnectionService.ListConnections", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.apigeeconnect.v1.ConnectionService" + } + } + } }, - "method": { - "shortName": "Egress", - "fullName": "google.cloud.apigeeconnect.v1.Tether.Egress", - "service": { - "shortName": "Tether", - "fullName": "google.cloud.apigeeconnect.v1.Tether" - } + { + "regionTag": "apigeeconnect_v1_generated_Tether_Egress_async", + "title": "ConnectionService egress Sample", + "origin": "API_DEFINITION", + "description": " Egress streams egress requests and responses. Logically, this is not actually a streaming request, but uses streaming as a mechanism to flip the client-server relationship of gRPC so that the server can act as a client. The listener, the RPC server, accepts connections from the dialer, the RPC client. The listener streams http requests and the dialer streams http responses.", + "canonical": true, + "file": "tether.egress.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 80, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "Egress", + "fullName": "google.cloud.apigeeconnect.v1.Tether.Egress", + "async": true, + "parameters": [ + { + "name": "id", + "type": "TYPE_STRING" + }, + { + "name": "http_response", + "type": ".google.cloud.apigeeconnect.v1.HttpResponse" + }, + { + "name": "status", + "type": ".google.rpc.Status" + }, + { + "name": "project", + "type": "TYPE_STRING" + }, + { + "name": "trace_id", + "type": "TYPE_STRING" + }, + { + "name": "endpoint", + "type": ".google.cloud.apigeeconnect.v1.TetherEndpoint" + }, + { + "name": "name", + "type": "TYPE_STRING" + } + ], + "resultType": ".google.cloud.apigeeconnect.v1.EgressRequest", + "client": { + "shortName": "TetherClient", + "fullName": "google.cloud.apigeeconnect.v1.TetherClient" + }, + "method": { + "shortName": "Egress", + "fullName": "google.cloud.apigeeconnect.v1.Tether.Egress", + "service": { + "shortName": "Tether", + "fullName": "google.cloud.apigeeconnect.v1.Tether" + } + } + } } - } - } - ] -} + ] +} \ No newline at end of file From 70e5f68372572a5103440bef6d1e6f44a1982573 Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Tue, 3 May 2022 03:24:23 +0200 Subject: [PATCH 41/63] chore(deps): update dependency @types/mocha to v9 (#77) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![WhiteSource Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [@types/mocha](https://togithub.com/DefinitelyTyped/DefinitelyTyped) | [`^8.2.2` -> `^9.0.0`](https://renovatebot.com/diffs/npm/@types%2fmocha/8.2.3/9.1.1) | [![age](https://badges.renovateapi.com/packages/npm/@types%2fmocha/9.1.1/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/@types%2fmocha/9.1.1/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/@types%2fmocha/9.1.1/compatibility-slim/8.2.3)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/@types%2fmocha/9.1.1/confidence-slim/8.2.3)](https://docs.renovatebot.com/merge-confidence/) | --- ### Configuration 📅 **Schedule**: "after 9am and before 3pm" (UTC). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, click this checkbox. --- This PR has been generated by [WhiteSource Renovate](https://renovate.whitesourcesoftware.com). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 425fa5277db..50293a10ada 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -42,7 +42,7 @@ "google-gax": "^2.24.1" }, "devDependencies": { - "@types/mocha": "^8.2.2", + "@types/mocha": "^9.0.0", "@types/node": "^16.0.0", "@types/sinon": "^10.0.0", "c8": "^7.7.2", From 40f66360bd5722dc0f671ef39b443577c99eb986 Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Mon, 9 May 2022 17:40:27 +0200 Subject: [PATCH 42/63] chore(deps): update dependency sinon to v14 (#80) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![WhiteSource Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [sinon](https://sinonjs.org/) ([source](https://togithub.com/sinonjs/sinon)) | [`^13.0.0` -> `^14.0.0`](https://renovatebot.com/diffs/npm/sinon/13.0.2/14.0.0) | [![age](https://badges.renovateapi.com/packages/npm/sinon/14.0.0/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/sinon/14.0.0/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/sinon/14.0.0/compatibility-slim/13.0.2)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/sinon/14.0.0/confidence-slim/13.0.2)](https://docs.renovatebot.com/merge-confidence/) | --- ### Release Notes
sinonjs/sinon ### [`v14.0.0`](https://togithub.com/sinonjs/sinon/blob/HEAD/CHANGES.md#​1400) [Compare Source](https://togithub.com/sinonjs/sinon/compare/v13.0.2...v14.0.0) - [`c2bbd826`](https://togithub.com/sinonjs/sinon/commit/c2bbd82641444eb5b32822489ae40f185afbbf00) Drop node 12 (Morgan Roderick) > And embrace Node 18 > > See https://nodejs.org/en/about/releases/ *Released by Morgan Roderick on 2022-05-07.*
--- ### Configuration 📅 **Schedule**: "after 9am and before 3pm" (UTC). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, click this checkbox. --- This PR has been generated by [WhiteSource Renovate](https://renovate.whitesourcesoftware.com). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 50293a10ada..e60826939ff 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -54,7 +54,7 @@ "mocha": "^8.4.0", "null-loader": "^4.0.1", "pack-n-play": "^1.0.0-2", - "sinon": "^13.0.0", + "sinon": "^14.0.0", "ts-loader": "^9.1.2", "typescript": "^4.2.4", "webpack": "^5.36.2", From d4a94863db33db8fedc42cc08983b84707c87ae9 Mon Sep 17 00:00:00 2001 From: sofisl <55454395+sofisl@users.noreply.github.com> Date: Fri, 20 May 2022 11:29:03 -0700 Subject: [PATCH 43/63] build!: update library to use Node 12 (#81) * build!: Update library to use Node 12 Co-authored-by: Owl Bot --- packages/google-cloud-apigeeconnect/package.json | 8 ++++---- packages/google-cloud-apigeeconnect/samples/package.json | 4 ++-- 2 files changed, 6 insertions(+), 6 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index e60826939ff..c27d325e969 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -39,7 +39,7 @@ "prelint": "cd samples; npm link ../; npm i" }, "dependencies": { - "google-gax": "^2.24.1" + "google-gax": "^3.0.1" }, "devDependencies": { "@types/mocha": "^9.0.0", @@ -51,16 +51,16 @@ "jsdoc-fresh": "^1.0.2", "jsdoc-region-tag": "^1.0.6", "linkinator": "^2.13.6", - "mocha": "^8.4.0", + "mocha": "^9.2.2", "null-loader": "^4.0.1", "pack-n-play": "^1.0.0-2", "sinon": "^14.0.0", "ts-loader": "^9.1.2", - "typescript": "^4.2.4", + "typescript": "^4.6.4", "webpack": "^5.36.2", "webpack-cli": "^4.7.0" }, "engines": { - "node": ">=v10.0.0" + "node": ">=12.0.0" } } diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 390a8ab5860..2ed2c98049c 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -4,7 +4,7 @@ "license": "Apache-2.0", "author": "Google LLC", "engines": { - "node": ">=10" + "node": ">=12.0.0" }, "files": [ "*.js" @@ -20,4 +20,4 @@ "chai": "^4.2.0", "mocha": "^8.0.0" } -} +} \ No newline at end of file From 4b731d0e41ab010688bfce3abb725ac0f056db79 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Tue, 31 May 2022 22:14:24 +0000 Subject: [PATCH 44/63] fix: fixes for dynamic routing and streaming descriptors (#84) - [ ] Regenerate this pull request now. Use gapic-generator-typescript v2.14.5. PiperOrigin-RevId: 450616838 Source-Link: https://github.com/googleapis/googleapis/commit/7a47b72791e0b84d78beca4c2b26bec42ce31572 Source-Link: https://github.com/googleapis/googleapis-gen/commit/42cc6331bae0b99f61b8e01ae15b05211716c4f9 Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiNDJjYzYzMzFiYWUwYjk5ZjYxYjhlMDFhZTE1YjA1MjExNzE2YzRmOSJ9 --- packages/google-cloud-apigeeconnect/src/v1/tether_client.ts | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index 9fb2f09ae6f..6386d7c247f 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -163,7 +163,8 @@ export class TetherClient { // Provide descriptors for these. this.descriptors.stream = { egress: new this._gaxModule.StreamDescriptor( - gax.StreamType.BIDI_STREAMING + gax.StreamType.BIDI_STREAMING, + opts.fallback === 'rest' ), }; From 0a87812c4ccea79fcd68c4c1c1f92e800e69d5b8 Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Tue, 7 Jun 2022 11:30:30 -0400 Subject: [PATCH 45/63] chore(main): release 2.0.0 (#83) See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md Co-authored-by: release-please[bot] <55107282+release-please[bot]@users.noreply.github.com> Co-authored-by: Owl Bot --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 16 ++++++++++++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- ...t_metadata.google.cloud.apigeeconnect.v1.json | 2 +- .../samples/package.json | 2 +- 4 files changed, 19 insertions(+), 3 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index 6483562624c..4cf5937ccb2 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,21 @@ # Changelog +## [2.0.0](https://github.com/googleapis/nodejs-apigee-connect/compare/v1.1.1...v2.0.0) (2022-05-31) + + +### ⚠ BREAKING CHANGES + +* update library to use Node 12 (#81) + +### Bug Fixes + +* fixes for dynamic routing and streaming descriptors ([#84](https://github.com/googleapis/nodejs-apigee-connect/issues/84)) ([a1e04af](https://github.com/googleapis/nodejs-apigee-connect/commit/a1e04af2fb52535938ff32cf5579b22c668d6ad2)) + + +### Build System + +* update library to use Node 12 ([#81](https://github.com/googleapis/nodejs-apigee-connect/issues/81)) ([5d4c69e](https://github.com/googleapis/nodejs-apigee-connect/commit/5d4c69e4268b4b253ed75ce87b2b3f5e61962d44)) + ### [1.1.1](https://www.github.com/googleapis/nodejs-apigee-connect/compare/v1.1.0...v1.1.1) (2021-08-25) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index c27d325e969..b9addcff08f 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "1.1.1", + "version": "2.0.0", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json index cc34cc74b4a..505ddfc57dd 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json @@ -1,7 +1,7 @@ { "clientLibrary": { "name": "nodejs-apigeeconnect", - "version": "1.1.1", + "version": "2.0.0", "language": "TYPESCRIPT", "apis": [ { diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 2ed2c98049c..6f3491b7f33 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^1.1.1" + "@google-cloud/apigee-connect": "^2.0.0" }, "devDependencies": { "c8": "^7.1.0", From 9d06991bfecd38b5629bbe6eca336bc28c507064 Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Fri, 10 Jun 2022 17:00:21 +0200 Subject: [PATCH 46/63] chore(deps): update dependency jsdoc-fresh to v2 (#86) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![Mend Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [jsdoc-fresh](https://togithub.com/googleapis/jsdoc-fresh) | [`^1.0.2` -> `^2.0.0`](https://renovatebot.com/diffs/npm/jsdoc-fresh/1.1.1/2.0.0) | [![age](https://badges.renovateapi.com/packages/npm/jsdoc-fresh/2.0.0/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/jsdoc-fresh/2.0.0/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/jsdoc-fresh/2.0.0/compatibility-slim/1.1.1)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/jsdoc-fresh/2.0.0/confidence-slim/1.1.1)](https://docs.renovatebot.com/merge-confidence/) | --- ### Release Notes
googleapis/jsdoc-fresh ### [`v2.0.0`](https://togithub.com/googleapis/jsdoc-fresh/blob/HEAD/CHANGELOG.md#​200-httpsgithubcomgoogleapisjsdoc-freshcomparev111v200-2022-05-18) [Compare Source](https://togithub.com/googleapis/jsdoc-fresh/compare/v1.1.1...v2.0.0) ##### ⚠ BREAKING CHANGES - update library to use Node 12 ([#​108](https://togithub.com/googleapis/jsdoc-fresh/issues/108)) ##### Build System - update library to use Node 12 ([#​108](https://togithub.com/googleapis/jsdoc-fresh/issues/108)) ([e61c223](https://togithub.com/googleapis/jsdoc-fresh/commit/e61c2238db8900e339e5fe7fb8aea09642290182)) ##### [1.1.1](https://www.github.com/googleapis/jsdoc-fresh/compare/v1.1.0...v1.1.1) (2021-08-11) ##### Bug Fixes - **build:** migrate to using main branch ([#​83](https://www.togithub.com/googleapis/jsdoc-fresh/issues/83)) ([9474adb](https://www.github.com/googleapis/jsdoc-fresh/commit/9474adbf0d559d319ff207397ba2be6b557999ac))
--- ### Configuration 📅 **Schedule**: Branch creation - "after 9am and before 3pm" (UTC), Automerge - At any time (no schedule defined). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, click this checkbox. --- This PR has been generated by [Mend Renovate](https://www.mend.io/free-developer-tools/renovate/). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index b9addcff08f..031c77ac27c 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -48,7 +48,7 @@ "c8": "^7.7.2", "gts": "^3.1.0", "jsdoc": "^3.6.6", - "jsdoc-fresh": "^1.0.2", + "jsdoc-fresh": "^2.0.0", "jsdoc-region-tag": "^1.0.6", "linkinator": "^2.13.6", "mocha": "^9.2.2", From cf9d2efdfb3268dd8bbdfdd56fd2eb43e2395cc5 Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Fri, 10 Jun 2022 17:24:36 +0200 Subject: [PATCH 47/63] chore(deps): update dependency jsdoc-region-tag to v2 (#87) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![Mend Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [jsdoc-region-tag](https://togithub.com/googleapis/jsdoc-region-tag) | [`^1.0.6` -> `^2.0.0`](https://renovatebot.com/diffs/npm/jsdoc-region-tag/1.3.1/2.0.0) | [![age](https://badges.renovateapi.com/packages/npm/jsdoc-region-tag/2.0.0/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/jsdoc-region-tag/2.0.0/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/jsdoc-region-tag/2.0.0/compatibility-slim/1.3.1)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/jsdoc-region-tag/2.0.0/confidence-slim/1.3.1)](https://docs.renovatebot.com/merge-confidence/) | --- ### Release Notes
googleapis/jsdoc-region-tag ### [`v2.0.0`](https://togithub.com/googleapis/jsdoc-region-tag/blob/HEAD/CHANGELOG.md#​200-httpsgithubcomgoogleapisjsdoc-region-tagcomparev131v200-2022-05-20) [Compare Source](https://togithub.com/googleapis/jsdoc-region-tag/compare/v1.3.1...v2.0.0) ##### ⚠ BREAKING CHANGES - update library to use Node 12 ([#​107](https://togithub.com/googleapis/jsdoc-region-tag/issues/107)) ##### Build System - update library to use Node 12 ([#​107](https://togithub.com/googleapis/jsdoc-region-tag/issues/107)) ([5b51796](https://togithub.com/googleapis/jsdoc-region-tag/commit/5b51796771984cf8b978990025f14faa03c19923)) ##### [1.3.1](https://www.github.com/googleapis/jsdoc-region-tag/compare/v1.3.0...v1.3.1) (2021-08-11) ##### Bug Fixes - **build:** migrate to using main branch ([#​79](https://www.togithub.com/googleapis/jsdoc-region-tag/issues/79)) ([5050615](https://www.github.com/googleapis/jsdoc-region-tag/commit/50506150b7758592df5e389c6a5c3d82b3b20881))
--- ### Configuration 📅 **Schedule**: Branch creation - "after 9am and before 3pm" (UTC), Automerge - At any time (no schedule defined). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, click this checkbox. --- This PR has been generated by [Mend Renovate](https://www.mend.io/free-developer-tools/renovate/). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 031c77ac27c..6f4c7809ba1 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -49,7 +49,7 @@ "gts": "^3.1.0", "jsdoc": "^3.6.6", "jsdoc-fresh": "^2.0.0", - "jsdoc-region-tag": "^1.0.6", + "jsdoc-region-tag": "^2.0.0", "linkinator": "^2.13.6", "mocha": "^9.2.2", "null-loader": "^4.0.1", From d45c02529f138b7e38dadaff0775b2e1ddf42e59 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Wed, 29 Jun 2022 16:35:49 -0400 Subject: [PATCH 48/63] feat: support regapic LRO (#88) Use gapic-generator-typescript v2.15.1. PiperOrigin-RevId: 456946341 Source-Link: https://github.com/googleapis/googleapis/commit/88fd18d9d3b872b3d06a3d9392879f50b5bf3ce5 Source-Link: https://github.com/googleapis/googleapis-gen/commit/accfa371f667439313335c64042b063c1c53102e Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiYWNjZmEzNzFmNjY3NDM5MzEzMzM1YzY0MDQyYjA2M2MxYzUzMTAyZSJ9 See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md Co-authored-by: Owl Bot --- .../src/v1/connection_service_client.ts | 11 +++++------ .../src/v1/tether_client.ts | 11 +++++------ 2 files changed, 10 insertions(+), 12 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index 45335f0a819..e67b5f3d60d 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -70,7 +70,7 @@ export class ConnectionServiceClient { * * @param {object} [options] - The configuration object. * The options accepted by the constructor are described in detail - * in [this document](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#creating-the-client-instance). + * in [this document](https://github.com/googleapis/gax-nodejs/blob/main/client-libraries.md#creating-the-client-instance). * The common options are: * @param {object} [options.credentials] - Credentials object. * @param {string} [options.credentials.client_email] @@ -93,11 +93,10 @@ export class ConnectionServiceClient { * API remote host. * @param {gax.ClientConfig} [options.clientConfig] - Client configuration override. * Follows the structure of {@link gapicConfig}. - * @param {boolean} [options.fallback] - Use HTTP fallback mode. - * In fallback mode, a special browser-compatible transport implementation is used - * instead of gRPC transport. In browser context (if the `window` object is defined) - * the fallback mode is enabled automatically; set `options.fallback` to `false` - * if you need to override this behavior. + * @param {boolean | "rest"} [options.fallback] - Use HTTP fallback mode. + * Pass "rest" to use HTTP/1.1 REST API instead of gRPC. + * For more information, please check the + * {@link https://github.com/googleapis/gax-nodejs/blob/main/client-libraries.md#http11-rest-api-mode documentation}. */ constructor(opts?: ClientOptions) { // Ensure that options include all the required fields. diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index 6386d7c247f..97b347066a1 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -69,7 +69,7 @@ export class TetherClient { * * @param {object} [options] - The configuration object. * The options accepted by the constructor are described in detail - * in [this document](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#creating-the-client-instance). + * in [this document](https://github.com/googleapis/gax-nodejs/blob/main/client-libraries.md#creating-the-client-instance). * The common options are: * @param {object} [options.credentials] - Credentials object. * @param {string} [options.credentials.client_email] @@ -92,11 +92,10 @@ export class TetherClient { * API remote host. * @param {gax.ClientConfig} [options.clientConfig] - Client configuration override. * Follows the structure of {@link gapicConfig}. - * @param {boolean} [options.fallback] - Use HTTP fallback mode. - * In fallback mode, a special browser-compatible transport implementation is used - * instead of gRPC transport. In browser context (if the `window` object is defined) - * the fallback mode is enabled automatically; set `options.fallback` to `false` - * if you need to override this behavior. + * @param {boolean | "rest"} [options.fallback] - Use HTTP fallback mode. + * Pass "rest" to use HTTP/1.1 REST API instead of gRPC. + * For more information, please check the + * {@link https://github.com/googleapis/gax-nodejs/blob/main/client-libraries.md#http11-rest-api-mode documentation}. */ constructor(opts?: ClientOptions) { // Ensure that options include all the required fields. From 20da014d993185f78d73d17006d7d3ae2225f29b Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Thu, 30 Jun 2022 19:12:11 +0000 Subject: [PATCH 49/63] chore(main): release 2.1.0 (#89) :robot: I have created a release *beep* *boop* --- ## [2.1.0](https://github.com/googleapis/nodejs-apigee-connect/compare/v2.0.0...v2.1.0) (2022-06-29) ### Features * support regapic LRO ([#88](https://github.com/googleapis/nodejs-apigee-connect/issues/88)) ([6ef6bed](https://github.com/googleapis/nodejs-apigee-connect/commit/6ef6bed421e56459dac29deab71898ce5c061206)) --- This PR was generated with [Release Please](https://github.com/googleapis/release-please). See [documentation](https://github.com/googleapis/release-please#release-please). --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 7 +++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- .../v1/snippet_metadata.google.cloud.apigeeconnect.v1.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 4 files changed, 10 insertions(+), 3 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index 4cf5937ccb2..bbf4f085fb8 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,12 @@ # Changelog +## [2.1.0](https://github.com/googleapis/nodejs-apigee-connect/compare/v2.0.0...v2.1.0) (2022-06-29) + + +### Features + +* support regapic LRO ([#88](https://github.com/googleapis/nodejs-apigee-connect/issues/88)) ([6ef6bed](https://github.com/googleapis/nodejs-apigee-connect/commit/6ef6bed421e56459dac29deab71898ce5c061206)) + ## [2.0.0](https://github.com/googleapis/nodejs-apigee-connect/compare/v1.1.1...v2.0.0) (2022-05-31) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 6f4c7809ba1..d5b2d203112 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "2.0.0", + "version": "2.1.0", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json index 505ddfc57dd..16dbad6dcfd 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json @@ -1,7 +1,7 @@ { "clientLibrary": { "name": "nodejs-apigeeconnect", - "version": "2.0.0", + "version": "2.1.0", "language": "TYPESCRIPT", "apis": [ { diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 6f3491b7f33..d3d44b4d415 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^2.0.0" + "@google-cloud/apigee-connect": "^2.1.0" }, "devDependencies": { "c8": "^7.1.0", From 7999c676569d51b8fe4eb9f87cc0924abbb0fcd2 Mon Sep 17 00:00:00 2001 From: WhiteSource Renovate Date: Wed, 13 Jul 2022 02:02:22 +0200 Subject: [PATCH 50/63] chore(deps): update dependency linkinator to v4 (#93) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![Mend Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [linkinator](https://togithub.com/JustinBeckwith/linkinator) | [`^2.13.6` -> `^4.0.0`](https://renovatebot.com/diffs/npm/linkinator/2.16.2/4.0.2) | [![age](https://badges.renovateapi.com/packages/npm/linkinator/4.0.2/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/linkinator/4.0.2/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/linkinator/4.0.2/compatibility-slim/2.16.2)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/linkinator/4.0.2/confidence-slim/2.16.2)](https://docs.renovatebot.com/merge-confidence/) | --- ### Release Notes
JustinBeckwith/linkinator ### [`v4.0.2`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v4.0.2) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v4.0.1...v4.0.2) ##### Bug Fixes - address srcset parsing with multiple spaces ([#​512](https://togithub.com/JustinBeckwith/linkinator/issues/512)) ([fefb5b6](https://togithub.com/JustinBeckwith/linkinator/commit/fefb5b6734fc4ab335793358c5f491338ecbeb90)) ### [`v4.0.1`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v4.0.1) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v4.0.0...v4.0.1) ##### Bug Fixes - properly parse srcset attribute ([#​510](https://togithub.com/JustinBeckwith/linkinator/issues/510)) ([9a8a83c](https://togithub.com/JustinBeckwith/linkinator/commit/9a8a83c35182b3cd4daee62a00f156767fe5c6a7)) ### [`v4.0.0`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v4.0.0) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v3.1.0...v4.0.0) ##### Features - create new release with notes ([#​508](https://togithub.com/JustinBeckwith/linkinator/issues/508)) ([2cab633](https://togithub.com/JustinBeckwith/linkinator/commit/2cab633c9659eb10794a4bac06f8b0acdc3e2c0c)) ##### BREAKING CHANGES - The commits in [#​507](https://togithub.com/JustinBeckwith/linkinator/issues/507) and [#​506](https://togithub.com/JustinBeckwith/linkinator/issues/506) both had breaking changes. They included dropping support for Node.js 12.x and updating the CSV export to be streaming, and to use a new way of writing the CSV file. This is an empty to commit using the `BREAKING CHANGE` format in the commit message to ensure a release is triggered. ### [`v3.1.0`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v3.1.0) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v3.0.6...v3.1.0) ##### Features - allow --skip to be defined multiple times ([#​399](https://togithub.com/JustinBeckwith/linkinator/issues/399)) ([5ca5a46](https://togithub.com/JustinBeckwith/linkinator/commit/5ca5a461508e688de12e5ae6b4cfb6565f832ebf)) ### [`v3.0.6`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v3.0.6) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v3.0.5...v3.0.6) ##### Bug Fixes - **deps:** upgrade node-glob to v8 ([#​397](https://togithub.com/JustinBeckwith/linkinator/issues/397)) ([d334dc6](https://togithub.com/JustinBeckwith/linkinator/commit/d334dc6734cd7c2b73d7ed3dea0550a6c3072ad5)) ### [`v3.0.5`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v3.0.5) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v3.0.4...v3.0.5) ##### Bug Fixes - **deps:** upgrade to htmlparser2 v8.0.1 ([#​396](https://togithub.com/JustinBeckwith/linkinator/issues/396)) ([ba3b9a8](https://togithub.com/JustinBeckwith/linkinator/commit/ba3b9a8a9b19d39af6ed91790135e833b80c1eb6)) ### [`v3.0.4`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v3.0.4) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v3.0.3...v3.0.4) ##### Bug Fixes - **deps:** update dependency gaxios to v5 ([#​391](https://togithub.com/JustinBeckwith/linkinator/issues/391)) ([48af50e](https://togithub.com/JustinBeckwith/linkinator/commit/48af50e787731204aeb7eff41325c62291311e45)) ### [`v3.0.3`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v3.0.3) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v3.0.2...v3.0.3) ##### Bug Fixes - export getConfig from index ([#​371](https://togithub.com/JustinBeckwith/linkinator/issues/371)) ([0bc0355](https://togithub.com/JustinBeckwith/linkinator/commit/0bc0355c7e2ea457f247e6b52d1577b8c4ecb3a1)) ### [`v3.0.2`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v3.0.2) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v3.0.1...v3.0.2) ##### Bug Fixes - allow server root with trailing slash ([#​370](https://togithub.com/JustinBeckwith/linkinator/issues/370)) ([8adf6b0](https://togithub.com/JustinBeckwith/linkinator/commit/8adf6b025fda250e38461f1cdad40fe08c3b3b7c)) ### [`v3.0.1`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v3.0.1) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v3.0.0...v3.0.1) ##### Bug Fixes - decode path parts in local web server ([#​369](https://togithub.com/JustinBeckwith/linkinator/issues/369)) ([4696a0c](https://togithub.com/JustinBeckwith/linkinator/commit/4696a0c38c341b178ed815f47371fca955979feb)) ### [`v3.0.0`](https://togithub.com/JustinBeckwith/linkinator/releases/tag/v3.0.0) [Compare Source](https://togithub.com/JustinBeckwith/linkinator/compare/v2.16.2...v3.0.0) ##### Bug Fixes - **deps:** update dependency chalk to v5 ([#​362](https://togithub.com/JustinBeckwith/linkinator/issues/362)) ([4b17a8d](https://togithub.com/JustinBeckwith/linkinator/commit/4b17a8d87b649eaf813428f8ee6955e1d21dae4f)) - feat!: convert to es modules, drop node 10 ([#​359](https://togithub.com/JustinBeckwith/linkinator/issues/359)) ([efee299](https://togithub.com/JustinBeckwith/linkinator/commit/efee299ab8a805accef751eecf8538915a4e7783)), closes [#​359](https://togithub.com/JustinBeckwith/linkinator/issues/359) ##### BREAKING CHANGES - this module now requires node.js 12 and above, and has moved to es modules by default.
--- ### Configuration 📅 **Schedule**: Branch creation - "after 9am and before 3pm" (UTC), Automerge - At any time (no schedule defined). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, click this checkbox. --- This PR has been generated by [Mend Renovate](https://www.mend.io/free-developer-tools/renovate/). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index d5b2d203112..5c0d774e4db 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -50,7 +50,7 @@ "jsdoc": "^3.6.6", "jsdoc-fresh": "^2.0.0", "jsdoc-region-tag": "^2.0.0", - "linkinator": "^2.13.6", + "linkinator": "^4.0.0", "mocha": "^9.2.2", "null-loader": "^4.0.1", "pack-n-play": "^1.0.0-2", From e5b0e2a0624a57951ac5e3e8ed3f4e43e4feaf1c Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Tue, 23 Aug 2022 00:12:31 +0000 Subject: [PATCH 51/63] fix: better support for fallback mode (#94) - [ ] Regenerate this pull request now. PiperOrigin-RevId: 468790263 Source-Link: https://github.com/googleapis/googleapis/commit/873ab456273d105245df0fb82a6c17a814553b80 Source-Link: https://github.com/googleapis/googleapis-gen/commit/cb6f37aeff2a3472e40a7bbace8c67d75e24bee5 Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiY2I2ZjM3YWVmZjJhMzQ3MmU0MGE3YmJhY2U4YzY3ZDc1ZTI0YmVlNSJ9 --- .../v1/connection_service.list_connections.js | 3 + ...etadata.google.cloud.apigeeconnect.v1.json | 4 +- .../samples/generated/v1/tether.egress.js | 3 + .../src/v1/connection_service_client.ts | 8 +- .../src/v1/tether_client.ts | 3 +- .../test/gapic_connection_service_v1.ts | 160 +++++++++--------- .../test/gapic_tether_v1.ts | 156 ++++++++--------- 7 files changed, 174 insertions(+), 163 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js b/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js index 18c3a90350a..75b79324d73 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/connection_service.list_connections.js @@ -23,6 +23,9 @@ function main(parent) { // [START apigeeconnect_v1_generated_ConnectionService_ListConnections_async] /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. * TODO(developer): Uncomment these variables before running the sample. */ /** diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json index 16dbad6dcfd..5a27b613287 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json @@ -22,7 +22,7 @@ "segments": [ { "start": 25, - "end": 66, + "end": 69, "type": "FULL" } ], @@ -70,7 +70,7 @@ "segments": [ { "start": 25, - "end": 80, + "end": 83, "type": "FULL" } ], diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js b/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js index 86b73462427..34757143ffe 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/tether.egress.js @@ -23,6 +23,9 @@ function main() { // [START apigeeconnect_v1_generated_Tether_Egress_async] /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. * TODO(developer): Uncomment these variables before running the sample. */ /** diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index e67b5f3d60d..95b546cfe4a 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -28,7 +28,6 @@ import { } from 'google-gax'; import {Transform} from 'stream'; -import {RequestType} from 'google-gax/build/src/apitypes'; import * as protos from '../../protos/protos'; import jsonProtos = require('../../protos/protos.json'); /** @@ -248,7 +247,8 @@ export class ConnectionServiceClient { const apiCall = this._gaxModule.createApiCall( callPromise, this._defaults[methodName], - descriptor + descriptor, + this._opts.fallback ); this.innerApiCalls[methodName] = apiCall; @@ -463,7 +463,7 @@ export class ConnectionServiceClient { const callSettings = defaultCallSettings.merge(options); this.initialize(); return this.descriptors.page.listConnections.createStream( - this.innerApiCalls.listConnections as gax.GaxCall, + this.innerApiCalls.listConnections as GaxCall, request, callSettings ); @@ -518,7 +518,7 @@ export class ConnectionServiceClient { this.initialize(); return this.descriptors.page.listConnections.asyncIterate( this.innerApiCalls['listConnections'] as GaxCall, - request as unknown as RequestType, + request as {}, callSettings ) as AsyncIterable; } diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index 97b347066a1..4ea4cbfc53e 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -246,7 +246,8 @@ export class TetherClient { const apiCall = this._gaxModule.createApiCall( callPromise, this._defaults[methodName], - descriptor + descriptor, + this._opts.fallback ); this.innerApiCalls[methodName] = apiCall; diff --git a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts index de8b0be20a2..d30e4b89ca1 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts @@ -113,101 +113,103 @@ function stubAsyncIterationCall( } describe('v1.ConnectionServiceClient', () => { - it('has servicePath', () => { - const servicePath = - connectionserviceModule.v1.ConnectionServiceClient.servicePath; - assert(servicePath); - }); - - it('has apiEndpoint', () => { - const apiEndpoint = - connectionserviceModule.v1.ConnectionServiceClient.apiEndpoint; - assert(apiEndpoint); - }); - - it('has port', () => { - const port = connectionserviceModule.v1.ConnectionServiceClient.port; - assert(port); - assert(typeof port === 'number'); - }); - - it('should create a client with no option', () => { - const client = new connectionserviceModule.v1.ConnectionServiceClient(); - assert(client); - }); + describe('Common methods', () => { + it('has servicePath', () => { + const servicePath = + connectionserviceModule.v1.ConnectionServiceClient.servicePath; + assert(servicePath); + }); - it('should create a client with gRPC fallback', () => { - const client = new connectionserviceModule.v1.ConnectionServiceClient({ - fallback: true, + it('has apiEndpoint', () => { + const apiEndpoint = + connectionserviceModule.v1.ConnectionServiceClient.apiEndpoint; + assert(apiEndpoint); }); - assert(client); - }); - it('has initialize method and supports deferred initialization', async () => { - const client = new connectionserviceModule.v1.ConnectionServiceClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('has port', () => { + const port = connectionserviceModule.v1.ConnectionServiceClient.port; + assert(port); + assert(typeof port === 'number'); }); - assert.strictEqual(client.connectionServiceStub, undefined); - await client.initialize(); - assert(client.connectionServiceStub); - }); - it('has close method for the initialized client', done => { - const client = new connectionserviceModule.v1.ConnectionServiceClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('should create a client with no option', () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient(); + assert(client); }); - client.initialize(); - assert(client.connectionServiceStub); - client.close().then(() => { - done(); + + it('should create a client with gRPC fallback', () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + fallback: true, + }); + assert(client); }); - }); - it('has close method for the non-initialized client', done => { - const client = new connectionserviceModule.v1.ConnectionServiceClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('has initialize method and supports deferred initialization', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.connectionServiceStub, undefined); + await client.initialize(); + assert(client.connectionServiceStub); }); - assert.strictEqual(client.connectionServiceStub, undefined); - client.close().then(() => { - done(); + + it('has close method for the initialized client', done => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + assert(client.connectionServiceStub); + client.close().then(() => { + done(); + }); }); - }); - it('has getProjectId method', async () => { - const fakeProjectId = 'fake-project-id'; - const client = new connectionserviceModule.v1.ConnectionServiceClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('has close method for the non-initialized client', done => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.connectionServiceStub, undefined); + client.close().then(() => { + done(); + }); }); - client.auth.getProjectId = sinon.stub().resolves(fakeProjectId); - const result = await client.getProjectId(); - assert.strictEqual(result, fakeProjectId); - assert((client.auth.getProjectId as SinonStub).calledWithExactly()); - }); - it('has getProjectId method with callback', async () => { - const fakeProjectId = 'fake-project-id'; - const client = new connectionserviceModule.v1.ConnectionServiceClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('has getProjectId method', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon.stub().resolves(fakeProjectId); + const result = await client.getProjectId(); + assert.strictEqual(result, fakeProjectId); + assert((client.auth.getProjectId as SinonStub).calledWithExactly()); }); - client.auth.getProjectId = sinon - .stub() - .callsArgWith(0, null, fakeProjectId); - const promise = new Promise((resolve, reject) => { - client.getProjectId((err?: Error | null, projectId?: string | null) => { - if (err) { - reject(err); - } else { - resolve(projectId); - } + + it('has getProjectId method with callback', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon + .stub() + .callsArgWith(0, null, fakeProjectId); + const promise = new Promise((resolve, reject) => { + client.getProjectId((err?: Error | null, projectId?: string | null) => { + if (err) { + reject(err); + } else { + resolve(projectId); + } + }); }); + const result = await promise; + assert.strictEqual(result, fakeProjectId); }); - const result = await promise; - assert.strictEqual(result, fakeProjectId); }); describe('listConnections', () => { diff --git a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts index 4a47f629303..79ab082c15c 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts @@ -51,99 +51,101 @@ function stubBidiStreamingCall( } describe('v1.TetherClient', () => { - it('has servicePath', () => { - const servicePath = tetherModule.v1.TetherClient.servicePath; - assert(servicePath); - }); - - it('has apiEndpoint', () => { - const apiEndpoint = tetherModule.v1.TetherClient.apiEndpoint; - assert(apiEndpoint); - }); - - it('has port', () => { - const port = tetherModule.v1.TetherClient.port; - assert(port); - assert(typeof port === 'number'); - }); - - it('should create a client with no option', () => { - const client = new tetherModule.v1.TetherClient(); - assert(client); - }); + describe('Common methods', () => { + it('has servicePath', () => { + const servicePath = tetherModule.v1.TetherClient.servicePath; + assert(servicePath); + }); - it('should create a client with gRPC fallback', () => { - const client = new tetherModule.v1.TetherClient({ - fallback: true, + it('has apiEndpoint', () => { + const apiEndpoint = tetherModule.v1.TetherClient.apiEndpoint; + assert(apiEndpoint); }); - assert(client); - }); - it('has initialize method and supports deferred initialization', async () => { - const client = new tetherModule.v1.TetherClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('has port', () => { + const port = tetherModule.v1.TetherClient.port; + assert(port); + assert(typeof port === 'number'); }); - assert.strictEqual(client.tetherStub, undefined); - await client.initialize(); - assert(client.tetherStub); - }); - it('has close method for the initialized client', done => { - const client = new tetherModule.v1.TetherClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('should create a client with no option', () => { + const client = new tetherModule.v1.TetherClient(); + assert(client); }); - client.initialize(); - assert(client.tetherStub); - client.close().then(() => { - done(); + + it('should create a client with gRPC fallback', () => { + const client = new tetherModule.v1.TetherClient({ + fallback: true, + }); + assert(client); }); - }); - it('has close method for the non-initialized client', done => { - const client = new tetherModule.v1.TetherClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('has initialize method and supports deferred initialization', async () => { + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.tetherStub, undefined); + await client.initialize(); + assert(client.tetherStub); }); - assert.strictEqual(client.tetherStub, undefined); - client.close().then(() => { - done(); + + it('has close method for the initialized client', done => { + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + assert(client.tetherStub); + client.close().then(() => { + done(); + }); }); - }); - it('has getProjectId method', async () => { - const fakeProjectId = 'fake-project-id'; - const client = new tetherModule.v1.TetherClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('has close method for the non-initialized client', done => { + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.tetherStub, undefined); + client.close().then(() => { + done(); + }); }); - client.auth.getProjectId = sinon.stub().resolves(fakeProjectId); - const result = await client.getProjectId(); - assert.strictEqual(result, fakeProjectId); - assert((client.auth.getProjectId as SinonStub).calledWithExactly()); - }); - it('has getProjectId method with callback', async () => { - const fakeProjectId = 'fake-project-id'; - const client = new tetherModule.v1.TetherClient({ - credentials: {client_email: 'bogus', private_key: 'bogus'}, - projectId: 'bogus', + it('has getProjectId method', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon.stub().resolves(fakeProjectId); + const result = await client.getProjectId(); + assert.strictEqual(result, fakeProjectId); + assert((client.auth.getProjectId as SinonStub).calledWithExactly()); }); - client.auth.getProjectId = sinon - .stub() - .callsArgWith(0, null, fakeProjectId); - const promise = new Promise((resolve, reject) => { - client.getProjectId((err?: Error | null, projectId?: string | null) => { - if (err) { - reject(err); - } else { - resolve(projectId); - } + + it('has getProjectId method with callback', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new tetherModule.v1.TetherClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon + .stub() + .callsArgWith(0, null, fakeProjectId); + const promise = new Promise((resolve, reject) => { + client.getProjectId((err?: Error | null, projectId?: string | null) => { + if (err) { + reject(err); + } else { + resolve(projectId); + } + }); }); + const result = await promise; + assert.strictEqual(result, fakeProjectId); }); - const result = await promise; - assert.strictEqual(result, fakeProjectId); }); describe('egress', () => { From df220d4801e4d0c20e3fa5f12bfee2034a3759bc Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Tue, 23 Aug 2022 17:00:34 +0000 Subject: [PATCH 52/63] fix: change import long to require (#95) Source-Link: https://github.com/googleapis/synthtool/commit/d229a1258999f599a90a9b674a1c5541e00db588 Post-Processor: gcr.io/cloud-devrel-public-resources/owlbot-nodejs:latest@sha256:74ab2b3c71ef27e6d8b69b1d0a0c9d31447777b79ac3cd4be82c265b45f37e5e --- .../protos/protos.d.ts | 363 ++- .../protos/protos.js | 2532 ++++++++++++----- .../protos/protos.json | 24 + 3 files changed, 2157 insertions(+), 762 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/protos/protos.d.ts b/packages/google-cloud-apigeeconnect/protos/protos.d.ts index 3f2ea95d519..4c533a91d03 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.d.ts +++ b/packages/google-cloud-apigeeconnect/protos/protos.d.ts @@ -12,7 +12,7 @@ // See the License for the specific language governing permissions and // limitations under the License. -import * as Long from "long"; +import Long = require("long"); import {protobuf as $protobuf} from "google-gax"; /** Namespace google. */ export namespace google { @@ -64,7 +64,7 @@ export namespace google { namespace ConnectionService { /** - * Callback as used by {@link google.cloud.apigeeconnect.v1.ConnectionService#listConnections}. + * Callback as used by {@link google.cloud.apigeeconnect.v1.ConnectionService|listConnections}. * @param error Error, if any * @param [response] ListConnectionsResponse */ @@ -171,6 +171,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ListConnectionsRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a ListConnectionsResponse. */ @@ -267,6 +274,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ListConnectionsResponse + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a Connection. */ @@ -369,6 +383,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Connection + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a Cluster. */ @@ -465,6 +486,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Cluster + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Represents a Tether */ @@ -505,7 +533,7 @@ export namespace google { namespace Tether { /** - * Callback as used by {@link google.cloud.apigeeconnect.v1.Tether#egress}. + * Callback as used by {@link google.cloud.apigeeconnect.v1.Tether|egress}. * @param error Error, if any * @param [response] EgressRequest */ @@ -630,6 +658,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EgressRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a Payload. */ @@ -735,6 +770,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Payload + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a StreamInfo. */ @@ -825,6 +867,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for StreamInfo + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Action enum. */ @@ -957,6 +1006,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EgressResponse + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** TetherEndpoint enum. */ @@ -1085,6 +1141,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for HttpRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of an Url. */ @@ -1187,6 +1250,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Url + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a Header. */ @@ -1283,6 +1353,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Header + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a HttpResponse. */ @@ -1403,6 +1480,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for HttpResponse + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } } } @@ -1505,6 +1589,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Http + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a HttpRule. */ @@ -1652,6 +1743,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for HttpRule + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a CustomHttpPattern. */ @@ -1748,6 +1846,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for CustomHttpPattern + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** FieldBehavior enum. */ @@ -1886,6 +1991,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ResourceDescriptor + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace ResourceDescriptor { @@ -1998,6 +2110,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ResourceReference + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } } @@ -2092,6 +2211,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FileDescriptorSet + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a FileDescriptorProto. */ @@ -2132,6 +2258,9 @@ export namespace google { /** FileDescriptorProto syntax */ syntax?: (string|null); + + /** FileDescriptorProto edition */ + edition?: (string|null); } /** Represents a FileDescriptorProto. */ @@ -2179,6 +2308,9 @@ export namespace google { /** FileDescriptorProto syntax. */ public syntax: string; + /** FileDescriptorProto edition. */ + public edition: string; + /** * Creates a new FileDescriptorProto instance using the specified properties. * @param [properties] Properties to set @@ -2248,6 +2380,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FileDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a DescriptorProto. */ @@ -2392,6 +2531,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for DescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace DescriptorProto { @@ -2496,6 +2642,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ExtensionRange + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a ReservedRange. */ @@ -2592,6 +2745,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ReservedRange + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } } @@ -2683,6 +2843,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ExtensionRangeOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a FieldDescriptorProto. */ @@ -2833,6 +3000,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FieldDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace FieldDescriptorProto { @@ -2961,6 +3135,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for OneofDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of an EnumDescriptorProto. */ @@ -3075,6 +3256,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace EnumDescriptorProto { @@ -3173,6 +3361,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumReservedRange + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } } @@ -3276,6 +3471,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumValueDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a ServiceDescriptorProto. */ @@ -3378,6 +3580,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ServiceDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a MethodDescriptorProto. */ @@ -3498,6 +3707,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for MethodDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a FileOptions. */ @@ -3711,6 +3927,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FileOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace FileOptions { @@ -3838,6 +4061,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for MessageOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a FieldOptions. */ @@ -3855,6 +4085,9 @@ export namespace google { /** FieldOptions lazy */ lazy?: (boolean|null); + /** FieldOptions unverifiedLazy */ + unverifiedLazy?: (boolean|null); + /** FieldOptions deprecated */ deprecated?: (boolean|null); @@ -3892,6 +4125,9 @@ export namespace google { /** FieldOptions lazy. */ public lazy: boolean; + /** FieldOptions unverifiedLazy. */ + public unverifiedLazy: boolean; + /** FieldOptions deprecated. */ public deprecated: boolean; @@ -3970,6 +4206,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FieldOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace FieldOptions { @@ -4077,6 +4320,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for OneofOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of an EnumOptions. */ @@ -4179,6 +4429,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of an EnumValueOptions. */ @@ -4275,6 +4532,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumValueOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a ServiceOptions. */ @@ -4377,6 +4641,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ServiceOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of a MethodOptions. */ @@ -4485,6 +4756,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for MethodOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace MethodOptions { @@ -4621,6 +4899,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for UninterpretedOption + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace UninterpretedOption { @@ -4719,6 +5004,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for NamePart + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } } @@ -4810,6 +5102,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for SourceCodeInfo + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace SourceCodeInfo { @@ -4926,6 +5225,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Location + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } } @@ -5017,6 +5323,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for GeneratedCodeInfo + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } namespace GeneratedCodeInfo { @@ -5035,6 +5348,9 @@ export namespace google { /** Annotation end */ end?: (number|null); + + /** Annotation semantic */ + semantic?: (google.protobuf.GeneratedCodeInfo.Annotation.Semantic|keyof typeof google.protobuf.GeneratedCodeInfo.Annotation.Semantic|null); } /** Represents an Annotation. */ @@ -5058,6 +5374,9 @@ export namespace google { /** Annotation end. */ public end: number; + /** Annotation semantic. */ + public semantic: (google.protobuf.GeneratedCodeInfo.Annotation.Semantic|keyof typeof google.protobuf.GeneratedCodeInfo.Annotation.Semantic); + /** * Creates a new Annotation instance using the specified properties. * @param [properties] Properties to set @@ -5127,6 +5446,23 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Annotation + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace Annotation { + + /** Semantic enum. */ + enum Semantic { + NONE = 0, + SET = 1, + ALIAS = 2 + } } } @@ -5224,6 +5560,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Duration + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } /** Properties of an Any. */ @@ -5320,6 +5663,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Any + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } } @@ -5426,6 +5776,13 @@ export namespace google { * @returns JSON object */ public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Status + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; } } } diff --git a/packages/google-cloud-apigeeconnect/protos/protos.js b/packages/google-cloud-apigeeconnect/protos/protos.js index a4d2d02b2be..e1b6e0c41c5 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.js +++ b/packages/google-cloud-apigeeconnect/protos/protos.js @@ -99,7 +99,7 @@ }; /** - * Callback as used by {@link google.cloud.apigeeconnect.v1.ConnectionService#listConnections}. + * Callback as used by {@link google.cloud.apigeeconnect.v1.ConnectionService|listConnections}. * @memberof google.cloud.apigeeconnect.v1.ConnectionService * @typedef ListConnectionsCallback * @type {function} @@ -248,15 +248,18 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.parent = reader.string(); - break; - case 2: - message.pageSize = reader.int32(); - break; - case 3: - message.pageToken = reader.string(); - break; + case 1: { + message.parent = reader.string(); + break; + } + case 2: { + message.pageSize = reader.int32(); + break; + } + case 3: { + message.pageToken = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -363,6 +366,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ListConnectionsRequest + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ListConnectionsRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.ListConnectionsRequest"; + }; + return ListConnectionsRequest; })(); @@ -471,14 +489,16 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - if (!(message.connections && message.connections.length)) - message.connections = []; - message.connections.push($root.google.cloud.apigeeconnect.v1.Connection.decode(reader, reader.uint32())); - break; - case 2: - message.nextPageToken = reader.string(); - break; + case 1: { + if (!(message.connections && message.connections.length)) + message.connections = []; + message.connections.push($root.google.cloud.apigeeconnect.v1.Connection.decode(reader, reader.uint32())); + break; + } + case 2: { + message.nextPageToken = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -594,6 +614,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ListConnectionsResponse + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.ListConnectionsResponse + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ListConnectionsResponse.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.ListConnectionsResponse"; + }; + return ListConnectionsResponse; })(); @@ -711,15 +746,18 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.endpoint = reader.string(); - break; - case 2: - message.cluster = $root.google.cloud.apigeeconnect.v1.Cluster.decode(reader, reader.uint32()); - break; - case 3: - message.streamCount = reader.int32(); - break; + case 1: { + message.endpoint = reader.string(); + break; + } + case 2: { + message.cluster = $root.google.cloud.apigeeconnect.v1.Cluster.decode(reader, reader.uint32()); + break; + } + case 3: { + message.streamCount = reader.int32(); + break; + } default: reader.skipType(tag & 7); break; @@ -831,6 +869,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Connection + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.Connection + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Connection.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.Connection"; + }; + return Connection; })(); @@ -937,12 +990,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 2: - message.region = reader.string(); - break; + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.region = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -1041,6 +1096,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Cluster + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.Cluster + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Cluster.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.Cluster"; + }; + return Cluster; })(); @@ -1077,7 +1147,7 @@ }; /** - * Callback as used by {@link google.cloud.apigeeconnect.v1.Tether#egress}. + * Callback as used by {@link google.cloud.apigeeconnect.v1.Tether|egress}. * @memberof google.cloud.apigeeconnect.v1.Tether * @typedef EgressCallback * @type {function} @@ -1259,24 +1329,30 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.id = reader.string(); - break; - case 2: - message.payload = $root.google.cloud.apigeeconnect.v1.Payload.decode(reader, reader.uint32()); - break; - case 3: - message.endpoint = reader.int32(); - break; - case 4: - message.project = reader.string(); - break; - case 5: - message.traceId = reader.string(); - break; - case 6: - message.timeout = $root.google.protobuf.Duration.decode(reader, reader.uint32()); - break; + case 1: { + message.id = reader.string(); + break; + } + case 2: { + message.payload = $root.google.cloud.apigeeconnect.v1.Payload.decode(reader, reader.uint32()); + break; + } + case 3: { + message.endpoint = reader.int32(); + break; + } + case 4: { + message.project = reader.string(); + break; + } + case 5: { + message.traceId = reader.string(); + break; + } + case 6: { + message.timeout = $root.google.protobuf.Duration.decode(reader, reader.uint32()); + break; + } default: reader.skipType(tag & 7); break; @@ -1440,6 +1516,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for EgressRequest + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.EgressRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EgressRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.EgressRequest"; + }; + return EgressRequest; })(); @@ -1571,15 +1662,18 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.httpRequest = $root.google.cloud.apigeeconnect.v1.HttpRequest.decode(reader, reader.uint32()); - break; - case 2: - message.streamInfo = $root.google.cloud.apigeeconnect.v1.StreamInfo.decode(reader, reader.uint32()); - break; - case 3: - message.action = reader.int32(); - break; + case 1: { + message.httpRequest = $root.google.cloud.apigeeconnect.v1.HttpRequest.decode(reader, reader.uint32()); + break; + } + case 2: { + message.streamInfo = $root.google.cloud.apigeeconnect.v1.StreamInfo.decode(reader, reader.uint32()); + break; + } + case 3: { + message.action = reader.int32(); + break; + } default: reader.skipType(tag & 7); break; @@ -1726,6 +1820,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Payload + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.Payload + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Payload.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.Payload"; + }; + return Payload; })(); @@ -1821,9 +1930,10 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.id = reader.string(); - break; + case 1: { + message.id = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -1913,6 +2023,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for StreamInfo + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.StreamInfo + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + StreamInfo.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.StreamInfo"; + }; + return StreamInfo; })(); @@ -2088,27 +2213,34 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.id = reader.string(); - break; - case 2: - message.httpResponse = $root.google.cloud.apigeeconnect.v1.HttpResponse.decode(reader, reader.uint32()); - break; - case 3: - message.status = $root.google.rpc.Status.decode(reader, reader.uint32()); - break; - case 4: - message.project = reader.string(); - break; - case 5: - message.traceId = reader.string(); - break; - case 6: - message.endpoint = reader.int32(); - break; - case 7: - message.name = reader.string(); - break; + case 1: { + message.id = reader.string(); + break; + } + case 2: { + message.httpResponse = $root.google.cloud.apigeeconnect.v1.HttpResponse.decode(reader, reader.uint32()); + break; + } + case 3: { + message.status = $root.google.rpc.Status.decode(reader, reader.uint32()); + break; + } + case 4: { + message.project = reader.string(); + break; + } + case 5: { + message.traceId = reader.string(); + break; + } + case 6: { + message.endpoint = reader.int32(); + break; + } + case 7: { + message.name = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -2280,6 +2412,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for EgressResponse + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.EgressResponse + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EgressResponse.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.EgressResponse"; + }; + return EgressResponse; })(); @@ -2453,23 +2600,28 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.id = reader.string(); - break; - case 2: - message.method = reader.string(); - break; - case 3: - message.url = $root.google.cloud.apigeeconnect.v1.Url.decode(reader, reader.uint32()); - break; - case 4: - if (!(message.headers && message.headers.length)) - message.headers = []; - message.headers.push($root.google.cloud.apigeeconnect.v1.Header.decode(reader, reader.uint32())); - break; - case 5: - message.body = reader.bytes(); - break; + case 1: { + message.id = reader.string(); + break; + } + case 2: { + message.method = reader.string(); + break; + } + case 3: { + message.url = $root.google.cloud.apigeeconnect.v1.Url.decode(reader, reader.uint32()); + break; + } + case 4: { + if (!(message.headers && message.headers.length)) + message.headers = []; + message.headers.push($root.google.cloud.apigeeconnect.v1.Header.decode(reader, reader.uint32())); + break; + } + case 5: { + message.body = reader.bytes(); + break; + } default: reader.skipType(tag & 7); break; @@ -2565,7 +2717,7 @@ if (object.body != null) if (typeof object.body === "string") $util.base64.decode(object.body, message.body = $util.newBuffer($util.base64.length(object.body)), 0); - else if (object.body.length) + else if (object.body.length >= 0) message.body = object.body; return message; }; @@ -2624,6 +2776,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for HttpRequest + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.HttpRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + HttpRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.HttpRequest"; + }; + return HttpRequest; })(); @@ -2741,15 +2908,18 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.scheme = reader.int32(); - break; - case 2: - message.host = reader.string(); - break; - case 3: - message.path = reader.string(); - break; + case 1: { + message.scheme = reader.int32(); + break; + } + case 2: { + message.host = reader.string(); + break; + } + case 3: { + message.path = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -2869,6 +3039,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Url + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.Url + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Url.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.Url"; + }; + return Url; })(); @@ -2977,14 +3162,16 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.key = reader.string(); - break; - case 2: - if (!(message.values && message.values.length)) - message.values = []; - message.values.push(reader.string()); - break; + case 1: { + message.key = reader.string(); + break; + } + case 2: { + if (!(message.values && message.values.length)) + message.values = []; + message.values.push(reader.string()); + break; + } default: reader.skipType(tag & 7); break; @@ -3095,6 +3282,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Header + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.Header + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Header.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.Header"; + }; + return Header; })(); @@ -3247,26 +3449,32 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.id = reader.string(); - break; - case 2: - message.status = reader.string(); - break; - case 3: - message.statusCode = reader.int32(); - break; - case 4: - message.body = reader.bytes(); - break; - case 5: - if (!(message.headers && message.headers.length)) - message.headers = []; - message.headers.push($root.google.cloud.apigeeconnect.v1.Header.decode(reader, reader.uint32())); - break; - case 6: - message.contentLength = reader.int64(); - break; + case 1: { + message.id = reader.string(); + break; + } + case 2: { + message.status = reader.string(); + break; + } + case 3: { + message.statusCode = reader.int32(); + break; + } + case 4: { + message.body = reader.bytes(); + break; + } + case 5: { + if (!(message.headers && message.headers.length)) + message.headers = []; + message.headers.push($root.google.cloud.apigeeconnect.v1.Header.decode(reader, reader.uint32())); + break; + } + case 6: { + message.contentLength = reader.int64(); + break; + } default: reader.skipType(tag & 7); break; @@ -3350,7 +3558,7 @@ if (object.body != null) if (typeof object.body === "string") $util.base64.decode(object.body, message.body = $util.newBuffer($util.base64.length(object.body)), 0); - else if (object.body.length) + else if (object.body.length >= 0) message.body = object.body; if (object.headers) { if (!Array.isArray(object.headers)) @@ -3438,6 +3646,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for HttpResponse + * @function getTypeUrl + * @memberof google.cloud.apigeeconnect.v1.HttpResponse + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + HttpResponse.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.apigeeconnect.v1.HttpResponse"; + }; + return HttpResponse; })(); @@ -3564,14 +3787,16 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - if (!(message.rules && message.rules.length)) - message.rules = []; - message.rules.push($root.google.api.HttpRule.decode(reader, reader.uint32())); - break; - case 2: - message.fullyDecodeReservedExpansion = reader.bool(); - break; + case 1: { + if (!(message.rules && message.rules.length)) + message.rules = []; + message.rules.push($root.google.api.HttpRule.decode(reader, reader.uint32())); + break; + } + case 2: { + message.fullyDecodeReservedExpansion = reader.bool(); + break; + } default: reader.skipType(tag & 7); break; @@ -3687,6 +3912,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Http + * @function getTypeUrl + * @memberof google.api.Http + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Http.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.Http"; + }; + return Http; })(); @@ -3897,38 +4137,48 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.selector = reader.string(); - break; - case 2: - message.get = reader.string(); - break; - case 3: - message.put = reader.string(); - break; - case 4: - message.post = reader.string(); - break; - case 5: - message["delete"] = reader.string(); - break; - case 6: - message.patch = reader.string(); - break; - case 8: - message.custom = $root.google.api.CustomHttpPattern.decode(reader, reader.uint32()); - break; - case 7: - message.body = reader.string(); - break; - case 12: - message.responseBody = reader.string(); - break; - case 11: - if (!(message.additionalBindings && message.additionalBindings.length)) - message.additionalBindings = []; - message.additionalBindings.push($root.google.api.HttpRule.decode(reader, reader.uint32())); - break; + case 1: { + message.selector = reader.string(); + break; + } + case 2: { + message.get = reader.string(); + break; + } + case 3: { + message.put = reader.string(); + break; + } + case 4: { + message.post = reader.string(); + break; + } + case 5: { + message["delete"] = reader.string(); + break; + } + case 6: { + message.patch = reader.string(); + break; + } + case 8: { + message.custom = $root.google.api.CustomHttpPattern.decode(reader, reader.uint32()); + break; + } + case 7: { + message.body = reader.string(); + break; + } + case 12: { + message.responseBody = reader.string(); + break; + } + case 11: { + if (!(message.additionalBindings && message.additionalBindings.length)) + message.additionalBindings = []; + message.additionalBindings.push($root.google.api.HttpRule.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -4150,6 +4400,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for HttpRule + * @function getTypeUrl + * @memberof google.api.HttpRule + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + HttpRule.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.HttpRule"; + }; + return HttpRule; })(); @@ -4256,12 +4521,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.kind = reader.string(); - break; - case 2: - message.path = reader.string(); - break; + case 1: { + message.kind = reader.string(); + break; + } + case 2: { + message.path = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -4360,6 +4627,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for CustomHttpPattern + * @function getTypeUrl + * @memberof google.api.CustomHttpPattern + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + CustomHttpPattern.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.CustomHttpPattern"; + }; + return CustomHttpPattern; })(); @@ -4554,42 +4836,49 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.type = reader.string(); - break; - case 2: - if (!(message.pattern && message.pattern.length)) - message.pattern = []; - message.pattern.push(reader.string()); - break; - case 3: - message.nameField = reader.string(); - break; - case 4: - message.history = reader.int32(); - break; - case 5: - message.plural = reader.string(); - break; - case 6: - message.singular = reader.string(); - break; - case 10: - if (!(message.style && message.style.length)) - message.style = []; - if ((tag & 7) === 2) { - var end2 = reader.uint32() + reader.pos; - while (reader.pos < end2) - message.style.push(reader.int32()); - } else - message.style.push(reader.int32()); - break; - default: - reader.skipType(tag & 7); - break; - } - } - return message; + case 1: { + message.type = reader.string(); + break; + } + case 2: { + if (!(message.pattern && message.pattern.length)) + message.pattern = []; + message.pattern.push(reader.string()); + break; + } + case 3: { + message.nameField = reader.string(); + break; + } + case 4: { + message.history = reader.int32(); + break; + } + case 5: { + message.plural = reader.string(); + break; + } + case 6: { + message.singular = reader.string(); + break; + } + case 10: { + if (!(message.style && message.style.length)) + message.style = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.style.push(reader.int32()); + } else + message.style.push(reader.int32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; }; /** @@ -4781,6 +5070,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ResourceDescriptor + * @function getTypeUrl + * @memberof google.api.ResourceDescriptor + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ResourceDescriptor.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.ResourceDescriptor"; + }; + /** * History enum. * @name google.api.ResourceDescriptor.History @@ -4917,12 +5221,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.type = reader.string(); - break; - case 2: - message.childType = reader.string(); - break; + case 1: { + message.type = reader.string(); + break; + } + case 2: { + message.childType = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -5021,6 +5327,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ResourceReference + * @function getTypeUrl + * @memberof google.api.ResourceReference + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ResourceReference.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.ResourceReference"; + }; + return ResourceReference; })(); @@ -5130,11 +5451,12 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - if (!(message.file && message.file.length)) - message.file = []; - message.file.push($root.google.protobuf.FileDescriptorProto.decode(reader, reader.uint32())); - break; + case 1: { + if (!(message.file && message.file.length)) + message.file = []; + message.file.push($root.google.protobuf.FileDescriptorProto.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -5241,6 +5563,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for FileDescriptorSet + * @function getTypeUrl + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FileDescriptorSet.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FileDescriptorSet"; + }; + return FileDescriptorSet; })(); @@ -5262,6 +5599,7 @@ * @property {google.protobuf.IFileOptions|null} [options] FileDescriptorProto options * @property {google.protobuf.ISourceCodeInfo|null} [sourceCodeInfo] FileDescriptorProto sourceCodeInfo * @property {string|null} [syntax] FileDescriptorProto syntax + * @property {string|null} [edition] FileDescriptorProto edition */ /** @@ -5382,6 +5720,14 @@ */ FileDescriptorProto.prototype.syntax = ""; + /** + * FileDescriptorProto edition. + * @member {string} edition + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.edition = ""; + /** * Creates a new FileDescriptorProto instance using the specified properties. * @function create @@ -5437,6 +5783,8 @@ writer.uint32(/* id 11, wireType 0 =*/88).int32(message.weakDependency[i]); if (message.syntax != null && Object.hasOwnProperty.call(message, "syntax")) writer.uint32(/* id 12, wireType 2 =*/98).string(message.syntax); + if (message.edition != null && Object.hasOwnProperty.call(message, "edition")) + writer.uint32(/* id 13, wireType 2 =*/106).string(message.edition); return writer; }; @@ -5471,66 +5819,82 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 2: - message["package"] = reader.string(); - break; - case 3: - if (!(message.dependency && message.dependency.length)) - message.dependency = []; - message.dependency.push(reader.string()); - break; - case 10: - if (!(message.publicDependency && message.publicDependency.length)) - message.publicDependency = []; - if ((tag & 7) === 2) { - var end2 = reader.uint32() + reader.pos; - while (reader.pos < end2) + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message["package"] = reader.string(); + break; + } + case 3: { + if (!(message.dependency && message.dependency.length)) + message.dependency = []; + message.dependency.push(reader.string()); + break; + } + case 10: { + if (!(message.publicDependency && message.publicDependency.length)) + message.publicDependency = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.publicDependency.push(reader.int32()); + } else message.publicDependency.push(reader.int32()); - } else - message.publicDependency.push(reader.int32()); - break; - case 11: - if (!(message.weakDependency && message.weakDependency.length)) - message.weakDependency = []; - if ((tag & 7) === 2) { - var end2 = reader.uint32() + reader.pos; - while (reader.pos < end2) + break; + } + case 11: { + if (!(message.weakDependency && message.weakDependency.length)) + message.weakDependency = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.weakDependency.push(reader.int32()); + } else message.weakDependency.push(reader.int32()); - } else - message.weakDependency.push(reader.int32()); - break; - case 4: - if (!(message.messageType && message.messageType.length)) - message.messageType = []; - message.messageType.push($root.google.protobuf.DescriptorProto.decode(reader, reader.uint32())); - break; - case 5: - if (!(message.enumType && message.enumType.length)) - message.enumType = []; - message.enumType.push($root.google.protobuf.EnumDescriptorProto.decode(reader, reader.uint32())); - break; - case 6: - if (!(message.service && message.service.length)) - message.service = []; - message.service.push($root.google.protobuf.ServiceDescriptorProto.decode(reader, reader.uint32())); - break; - case 7: - if (!(message.extension && message.extension.length)) - message.extension = []; - message.extension.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); - break; - case 8: - message.options = $root.google.protobuf.FileOptions.decode(reader, reader.uint32()); - break; - case 9: - message.sourceCodeInfo = $root.google.protobuf.SourceCodeInfo.decode(reader, reader.uint32()); - break; - case 12: - message.syntax = reader.string(); - break; + break; + } + case 4: { + if (!(message.messageType && message.messageType.length)) + message.messageType = []; + message.messageType.push($root.google.protobuf.DescriptorProto.decode(reader, reader.uint32())); + break; + } + case 5: { + if (!(message.enumType && message.enumType.length)) + message.enumType = []; + message.enumType.push($root.google.protobuf.EnumDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 6: { + if (!(message.service && message.service.length)) + message.service = []; + message.service.push($root.google.protobuf.ServiceDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 7: { + if (!(message.extension && message.extension.length)) + message.extension = []; + message.extension.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 8: { + message.options = $root.google.protobuf.FileOptions.decode(reader, reader.uint32()); + break; + } + case 9: { + message.sourceCodeInfo = $root.google.protobuf.SourceCodeInfo.decode(reader, reader.uint32()); + break; + } + case 12: { + message.syntax = reader.string(); + break; + } + case 13: { + message.edition = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -5642,6 +6006,9 @@ if (message.syntax != null && message.hasOwnProperty("syntax")) if (!$util.isString(message.syntax)) return "syntax: string expected"; + if (message.edition != null && message.hasOwnProperty("edition")) + if (!$util.isString(message.edition)) + return "edition: string expected"; return null; }; @@ -5734,6 +6101,8 @@ } if (object.syntax != null) message.syntax = String(object.syntax); + if (object.edition != null) + message.edition = String(object.edition); return message; }; @@ -5765,6 +6134,7 @@ object.options = null; object.sourceCodeInfo = null; object.syntax = ""; + object.edition = ""; } if (message.name != null && message.hasOwnProperty("name")) object.name = message.name; @@ -5811,6 +6181,8 @@ } if (message.syntax != null && message.hasOwnProperty("syntax")) object.syntax = message.syntax; + if (message.edition != null && message.hasOwnProperty("edition")) + object.edition = message.edition; return object; }; @@ -5825,6 +6197,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for FileDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FileDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FileDescriptorProto"; + }; + return FileDescriptorProto; })(); @@ -6035,52 +6422,62 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 2: - if (!(message.field && message.field.length)) - message.field = []; - message.field.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); - break; - case 6: - if (!(message.extension && message.extension.length)) - message.extension = []; - message.extension.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); - break; - case 3: - if (!(message.nestedType && message.nestedType.length)) - message.nestedType = []; - message.nestedType.push($root.google.protobuf.DescriptorProto.decode(reader, reader.uint32())); - break; - case 4: - if (!(message.enumType && message.enumType.length)) - message.enumType = []; - message.enumType.push($root.google.protobuf.EnumDescriptorProto.decode(reader, reader.uint32())); - break; - case 5: - if (!(message.extensionRange && message.extensionRange.length)) - message.extensionRange = []; - message.extensionRange.push($root.google.protobuf.DescriptorProto.ExtensionRange.decode(reader, reader.uint32())); - break; - case 8: - if (!(message.oneofDecl && message.oneofDecl.length)) - message.oneofDecl = []; - message.oneofDecl.push($root.google.protobuf.OneofDescriptorProto.decode(reader, reader.uint32())); - break; - case 7: - message.options = $root.google.protobuf.MessageOptions.decode(reader, reader.uint32()); - break; - case 9: - if (!(message.reservedRange && message.reservedRange.length)) - message.reservedRange = []; - message.reservedRange.push($root.google.protobuf.DescriptorProto.ReservedRange.decode(reader, reader.uint32())); - break; - case 10: - if (!(message.reservedName && message.reservedName.length)) - message.reservedName = []; - message.reservedName.push(reader.string()); - break; + case 1: { + message.name = reader.string(); + break; + } + case 2: { + if (!(message.field && message.field.length)) + message.field = []; + message.field.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 6: { + if (!(message.extension && message.extension.length)) + message.extension = []; + message.extension.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 3: { + if (!(message.nestedType && message.nestedType.length)) + message.nestedType = []; + message.nestedType.push($root.google.protobuf.DescriptorProto.decode(reader, reader.uint32())); + break; + } + case 4: { + if (!(message.enumType && message.enumType.length)) + message.enumType = []; + message.enumType.push($root.google.protobuf.EnumDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 5: { + if (!(message.extensionRange && message.extensionRange.length)) + message.extensionRange = []; + message.extensionRange.push($root.google.protobuf.DescriptorProto.ExtensionRange.decode(reader, reader.uint32())); + break; + } + case 8: { + if (!(message.oneofDecl && message.oneofDecl.length)) + message.oneofDecl = []; + message.oneofDecl.push($root.google.protobuf.OneofDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 7: { + message.options = $root.google.protobuf.MessageOptions.decode(reader, reader.uint32()); + break; + } + case 9: { + if (!(message.reservedRange && message.reservedRange.length)) + message.reservedRange = []; + message.reservedRange.push($root.google.protobuf.DescriptorProto.ReservedRange.decode(reader, reader.uint32())); + break; + } + case 10: { + if (!(message.reservedName && message.reservedName.length)) + message.reservedName = []; + message.reservedName.push(reader.string()); + break; + } default: reader.skipType(tag & 7); break; @@ -6381,6 +6778,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for DescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.DescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + DescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.DescriptorProto"; + }; + DescriptorProto.ExtensionRange = (function() { /** @@ -6495,15 +6907,18 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.start = reader.int32(); - break; - case 2: - message.end = reader.int32(); - break; - case 3: - message.options = $root.google.protobuf.ExtensionRangeOptions.decode(reader, reader.uint32()); - break; + case 1: { + message.start = reader.int32(); + break; + } + case 2: { + message.end = reader.int32(); + break; + } + case 3: { + message.options = $root.google.protobuf.ExtensionRangeOptions.decode(reader, reader.uint32()); + break; + } default: reader.skipType(tag & 7); break; @@ -6615,6 +7030,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ExtensionRange + * @function getTypeUrl + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ExtensionRange.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.DescriptorProto.ExtensionRange"; + }; + return ExtensionRange; })(); @@ -6721,12 +7151,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.start = reader.int32(); - break; - case 2: - message.end = reader.int32(); - break; + case 1: { + message.start = reader.int32(); + break; + } + case 2: { + message.end = reader.int32(); + break; + } default: reader.skipType(tag & 7); break; @@ -6825,6 +7257,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ReservedRange + * @function getTypeUrl + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ReservedRange.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.DescriptorProto.ReservedRange"; + }; + return ReservedRange; })(); @@ -6925,11 +7372,12 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -7036,6 +7484,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ExtensionRangeOptions + * @function getTypeUrl + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ExtensionRangeOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.ExtensionRangeOptions"; + }; + return ExtensionRangeOptions; })(); @@ -7241,39 +7704,50 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 3: - message.number = reader.int32(); - break; - case 4: - message.label = reader.int32(); - break; - case 5: - message.type = reader.int32(); - break; - case 6: - message.typeName = reader.string(); - break; - case 2: - message.extendee = reader.string(); - break; - case 7: - message.defaultValue = reader.string(); - break; - case 9: - message.oneofIndex = reader.int32(); - break; - case 10: - message.jsonName = reader.string(); - break; - case 8: - message.options = $root.google.protobuf.FieldOptions.decode(reader, reader.uint32()); - break; - case 17: - message.proto3Optional = reader.bool(); - break; + case 1: { + message.name = reader.string(); + break; + } + case 3: { + message.number = reader.int32(); + break; + } + case 4: { + message.label = reader.int32(); + break; + } + case 5: { + message.type = reader.int32(); + break; + } + case 6: { + message.typeName = reader.string(); + break; + } + case 2: { + message.extendee = reader.string(); + break; + } + case 7: { + message.defaultValue = reader.string(); + break; + } + case 9: { + message.oneofIndex = reader.int32(); + break; + } + case 10: { + message.jsonName = reader.string(); + break; + } + case 8: { + message.options = $root.google.protobuf.FieldOptions.decode(reader, reader.uint32()); + break; + } + case 17: { + message.proto3Optional = reader.bool(); + break; + } default: reader.skipType(tag & 7); break; @@ -7560,6 +8034,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for FieldDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FieldDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FieldDescriptorProto"; + }; + /** * Type enum. * @name google.protobuf.FieldDescriptorProto.Type @@ -7728,12 +8217,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 2: - message.options = $root.google.protobuf.OneofOptions.decode(reader, reader.uint32()); - break; + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.options = $root.google.protobuf.OneofOptions.decode(reader, reader.uint32()); + break; + } default: reader.skipType(tag & 7); break; @@ -7837,6 +8328,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for OneofDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + OneofDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.OneofDescriptorProto"; + }; + return OneofDescriptorProto; })(); @@ -7982,27 +8488,32 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 2: - if (!(message.value && message.value.length)) - message.value = []; - message.value.push($root.google.protobuf.EnumValueDescriptorProto.decode(reader, reader.uint32())); - break; - case 3: - message.options = $root.google.protobuf.EnumOptions.decode(reader, reader.uint32()); - break; - case 4: - if (!(message.reservedRange && message.reservedRange.length)) - message.reservedRange = []; - message.reservedRange.push($root.google.protobuf.EnumDescriptorProto.EnumReservedRange.decode(reader, reader.uint32())); - break; - case 5: - if (!(message.reservedName && message.reservedName.length)) - message.reservedName = []; - message.reservedName.push(reader.string()); - break; + case 1: { + message.name = reader.string(); + break; + } + case 2: { + if (!(message.value && message.value.length)) + message.value = []; + message.value.push($root.google.protobuf.EnumValueDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 3: { + message.options = $root.google.protobuf.EnumOptions.decode(reader, reader.uint32()); + break; + } + case 4: { + if (!(message.reservedRange && message.reservedRange.length)) + message.reservedRange = []; + message.reservedRange.push($root.google.protobuf.EnumDescriptorProto.EnumReservedRange.decode(reader, reader.uint32())); + break; + } + case 5: { + if (!(message.reservedName && message.reservedName.length)) + message.reservedName = []; + message.reservedName.push(reader.string()); + break; + } default: reader.skipType(tag & 7); break; @@ -8178,6 +8689,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for EnumDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumDescriptorProto"; + }; + EnumDescriptorProto.EnumReservedRange = (function() { /** @@ -8281,12 +8807,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.start = reader.int32(); - break; - case 2: - message.end = reader.int32(); - break; + case 1: { + message.start = reader.int32(); + break; + } + case 2: { + message.end = reader.int32(); + break; + } default: reader.skipType(tag & 7); break; @@ -8385,6 +8913,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for EnumReservedRange + * @function getTypeUrl + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumReservedRange.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumDescriptorProto.EnumReservedRange"; + }; + return EnumReservedRange; })(); @@ -8505,15 +9048,18 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 2: - message.number = reader.int32(); - break; - case 3: - message.options = $root.google.protobuf.EnumValueOptions.decode(reader, reader.uint32()); - break; + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.number = reader.int32(); + break; + } + case 3: { + message.options = $root.google.protobuf.EnumValueOptions.decode(reader, reader.uint32()); + break; + } default: reader.skipType(tag & 7); break; @@ -8621,8 +9167,23 @@ * @instance * @returns {Object.} JSON object */ - EnumValueDescriptorProto.prototype.toJSON = function toJSON() { - return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + EnumValueDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for EnumValueDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumValueDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumValueDescriptorProto"; }; return EnumValueDescriptorProto; @@ -8744,17 +9305,20 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 2: - if (!(message.method && message.method.length)) - message.method = []; - message.method.push($root.google.protobuf.MethodDescriptorProto.decode(reader, reader.uint32())); - break; - case 3: - message.options = $root.google.protobuf.ServiceOptions.decode(reader, reader.uint32()); - break; + case 1: { + message.name = reader.string(); + break; + } + case 2: { + if (!(message.method && message.method.length)) + message.method = []; + message.method.push($root.google.protobuf.MethodDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 3: { + message.options = $root.google.protobuf.ServiceOptions.decode(reader, reader.uint32()); + break; + } default: reader.skipType(tag & 7); break; @@ -8884,6 +9448,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ServiceDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ServiceDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.ServiceDescriptorProto"; + }; + return ServiceDescriptorProto; })(); @@ -9034,24 +9613,30 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.name = reader.string(); - break; - case 2: - message.inputType = reader.string(); - break; - case 3: - message.outputType = reader.string(); - break; - case 4: - message.options = $root.google.protobuf.MethodOptions.decode(reader, reader.uint32()); - break; - case 5: - message.clientStreaming = reader.bool(); - break; - case 6: - message.serverStreaming = reader.bool(); - break; + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.inputType = reader.string(); + break; + } + case 3: { + message.outputType = reader.string(); + break; + } + case 4: { + message.options = $root.google.protobuf.MethodOptions.decode(reader, reader.uint32()); + break; + } + case 5: { + message.clientStreaming = reader.bool(); + break; + } + case 6: { + message.serverStreaming = reader.bool(); + break; + } default: reader.skipType(tag & 7); break; @@ -9187,6 +9772,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for MethodDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + MethodDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.MethodDescriptorProto"; + }; + return MethodDescriptorProto; })(); @@ -9517,76 +10117,98 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.javaPackage = reader.string(); - break; - case 8: - message.javaOuterClassname = reader.string(); - break; - case 10: - message.javaMultipleFiles = reader.bool(); - break; - case 20: - message.javaGenerateEqualsAndHash = reader.bool(); - break; - case 27: - message.javaStringCheckUtf8 = reader.bool(); - break; - case 9: - message.optimizeFor = reader.int32(); - break; - case 11: - message.goPackage = reader.string(); - break; - case 16: - message.ccGenericServices = reader.bool(); - break; - case 17: - message.javaGenericServices = reader.bool(); - break; - case 18: - message.pyGenericServices = reader.bool(); - break; - case 42: - message.phpGenericServices = reader.bool(); - break; - case 23: - message.deprecated = reader.bool(); - break; - case 31: - message.ccEnableArenas = reader.bool(); - break; - case 36: - message.objcClassPrefix = reader.string(); - break; - case 37: - message.csharpNamespace = reader.string(); - break; - case 39: - message.swiftPrefix = reader.string(); - break; - case 40: - message.phpClassPrefix = reader.string(); - break; - case 41: - message.phpNamespace = reader.string(); - break; - case 44: - message.phpMetadataNamespace = reader.string(); - break; - case 45: - message.rubyPackage = reader.string(); - break; - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; - case 1053: - if (!(message[".google.api.resourceDefinition"] && message[".google.api.resourceDefinition"].length)) - message[".google.api.resourceDefinition"] = []; - message[".google.api.resourceDefinition"].push($root.google.api.ResourceDescriptor.decode(reader, reader.uint32())); - break; + case 1: { + message.javaPackage = reader.string(); + break; + } + case 8: { + message.javaOuterClassname = reader.string(); + break; + } + case 10: { + message.javaMultipleFiles = reader.bool(); + break; + } + case 20: { + message.javaGenerateEqualsAndHash = reader.bool(); + break; + } + case 27: { + message.javaStringCheckUtf8 = reader.bool(); + break; + } + case 9: { + message.optimizeFor = reader.int32(); + break; + } + case 11: { + message.goPackage = reader.string(); + break; + } + case 16: { + message.ccGenericServices = reader.bool(); + break; + } + case 17: { + message.javaGenericServices = reader.bool(); + break; + } + case 18: { + message.pyGenericServices = reader.bool(); + break; + } + case 42: { + message.phpGenericServices = reader.bool(); + break; + } + case 23: { + message.deprecated = reader.bool(); + break; + } + case 31: { + message.ccEnableArenas = reader.bool(); + break; + } + case 36: { + message.objcClassPrefix = reader.string(); + break; + } + case 37: { + message.csharpNamespace = reader.string(); + break; + } + case 39: { + message.swiftPrefix = reader.string(); + break; + } + case 40: { + message.phpClassPrefix = reader.string(); + break; + } + case 41: { + message.phpNamespace = reader.string(); + break; + } + case 44: { + message.phpMetadataNamespace = reader.string(); + break; + } + case 45: { + message.rubyPackage = reader.string(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 1053: { + if (!(message[".google.api.resourceDefinition"] && message[".google.api.resourceDefinition"].length)) + message[".google.api.resourceDefinition"] = []; + message[".google.api.resourceDefinition"].push($root.google.api.ResourceDescriptor.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -9899,6 +10521,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for FileOptions + * @function getTypeUrl + * @memberof google.protobuf.FileOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FileOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FileOptions"; + }; + /** * OptimizeMode enum. * @name google.protobuf.FileOptions.OptimizeMode @@ -10067,26 +10704,32 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.messageSetWireFormat = reader.bool(); - break; - case 2: - message.noStandardDescriptorAccessor = reader.bool(); - break; - case 3: - message.deprecated = reader.bool(); - break; - case 7: - message.mapEntry = reader.bool(); - break; - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; - case 1053: - message[".google.api.resource"] = $root.google.api.ResourceDescriptor.decode(reader, reader.uint32()); - break; + case 1: { + message.messageSetWireFormat = reader.bool(); + break; + } + case 2: { + message.noStandardDescriptorAccessor = reader.bool(); + break; + } + case 3: { + message.deprecated = reader.bool(); + break; + } + case 7: { + message.mapEntry = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 1053: { + message[".google.api.resource"] = $root.google.api.ResourceDescriptor.decode(reader, reader.uint32()); + break; + } default: reader.skipType(tag & 7); break; @@ -10240,6 +10883,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for MessageOptions + * @function getTypeUrl + * @memberof google.protobuf.MessageOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + MessageOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.MessageOptions"; + }; + return MessageOptions; })(); @@ -10253,6 +10911,7 @@ * @property {boolean|null} [packed] FieldOptions packed * @property {google.protobuf.FieldOptions.JSType|null} [jstype] FieldOptions jstype * @property {boolean|null} [lazy] FieldOptions lazy + * @property {boolean|null} [unverifiedLazy] FieldOptions unverifiedLazy * @property {boolean|null} [deprecated] FieldOptions deprecated * @property {boolean|null} [weak] FieldOptions weak * @property {Array.|null} [uninterpretedOption] FieldOptions uninterpretedOption @@ -10309,6 +10968,14 @@ */ FieldOptions.prototype.lazy = false; + /** + * FieldOptions unverifiedLazy. + * @member {boolean} unverifiedLazy + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.unverifiedLazy = false; + /** * FieldOptions deprecated. * @member {boolean} deprecated @@ -10385,6 +11052,8 @@ writer.uint32(/* id 6, wireType 0 =*/48).int32(message.jstype); if (message.weak != null && Object.hasOwnProperty.call(message, "weak")) writer.uint32(/* id 10, wireType 0 =*/80).bool(message.weak); + if (message.unverifiedLazy != null && Object.hasOwnProperty.call(message, "unverifiedLazy")) + writer.uint32(/* id 15, wireType 0 =*/120).bool(message.unverifiedLazy); if (message.uninterpretedOption != null && message.uninterpretedOption.length) for (var i = 0; i < message.uninterpretedOption.length; ++i) $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); @@ -10430,42 +11099,55 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.ctype = reader.int32(); - break; - case 2: - message.packed = reader.bool(); - break; - case 6: - message.jstype = reader.int32(); - break; - case 5: - message.lazy = reader.bool(); - break; - case 3: - message.deprecated = reader.bool(); - break; - case 10: - message.weak = reader.bool(); - break; - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; - case 1052: - if (!(message[".google.api.fieldBehavior"] && message[".google.api.fieldBehavior"].length)) - message[".google.api.fieldBehavior"] = []; - if ((tag & 7) === 2) { - var end2 = reader.uint32() + reader.pos; - while (reader.pos < end2) + case 1: { + message.ctype = reader.int32(); + break; + } + case 2: { + message.packed = reader.bool(); + break; + } + case 6: { + message.jstype = reader.int32(); + break; + } + case 5: { + message.lazy = reader.bool(); + break; + } + case 15: { + message.unverifiedLazy = reader.bool(); + break; + } + case 3: { + message.deprecated = reader.bool(); + break; + } + case 10: { + message.weak = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 1052: { + if (!(message[".google.api.fieldBehavior"] && message[".google.api.fieldBehavior"].length)) + message[".google.api.fieldBehavior"] = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message[".google.api.fieldBehavior"].push(reader.int32()); + } else message[".google.api.fieldBehavior"].push(reader.int32()); - } else - message[".google.api.fieldBehavior"].push(reader.int32()); - break; - case 1055: - message[".google.api.resourceReference"] = $root.google.api.ResourceReference.decode(reader, reader.uint32()); - break; + break; + } + case 1055: { + message[".google.api.resourceReference"] = $root.google.api.ResourceReference.decode(reader, reader.uint32()); + break; + } default: reader.skipType(tag & 7); break; @@ -10525,6 +11207,9 @@ if (message.lazy != null && message.hasOwnProperty("lazy")) if (typeof message.lazy !== "boolean") return "lazy: boolean expected"; + if (message.unverifiedLazy != null && message.hasOwnProperty("unverifiedLazy")) + if (typeof message.unverifiedLazy !== "boolean") + return "unverifiedLazy: boolean expected"; if (message.deprecated != null && message.hasOwnProperty("deprecated")) if (typeof message.deprecated !== "boolean") return "deprecated: boolean expected"; @@ -10610,6 +11295,8 @@ } if (object.lazy != null) message.lazy = Boolean(object.lazy); + if (object.unverifiedLazy != null) + message.unverifiedLazy = Boolean(object.unverifiedLazy); if (object.deprecated != null) message.deprecated = Boolean(object.deprecated); if (object.weak != null) @@ -10697,6 +11384,7 @@ object.lazy = false; object.jstype = options.enums === String ? "JS_NORMAL" : 0; object.weak = false; + object.unverifiedLazy = false; object[".google.api.resourceReference"] = null; } if (message.ctype != null && message.hasOwnProperty("ctype")) @@ -10711,6 +11399,8 @@ object.jstype = options.enums === String ? $root.google.protobuf.FieldOptions.JSType[message.jstype] : message.jstype; if (message.weak != null && message.hasOwnProperty("weak")) object.weak = message.weak; + if (message.unverifiedLazy != null && message.hasOwnProperty("unverifiedLazy")) + object.unverifiedLazy = message.unverifiedLazy; if (message.uninterpretedOption && message.uninterpretedOption.length) { object.uninterpretedOption = []; for (var j = 0; j < message.uninterpretedOption.length; ++j) @@ -10737,6 +11427,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for FieldOptions + * @function getTypeUrl + * @memberof google.protobuf.FieldOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FieldOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FieldOptions"; + }; + /** * CType enum. * @name google.protobuf.FieldOptions.CType @@ -10866,11 +11571,12 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -10977,6 +11683,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for OneofOptions + * @function getTypeUrl + * @memberof google.protobuf.OneofOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + OneofOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.OneofOptions"; + }; + return OneofOptions; })(); @@ -11096,17 +11817,20 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 2: - message.allowAlias = reader.bool(); - break; - case 3: - message.deprecated = reader.bool(); - break; - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; + case 2: { + message.allowAlias = reader.bool(); + break; + } + case 3: { + message.deprecated = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -11231,6 +11955,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for EnumOptions + * @function getTypeUrl + * @memberof google.protobuf.EnumOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumOptions"; + }; + return EnumOptions; })(); @@ -11339,14 +12078,16 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.deprecated = reader.bool(); - break; - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; + case 1: { + message.deprecated = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -11458,8 +12199,23 @@ * @instance * @returns {Object.} JSON object */ - EnumValueOptions.prototype.toJSON = function toJSON() { - return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + EnumValueOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for EnumValueOptions + * @function getTypeUrl + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumValueOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumValueOptions"; }; return EnumValueOptions; @@ -11592,20 +12348,24 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 33: - message.deprecated = reader.bool(); - break; - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; - case 1049: - message[".google.api.defaultHost"] = reader.string(); - break; - case 1050: - message[".google.api.oauthScopes"] = reader.string(); - break; + case 33: { + message.deprecated = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 1049: { + message[".google.api.defaultHost"] = reader.string(); + break; + } + case 1050: { + message[".google.api.oauthScopes"] = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -11738,6 +12498,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for ServiceOptions + * @function getTypeUrl + * @memberof google.protobuf.ServiceOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ServiceOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.ServiceOptions"; + }; + return ServiceOptions; })(); @@ -11881,25 +12656,30 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 33: - message.deprecated = reader.bool(); - break; - case 34: - message.idempotencyLevel = reader.int32(); - break; - case 999: - if (!(message.uninterpretedOption && message.uninterpretedOption.length)) - message.uninterpretedOption = []; - message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); - break; - case 72295728: - message[".google.api.http"] = $root.google.api.HttpRule.decode(reader, reader.uint32()); - break; - case 1051: - if (!(message[".google.api.methodSignature"] && message[".google.api.methodSignature"].length)) - message[".google.api.methodSignature"] = []; - message[".google.api.methodSignature"].push(reader.string()); - break; + case 33: { + message.deprecated = reader.bool(); + break; + } + case 34: { + message.idempotencyLevel = reader.int32(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 72295728: { + message[".google.api.http"] = $root.google.api.HttpRule.decode(reader, reader.uint32()); + break; + } + case 1051: { + if (!(message[".google.api.methodSignature"] && message[".google.api.methodSignature"].length)) + message[".google.api.methodSignature"] = []; + message[".google.api.methodSignature"].push(reader.string()); + break; + } default: reader.skipType(tag & 7); break; @@ -12076,6 +12856,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for MethodOptions + * @function getTypeUrl + * @memberof google.protobuf.MethodOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + MethodOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.MethodOptions"; + }; + /** * IdempotencyLevel enum. * @name google.protobuf.MethodOptions.IdempotencyLevel @@ -12255,29 +13050,36 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 2: - if (!(message.name && message.name.length)) - message.name = []; - message.name.push($root.google.protobuf.UninterpretedOption.NamePart.decode(reader, reader.uint32())); - break; - case 3: - message.identifierValue = reader.string(); - break; - case 4: - message.positiveIntValue = reader.uint64(); - break; - case 5: - message.negativeIntValue = reader.int64(); - break; - case 6: - message.doubleValue = reader.double(); - break; - case 7: - message.stringValue = reader.bytes(); - break; - case 8: - message.aggregateValue = reader.string(); - break; + case 2: { + if (!(message.name && message.name.length)) + message.name = []; + message.name.push($root.google.protobuf.UninterpretedOption.NamePart.decode(reader, reader.uint32())); + break; + } + case 3: { + message.identifierValue = reader.string(); + break; + } + case 4: { + message.positiveIntValue = reader.uint64(); + break; + } + case 5: { + message.negativeIntValue = reader.int64(); + break; + } + case 6: { + message.doubleValue = reader.double(); + break; + } + case 7: { + message.stringValue = reader.bytes(); + break; + } + case 8: { + message.aggregateValue = reader.string(); + break; + } default: reader.skipType(tag & 7); break; @@ -12390,7 +13192,7 @@ if (object.stringValue != null) if (typeof object.stringValue === "string") $util.base64.decode(object.stringValue, message.stringValue = $util.newBuffer($util.base64.length(object.stringValue)), 0); - else if (object.stringValue.length) + else if (object.stringValue.length >= 0) message.stringValue = object.stringValue; if (object.aggregateValue != null) message.aggregateValue = String(object.aggregateValue); @@ -12471,6 +13273,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for UninterpretedOption + * @function getTypeUrl + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + UninterpretedOption.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.UninterpretedOption"; + }; + UninterpretedOption.NamePart = (function() { /** @@ -12572,12 +13389,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.namePart = reader.string(); - break; - case 2: - message.isExtension = reader.bool(); - break; + case 1: { + message.namePart = reader.string(); + break; + } + case 2: { + message.isExtension = reader.bool(); + break; + } default: reader.skipType(tag & 7); break; @@ -12678,6 +13497,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for NamePart + * @function getTypeUrl + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + NamePart.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.UninterpretedOption.NamePart"; + }; + return NamePart; })(); @@ -12778,11 +13612,12 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - if (!(message.location && message.location.length)) - message.location = []; - message.location.push($root.google.protobuf.SourceCodeInfo.Location.decode(reader, reader.uint32())); - break; + case 1: { + if (!(message.location && message.location.length)) + message.location = []; + message.location.push($root.google.protobuf.SourceCodeInfo.Location.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -12889,6 +13724,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for SourceCodeInfo + * @function getTypeUrl + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + SourceCodeInfo.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.SourceCodeInfo"; + }; + SourceCodeInfo.Location = (function() { /** @@ -13037,37 +13887,42 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - if (!(message.path && message.path.length)) - message.path = []; - if ((tag & 7) === 2) { - var end2 = reader.uint32() + reader.pos; - while (reader.pos < end2) + case 1: { + if (!(message.path && message.path.length)) + message.path = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.path.push(reader.int32()); + } else message.path.push(reader.int32()); - } else - message.path.push(reader.int32()); - break; - case 2: - if (!(message.span && message.span.length)) - message.span = []; - if ((tag & 7) === 2) { - var end2 = reader.uint32() + reader.pos; - while (reader.pos < end2) + break; + } + case 2: { + if (!(message.span && message.span.length)) + message.span = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.span.push(reader.int32()); + } else message.span.push(reader.int32()); - } else - message.span.push(reader.int32()); - break; - case 3: - message.leadingComments = reader.string(); - break; - case 4: - message.trailingComments = reader.string(); - break; - case 6: - if (!(message.leadingDetachedComments && message.leadingDetachedComments.length)) - message.leadingDetachedComments = []; - message.leadingDetachedComments.push(reader.string()); - break; + break; + } + case 3: { + message.leadingComments = reader.string(); + break; + } + case 4: { + message.trailingComments = reader.string(); + break; + } + case 6: { + if (!(message.leadingDetachedComments && message.leadingDetachedComments.length)) + message.leadingDetachedComments = []; + message.leadingDetachedComments.push(reader.string()); + break; + } default: reader.skipType(tag & 7); break; @@ -13228,6 +14083,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Location + * @function getTypeUrl + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Location.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.SourceCodeInfo.Location"; + }; + return Location; })(); @@ -13328,11 +14198,12 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - if (!(message.annotation && message.annotation.length)) - message.annotation = []; - message.annotation.push($root.google.protobuf.GeneratedCodeInfo.Annotation.decode(reader, reader.uint32())); - break; + case 1: { + if (!(message.annotation && message.annotation.length)) + message.annotation = []; + message.annotation.push($root.google.protobuf.GeneratedCodeInfo.Annotation.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -13439,6 +14310,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for GeneratedCodeInfo + * @function getTypeUrl + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + GeneratedCodeInfo.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.GeneratedCodeInfo"; + }; + GeneratedCodeInfo.Annotation = (function() { /** @@ -13449,6 +14335,7 @@ * @property {string|null} [sourceFile] Annotation sourceFile * @property {number|null} [begin] Annotation begin * @property {number|null} [end] Annotation end + * @property {google.protobuf.GeneratedCodeInfo.Annotation.Semantic|null} [semantic] Annotation semantic */ /** @@ -13499,6 +14386,14 @@ */ Annotation.prototype.end = 0; + /** + * Annotation semantic. + * @member {google.protobuf.GeneratedCodeInfo.Annotation.Semantic} semantic + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.semantic = 0; + /** * Creates a new Annotation instance using the specified properties. * @function create @@ -13535,6 +14430,8 @@ writer.uint32(/* id 3, wireType 0 =*/24).int32(message.begin); if (message.end != null && Object.hasOwnProperty.call(message, "end")) writer.uint32(/* id 4, wireType 0 =*/32).int32(message.end); + if (message.semantic != null && Object.hasOwnProperty.call(message, "semantic")) + writer.uint32(/* id 5, wireType 0 =*/40).int32(message.semantic); return writer; }; @@ -13569,25 +14466,33 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - if (!(message.path && message.path.length)) - message.path = []; - if ((tag & 7) === 2) { - var end2 = reader.uint32() + reader.pos; - while (reader.pos < end2) + case 1: { + if (!(message.path && message.path.length)) + message.path = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.path.push(reader.int32()); + } else message.path.push(reader.int32()); - } else - message.path.push(reader.int32()); - break; - case 2: - message.sourceFile = reader.string(); - break; - case 3: - message.begin = reader.int32(); - break; - case 4: - message.end = reader.int32(); - break; + break; + } + case 2: { + message.sourceFile = reader.string(); + break; + } + case 3: { + message.begin = reader.int32(); + break; + } + case 4: { + message.end = reader.int32(); + break; + } + case 5: { + message.semantic = reader.int32(); + break; + } default: reader.skipType(tag & 7); break; @@ -13639,6 +14544,15 @@ if (message.end != null && message.hasOwnProperty("end")) if (!$util.isInteger(message.end)) return "end: integer expected"; + if (message.semantic != null && message.hasOwnProperty("semantic")) + switch (message.semantic) { + default: + return "semantic: enum value expected"; + case 0: + case 1: + case 2: + break; + } return null; }; @@ -13667,6 +14581,20 @@ message.begin = object.begin | 0; if (object.end != null) message.end = object.end | 0; + switch (object.semantic) { + case "NONE": + case 0: + message.semantic = 0; + break; + case "SET": + case 1: + message.semantic = 1; + break; + case "ALIAS": + case 2: + message.semantic = 2; + break; + } return message; }; @@ -13689,6 +14617,7 @@ object.sourceFile = ""; object.begin = 0; object.end = 0; + object.semantic = options.enums === String ? "NONE" : 0; } if (message.path && message.path.length) { object.path = []; @@ -13701,6 +14630,8 @@ object.begin = message.begin; if (message.end != null && message.hasOwnProperty("end")) object.end = message.end; + if (message.semantic != null && message.hasOwnProperty("semantic")) + object.semantic = options.enums === String ? $root.google.protobuf.GeneratedCodeInfo.Annotation.Semantic[message.semantic] : message.semantic; return object; }; @@ -13715,6 +14646,37 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Annotation + * @function getTypeUrl + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Annotation.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.GeneratedCodeInfo.Annotation"; + }; + + /** + * Semantic enum. + * @name google.protobuf.GeneratedCodeInfo.Annotation.Semantic + * @enum {number} + * @property {number} NONE=0 NONE value + * @property {number} SET=1 SET value + * @property {number} ALIAS=2 ALIAS value + */ + Annotation.Semantic = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "NONE"] = 0; + values[valuesById[1] = "SET"] = 1; + values[valuesById[2] = "ALIAS"] = 2; + return values; + })(); + return Annotation; })(); @@ -13824,12 +14786,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.seconds = reader.int64(); - break; - case 2: - message.nanos = reader.int32(); - break; + case 1: { + message.seconds = reader.int64(); + break; + } + case 2: { + message.nanos = reader.int32(); + break; + } default: reader.skipType(tag & 7); break; @@ -13942,6 +14906,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Duration + * @function getTypeUrl + * @memberof google.protobuf.Duration + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Duration.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.Duration"; + }; + return Duration; })(); @@ -14048,12 +15027,14 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.type_url = reader.string(); - break; - case 2: - message.value = reader.bytes(); - break; + case 1: { + message.type_url = reader.string(); + break; + } + case 2: { + message.value = reader.bytes(); + break; + } default: reader.skipType(tag & 7); break; @@ -14115,7 +15096,7 @@ if (object.value != null) if (typeof object.value === "string") $util.base64.decode(object.value, message.value = $util.newBuffer($util.base64.length(object.value)), 0); - else if (object.value.length) + else if (object.value.length >= 0) message.value = object.value; return message; }; @@ -14161,6 +15142,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Any + * @function getTypeUrl + * @memberof google.protobuf.Any + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Any.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.Any"; + }; + return Any; })(); @@ -14292,17 +15288,20 @@ while (reader.pos < end) { var tag = reader.uint32(); switch (tag >>> 3) { - case 1: - message.code = reader.int32(); - break; - case 2: - message.message = reader.string(); - break; - case 3: - if (!(message.details && message.details.length)) - message.details = []; - message.details.push($root.google.protobuf.Any.decode(reader, reader.uint32())); - break; + case 1: { + message.code = reader.int32(); + break; + } + case 2: { + message.message = reader.string(); + break; + } + case 3: { + if (!(message.details && message.details.length)) + message.details = []; + message.details.push($root.google.protobuf.Any.decode(reader, reader.uint32())); + break; + } default: reader.skipType(tag & 7); break; @@ -14427,6 +15426,21 @@ return this.constructor.toObject(this, $protobuf.util.toJSONOptions); }; + /** + * Gets the default type url for Status + * @function getTypeUrl + * @memberof google.rpc.Status + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Status.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.rpc.Status"; + }; + return Status; })(); diff --git a/packages/google-cloud-apigeeconnect/protos/protos.json b/packages/google-cloud-apigeeconnect/protos/protos.json index 85d4d1cf459..3d6c93b357b 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.json +++ b/packages/google-cloud-apigeeconnect/protos/protos.json @@ -614,6 +614,10 @@ "syntax": { "type": "string", "id": 12 + }, + "edition": { + "type": "string", + "id": 13 } } }, @@ -1142,6 +1146,13 @@ "default": false } }, + "unverifiedLazy": { + "type": "bool", + "id": 15, + "options": { + "default": false + } + }, "deprecated": { "type": "bool", "id": 3, @@ -1434,6 +1445,19 @@ "end": { "type": "int32", "id": 4 + }, + "semantic": { + "type": "Semantic", + "id": 5 + } + }, + "nested": { + "Semantic": { + "values": { + "NONE": 0, + "SET": 1, + "ALIAS": 2 + } } } } From 93c9b8684a3f85ff091e42d71937d73ba9cf8ec0 Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Tue, 23 Aug 2022 16:21:22 -0700 Subject: [PATCH 53/63] chore(main): release 2.1.1 (#96) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * chore(main): release 2.1.1 * 🦉 Updates from OwlBot post-processor See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md Co-authored-by: release-please[bot] <55107282+release-please[bot]@users.noreply.github.com> Co-authored-by: Owl Bot --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 9 +++++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- .../snippet_metadata.google.cloud.apigeeconnect.v1.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 4 files changed, 12 insertions(+), 3 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index bbf4f085fb8..6a6856a3333 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,14 @@ # Changelog +## [2.1.1](https://github.com/googleapis/nodejs-apigee-connect/compare/v2.1.0...v2.1.1) (2022-08-23) + + +### Bug Fixes + +* better support for fallback mode ([#94](https://github.com/googleapis/nodejs-apigee-connect/issues/94)) ([269d5e0](https://github.com/googleapis/nodejs-apigee-connect/commit/269d5e0616b640262bf5e907ec083928e5c242be)) +* change import long to require ([#95](https://github.com/googleapis/nodejs-apigee-connect/issues/95)) ([4757aac](https://github.com/googleapis/nodejs-apigee-connect/commit/4757aacfdd505985c5228e0498495814e6436ef2)) +* remove pip install statements ([#1546](https://github.com/googleapis/nodejs-apigee-connect/issues/1546)) ([#97](https://github.com/googleapis/nodejs-apigee-connect/issues/97)) ([43c6667](https://github.com/googleapis/nodejs-apigee-connect/commit/43c66675c0ec0dcb3e208c5b11d0ee7b8b43f0ee)) + ## [2.1.0](https://github.com/googleapis/nodejs-apigee-connect/compare/v2.0.0...v2.1.0) (2022-06-29) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 5c0d774e4db..9a8668e10e8 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "2.1.0", + "version": "2.1.1", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json index 5a27b613287..c5edcc894e9 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json @@ -1,7 +1,7 @@ { "clientLibrary": { "name": "nodejs-apigeeconnect", - "version": "2.1.0", + "version": "2.1.1", "language": "TYPESCRIPT", "apis": [ { diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index d3d44b4d415..33d80b88993 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^2.1.0" + "@google-cloud/apigee-connect": "^2.1.1" }, "devDependencies": { "c8": "^7.1.0", From ad21c17dbeed1638253b20385d3f7434c879abb6 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Sat, 27 Aug 2022 05:02:32 +0000 Subject: [PATCH 54/63] fix: do not import the whole google-gax from proto JS (#1553) (#98) fix: use google-gax v3.3.0 Source-Link: https://github.com/googleapis/synthtool/commit/c73d112a11a1f1a93efa67c50495c19aa3a88910 Post-Processor: gcr.io/cloud-devrel-public-resources/owlbot-nodejs:latest@sha256:b15a6f06cc06dcffa11e1bebdf1a74b6775a134aac24a0f86f51ddf728eb373e --- packages/google-cloud-apigeeconnect/package.json | 2 +- packages/google-cloud-apigeeconnect/protos/protos.d.ts | 2 +- packages/google-cloud-apigeeconnect/protos/protos.js | 2 +- 3 files changed, 3 insertions(+), 3 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 9a8668e10e8..096a34cadab 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -39,7 +39,7 @@ "prelint": "cd samples; npm link ../; npm i" }, "dependencies": { - "google-gax": "^3.0.1" + "google-gax": "^3.3.0" }, "devDependencies": { "@types/mocha": "^9.0.0", diff --git a/packages/google-cloud-apigeeconnect/protos/protos.d.ts b/packages/google-cloud-apigeeconnect/protos/protos.d.ts index 4c533a91d03..d8c58b27492 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.d.ts +++ b/packages/google-cloud-apigeeconnect/protos/protos.d.ts @@ -13,7 +13,7 @@ // limitations under the License. import Long = require("long"); -import {protobuf as $protobuf} from "google-gax"; +import type {protobuf as $protobuf} from "google-gax"; /** Namespace google. */ export namespace google { diff --git a/packages/google-cloud-apigeeconnect/protos/protos.js b/packages/google-cloud-apigeeconnect/protos/protos.js index e1b6e0c41c5..a3ddf6065c5 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.js +++ b/packages/google-cloud-apigeeconnect/protos/protos.js @@ -19,7 +19,7 @@ define(["protobufjs/minimal"], factory); /* CommonJS */ else if (typeof require === 'function' && typeof module === 'object' && module && module.exports) - module.exports = factory(require("google-gax").protobufMinimal); + module.exports = factory(require("google-gax/build/src/protobuf").protobufMinimal); })(this, function($protobuf) { "use strict"; From 61f9bcfd14b3b66e97566ad8f0b531b0c647fd2d Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Thu, 1 Sep 2022 20:48:25 +0000 Subject: [PATCH 55/63] fix: allow passing gax instance to client constructor (#99) - [ ] Regenerate this pull request now. PiperOrigin-RevId: 470911839 Source-Link: https://github.com/googleapis/googleapis/commit/352756699ebc5b2144c252867c265ea44448712e Source-Link: https://github.com/googleapis/googleapis-gen/commit/f16a1d224f00a630ea43d6a9a1a31f566f45cdea Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiZjE2YTFkMjI0ZjAwYTYzMGVhNDNkNmE5YTFhMzFmNTY2ZjQ1Y2RlYSJ9 feat: accept google-gax instance as a parameter Please see the documentation of the client constructor for details. PiperOrigin-RevId: 470332808 Source-Link: https://github.com/googleapis/googleapis/commit/d4a23675457cd8f0b44080e0594ec72de1291b89 Source-Link: https://github.com/googleapis/googleapis-gen/commit/e97a1ac204ead4fe7341f91e72db7c6ac6016341 Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiZTk3YTFhYzIwNGVhZDRmZTczNDFmOTFlNzJkYjdjNmFjNjAxNjM0MSJ9 --- .../src/v1/connection_service_client.ts | 33 ++++++++++++------ .../src/v1/tether_client.ts | 34 +++++++++++++------ 2 files changed, 47 insertions(+), 20 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index 95b546cfe4a..c7f51b3875e 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -17,8 +17,8 @@ // ** All changes to this file may be overwritten. ** /* global window */ -import * as gax from 'google-gax'; -import { +import type * as gax from 'google-gax'; +import type { Callback, CallOptions, Descriptors, @@ -26,7 +26,6 @@ import { PaginationCallback, GaxCall, } from 'google-gax'; - import {Transform} from 'stream'; import * as protos from '../../protos/protos'; import jsonProtos = require('../../protos/protos.json'); @@ -36,7 +35,6 @@ import jsonProtos = require('../../protos/protos.json'); * This file defines retry strategy and timeouts for all API methods in this library. */ import * as gapicConfig from './connection_service_client_config.json'; - const version = require('../../../package.json').version; /** @@ -96,8 +94,18 @@ export class ConnectionServiceClient { * Pass "rest" to use HTTP/1.1 REST API instead of gRPC. * For more information, please check the * {@link https://github.com/googleapis/gax-nodejs/blob/main/client-libraries.md#http11-rest-api-mode documentation}. + * @param {gax} [gaxInstance]: loaded instance of `google-gax`. Useful if you + * need to avoid loading the default gRPC version and want to use the fallback + * HTTP implementation. Load only fallback version and pass it to the constructor: + * ``` + * const gax = require('google-gax/build/src/fallback'); // avoids loading google-gax with gRPC + * const client = new ConnectionServiceClient({fallback: 'rest'}, gax); + * ``` */ - constructor(opts?: ClientOptions) { + constructor( + opts?: ClientOptions, + gaxInstance?: typeof gax | typeof gax.fallback + ) { // Ensure that options include all the required fields. const staticMembers = this.constructor as typeof ConnectionServiceClient; const servicePath = @@ -117,8 +125,13 @@ export class ConnectionServiceClient { opts['scopes'] = staticMembers.scopes; } + // Load google-gax module synchronously if needed + if (!gaxInstance) { + gaxInstance = require('google-gax') as typeof gax; + } + // Choose either gRPC or proto-over-HTTP implementation of google-gax. - this._gaxModule = opts.fallback ? gax.fallback : gax; + this._gaxModule = opts.fallback ? gaxInstance.fallback : gaxInstance; // Create a `gaxGrpc` object, with any grpc-specific options sent to the client. this._gaxGrpc = new this._gaxModule.GrpcClient(opts); @@ -192,7 +205,7 @@ export class ConnectionServiceClient { this.innerApiCalls = {}; // Add a warn function to the client constructor so it can be easily tested. - this.warn = gax.warn; + this.warn = this._gaxModule.warn; } /** @@ -411,7 +424,7 @@ export class ConnectionServiceClient { options.otherArgs = options.otherArgs || {}; options.otherArgs.headers = options.otherArgs.headers || {}; options.otherArgs.headers['x-goog-request-params'] = - gax.routingHeader.fromParams({ + this._gaxModule.routingHeader.fromParams({ parent: request.parent || '', }); this.initialize(); @@ -456,7 +469,7 @@ export class ConnectionServiceClient { options.otherArgs = options.otherArgs || {}; options.otherArgs.headers = options.otherArgs.headers || {}; options.otherArgs.headers['x-goog-request-params'] = - gax.routingHeader.fromParams({ + this._gaxModule.routingHeader.fromParams({ parent: request.parent || '', }); const defaultCallSettings = this._defaults['listConnections']; @@ -510,7 +523,7 @@ export class ConnectionServiceClient { options.otherArgs = options.otherArgs || {}; options.otherArgs.headers = options.otherArgs.headers || {}; options.otherArgs.headers['x-goog-request-params'] = - gax.routingHeader.fromParams({ + this._gaxModule.routingHeader.fromParams({ parent: request.parent || '', }); const defaultCallSettings = this._defaults['listConnections']; diff --git a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts index 4ea4cbfc53e..6debedc7f9e 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/tether_client.ts @@ -17,15 +17,13 @@ // ** All changes to this file may be overwritten. ** /* global window */ -import * as gax from 'google-gax'; -import { +import type * as gax from 'google-gax'; +import type { Callback, CallOptions, Descriptors, ClientOptions, - GoogleError, } from 'google-gax'; - import {PassThrough} from 'stream'; import * as protos from '../../protos/protos'; import jsonProtos = require('../../protos/protos.json'); @@ -35,7 +33,6 @@ import jsonProtos = require('../../protos/protos.json'); * This file defines retry strategy and timeouts for all API methods in this library. */ import * as gapicConfig from './tether_client_config.json'; - const version = require('../../../package.json').version; /** @@ -96,8 +93,18 @@ export class TetherClient { * Pass "rest" to use HTTP/1.1 REST API instead of gRPC. * For more information, please check the * {@link https://github.com/googleapis/gax-nodejs/blob/main/client-libraries.md#http11-rest-api-mode documentation}. + * @param {gax} [gaxInstance]: loaded instance of `google-gax`. Useful if you + * need to avoid loading the default gRPC version and want to use the fallback + * HTTP implementation. Load only fallback version and pass it to the constructor: + * ``` + * const gax = require('google-gax/build/src/fallback'); // avoids loading google-gax with gRPC + * const client = new TetherClient({fallback: 'rest'}, gax); + * ``` */ - constructor(opts?: ClientOptions) { + constructor( + opts?: ClientOptions, + gaxInstance?: typeof gax | typeof gax.fallback + ) { // Ensure that options include all the required fields. const staticMembers = this.constructor as typeof TetherClient; const servicePath = @@ -117,8 +124,13 @@ export class TetherClient { opts['scopes'] = staticMembers.scopes; } + // Load google-gax module synchronously if needed + if (!gaxInstance) { + gaxInstance = require('google-gax') as typeof gax; + } + // Choose either gRPC or proto-over-HTTP implementation of google-gax. - this._gaxModule = opts.fallback ? gax.fallback : gax; + this._gaxModule = opts.fallback ? gaxInstance.fallback : gaxInstance; // Create a `gaxGrpc` object, with any grpc-specific options sent to the client. this._gaxGrpc = new this._gaxModule.GrpcClient(opts); @@ -162,7 +174,7 @@ export class TetherClient { // Provide descriptors for these. this.descriptors.stream = { egress: new this._gaxModule.StreamDescriptor( - gax.StreamType.BIDI_STREAMING, + this._gaxModule.StreamType.BIDI_STREAMING, opts.fallback === 'rest' ), }; @@ -181,7 +193,7 @@ export class TetherClient { this.innerApiCalls = {}; // Add a warn function to the client constructor so it can be easily tested. - this.warn = gax.warn; + this.warn = this._gaxModule.warn; } /** @@ -227,7 +239,9 @@ export class TetherClient { setImmediate(() => { stream.emit( 'error', - new GoogleError('The client has already been closed.') + new this._gaxModule.GoogleError( + 'The client has already been closed.' + ) ); }); return stream; From df2f8fe35053805723ff668d6eceafd7b56bf093 Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Thu, 8 Sep 2022 16:49:10 -0400 Subject: [PATCH 56/63] chore(main): release 2.1.2 (#100) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * chore(main): release 2.1.2 * 🦉 Updates from OwlBot post-processor See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md Co-authored-by: release-please[bot] <55107282+release-please[bot]@users.noreply.github.com> Co-authored-by: Owl Bot --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 8 ++++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- .../snippet_metadata.google.cloud.apigeeconnect.v1.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 4 files changed, 11 insertions(+), 3 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index 6a6856a3333..e5f2b42b21a 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,13 @@ # Changelog +## [2.1.2](https://github.com/googleapis/nodejs-apigee-connect/compare/v2.1.1...v2.1.2) (2022-09-01) + + +### Bug Fixes + +* Allow passing gax instance to client constructor ([#99](https://github.com/googleapis/nodejs-apigee-connect/issues/99)) ([bdc2600](https://github.com/googleapis/nodejs-apigee-connect/commit/bdc26002bb391f81cdba9c7c13643944faa20620)) +* Do not import the whole google-gax from proto JS ([#1553](https://github.com/googleapis/nodejs-apigee-connect/issues/1553)) ([#98](https://github.com/googleapis/nodejs-apigee-connect/issues/98)) ([f52ed29](https://github.com/googleapis/nodejs-apigee-connect/commit/f52ed29e966efce3b04b1271e3e161f8bb8ee812)) + ## [2.1.1](https://github.com/googleapis/nodejs-apigee-connect/compare/v2.1.0...v2.1.1) (2022-08-23) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 096a34cadab..7e593a48cd3 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "2.1.1", + "version": "2.1.2", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json index c5edcc894e9..23dad0fb31f 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json @@ -1,7 +1,7 @@ { "clientLibrary": { "name": "nodejs-apigeeconnect", - "version": "2.1.1", + "version": "2.1.2", "language": "TYPESCRIPT", "apis": [ { diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 33d80b88993..0efd636e236 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^2.1.1" + "@google-cloud/apigee-connect": "^2.1.2" }, "devDependencies": { "c8": "^7.1.0", From cd9850712efe14dcc7a074e1d6bd62c7019e67bb Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Wed, 14 Sep 2022 22:38:33 +0000 Subject: [PATCH 57/63] fix: preserve default values in x-goog-request-params header (#101) - [ ] Regenerate this pull request now. PiperOrigin-RevId: 474338479 Source-Link: https://github.com/googleapis/googleapis/commit/d5d35e0353b59719e8917103b1bc7df2782bf6ba Source-Link: https://github.com/googleapis/googleapis-gen/commit/efcd3f93962a103f68f003e2a1eecde6fa216a27 Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiZWZjZDNmOTM5NjJhMTAzZjY4ZjAwM2UyYTFlZWNkZTZmYTIxNmEyNyJ9 --- .../src/v1/connection_service_client.ts | 6 +- .../test/gapic_connection_service_v1.ts | 168 ++++++++++-------- .../test/gapic_tether_v1.ts | 16 ++ 3 files changed, 117 insertions(+), 73 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts index c7f51b3875e..12c4ce1e95c 100644 --- a/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts +++ b/packages/google-cloud-apigeeconnect/src/v1/connection_service_client.ts @@ -425,7 +425,7 @@ export class ConnectionServiceClient { options.otherArgs.headers = options.otherArgs.headers || {}; options.otherArgs.headers['x-goog-request-params'] = this._gaxModule.routingHeader.fromParams({ - parent: request.parent || '', + parent: request.parent ?? '', }); this.initialize(); return this.innerApiCalls.listConnections(request, options, callback); @@ -470,7 +470,7 @@ export class ConnectionServiceClient { options.otherArgs.headers = options.otherArgs.headers || {}; options.otherArgs.headers['x-goog-request-params'] = this._gaxModule.routingHeader.fromParams({ - parent: request.parent || '', + parent: request.parent ?? '', }); const defaultCallSettings = this._defaults['listConnections']; const callSettings = defaultCallSettings.merge(options); @@ -524,7 +524,7 @@ export class ConnectionServiceClient { options.otherArgs.headers = options.otherArgs.headers || {}; options.otherArgs.headers['x-goog-request-params'] = this._gaxModule.routingHeader.fromParams({ - parent: request.parent || '', + parent: request.parent ?? '', }); const defaultCallSettings = this._defaults['listConnections']; const callSettings = defaultCallSettings.merge(options); diff --git a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts index d30e4b89ca1..6a54d2e5e35 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts @@ -27,6 +27,21 @@ import {PassThrough} from 'stream'; import {protobuf} from 'google-gax'; +// Dynamically loaded proto JSON is needed to get the type information +// to fill in default values for request objects +const root = protobuf.Root.fromJSON( + require('../protos/protos.json') +).resolveAll(); + +// eslint-disable-next-line @typescript-eslint/no-unused-vars +function getTypeDefaultValue(typeName: string, fields: string[]) { + let type = root.lookupType(typeName) as protobuf.Type; + for (const field of fields.slice(0, -1)) { + type = type.fields[field]?.resolvedType as protobuf.Type; + } + return type.fields[fields[fields.length - 1]]?.defaultValue; +} + function generateSampleMessage(instance: T) { const filledObject = ( instance.constructor as typeof protobuf.Message @@ -222,15 +237,11 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - request.parent = ''; - const expectedHeaderRequestParams = 'parent='; - const expectedOptions = { - otherArgs: { - headers: { - 'x-goog-request-params': expectedHeaderRequestParams, - }, - }, - }; + const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ + 'parent', + ]); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedResponse = [ generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.Connection() @@ -245,11 +256,14 @@ describe('v1.ConnectionServiceClient', () => { client.innerApiCalls.listConnections = stubSimpleCall(expectedResponse); const [response] = await client.listConnections(request); assert.deepStrictEqual(response, expectedResponse); - assert( - (client.innerApiCalls.listConnections as SinonStub) - .getCall(0) - .calledWith(request, expectedOptions, undefined) - ); + const actualRequest = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); }); it('invokes listConnections without error using callback', async () => { @@ -261,15 +275,11 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - request.parent = ''; - const expectedHeaderRequestParams = 'parent='; - const expectedOptions = { - otherArgs: { - headers: { - 'x-goog-request-params': expectedHeaderRequestParams, - }, - }, - }; + const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ + 'parent', + ]); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedResponse = [ generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.Connection() @@ -300,11 +310,14 @@ describe('v1.ConnectionServiceClient', () => { }); const response = await promise; assert.deepStrictEqual(response, expectedResponse); - assert( - (client.innerApiCalls.listConnections as SinonStub) - .getCall(0) - .calledWith(request, expectedOptions /*, callback defined above */) - ); + const actualRequest = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); }); it('invokes listConnections with error', async () => { @@ -316,26 +329,25 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - request.parent = ''; - const expectedHeaderRequestParams = 'parent='; - const expectedOptions = { - otherArgs: { - headers: { - 'x-goog-request-params': expectedHeaderRequestParams, - }, - }, - }; + const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ + 'parent', + ]); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedError = new Error('expected'); client.innerApiCalls.listConnections = stubSimpleCall( undefined, expectedError ); await assert.rejects(client.listConnections(request), expectedError); - assert( - (client.innerApiCalls.listConnections as SinonStub) - .getCall(0) - .calledWith(request, expectedOptions, undefined) - ); + const actualRequest = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); }); it('invokes listConnectionsStream without error', async () => { @@ -347,8 +359,11 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - request.parent = ''; - const expectedHeaderRequestParams = 'parent='; + const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ + 'parent', + ]); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedResponse = [ generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.Connection() @@ -385,11 +400,12 @@ describe('v1.ConnectionServiceClient', () => { .getCall(0) .calledWith(client.innerApiCalls.listConnections, request) ); - assert.strictEqual( - ( - client.descriptors.page.listConnections.createStream as SinonStub - ).getCall(0).args[2].otherArgs.headers['x-goog-request-params'], - expectedHeaderRequestParams + assert( + (client.descriptors.page.listConnections.createStream as SinonStub) + .getCall(0) + .args[2].otherArgs.headers['x-goog-request-params'].includes( + expectedHeaderRequestParams + ) ); }); @@ -402,8 +418,11 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - request.parent = ''; - const expectedHeaderRequestParams = 'parent='; + const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ + 'parent', + ]); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedError = new Error('expected'); client.descriptors.page.listConnections.createStream = stubPageStreamingCall(undefined, expectedError); @@ -429,11 +448,12 @@ describe('v1.ConnectionServiceClient', () => { .getCall(0) .calledWith(client.innerApiCalls.listConnections, request) ); - assert.strictEqual( - ( - client.descriptors.page.listConnections.createStream as SinonStub - ).getCall(0).args[2].otherArgs.headers['x-goog-request-params'], - expectedHeaderRequestParams + assert( + (client.descriptors.page.listConnections.createStream as SinonStub) + .getCall(0) + .args[2].otherArgs.headers['x-goog-request-params'].includes( + expectedHeaderRequestParams + ) ); }); @@ -446,8 +466,11 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - request.parent = ''; - const expectedHeaderRequestParams = 'parent='; + const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ + 'parent', + ]); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedResponse = [ generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.Connection() @@ -473,11 +496,12 @@ describe('v1.ConnectionServiceClient', () => { ).getCall(0).args[1], request ); - assert.strictEqual( - ( - client.descriptors.page.listConnections.asyncIterate as SinonStub - ).getCall(0).args[2].otherArgs.headers['x-goog-request-params'], - expectedHeaderRequestParams + assert( + (client.descriptors.page.listConnections.asyncIterate as SinonStub) + .getCall(0) + .args[2].otherArgs.headers['x-goog-request-params'].includes( + expectedHeaderRequestParams + ) ); }); @@ -490,8 +514,11 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - request.parent = ''; - const expectedHeaderRequestParams = 'parent='; + const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ + 'parent', + ]); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedError = new Error('expected'); client.descriptors.page.listConnections.asyncIterate = stubAsyncIterationCall(undefined, expectedError); @@ -509,11 +536,12 @@ describe('v1.ConnectionServiceClient', () => { ).getCall(0).args[1], request ); - assert.strictEqual( - ( - client.descriptors.page.listConnections.asyncIterate as SinonStub - ).getCall(0).args[2].otherArgs.headers['x-goog-request-params'], - expectedHeaderRequestParams + assert( + (client.descriptors.page.listConnections.asyncIterate as SinonStub) + .getCall(0) + .args[2].otherArgs.headers['x-goog-request-params'].includes( + expectedHeaderRequestParams + ) ); }); }); diff --git a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts index 79ab082c15c..d99b08da0b9 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_tether_v1.ts @@ -27,6 +27,21 @@ import {PassThrough} from 'stream'; import {protobuf} from 'google-gax'; +// Dynamically loaded proto JSON is needed to get the type information +// to fill in default values for request objects +const root = protobuf.Root.fromJSON( + require('../protos/protos.json') +).resolveAll(); + +// eslint-disable-next-line @typescript-eslint/no-unused-vars +function getTypeDefaultValue(typeName: string, fields: string[]) { + let type = root.lookupType(typeName) as protobuf.Type; + for (const field of fields.slice(0, -1)) { + type = type.fields[field]?.resolvedType as protobuf.Type; + } + return type.fields[fields[fields.length - 1]]?.defaultValue; +} + function generateSampleMessage(instance: T) { const filledObject = ( instance.constructor as typeof protobuf.Message @@ -158,6 +173,7 @@ describe('v1.TetherClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.EgressResponse() ); + const expectedResponse = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.EgressRequest() ); From 587f91d3b9a44d9b3c890770608724b6f047f886 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Fri, 23 Sep 2022 14:29:18 -0700 Subject: [PATCH 58/63] test: use fully qualified request type name in tests (#104) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit * test: use fully qualified request type name in tests PiperOrigin-RevId: 475685359 Source-Link: https://github.com/googleapis/googleapis/commit/7a129736313ceb1f277c3b7f7e16d2e04cc901dd Source-Link: https://github.com/googleapis/googleapis-gen/commit/370c729e2ba062a167449c27882ba5f379c5c34d Copy-Tag: eyJwIjoiLmdpdGh1Yi8uT3dsQm90LnlhbWwiLCJoIjoiMzcwYzcyOWUyYmEwNjJhMTY3NDQ5YzI3ODgyYmE1ZjM3OWM1YzM0ZCJ9 * 🦉 Updates from OwlBot post-processor See https://github.com/googleapis/repo-automation-bots/blob/main/packages/owl-bot/README.md Co-authored-by: Owl Bot --- .../test/gapic_connection_service_v1.ts | 49 +++++++++++-------- 1 file changed, 28 insertions(+), 21 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts index 6a54d2e5e35..b987e545fab 100644 --- a/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts +++ b/packages/google-cloud-apigeeconnect/test/gapic_connection_service_v1.ts @@ -237,9 +237,10 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ - 'parent', - ]); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.apigeeconnect.v1.ListConnectionsRequest', + ['parent'] + ); request.parent = defaultValue1; const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedResponse = [ @@ -275,9 +276,10 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ - 'parent', - ]); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.apigeeconnect.v1.ListConnectionsRequest', + ['parent'] + ); request.parent = defaultValue1; const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedResponse = [ @@ -329,9 +331,10 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ - 'parent', - ]); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.apigeeconnect.v1.ListConnectionsRequest', + ['parent'] + ); request.parent = defaultValue1; const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedError = new Error('expected'); @@ -359,9 +362,10 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ - 'parent', - ]); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.apigeeconnect.v1.ListConnectionsRequest', + ['parent'] + ); request.parent = defaultValue1; const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedResponse = [ @@ -418,9 +422,10 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ - 'parent', - ]); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.apigeeconnect.v1.ListConnectionsRequest', + ['parent'] + ); request.parent = defaultValue1; const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedError = new Error('expected'); @@ -466,9 +471,10 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ - 'parent', - ]); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.apigeeconnect.v1.ListConnectionsRequest', + ['parent'] + ); request.parent = defaultValue1; const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedResponse = [ @@ -514,9 +520,10 @@ describe('v1.ConnectionServiceClient', () => { const request = generateSampleMessage( new protos.google.cloud.apigeeconnect.v1.ListConnectionsRequest() ); - const defaultValue1 = getTypeDefaultValue('ListConnectionsRequest', [ - 'parent', - ]); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.apigeeconnect.v1.ListConnectionsRequest', + ['parent'] + ); request.parent = defaultValue1; const expectedHeaderRequestParams = `parent=${defaultValue1}`; const expectedError = new Error('expected'); From 81bdbc91dbc0f790f4958ed9d1db99c27e36515f Mon Sep 17 00:00:00 2001 From: Alexander Fenster Date: Thu, 3 Nov 2022 23:45:12 -0700 Subject: [PATCH 59/63] fix(deps): use google-gax v3.5.2 (#108) --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 7e593a48cd3..fdcab01e6c5 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -39,7 +39,7 @@ "prelint": "cd samples; npm link ../; npm i" }, "dependencies": { - "google-gax": "^3.3.0" + "google-gax": "^3.5.2" }, "devDependencies": { "@types/mocha": "^9.0.0", From 8f7cfac36c648d7dfd49861648dfbac573b7798d Mon Sep 17 00:00:00 2001 From: Mend Renovate Date: Thu, 10 Nov 2022 10:20:19 +0100 Subject: [PATCH 60/63] chore(deps): update dependency @types/node to v18 (#106) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![Mend Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [@types/node](https://togithub.com/DefinitelyTyped/DefinitelyTyped/tree/master/types/node) ([source](https://togithub.com/DefinitelyTyped/DefinitelyTyped)) | [`^16.0.0` -> `^18.0.0`](https://renovatebot.com/diffs/npm/@types%2fnode/16.18.3/18.11.9) | [![age](https://badges.renovateapi.com/packages/npm/@types%2fnode/18.11.9/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/@types%2fnode/18.11.9/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/@types%2fnode/18.11.9/compatibility-slim/16.18.3)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/@types%2fnode/18.11.9/confidence-slim/16.18.3)](https://docs.renovatebot.com/merge-confidence/) | --- ### Configuration 📅 **Schedule**: Branch creation - "after 9am and before 3pm" (UTC), Automerge - At any time (no schedule defined). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, check this box --- This PR has been generated by [Mend Renovate](https://www.mend.io/free-developer-tools/renovate/). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index fdcab01e6c5..067798cf4ff 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -43,7 +43,7 @@ }, "devDependencies": { "@types/mocha": "^9.0.0", - "@types/node": "^16.0.0", + "@types/node": "^18.0.0", "@types/sinon": "^10.0.0", "c8": "^7.7.2", "gts": "^3.1.0", From 732b9123167387b5e312708a047af052acf82de7 Mon Sep 17 00:00:00 2001 From: "gcf-owl-bot[bot]" <78513119+gcf-owl-bot[bot]@users.noreply.github.com> Date: Thu, 10 Nov 2022 10:56:24 +0000 Subject: [PATCH 61/63] fix: regenerated protos JS and TS definitions (#111) samples: pull in latest typeless bot, clean up some comments Source-Link: https://togithub.com/googleapis/synthtool/commit/0a68e568b6911b60bb6fd452eba4848b176031d8 Post-Processor: gcr.io/cloud-devrel-public-resources/owlbot-nodejs:latest@sha256:5b05f26103855c3a15433141389c478d1d3fe088fb5d4e3217c4793f6b3f245e --- .../protos/protos.d.ts | 2 +- .../protos/protos.js | 108 +++++++++++++++--- 2 files changed, 95 insertions(+), 15 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/protos/protos.d.ts b/packages/google-cloud-apigeeconnect/protos/protos.d.ts index d8c58b27492..dad0de5cdfd 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.d.ts +++ b/packages/google-cloud-apigeeconnect/protos/protos.d.ts @@ -12,8 +12,8 @@ // See the License for the specific language governing permissions and // limitations under the License. -import Long = require("long"); import type {protobuf as $protobuf} from "google-gax"; +import Long = require("long"); /** Namespace google. */ export namespace google { diff --git a/packages/google-cloud-apigeeconnect/protos/protos.js b/packages/google-cloud-apigeeconnect/protos/protos.js index a3ddf6065c5..663dd062a5d 100644 --- a/packages/google-cloud-apigeeconnect/protos/protos.js +++ b/packages/google-cloud-apigeeconnect/protos/protos.js @@ -1440,6 +1440,12 @@ message.payload = $root.google.cloud.apigeeconnect.v1.Payload.fromObject(object.payload); } switch (object.endpoint) { + default: + if (typeof object.endpoint === "number") { + message.endpoint = object.endpoint; + break; + } + break; case "TETHER_ENDPOINT_UNSPECIFIED": case 0: message.endpoint = 0; @@ -1495,7 +1501,7 @@ if (message.payload != null && message.hasOwnProperty("payload")) object.payload = $root.google.cloud.apigeeconnect.v1.Payload.toObject(message.payload, options); if (message.endpoint != null && message.hasOwnProperty("endpoint")) - object.endpoint = options.enums === String ? $root.google.cloud.apigeeconnect.v1.TetherEndpoint[message.endpoint] : message.endpoint; + object.endpoint = options.enums === String ? $root.google.cloud.apigeeconnect.v1.TetherEndpoint[message.endpoint] === undefined ? message.endpoint : $root.google.cloud.apigeeconnect.v1.TetherEndpoint[message.endpoint] : message.endpoint; if (message.project != null && message.hasOwnProperty("project")) object.project = message.project; if (message.traceId != null && message.hasOwnProperty("traceId")) @@ -1766,6 +1772,12 @@ message.streamInfo = $root.google.cloud.apigeeconnect.v1.StreamInfo.fromObject(object.streamInfo); } switch (object.action) { + default: + if (typeof object.action === "number") { + message.action = object.action; + break; + } + break; case "ACTION_UNSPECIFIED": case 0: message.action = 0; @@ -1802,7 +1814,7 @@ object.kind = "streamInfo"; } if (message.action != null && message.hasOwnProperty("action")) { - object.action = options.enums === String ? $root.google.cloud.apigeeconnect.v1.Action[message.action] : message.action; + object.action = options.enums === String ? $root.google.cloud.apigeeconnect.v1.Action[message.action] === undefined ? message.action : $root.google.cloud.apigeeconnect.v1.Action[message.action] : message.action; if (options.oneofs) object.kind = "action"; } @@ -2340,6 +2352,12 @@ if (object.traceId != null) message.traceId = String(object.traceId); switch (object.endpoint) { + default: + if (typeof object.endpoint === "number") { + message.endpoint = object.endpoint; + break; + } + break; case "TETHER_ENDPOINT_UNSPECIFIED": case 0: message.endpoint = 0; @@ -2395,7 +2413,7 @@ if (message.traceId != null && message.hasOwnProperty("traceId")) object.traceId = message.traceId; if (message.endpoint != null && message.hasOwnProperty("endpoint")) - object.endpoint = options.enums === String ? $root.google.cloud.apigeeconnect.v1.TetherEndpoint[message.endpoint] : message.endpoint; + object.endpoint = options.enums === String ? $root.google.cloud.apigeeconnect.v1.TetherEndpoint[message.endpoint] === undefined ? message.endpoint : $root.google.cloud.apigeeconnect.v1.TetherEndpoint[message.endpoint] : message.endpoint; if (message.name != null && message.hasOwnProperty("name")) object.name = message.name; return object; @@ -2985,6 +3003,12 @@ return object; var message = new $root.google.cloud.apigeeconnect.v1.Url(); switch (object.scheme) { + default: + if (typeof object.scheme === "number") { + message.scheme = object.scheme; + break; + } + break; case "SCHEME_UNSPECIFIED": case 0: message.scheme = 0; @@ -3020,7 +3044,7 @@ object.path = ""; } if (message.scheme != null && message.hasOwnProperty("scheme")) - object.scheme = options.enums === String ? $root.google.cloud.apigeeconnect.v1.Scheme[message.scheme] : message.scheme; + object.scheme = options.enums === String ? $root.google.cloud.apigeeconnect.v1.Scheme[message.scheme] === undefined ? message.scheme : $root.google.cloud.apigeeconnect.v1.Scheme[message.scheme] : message.scheme; if (message.host != null && message.hasOwnProperty("host")) object.host = message.host; if (message.path != null && message.hasOwnProperty("path")) @@ -4975,6 +4999,12 @@ if (object.nameField != null) message.nameField = String(object.nameField); switch (object.history) { + default: + if (typeof object.history === "number") { + message.history = object.history; + break; + } + break; case "HISTORY_UNSPECIFIED": case 0: message.history = 0; @@ -4999,6 +5029,10 @@ for (var i = 0; i < object.style.length; ++i) switch (object.style[i]) { default: + if (typeof object.style[i] === "number") { + message.style[i] = object.style[i]; + break; + } case "STYLE_UNSPECIFIED": case 0: message.style[i] = 0; @@ -5046,7 +5080,7 @@ if (message.nameField != null && message.hasOwnProperty("nameField")) object.nameField = message.nameField; if (message.history != null && message.hasOwnProperty("history")) - object.history = options.enums === String ? $root.google.api.ResourceDescriptor.History[message.history] : message.history; + object.history = options.enums === String ? $root.google.api.ResourceDescriptor.History[message.history] === undefined ? message.history : $root.google.api.ResourceDescriptor.History[message.history] : message.history; if (message.plural != null && message.hasOwnProperty("plural")) object.plural = message.plural; if (message.singular != null && message.hasOwnProperty("singular")) @@ -5054,7 +5088,7 @@ if (message.style && message.style.length) { object.style = []; for (var j = 0; j < message.style.length; ++j) - object.style[j] = options.enums === String ? $root.google.api.ResourceDescriptor.Style[message.style[j]] : message.style[j]; + object.style[j] = options.enums === String ? $root.google.api.ResourceDescriptor.Style[message.style[j]] === undefined ? message.style[j] : $root.google.api.ResourceDescriptor.Style[message.style[j]] : message.style[j]; } return object; }; @@ -7865,6 +7899,12 @@ if (object.number != null) message.number = object.number | 0; switch (object.label) { + default: + if (typeof object.label === "number") { + message.label = object.label; + break; + } + break; case "LABEL_OPTIONAL": case 1: message.label = 1; @@ -7879,6 +7919,12 @@ break; } switch (object.type) { + default: + if (typeof object.type === "number") { + message.type = object.type; + break; + } + break; case "TYPE_DOUBLE": case 1: message.type = 1; @@ -8005,9 +8051,9 @@ if (message.number != null && message.hasOwnProperty("number")) object.number = message.number; if (message.label != null && message.hasOwnProperty("label")) - object.label = options.enums === String ? $root.google.protobuf.FieldDescriptorProto.Label[message.label] : message.label; + object.label = options.enums === String ? $root.google.protobuf.FieldDescriptorProto.Label[message.label] === undefined ? message.label : $root.google.protobuf.FieldDescriptorProto.Label[message.label] : message.label; if (message.type != null && message.hasOwnProperty("type")) - object.type = options.enums === String ? $root.google.protobuf.FieldDescriptorProto.Type[message.type] : message.type; + object.type = options.enums === String ? $root.google.protobuf.FieldDescriptorProto.Type[message.type] === undefined ? message.type : $root.google.protobuf.FieldDescriptorProto.Type[message.type] : message.type; if (message.typeName != null && message.hasOwnProperty("typeName")) object.typeName = message.typeName; if (message.defaultValue != null && message.hasOwnProperty("defaultValue")) @@ -10354,6 +10400,12 @@ if (object.javaStringCheckUtf8 != null) message.javaStringCheckUtf8 = Boolean(object.javaStringCheckUtf8); switch (object.optimizeFor) { + default: + if (typeof object.optimizeFor === "number") { + message.optimizeFor = object.optimizeFor; + break; + } + break; case "SPEED": case 1: message.optimizeFor = 1; @@ -10462,7 +10514,7 @@ if (message.javaOuterClassname != null && message.hasOwnProperty("javaOuterClassname")) object.javaOuterClassname = message.javaOuterClassname; if (message.optimizeFor != null && message.hasOwnProperty("optimizeFor")) - object.optimizeFor = options.enums === String ? $root.google.protobuf.FileOptions.OptimizeMode[message.optimizeFor] : message.optimizeFor; + object.optimizeFor = options.enums === String ? $root.google.protobuf.FileOptions.OptimizeMode[message.optimizeFor] === undefined ? message.optimizeFor : $root.google.protobuf.FileOptions.OptimizeMode[message.optimizeFor] : message.optimizeFor; if (message.javaMultipleFiles != null && message.hasOwnProperty("javaMultipleFiles")) object.javaMultipleFiles = message.javaMultipleFiles; if (message.goPackage != null && message.hasOwnProperty("goPackage")) @@ -11264,6 +11316,12 @@ return object; var message = new $root.google.protobuf.FieldOptions(); switch (object.ctype) { + default: + if (typeof object.ctype === "number") { + message.ctype = object.ctype; + break; + } + break; case "STRING": case 0: message.ctype = 0; @@ -11280,6 +11338,12 @@ if (object.packed != null) message.packed = Boolean(object.packed); switch (object.jstype) { + default: + if (typeof object.jstype === "number") { + message.jstype = object.jstype; + break; + } + break; case "JS_NORMAL": case 0: message.jstype = 0; @@ -11318,6 +11382,10 @@ for (var i = 0; i < object[".google.api.fieldBehavior"].length; ++i) switch (object[".google.api.fieldBehavior"][i]) { default: + if (typeof object[".google.api.fieldBehavior"][i] === "number") { + message[".google.api.fieldBehavior"][i] = object[".google.api.fieldBehavior"][i]; + break; + } case "FIELD_BEHAVIOR_UNSPECIFIED": case 0: message[".google.api.fieldBehavior"][i] = 0; @@ -11388,7 +11456,7 @@ object[".google.api.resourceReference"] = null; } if (message.ctype != null && message.hasOwnProperty("ctype")) - object.ctype = options.enums === String ? $root.google.protobuf.FieldOptions.CType[message.ctype] : message.ctype; + object.ctype = options.enums === String ? $root.google.protobuf.FieldOptions.CType[message.ctype] === undefined ? message.ctype : $root.google.protobuf.FieldOptions.CType[message.ctype] : message.ctype; if (message.packed != null && message.hasOwnProperty("packed")) object.packed = message.packed; if (message.deprecated != null && message.hasOwnProperty("deprecated")) @@ -11396,7 +11464,7 @@ if (message.lazy != null && message.hasOwnProperty("lazy")) object.lazy = message.lazy; if (message.jstype != null && message.hasOwnProperty("jstype")) - object.jstype = options.enums === String ? $root.google.protobuf.FieldOptions.JSType[message.jstype] : message.jstype; + object.jstype = options.enums === String ? $root.google.protobuf.FieldOptions.JSType[message.jstype] === undefined ? message.jstype : $root.google.protobuf.FieldOptions.JSType[message.jstype] : message.jstype; if (message.weak != null && message.hasOwnProperty("weak")) object.weak = message.weak; if (message.unverifiedLazy != null && message.hasOwnProperty("unverifiedLazy")) @@ -11409,7 +11477,7 @@ if (message[".google.api.fieldBehavior"] && message[".google.api.fieldBehavior"].length) { object[".google.api.fieldBehavior"] = []; for (var j = 0; j < message[".google.api.fieldBehavior"].length; ++j) - object[".google.api.fieldBehavior"][j] = options.enums === String ? $root.google.api.FieldBehavior[message[".google.api.fieldBehavior"][j]] : message[".google.api.fieldBehavior"][j]; + object[".google.api.fieldBehavior"][j] = options.enums === String ? $root.google.api.FieldBehavior[message[".google.api.fieldBehavior"][j]] === undefined ? message[".google.api.fieldBehavior"][j] : $root.google.api.FieldBehavior[message[".google.api.fieldBehavior"][j]] : message[".google.api.fieldBehavior"][j]; } if (message[".google.api.resourceReference"] != null && message.hasOwnProperty(".google.api.resourceReference")) object[".google.api.resourceReference"] = $root.google.api.ResourceReference.toObject(message[".google.api.resourceReference"], options); @@ -12766,6 +12834,12 @@ if (object.deprecated != null) message.deprecated = Boolean(object.deprecated); switch (object.idempotencyLevel) { + default: + if (typeof object.idempotencyLevel === "number") { + message.idempotencyLevel = object.idempotencyLevel; + break; + } + break; case "IDEMPOTENCY_UNKNOWN": case 0: message.idempotencyLevel = 0; @@ -12829,7 +12903,7 @@ if (message.deprecated != null && message.hasOwnProperty("deprecated")) object.deprecated = message.deprecated; if (message.idempotencyLevel != null && message.hasOwnProperty("idempotencyLevel")) - object.idempotencyLevel = options.enums === String ? $root.google.protobuf.MethodOptions.IdempotencyLevel[message.idempotencyLevel] : message.idempotencyLevel; + object.idempotencyLevel = options.enums === String ? $root.google.protobuf.MethodOptions.IdempotencyLevel[message.idempotencyLevel] === undefined ? message.idempotencyLevel : $root.google.protobuf.MethodOptions.IdempotencyLevel[message.idempotencyLevel] : message.idempotencyLevel; if (message.uninterpretedOption && message.uninterpretedOption.length) { object.uninterpretedOption = []; for (var j = 0; j < message.uninterpretedOption.length; ++j) @@ -14582,6 +14656,12 @@ if (object.end != null) message.end = object.end | 0; switch (object.semantic) { + default: + if (typeof object.semantic === "number") { + message.semantic = object.semantic; + break; + } + break; case "NONE": case 0: message.semantic = 0; @@ -14631,7 +14711,7 @@ if (message.end != null && message.hasOwnProperty("end")) object.end = message.end; if (message.semantic != null && message.hasOwnProperty("semantic")) - object.semantic = options.enums === String ? $root.google.protobuf.GeneratedCodeInfo.Annotation.Semantic[message.semantic] : message.semantic; + object.semantic = options.enums === String ? $root.google.protobuf.GeneratedCodeInfo.Annotation.Semantic[message.semantic] === undefined ? message.semantic : $root.google.protobuf.GeneratedCodeInfo.Annotation.Semantic[message.semantic] : message.semantic; return object; }; From 83761a55e40e58a4a19403cdda0d140044c978bc Mon Sep 17 00:00:00 2001 From: Mend Renovate Date: Thu, 10 Nov 2022 14:14:17 +0100 Subject: [PATCH 62/63] chore(deps): update dependency jsdoc to v4 (#110) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit [![Mend Renovate](https://app.renovatebot.com/images/banner.svg)](https://renovatebot.com) This PR contains the following updates: | Package | Change | Age | Adoption | Passing | Confidence | |---|---|---|---|---|---| | [jsdoc](https://togithub.com/jsdoc/jsdoc) | [`^3.6.6` -> `^4.0.0`](https://renovatebot.com/diffs/npm/jsdoc/3.6.11/4.0.0) | [![age](https://badges.renovateapi.com/packages/npm/jsdoc/4.0.0/age-slim)](https://docs.renovatebot.com/merge-confidence/) | [![adoption](https://badges.renovateapi.com/packages/npm/jsdoc/4.0.0/adoption-slim)](https://docs.renovatebot.com/merge-confidence/) | [![passing](https://badges.renovateapi.com/packages/npm/jsdoc/4.0.0/compatibility-slim/3.6.11)](https://docs.renovatebot.com/merge-confidence/) | [![confidence](https://badges.renovateapi.com/packages/npm/jsdoc/4.0.0/confidence-slim/3.6.11)](https://docs.renovatebot.com/merge-confidence/) | --- ### Release Notes
jsdoc/jsdoc ### [`v4.0.0`](https://togithub.com/jsdoc/jsdoc/blob/HEAD/CHANGES.md#​400-November-2022) [Compare Source](https://togithub.com/jsdoc/jsdoc/compare/3.6.11...084218523a7d69fec14a852ce680f374f526af28) - JSDoc releases now use [semantic versioning](https://semver.org/). If JSDoc makes backwards-incompatible changes in the future, the major version will be incremented. - JSDoc no longer uses the [`taffydb`](https://taffydb.com/) package. If your JSDoc template or plugin uses the `taffydb` package, see the [instructions for replacing `taffydb` with `@jsdoc/salty`](https://togithub.com/jsdoc/jsdoc/tree/main/packages/jsdoc-salty#use-salty-in-a-jsdoc-template). - JSDoc now supports Node.js 12.0.0 and later.
--- ### Configuration 📅 **Schedule**: Branch creation - "after 9am and before 3pm" (UTC), Automerge - At any time (no schedule defined). 🚦 **Automerge**: Disabled by config. Please merge this manually once you are satisfied. ♻ **Rebasing**: Whenever PR is behind base branch, or you tick the rebase/retry checkbox. 🔕 **Ignore**: Close this PR and you won't be reminded about this update again. --- - [ ] If you want to rebase/retry this PR, check this box --- This PR has been generated by [Mend Renovate](https://www.mend.io/free-developer-tools/renovate/). View repository job log [here](https://app.renovatebot.com/dashboard#github/googleapis/nodejs-apigee-connect). --- packages/google-cloud-apigeeconnect/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index 067798cf4ff..c2a8a42f46c 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -47,7 +47,7 @@ "@types/sinon": "^10.0.0", "c8": "^7.7.2", "gts": "^3.1.0", - "jsdoc": "^3.6.6", + "jsdoc": "^4.0.0", "jsdoc-fresh": "^2.0.0", "jsdoc-region-tag": "^2.0.0", "linkinator": "^4.0.0", From a031f7a290115e1978f3c9ee508022e742ea7b6a Mon Sep 17 00:00:00 2001 From: "release-please[bot]" <55107282+release-please[bot]@users.noreply.github.com> Date: Fri, 11 Nov 2022 02:36:20 +0000 Subject: [PATCH 63/63] chore(main): release 2.1.3 (#102) :robot: I have created a release *beep* *boop* --- ## [2.1.3](https://togithub.com/googleapis/nodejs-apigee-connect/compare/v2.1.2...v2.1.3) (2022-11-10) ### Bug Fixes * **deps:** Use google-gax v3.5.2 ([#108](https://togithub.com/googleapis/nodejs-apigee-connect/issues/108)) ([2f8d882](https://togithub.com/googleapis/nodejs-apigee-connect/commit/2f8d882d3309b578d48e8838beeab5a52829963f)) * Preserve default values in x-goog-request-params header ([#101](https://togithub.com/googleapis/nodejs-apigee-connect/issues/101)) ([a88a102](https://togithub.com/googleapis/nodejs-apigee-connect/commit/a88a10218e6e3150495e1b47ae15b3895ed7ed5e)) * Regenerated protos JS and TS definitions ([#111](https://togithub.com/googleapis/nodejs-apigee-connect/issues/111)) ([5092ed8](https://togithub.com/googleapis/nodejs-apigee-connect/commit/5092ed8134687cd0fd3be3a47b6f1e88ed1b2444)) --- This PR was generated with [Release Please](https://togithub.com/googleapis/release-please). See [documentation](https://togithub.com/googleapis/release-please#release-please). --- packages/google-cloud-apigeeconnect/CHANGELOG.md | 9 +++++++++ packages/google-cloud-apigeeconnect/package.json | 2 +- .../snippet_metadata.google.cloud.apigeeconnect.v1.json | 2 +- packages/google-cloud-apigeeconnect/samples/package.json | 2 +- 4 files changed, 12 insertions(+), 3 deletions(-) diff --git a/packages/google-cloud-apigeeconnect/CHANGELOG.md b/packages/google-cloud-apigeeconnect/CHANGELOG.md index e5f2b42b21a..3dd282fd385 100644 --- a/packages/google-cloud-apigeeconnect/CHANGELOG.md +++ b/packages/google-cloud-apigeeconnect/CHANGELOG.md @@ -1,5 +1,14 @@ # Changelog +## [2.1.3](https://github.com/googleapis/nodejs-apigee-connect/compare/v2.1.2...v2.1.3) (2022-11-10) + + +### Bug Fixes + +* **deps:** Use google-gax v3.5.2 ([#108](https://github.com/googleapis/nodejs-apigee-connect/issues/108)) ([2f8d882](https://github.com/googleapis/nodejs-apigee-connect/commit/2f8d882d3309b578d48e8838beeab5a52829963f)) +* Preserve default values in x-goog-request-params header ([#101](https://github.com/googleapis/nodejs-apigee-connect/issues/101)) ([a88a102](https://github.com/googleapis/nodejs-apigee-connect/commit/a88a10218e6e3150495e1b47ae15b3895ed7ed5e)) +* Regenerated protos JS and TS definitions ([#111](https://github.com/googleapis/nodejs-apigee-connect/issues/111)) ([5092ed8](https://github.com/googleapis/nodejs-apigee-connect/commit/5092ed8134687cd0fd3be3a47b6f1e88ed1b2444)) + ## [2.1.2](https://github.com/googleapis/nodejs-apigee-connect/compare/v2.1.1...v2.1.2) (2022-09-01) diff --git a/packages/google-cloud-apigeeconnect/package.json b/packages/google-cloud-apigeeconnect/package.json index c2a8a42f46c..8c457006c6d 100644 --- a/packages/google-cloud-apigeeconnect/package.json +++ b/packages/google-cloud-apigeeconnect/package.json @@ -1,6 +1,6 @@ { "name": "@google-cloud/apigee-connect", - "version": "2.1.2", + "version": "2.1.3", "description": "apigeeconnect client for Node.js", "repository": "googleapis/nodejs-apigee-connect", "license": "Apache-2.0", diff --git a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json index 23dad0fb31f..fa51b96eb31 100644 --- a/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json +++ b/packages/google-cloud-apigeeconnect/samples/generated/v1/snippet_metadata.google.cloud.apigeeconnect.v1.json @@ -1,7 +1,7 @@ { "clientLibrary": { "name": "nodejs-apigeeconnect", - "version": "2.1.2", + "version": "2.1.3", "language": "TYPESCRIPT", "apis": [ { diff --git a/packages/google-cloud-apigeeconnect/samples/package.json b/packages/google-cloud-apigeeconnect/samples/package.json index 0efd636e236..11e784ae34b 100644 --- a/packages/google-cloud-apigeeconnect/samples/package.json +++ b/packages/google-cloud-apigeeconnect/samples/package.json @@ -13,7 +13,7 @@ "test": "c8 mocha --timeout 600000 test/*.js" }, "dependencies": { - "@google-cloud/apigee-connect": "^2.1.2" + "@google-cloud/apigee-connect": "^2.1.3" }, "devDependencies": { "c8": "^7.1.0",