diff --git a/build/Assert.sol b/build/Assert.sol index 995ae3dcbcf..d6ce450f881 100644 --- a/build/Assert.sol +++ b/build/Assert.sol @@ -111,12 +111,12 @@ library Assert { Returns: result (bool) - The result. */ - function equal(string A, string B, string message) constant returns (bool result) { - result = _stringsEqual(A, B); + function equal(string a, string b, string message) constant returns (bool result) { + result = _stringsEqual(a, b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -134,12 +134,12 @@ library Assert { Returns: result (bool) - The result. */ - function notEqual(string A, string B, string message) constant returns (bool result) { - result = !_stringsEqual(A, B); + function notEqual(string a, string b, string message) constant returns (bool result) { + result = !_stringsEqual(a, b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -203,8 +203,8 @@ library Assert { Returns: result (bool) - The result. */ - function equal(bytes32 A, bytes32 B, string message) constant returns (bool result) { - result = (A == B); + function equal(bytes32 a, bytes32 b, string message) constant returns (bool result) { + result = (a == b); _report(result, message); } @@ -223,8 +223,8 @@ library Assert { Returns: result (bool) - The result. */ - function notEqual(bytes32 A, bytes32 B, string message) constant returns (bool result) { - result = (A != B); + function notEqual(bytes32 a, bytes32 b, string message) constant returns (bool result) { + result = (a != b); _report(result, message); } @@ -283,8 +283,8 @@ library Assert { Returns: result (bool) - The result. */ - function equal(address A, address B, string message) constant returns (bool result) { - result = (A == B); + function equal(address a, address b, string message) constant returns (bool result) { + result = (a == b); _report(result, message); } /* @@ -302,8 +302,8 @@ library Assert { Returns: result (bool) - The result. */ - function notEqual(address A, address B, string message) constant returns (bool result) { - result = (A != B); + function notEqual(address a, address b, string message) constant returns (bool result) { + result = (a != b); _report(result, message); } @@ -400,12 +400,12 @@ library Assert { Returns: result (bool) - The result. */ - function equal(bool A, bool B, string message) constant returns (bool result) { - result = (A == B); + function equal(bool a, bool b, string message) constant returns (bool result) { + result = (a == b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -423,12 +423,12 @@ library Assert { Returns: result (bool) - The result. */ - function notEqual(bool A, bool B, string message) constant returns (bool result) { - result = (A != B); + function notEqual(bool a, bool b, string message) constant returns (bool result) { + result = (a != b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } // ************************************** uint ************************************** @@ -448,12 +448,12 @@ library Assert { Returns: result (bool) - The result. */ - function equal(uint A, uint B, string message) constant returns (bool result) { - result = (A == B); + function equal(uint a, uint b, string message) constant returns (bool result) { + result = (a == b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -471,12 +471,12 @@ library Assert { Returns: result (bool) - The result. */ - function notEqual(uint A, uint B, string message) constant returns (bool result) { - result = (A != B); + function notEqual(uint a, uint b, string message) constant returns (bool result) { + result = (a != b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -494,12 +494,12 @@ library Assert { Returns: result (bool) - The result. */ - function isAbove(uint A, uint B, string message) constant returns (bool result) { - result = (A > B); + function isAbove(uint a, uint b, string message) constant returns (bool result) { + result = (a > b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -517,12 +517,12 @@ library Assert { Returns: result (bool) - The result. */ - function isAtLeast(uint A, uint B, string message) constant returns (bool result) { - result = (A >= B); + function isAtLeast(uint a, uint b, string message) constant returns (bool result) { + result = (a >= b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -540,12 +540,12 @@ library Assert { Returns: result (bool) - The result. */ - function isBelow(uint A, uint B, string message) constant returns (bool result) { - result = (A < B); + function isBelow(uint a, uint b, string message) constant returns (bool result) { + result = (a < b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -563,12 +563,12 @@ library Assert { Returns: result (bool) - The result. */ - function isAtMost(uint A, uint B, string message) constant returns (bool result) { - result = (A <= B); + function isAtMost(uint a, uint b, string message) constant returns (bool result) { + result = (a <= b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -632,12 +632,12 @@ library Assert { Returns: result (bool) - The result. */ - function equal(int A, int B, string message) constant returns (bool result) { - result = (A == B); + function equal(int a, int b, string message) constant returns (bool result) { + result = (a == b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -655,12 +655,12 @@ library Assert { Returns: result (bool) - The result. */ - function notEqual(int A, int B, string message) constant returns (bool result) { - result = (A != B); + function notEqual(int a, int b, string message) constant returns (bool result) { + result = (a != b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -678,12 +678,12 @@ library Assert { Returns: result (bool) - The result. */ - function isAbove(int A, int B, string message) constant returns (bool result) { - result = (A > B); + function isAbove(int a, int b, string message) constant returns (bool result) { + result = (a > b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -701,12 +701,12 @@ library Assert { Returns: result (bool) - The result. */ - function isAtLeast(int A, int B, string message) constant returns (bool result) { - result = (A >= B); + function isAtLeast(int a, int b, string message) constant returns (bool result) { + result = (a >= b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -724,12 +724,12 @@ library Assert { Returns: result (bool) - The result. */ - function isBelow(int A, int B, string message) constant returns (bool result) { - result = (A < B); + function isBelow(int a, int b, string message) constant returns (bool result) { + result = (a < b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -747,12 +747,12 @@ library Assert { Returns: result (bool) - The result. */ - function isAtMost(int A, int B, string message) constant returns (bool result) { - result = (A <= B); + function isAtMost(int a, int b, string message) constant returns (bool result) { + result = (a <= b); if (result) _report(result, message); else - _report(result, _appendTagged(_tag(A, "Tested"), _tag(B, "Against"), message)); + _report(result, _appendTagged(_tag(a, "Tested"), _tag(b, "Against"), message)); } /* @@ -1264,8 +1264,8 @@ library Assert { Returns: result (bool) - The result. */ - function balanceEqual(address A, uint b, string message) constant returns (bool result) { - result = (A.balance == b); + function balanceEqual(address a, uint b, string message) constant returns (bool result) { + result = (a.balance == b); _report(result, message); } @@ -1284,8 +1284,8 @@ library Assert { Returns: result (bool) - The result. */ - function balanceNotEqual(address A, uint b, string message) constant returns (bool result) { - result = (A.balance != b); + function balanceNotEqual(address a, uint b, string message) constant returns (bool result) { + result = (a.balance != b); _report(result, message); } @@ -1303,8 +1303,8 @@ library Assert { Returns: result (bool) - The result. */ - function balanceIsZero(address A, string message) constant returns (bool result) { - result = (A.balance == 0); + function balanceIsZero(address a, string message) constant returns (bool result) { + result = (a.balance == 0); _report(result, message); } @@ -1322,8 +1322,8 @@ library Assert { Returns: result (bool) - The result. */ - function balanceIsNotZero(address A, string message) constant returns (bool result) { - result = (A.balance != 0); + function balanceIsNotZero(address a, string message) constant returns (bool result) { + result = (a.balance != 0); _report(result, message); } diff --git a/build/cli.bundled.js b/build/cli.bundled.js index 105466672aa..ddf23f93e61 100755 --- a/build/cli.bundled.js +++ b/build/cli.bundled.js @@ -64,7 +64,7 @@ /******/ __webpack_require__.p = ""; /******/ /******/ // Load entry module and return exports -/******/ return __webpack_require__(__webpack_require__.s = 1070); +/******/ return __webpack_require__(__webpack_require__.s = 1243); /******/ }) /************************************************************************/ /******/ ([ @@ -78,8 +78,8 @@ module.exports = require("path"); /***/ (function(module, exports, __webpack_require__) { var fs = __webpack_require__(2) -var polyfills = __webpack_require__(725) -var legacy = __webpack_require__(724) +var polyfills = __webpack_require__(894) +var legacy = __webpack_require__(893) var queue = [] var util = __webpack_require__(3) @@ -99,11 +99,11 @@ else if (/\bgfs4\b/i.test(process.env.NODE_DEBUG || '')) if (/\bgfs4\b/i.test(process.env.NODE_DEBUG || '')) { process.on('exit', function() { debug(queue) - __webpack_require__(9).equal(queue.length, 0) + __webpack_require__(11).equal(queue.length, 0) }) } -module.exports = patch(__webpack_require__(290)) +module.exports = patch(__webpack_require__(345)) if (process.env.TEST_GRACEFUL_FS_GLOBAL_PATCH) { module.exports = patch(fs) } @@ -1122,3975 +1122,4230 @@ module.exports = require("util"); /* 5 */ /***/ (function(module, exports, __webpack_require__) { -"use strict"; +;(function (root, factory) { + if (true) { + // CommonJS + module.exports = exports = factory(); + } + else if (typeof define === "function" && define.amd) { + // AMD + define([], factory); + } + else { + // Global (browser) + root.CryptoJS = factory(); + } +}(this, function () { -var es5 = __webpack_require__(82); -var canEvaluate = typeof navigator == "undefined"; + /** + * CryptoJS core components. + */ + var CryptoJS = CryptoJS || (function (Math, undefined) { + /* + * Local polyfil of Object.create + */ + var create = Object.create || (function () { + function F() {}; -var errorObj = {e: {}}; -var tryCatchTarget; -var globalObject = typeof self !== "undefined" ? self : - typeof window !== "undefined" ? window : - typeof global !== "undefined" ? global : - this !== undefined ? this : null; + return function (obj) { + var subtype; -function tryCatcher() { - try { - var target = tryCatchTarget; - tryCatchTarget = null; - return target.apply(this, arguments); - } catch (e) { - errorObj.e = e; - return errorObj; - } -} -function tryCatch(fn) { - tryCatchTarget = fn; - return tryCatcher; -} + F.prototype = obj; -var inherits = function(Child, Parent) { - var hasProp = {}.hasOwnProperty; + subtype = new F(); - function T() { - this.constructor = Child; - this.constructor$ = Parent; - for (var propertyName in Parent.prototype) { - if (hasProp.call(Parent.prototype, propertyName) && - propertyName.charAt(propertyName.length-1) !== "$" - ) { - this[propertyName + "$"] = Parent.prototype[propertyName]; - } - } - } - T.prototype = Parent.prototype; - Child.prototype = new T(); - return Child.prototype; -}; + F.prototype = null; + return subtype; + }; + }()) -function isPrimitive(val) { - return val == null || val === true || val === false || - typeof val === "string" || typeof val === "number"; + /** + * CryptoJS namespace. + */ + var C = {}; -} + /** + * Library namespace. + */ + var C_lib = C.lib = {}; -function isObject(value) { - return typeof value === "function" || - typeof value === "object" && value !== null; -} + /** + * Base object for prototypal inheritance. + */ + var Base = C_lib.Base = (function () { -function maybeWrapAsError(maybeError) { - if (!isPrimitive(maybeError)) return maybeError; - return new Error(safeToString(maybeError)); -} + return { + /** + * Creates a new object that inherits from this object. + * + * @param {Object} overrides Properties to copy into the new object. + * + * @return {Object} The new object. + * + * @static + * + * @example + * + * var MyType = CryptoJS.lib.Base.extend({ + * field: 'value', + * + * method: function () { + * } + * }); + */ + extend: function (overrides) { + // Spawn + var subtype = create(this); -function withAppended(target, appendee) { - var len = target.length; - var ret = new Array(len + 1); - var i; - for (i = 0; i < len; ++i) { - ret[i] = target[i]; - } - ret[i] = appendee; - return ret; -} + // Augment + if (overrides) { + subtype.mixIn(overrides); + } -function getDataPropertyOrDefault(obj, key, defaultValue) { - if (es5.isES5) { - var desc = Object.getOwnPropertyDescriptor(obj, key); + // Create default initializer + if (!subtype.hasOwnProperty('init') || this.init === subtype.init) { + subtype.init = function () { + subtype.$super.init.apply(this, arguments); + }; + } - if (desc != null) { - return desc.get == null && desc.set == null - ? desc.value - : defaultValue; - } - } else { - return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined; - } -} + // Initializer's prototype is the subtype object + subtype.init.prototype = subtype; -function notEnumerableProp(obj, name, value) { - if (isPrimitive(obj)) return obj; - var descriptor = { - value: value, - configurable: true, - enumerable: false, - writable: true - }; - es5.defineProperty(obj, name, descriptor); - return obj; -} + // Reference supertype + subtype.$super = this; -function thrower(r) { - throw r; -} + return subtype; + }, -var inheritedDataKeys = (function() { - var excludedPrototypes = [ - Array.prototype, - Object.prototype, - Function.prototype - ]; + /** + * Extends this object and runs the init method. + * Arguments to create() will be passed to init(). + * + * @return {Object} The new object. + * + * @static + * + * @example + * + * var instance = MyType.create(); + */ + create: function () { + var instance = this.extend(); + instance.init.apply(instance, arguments); - var isExcludedProto = function(val) { - for (var i = 0; i < excludedPrototypes.length; ++i) { - if (excludedPrototypes[i] === val) { - return true; - } - } - return false; - }; + return instance; + }, - if (es5.isES5) { - var getKeys = Object.getOwnPropertyNames; - return function(obj) { - var ret = []; - var visitedKeys = Object.create(null); - while (obj != null && !isExcludedProto(obj)) { - var keys; - try { - keys = getKeys(obj); - } catch (e) { - return ret; - } - for (var i = 0; i < keys.length; ++i) { - var key = keys[i]; - if (visitedKeys[key]) continue; - visitedKeys[key] = true; - var desc = Object.getOwnPropertyDescriptor(obj, key); - if (desc != null && desc.get == null && desc.set == null) { - ret.push(key); - } - } - obj = es5.getPrototypeOf(obj); - } - return ret; - }; - } else { - var hasProp = {}.hasOwnProperty; - return function(obj) { - if (isExcludedProto(obj)) return []; - var ret = []; + /** + * Initializes a newly created object. + * Override this method to add some logic when your objects are created. + * + * @example + * + * var MyType = CryptoJS.lib.Base.extend({ + * init: function () { + * // ... + * } + * }); + */ + init: function () { + }, - /*jshint forin:false */ - enumeration: for (var key in obj) { - if (hasProp.call(obj, key)) { - ret.push(key); - } else { - for (var i = 0; i < excludedPrototypes.length; ++i) { - if (hasProp.call(excludedPrototypes[i], key)) { - continue enumeration; - } - } - ret.push(key); - } - } - return ret; - }; - } + /** + * Copies properties into this object. + * + * @param {Object} properties The properties to mix in. + * + * @example + * + * MyType.mixIn({ + * field: 'value' + * }); + */ + mixIn: function (properties) { + for (var propertyName in properties) { + if (properties.hasOwnProperty(propertyName)) { + this[propertyName] = properties[propertyName]; + } + } -})(); + // IE won't copy toString using the loop above + if (properties.hasOwnProperty('toString')) { + this.toString = properties.toString; + } + }, -var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/; -function isClass(fn) { - try { - if (typeof fn === "function") { - var keys = es5.names(fn.prototype); + /** + * Creates a copy of this object. + * + * @return {Object} The clone. + * + * @example + * + * var clone = instance.clone(); + */ + clone: function () { + return this.init.prototype.extend(this); + } + }; + }()); - var hasMethods = es5.isES5 && keys.length > 1; - var hasMethodsOtherThanConstructor = keys.length > 0 && - !(keys.length === 1 && keys[0] === "constructor"); - var hasThisAssignmentAndStaticMethods = - thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0; + /** + * An array of 32-bit words. + * + * @property {Array} words The array of 32-bit words. + * @property {number} sigBytes The number of significant bytes in this word array. + */ + var WordArray = C_lib.WordArray = Base.extend({ + /** + * Initializes a newly created word array. + * + * @param {Array} words (Optional) An array of 32-bit words. + * @param {number} sigBytes (Optional) The number of significant bytes in the words. + * + * @example + * + * var wordArray = CryptoJS.lib.WordArray.create(); + * var wordArray = CryptoJS.lib.WordArray.create([0x00010203, 0x04050607]); + * var wordArray = CryptoJS.lib.WordArray.create([0x00010203, 0x04050607], 6); + */ + init: function (words, sigBytes) { + words = this.words = words || []; - if (hasMethods || hasMethodsOtherThanConstructor || - hasThisAssignmentAndStaticMethods) { - return true; - } - } - return false; - } catch (e) { - return false; - } -} + if (sigBytes != undefined) { + this.sigBytes = sigBytes; + } else { + this.sigBytes = words.length * 4; + } + }, -function toFastProperties(obj) { - /*jshint -W027,-W055,-W031*/ - function FakeConstructor() {} - FakeConstructor.prototype = obj; - var l = 8; - while (l--) new FakeConstructor(); - return obj; - eval(obj); -} + /** + * Converts this word array to a string. + * + * @param {Encoder} encoder (Optional) The encoding strategy to use. Default: CryptoJS.enc.Hex + * + * @return {string} The stringified word array. + * + * @example + * + * var string = wordArray + ''; + * var string = wordArray.toString(); + * var string = wordArray.toString(CryptoJS.enc.Utf8); + */ + toString: function (encoder) { + return (encoder || Hex).stringify(this); + }, -var rident = /^[a-z$_][a-z$_0-9]*$/i; -function isIdentifier(str) { - return rident.test(str); -} + /** + * Concatenates a word array to this word array. + * + * @param {WordArray} wordArray The word array to append. + * + * @return {WordArray} This word array. + * + * @example + * + * wordArray1.concat(wordArray2); + */ + concat: function (wordArray) { + // Shortcuts + var thisWords = this.words; + var thatWords = wordArray.words; + var thisSigBytes = this.sigBytes; + var thatSigBytes = wordArray.sigBytes; -function filledRange(count, prefix, suffix) { - var ret = new Array(count); - for(var i = 0; i < count; ++i) { - ret[i] = prefix + i + suffix; - } - return ret; -} + // Clamp excess bits + this.clamp(); -function safeToString(obj) { - try { - return obj + ""; - } catch (e) { - return "[no string representation]"; - } -} + // Concat + if (thisSigBytes % 4) { + // Copy one byte at a time + for (var i = 0; i < thatSigBytes; i++) { + var thatByte = (thatWords[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff; + thisWords[(thisSigBytes + i) >>> 2] |= thatByte << (24 - ((thisSigBytes + i) % 4) * 8); + } + } else { + // Copy one word at a time + for (var i = 0; i < thatSigBytes; i += 4) { + thisWords[(thisSigBytes + i) >>> 2] = thatWords[i >>> 2]; + } + } + this.sigBytes += thatSigBytes; -function isError(obj) { - return obj !== null && - typeof obj === "object" && - typeof obj.message === "string" && - typeof obj.name === "string"; -} + // Chainable + return this; + }, -function markAsOriginatingFromRejection(e) { - try { - notEnumerableProp(e, "isOperational", true); - } - catch(ignore) {} -} + /** + * Removes insignificant bits. + * + * @example + * + * wordArray.clamp(); + */ + clamp: function () { + // Shortcuts + var words = this.words; + var sigBytes = this.sigBytes; -function originatesFromRejection(e) { - if (e == null) return false; - return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) || - e["isOperational"] === true); -} + // Clamp + words[sigBytes >>> 2] &= 0xffffffff << (32 - (sigBytes % 4) * 8); + words.length = Math.ceil(sigBytes / 4); + }, -function canAttachTrace(obj) { - return isError(obj) && es5.propertyIsWritable(obj, "stack"); -} + /** + * Creates a copy of this word array. + * + * @return {WordArray} The clone. + * + * @example + * + * var clone = wordArray.clone(); + */ + clone: function () { + var clone = Base.clone.call(this); + clone.words = this.words.slice(0); -var ensureErrorObject = (function() { - if (!("stack" in new Error())) { - return function(value) { - if (canAttachTrace(value)) return value; - try {throw new Error(safeToString(value));} - catch(err) {return err;} - }; - } else { - return function(value) { - if (canAttachTrace(value)) return value; - return new Error(safeToString(value)); - }; - } -})(); + return clone; + }, -function classString(obj) { - return {}.toString.call(obj); -} + /** + * Creates a word array filled with random bytes. + * + * @param {number} nBytes The number of random bytes to generate. + * + * @return {WordArray} The random word array. + * + * @static + * + * @example + * + * var wordArray = CryptoJS.lib.WordArray.random(16); + */ + random: function (nBytes) { + var words = []; -function copyDescriptors(from, to, filter) { - var keys = es5.names(from); - for (var i = 0; i < keys.length; ++i) { - var key = keys[i]; - if (filter(key)) { - try { - es5.defineProperty(to, key, es5.getDescriptor(from, key)); - } catch (ignore) {} - } - } -} + var r = (function (m_w) { + var m_w = m_w; + var m_z = 0x3ade68b1; + var mask = 0xffffffff; -var asArray = function(v) { - if (es5.isArray(v)) { - return v; - } - return null; -}; + return function () { + m_z = (0x9069 * (m_z & 0xFFFF) + (m_z >> 0x10)) & mask; + m_w = (0x4650 * (m_w & 0xFFFF) + (m_w >> 0x10)) & mask; + var result = ((m_z << 0x10) + m_w) & mask; + result /= 0x100000000; + result += 0.5; + return result * (Math.random() > .5 ? 1 : -1); + } + }); -if (typeof Symbol !== "undefined" && Symbol.iterator) { - var ArrayFrom = typeof Array.from === "function" ? function(v) { - return Array.from(v); - } : function(v) { - var ret = []; - var it = v[Symbol.iterator](); - var itResult; - while (!((itResult = it.next()).done)) { - ret.push(itResult.value); - } - return ret; - }; + for (var i = 0, rcache; i < nBytes; i += 4) { + var _r = r((rcache || Math.random()) * 0x100000000); - asArray = function(v) { - if (es5.isArray(v)) { - return v; - } else if (v != null && typeof v[Symbol.iterator] === "function") { - return ArrayFrom(v); - } - return null; - }; -} + rcache = _r() * 0x3ade67b7; + words.push((_r() * 0x100000000) | 0); + } -var isNode = typeof process !== "undefined" && - classString(process).toLowerCase() === "[object process]"; + return new WordArray.init(words, nBytes); + } + }); -var hasEnvVariables = typeof process !== "undefined" && - typeof process.env !== "undefined"; + /** + * Encoder namespace. + */ + var C_enc = C.enc = {}; -function env(key) { - return hasEnvVariables ? process.env[key] : undefined; -} + /** + * Hex encoding strategy. + */ + var Hex = C_enc.Hex = { + /** + * Converts a word array to a hex string. + * + * @param {WordArray} wordArray The word array. + * + * @return {string} The hex string. + * + * @static + * + * @example + * + * var hexString = CryptoJS.enc.Hex.stringify(wordArray); + */ + stringify: function (wordArray) { + // Shortcuts + var words = wordArray.words; + var sigBytes = wordArray.sigBytes; -function getNativePromise() { - if (typeof Promise === "function") { - try { - var promise = new Promise(function(){}); - if ({}.toString.call(promise) === "[object Promise]") { - return Promise; - } - } catch (e) {} - } -} + // Convert + var hexChars = []; + for (var i = 0; i < sigBytes; i++) { + var bite = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff; + hexChars.push((bite >>> 4).toString(16)); + hexChars.push((bite & 0x0f).toString(16)); + } -function domainBind(self, cb) { - return self.bind(cb); -} + return hexChars.join(''); + }, -var ret = { - isClass: isClass, - isIdentifier: isIdentifier, - inheritedDataKeys: inheritedDataKeys, - getDataPropertyOrDefault: getDataPropertyOrDefault, - thrower: thrower, - isArray: es5.isArray, - asArray: asArray, - notEnumerableProp: notEnumerableProp, - isPrimitive: isPrimitive, - isObject: isObject, - isError: isError, - canEvaluate: canEvaluate, - errorObj: errorObj, - tryCatch: tryCatch, - inherits: inherits, - withAppended: withAppended, - maybeWrapAsError: maybeWrapAsError, - toFastProperties: toFastProperties, - filledRange: filledRange, - toString: safeToString, - canAttachTrace: canAttachTrace, - ensureErrorObject: ensureErrorObject, - originatesFromRejection: originatesFromRejection, - markAsOriginatingFromRejection: markAsOriginatingFromRejection, - classString: classString, - copyDescriptors: copyDescriptors, - hasDevTools: typeof chrome !== "undefined" && chrome && - typeof chrome.loadTimes === "function", - isNode: isNode, - hasEnvVariables: hasEnvVariables, - env: env, - global: globalObject, - getNativePromise: getNativePromise, - domainBind: domainBind -}; -ret.isRecentNode = ret.isNode && (function() { - var version = process.versions.node.split(".").map(Number); - return (version[0] === 0 && version[1] > 10) || (version[0] > 0); -})(); + /** + * Converts a hex string to a word array. + * + * @param {string} hexStr The hex string. + * + * @return {WordArray} The word array. + * + * @static + * + * @example + * + * var wordArray = CryptoJS.enc.Hex.parse(hexString); + */ + parse: function (hexStr) { + // Shortcut + var hexStrLength = hexStr.length; -if (ret.isNode) ret.toFastProperties(process); + // Convert + var words = []; + for (var i = 0; i < hexStrLength; i += 2) { + words[i >>> 3] |= parseInt(hexStr.substr(i, 2), 16) << (24 - (i % 8) * 4); + } -try {throw new Error(); } catch (e) {ret.lastLineError = e;} -module.exports = ret; + return new WordArray.init(words, hexStrLength / 2); + } + }; + /** + * Latin1 encoding strategy. + */ + var Latin1 = C_enc.Latin1 = { + /** + * Converts a word array to a Latin1 string. + * + * @param {WordArray} wordArray The word array. + * + * @return {string} The Latin1 string. + * + * @static + * + * @example + * + * var latin1String = CryptoJS.enc.Latin1.stringify(wordArray); + */ + stringify: function (wordArray) { + // Shortcuts + var words = wordArray.words; + var sigBytes = wordArray.sigBytes; -/***/ }), -/* 6 */ -/***/ (function(module, exports) { + // Convert + var latin1Chars = []; + for (var i = 0; i < sigBytes; i++) { + var bite = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff; + latin1Chars.push(String.fromCharCode(bite)); + } -module.exports = require("crypto"); + return latin1Chars.join(''); + }, -/***/ }), -/* 7 */ -/***/ (function(module, exports) { + /** + * Converts a Latin1 string to a word array. + * + * @param {string} latin1Str The Latin1 string. + * + * @return {WordArray} The word array. + * + * @static + * + * @example + * + * var wordArray = CryptoJS.enc.Latin1.parse(latin1String); + */ + parse: function (latin1Str) { + // Shortcut + var latin1StrLength = latin1Str.length; -module.exports = require("url"); + // Convert + var words = []; + for (var i = 0; i < latin1StrLength; i++) { + words[i >>> 2] |= (latin1Str.charCodeAt(i) & 0xff) << (24 - (i % 4) * 8); + } -/***/ }), -/* 8 */ -/***/ (function(module, exports, __webpack_require__) { + return new WordArray.init(words, latin1StrLength); + } + }; -/* WEBPACK VAR INJECTION */(function(module) {var fs = __webpack_require__(2); -var _ = __webpack_require__(23); -var path = __webpack_require__(0); -var Provider = __webpack_require__(1036); -var TruffleError = __webpack_require__(27); -var Module = __webpack_require__(412); -var findUp = __webpack_require__(1034); -var originalrequire = __webpack_require__(413); + /** + * UTF-8 encoding strategy. + */ + var Utf8 = C_enc.Utf8 = { + /** + * Converts a word array to a UTF-8 string. + * + * @param {WordArray} wordArray The word array. + * + * @return {string} The UTF-8 string. + * + * @static + * + * @example + * + * var utf8String = CryptoJS.enc.Utf8.stringify(wordArray); + */ + stringify: function (wordArray) { + try { + return decodeURIComponent(escape(Latin1.stringify(wordArray))); + } catch (e) { + throw new Error('Malformed UTF-8 data'); + } + }, -var DEFAULT_CONFIG_FILENAME = "truffle.js"; -var BACKUP_CONFIG_FILENAME = "truffle-config.js"; // For Windows + Command Prompt + /** + * Converts a UTF-8 string to a word array. + * + * @param {string} utf8Str The UTF-8 string. + * + * @return {WordArray} The word array. + * + * @static + * + * @example + * + * var wordArray = CryptoJS.enc.Utf8.parse(utf8String); + */ + parse: function (utf8Str) { + return Latin1.parse(unescape(encodeURIComponent(utf8Str))); + } + }; -function Config(truffle_directory, working_directory, network) { - var self = this; + /** + * Abstract buffered block algorithm template. + * + * The property blockSize must be implemented in a concrete subtype. + * + * @property {number} _minBufferSize The number of blocks that should be kept unprocessed in the buffer. Default: 0 + */ + var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm = Base.extend({ + /** + * Resets this block algorithm's data buffer to its initial state. + * + * @example + * + * bufferedBlockAlgorithm.reset(); + */ + reset: function () { + // Initial values + this._data = new WordArray.init(); + this._nDataBytes = 0; + }, - var default_tx_values = { - gas: 4712388, - gasPrice: 100000000000, // 100 Shannon, - from: null - }; + /** + * Adds new data to this block algorithm's buffer. + * + * @param {WordArray|string} data The data to append. Strings are converted to a WordArray using UTF-8. + * + * @example + * + * bufferedBlockAlgorithm._append('data'); + * bufferedBlockAlgorithm._append(wordArray); + */ + _append: function (data) { + // Convert string to WordArray, else assume WordArray already + if (typeof data == 'string') { + data = Utf8.parse(data); + } - this._values = { - truffle_directory: truffle_directory || path.resolve(path.join(__dirname, "../")), - working_directory: working_directory || process.cwd(), - network: network, - networks: {}, - verboseRpc: false, - gas: null, - gasPrice: null, - from: null, - build: null, - resolver: null, - artifactor: null, - ethpm: { - ipfs_host: "ipfs.infura.io", - ipfs_protocol: "https", - registry: "0x8011df4830b4f696cd81393997e5371b93338878", - install_provider_uri: "https://ropsten.infura.io/truffle" - }, - solc: { - optimizer: { - enabled: true, - runs: 200 - } - }, - logger: { - log: function() {}, - } - }; + // Append + this._data.concat(data); + this._nDataBytes += data.sigBytes; + }, - var props = { - // These are already set. - truffle_directory: function() {}, - working_directory: function() {}, - network: function() {}, - networks: function() {}, - verboseRpc: function() {}, - build: function() {}, - resolver: function() {}, - artifactor: function() {}, - ethpm: function() {}, - solc: function() {}, - logger: function() {}, + /** + * Processes available data blocks. + * + * This method invokes _doProcessBlock(offset), which must be implemented by a concrete subtype. + * + * @param {boolean} doFlush Whether all blocks and partial blocks should be processed. + * + * @return {WordArray} The processed data. + * + * @example + * + * var processedData = bufferedBlockAlgorithm._process(); + * var processedData = bufferedBlockAlgorithm._process(!!'flush'); + */ + _process: function (doFlush) { + // Shortcuts + var data = this._data; + var dataWords = data.words; + var dataSigBytes = data.sigBytes; + var blockSize = this.blockSize; + var blockSizeBytes = blockSize * 4; - build_directory: function() { - return path.join(self.working_directory, "build"); - }, - contracts_directory: function() { - return path.join(self.working_directory, "contracts"); - }, - contracts_build_directory: function() { - return path.join(self.build_directory, "contracts"); - }, - migrations_directory: function() { - return path.join(self.working_directory, "migrations"); - }, - test_directory: function() { - return path.join(self.working_directory, "test"); - }, - test_file_extension_regexp: function() { - return /.*\.(js|es|es6|jsx|sol)$/ - }, - example_project_directory: function() { - return path.join(self.truffle_directory, "example"); - }, - network_id: { - get: function() { - try { - return self.network_config.network_id; - } catch (e) { - return null; - } - }, - set: function(val) { - throw new Error("Do not set config.network_id. Instead, set config.networks and then config.networks[].network_id"); - } - }, - network_config: { - get: function() { - var network = self.network; + // Count blocks ready + var nBlocksReady = dataSigBytes / blockSizeBytes; + if (doFlush) { + // Round up to include partial blocks + nBlocksReady = Math.ceil(nBlocksReady); + } else { + // Round down to include only full blocks, + // less the number of blocks that must remain in the buffer + nBlocksReady = Math.max((nBlocksReady | 0) - this._minBufferSize, 0); + } - if (network == null) { - throw new Error("Network not set. Cannot determine network to use."); - } + // Count words ready + var nWordsReady = nBlocksReady * blockSize; - var conf = self.networks[network]; + // Count bytes ready + var nBytesReady = Math.min(nWordsReady * 4, dataSigBytes); - if (conf == null) { - config = {}; - } + // Process blocks + if (nWordsReady) { + for (var offset = 0; offset < nWordsReady; offset += blockSize) { + // Perform concrete-algorithm logic + this._doProcessBlock(dataWords, offset); + } - conf = _.extend({}, default_tx_values, conf); + // Remove processed words + var processedWords = dataWords.splice(0, nWordsReady); + data.sigBytes -= nBytesReady; + } - return conf; - }, - set: function(val) { - throw new Error("Don't set config.network_config. Instead, set config.networks with the desired values."); - } - }, - from: { - get: function() { - try { - return self.network_config.from; - } catch (e) { - return default_tx_values.from; - } - }, - set: function(val) { - throw new Error("Don't set config.from directly. Instead, set config.networks and then config.networks[].from") - } - }, - gas: { - get: function() { - try { - return self.network_config.gas; - } catch (e) { - return default_tx_values.gas; - } - }, - set: function(val) { - throw new Error("Don't set config.gas directly. Instead, set config.networks and then config.networks[].gas") - } - }, - gasPrice: { - get: function() { - try { - return self.network_config.gasPrice; - } catch (e) { - return default_tx_values.gasPrice; - } - }, - set: function(val) { - throw new Error("Don't set config.gasPrice directly. Instead, set config.networks and then config.networks[].gasPrice") - } - }, - provider: { - get: function() { - if (!self.network) { - return null; - } + // Return processed words + return new WordArray.init(processedWords, nBytesReady); + }, - var options = self.network_config; - options.verboseRpc = self.verboseRpc; - return Provider.create(options); - }, - set: function(val) { - throw new Error("Don't set config.provider directly. Instead, set config.networks and then set config.networks[].provider") - } - } - }; - - Object.keys(props).forEach(function(prop) { - self.addProp(prop, props[prop]); - }); -}; - -Config.prototype.addProp = function(key, obj) { - Object.defineProperty(this, key, { - get: obj.get || function() { - return this._values[key] || obj(); - }, - set: obj.set || function(val) { - this._values[key] = val; - }, - configurable: true, - enumerable: true - }); -}; + /** + * Creates a copy of this object. + * + * @return {Object} The clone. + * + * @example + * + * var clone = bufferedBlockAlgorithm.clone(); + */ + clone: function () { + var clone = Base.clone.call(this); + clone._data = this._data.clone(); -Config.prototype.normalize = function(obj) { - var clone = {}; - Object.keys(obj).forEach(function(key) { - try { - clone[key] = obj[key]; - } catch (e) { - // Do nothing with values that throw. - } - }); - return clone; -} + return clone; + }, -Config.prototype.with = function(obj) { - var normalized = this.normalize(obj); - var current = this.normalize(this); + _minBufferSize: 0 + }); - return _.extend({}, current, normalized); -}; + /** + * Abstract hasher template. + * + * @property {number} blockSize The number of 32-bit words this hasher operates on. Default: 16 (512 bits) + */ + var Hasher = C_lib.Hasher = BufferedBlockAlgorithm.extend({ + /** + * Configuration options. + */ + cfg: Base.extend(), -Config.prototype.merge = function(obj) { - var self = this; - var clone = this.normalize(obj); + /** + * Initializes a newly created hasher. + * + * @param {Object} cfg (Optional) The configuration options to use for this hash computation. + * + * @example + * + * var hasher = CryptoJS.algo.SHA256.create(); + */ + init: function (cfg) { + // Apply config defaults + this.cfg = this.cfg.extend(cfg); - // Only set keys for values that don't throw. - Object.keys(obj).forEach(function(key) { - try { - self[key] = clone[key]; - } catch (e) { - // Do nothing. - } - }); + // Set initial values + this.reset(); + }, - return this; -}; + /** + * Resets this hasher to its initial state. + * + * @example + * + * hasher.reset(); + */ + reset: function () { + // Reset data buffer + BufferedBlockAlgorithm.reset.call(this); -Config.default = function() { - return new Config(); -}; + // Perform concrete-hasher logic + this._doReset(); + }, -Config.detect = function(options, filename) { - // Only attempt to detect the backup if a specific file wasn't asked for. - var checkBackup = false; + /** + * Updates this hasher with a message. + * + * @param {WordArray|string} messageUpdate The message to append. + * + * @return {Hasher} This hasher. + * + * @example + * + * hasher.update('message'); + * hasher.update(wordArray); + */ + update: function (messageUpdate) { + // Append + this._append(messageUpdate); - if (filename == null) { - filename = DEFAULT_CONFIG_FILENAME; - checkBackup = true; - } + // Update the hash + this._process(); - var file = findUp.sync(filename, {cwd: options.working_directory || options.workingDirectory}); + // Chainable + return this; + }, - if (file == null) { - if (checkBackup == true) { - return this.detect(options, BACKUP_CONFIG_FILENAME); - } else { - throw new TruffleError("Could not find suitable configuration file."); - } - } + /** + * Finalizes the hash computation. + * Note that the finalize operation is effectively a destructive, read-once operation. + * + * @param {WordArray|string} messageUpdate (Optional) A final message update. + * + * @return {WordArray} The hash. + * + * @example + * + * var hash = hasher.finalize(); + * var hash = hasher.finalize('message'); + * var hash = hasher.finalize(wordArray); + */ + finalize: function (messageUpdate) { + // Final message update + if (messageUpdate) { + this._append(messageUpdate); + } - return this.load(file, options); -}; + // Perform concrete-hasher logic + var hash = this._doFinalize(); -Config.load = function(file, options) { - var config = new Config(); + return hash; + }, - config.working_directory = path.dirname(path.resolve(file)); + blockSize: 512/32, - // The require-nocache module used to do this for us, but - // it doesn't bundle very well. So we've pulled it out ourselves. - delete __webpack_require__.c[Module._resolveFilename(file, module)]; - var static_config = originalrequire(file); + /** + * Creates a shortcut function to a hasher's object interface. + * + * @param {Hasher} hasher The hasher to create a helper for. + * + * @return {Function} The shortcut function. + * + * @static + * + * @example + * + * var SHA256 = CryptoJS.lib.Hasher._createHelper(CryptoJS.algo.SHA256); + */ + _createHelper: function (hasher) { + return function (message, cfg) { + return new hasher.init(cfg).finalize(message); + }; + }, - config.merge(static_config); - config.merge(options); + /** + * Creates a shortcut function to the HMAC's object interface. + * + * @param {Hasher} hasher The hasher to use in this HMAC helper. + * + * @return {Function} The shortcut function. + * + * @static + * + * @example + * + * var HmacSHA256 = CryptoJS.lib.Hasher._createHmacHelper(CryptoJS.algo.SHA256); + */ + _createHmacHelper: function (hasher) { + return function (message, key) { + return new C_algo.HMAC.init(hasher, key).finalize(message); + }; + } + }); - return config; -}; + /** + * Algorithm namespace. + */ + var C_algo = C.algo = {}; -module.exports = Config; + return C; + }(Math)); -/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(26)(module))) -/***/ }), -/* 9 */ -/***/ (function(module, exports) { + return CryptoJS; -module.exports = require("assert"); +})); /***/ }), -/* 10 */ +/* 6 */ /***/ (function(module, exports, __webpack_require__) { -// Copyright (c) 2012, Mark Cavage. All rights reserved. -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(9); -var Stream = __webpack_require__(17).Stream; -var util = __webpack_require__(3); - - -///--- Globals - -/* JSSTYLED */ -var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; - +;(function (root, factory) { + if (true) { + // CommonJS + module.exports = exports = factory(); + } + else if (typeof define === "function" && define.amd) { + // AMD + define([], factory); + } + else { + // Global (browser) + root.CryptoJS = factory(); + } +}(this, function () { -///--- Internal + /** + * CryptoJS core components. + */ + var CryptoJS = CryptoJS || (function (Math, undefined) { + /* + * Local polyfil of Object.create + */ + var create = Object.create || (function () { + function F() {}; -function _capitalize(str) { - return (str.charAt(0).toUpperCase() + str.slice(1)); -} + return function (obj) { + var subtype; -function _toss(name, expected, oper, arg, actual) { - throw new assert.AssertionError({ - message: util.format('%s (%s) is required', name, expected), - actual: (actual === undefined) ? typeof (arg) : actual(arg), - expected: expected, - operator: oper || '===', - stackStartFunction: _toss.caller - }); -} + F.prototype = obj; -function _getClass(arg) { - return (Object.prototype.toString.call(arg).slice(8, -1)); -} + subtype = new F(); -function noop() { - // Why even bother with asserts? -} + F.prototype = null; + return subtype; + }; + }()) -///--- Exports + /** + * CryptoJS namespace. + */ + var C = {}; -var types = { - bool: { - check: function (arg) { return typeof (arg) === 'boolean'; } - }, - func: { - check: function (arg) { return typeof (arg) === 'function'; } - }, - string: { - check: function (arg) { return typeof (arg) === 'string'; } - }, - object: { - check: function (arg) { - return typeof (arg) === 'object' && arg !== null; - } - }, - number: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg); - } - }, - finite: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); - } - }, - buffer: { - check: function (arg) { return Buffer.isBuffer(arg); }, - operator: 'Buffer.isBuffer' - }, - array: { - check: function (arg) { return Array.isArray(arg); }, - operator: 'Array.isArray' - }, - stream: { - check: function (arg) { return arg instanceof Stream; }, - operator: 'instanceof', - actual: _getClass - }, - date: { - check: function (arg) { return arg instanceof Date; }, - operator: 'instanceof', - actual: _getClass - }, - regexp: { - check: function (arg) { return arg instanceof RegExp; }, - operator: 'instanceof', - actual: _getClass - }, - uuid: { - check: function (arg) { - return typeof (arg) === 'string' && UUID_REGEXP.test(arg); - }, - operator: 'isUUID' - } -}; + /** + * Library namespace. + */ + var C_lib = C.lib = {}; -function _setExports(ndebug) { - var keys = Object.keys(types); - var out; + /** + * Base object for prototypal inheritance. + */ + var Base = C_lib.Base = (function () { - /* re-export standard assert */ - if (process.env.NODE_NDEBUG) { - out = noop; - } else { - out = function (arg, msg) { - if (!arg) { - _toss(msg, 'true', arg); - } - }; - } - /* standard checks */ - keys.forEach(function (k) { - if (ndebug) { - out[k] = noop; - return; - } - var type = types[k]; - out[k] = function (arg, msg) { - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); + return { + /** + * Creates a new object that inherits from this object. + * + * @param {Object} overrides Properties to copy into the new object. + * + * @return {Object} The new object. + * + * @static + * + * @example + * + * var MyType = CryptoJS.lib.Base.extend({ + * field: 'value', + * + * method: function () { + * } + * }); + */ + extend: function (overrides) { + // Spawn + var subtype = create(this); - /* optional checks */ - keys.forEach(function (k) { - var name = 'optional' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); + // Augment + if (overrides) { + subtype.mixIn(overrides); + } - /* arrayOf checks */ - keys.forEach(function (k) { - var name = 'arrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); + // Create default initializer + if (!subtype.hasOwnProperty('init') || this.init === subtype.init) { + subtype.init = function () { + subtype.$super.init.apply(this, arguments); + }; + } - /* optionalArrayOf checks */ - keys.forEach(function (k) { - var name = 'optionalArrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); + // Initializer's prototype is the subtype object + subtype.init.prototype = subtype; - /* re-export built-in assertions */ - Object.keys(assert).forEach(function (k) { - if (k === 'AssertionError') { - out[k] = assert[k]; - return; - } - if (ndebug) { - out[k] = noop; - return; - } - out[k] = assert[k]; - }); + // Reference supertype + subtype.$super = this; - /* export ourselves (for unit tests _only_) */ - out._setExports = _setExports; + return subtype; + }, - return out; -} + /** + * Extends this object and runs the init method. + * Arguments to create() will be passed to init(). + * + * @return {Object} The new object. + * + * @static + * + * @example + * + * var instance = MyType.create(); + */ + create: function () { + var instance = this.extend(); + instance.init.apply(instance, arguments); -module.exports = _setExports(process.env.NODE_NDEBUG); + return instance; + }, + /** + * Initializes a newly created object. + * Override this method to add some logic when your objects are created. + * + * @example + * + * var MyType = CryptoJS.lib.Base.extend({ + * init: function () { + * // ... + * } + * }); + */ + init: function () { + }, -/***/ }), -/* 11 */ -/***/ (function(module, exports, __webpack_require__) { + /** + * Copies properties into this object. + * + * @param {Object} properties The properties to mix in. + * + * @example + * + * MyType.mixIn({ + * field: 'value' + * }); + */ + mixIn: function (properties) { + for (var propertyName in properties) { + if (properties.hasOwnProperty(propertyName)) { + this[propertyName] = properties[propertyName]; + } + } -;(function (root, factory) { - if (true) { - // CommonJS - module.exports = exports = factory(__webpack_require__(4)); - } - else if (typeof define === "function" && define.amd) { - // AMD - define(["./core"], factory); - } - else { - // Global (browser) - factory(root.CryptoJS); - } -}(this, function (CryptoJS) { + // IE won't copy toString using the loop above + if (properties.hasOwnProperty('toString')) { + this.toString = properties.toString; + } + }, - /** - * Cipher core components. - */ - CryptoJS.lib.Cipher || (function (undefined) { - // Shortcuts - var C = CryptoJS; - var C_lib = C.lib; - var Base = C_lib.Base; - var WordArray = C_lib.WordArray; - var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm; - var C_enc = C.enc; - var Utf8 = C_enc.Utf8; - var Base64 = C_enc.Base64; - var C_algo = C.algo; - var EvpKDF = C_algo.EvpKDF; + /** + * Creates a copy of this object. + * + * @return {Object} The clone. + * + * @example + * + * var clone = instance.clone(); + */ + clone: function () { + return this.init.prototype.extend(this); + } + }; + }()); /** - * Abstract base cipher template. + * An array of 32-bit words. * - * @property {number} keySize This cipher's key size. Default: 4 (128 bits) - * @property {number} ivSize This cipher's IV size. Default: 4 (128 bits) - * @property {number} _ENC_XFORM_MODE A constant representing encryption mode. - * @property {number} _DEC_XFORM_MODE A constant representing decryption mode. + * @property {Array} words The array of 32-bit words. + * @property {number} sigBytes The number of significant bytes in this word array. */ - var Cipher = C_lib.Cipher = BufferedBlockAlgorithm.extend({ - /** - * Configuration options. - * - * @property {WordArray} iv The IV to use for this operation. - */ - cfg: Base.extend(), - + var WordArray = C_lib.WordArray = Base.extend({ /** - * Creates this cipher in encryption mode. - * - * @param {WordArray} key The key. - * @param {Object} cfg (Optional) The configuration options to use for this operation. - * - * @return {Cipher} A cipher instance. + * Initializes a newly created word array. * - * @static + * @param {Array} words (Optional) An array of 32-bit words. + * @param {number} sigBytes (Optional) The number of significant bytes in the words. * * @example * - * var cipher = CryptoJS.algo.AES.createEncryptor(keyWordArray, { iv: ivWordArray }); + * var wordArray = CryptoJS.lib.WordArray.create(); + * var wordArray = CryptoJS.lib.WordArray.create([0x00010203, 0x04050607]); + * var wordArray = CryptoJS.lib.WordArray.create([0x00010203, 0x04050607], 6); */ - createEncryptor: function (key, cfg) { - return this.create(this._ENC_XFORM_MODE, key, cfg); + init: function (words, sigBytes) { + words = this.words = words || []; + + if (sigBytes != undefined) { + this.sigBytes = sigBytes; + } else { + this.sigBytes = words.length * 4; + } }, /** - * Creates this cipher in decryption mode. - * - * @param {WordArray} key The key. - * @param {Object} cfg (Optional) The configuration options to use for this operation. + * Converts this word array to a string. * - * @return {Cipher} A cipher instance. + * @param {Encoder} encoder (Optional) The encoding strategy to use. Default: CryptoJS.enc.Hex * - * @static + * @return {string} The stringified word array. * * @example * - * var cipher = CryptoJS.algo.AES.createDecryptor(keyWordArray, { iv: ivWordArray }); + * var string = wordArray + ''; + * var string = wordArray.toString(); + * var string = wordArray.toString(CryptoJS.enc.Utf8); */ - createDecryptor: function (key, cfg) { - return this.create(this._DEC_XFORM_MODE, key, cfg); + toString: function (encoder) { + return (encoder || Hex).stringify(this); }, /** - * Initializes a newly created cipher. + * Concatenates a word array to this word array. * - * @param {number} xformMode Either the encryption or decryption transormation mode constant. - * @param {WordArray} key The key. - * @param {Object} cfg (Optional) The configuration options to use for this operation. + * @param {WordArray} wordArray The word array to append. + * + * @return {WordArray} This word array. * * @example * - * var cipher = CryptoJS.algo.AES.create(CryptoJS.algo.AES._ENC_XFORM_MODE, keyWordArray, { iv: ivWordArray }); + * wordArray1.concat(wordArray2); */ - init: function (xformMode, key, cfg) { - // Apply config defaults - this.cfg = this.cfg.extend(cfg); + concat: function (wordArray) { + // Shortcuts + var thisWords = this.words; + var thatWords = wordArray.words; + var thisSigBytes = this.sigBytes; + var thatSigBytes = wordArray.sigBytes; - // Store transform mode and key - this._xformMode = xformMode; - this._key = key; + // Clamp excess bits + this.clamp(); - // Set initial values - this.reset(); + // Concat + if (thisSigBytes % 4) { + // Copy one byte at a time + for (var i = 0; i < thatSigBytes; i++) { + var thatByte = (thatWords[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff; + thisWords[(thisSigBytes + i) >>> 2] |= thatByte << (24 - ((thisSigBytes + i) % 4) * 8); + } + } else { + // Copy one word at a time + for (var i = 0; i < thatSigBytes; i += 4) { + thisWords[(thisSigBytes + i) >>> 2] = thatWords[i >>> 2]; + } + } + this.sigBytes += thatSigBytes; + + // Chainable + return this; }, /** - * Resets this cipher to its initial state. + * Removes insignificant bits. * * @example * - * cipher.reset(); + * wordArray.clamp(); */ - reset: function () { - // Reset data buffer - BufferedBlockAlgorithm.reset.call(this); + clamp: function () { + // Shortcuts + var words = this.words; + var sigBytes = this.sigBytes; - // Perform concrete-cipher logic - this._doReset(); + // Clamp + words[sigBytes >>> 2] &= 0xffffffff << (32 - (sigBytes % 4) * 8); + words.length = Math.ceil(sigBytes / 4); }, /** - * Adds data to be encrypted or decrypted. - * - * @param {WordArray|string} dataUpdate The data to encrypt or decrypt. + * Creates a copy of this word array. * - * @return {WordArray} The data after processing. + * @return {WordArray} The clone. * * @example * - * var encrypted = cipher.process('data'); - * var encrypted = cipher.process(wordArray); + * var clone = wordArray.clone(); */ - process: function (dataUpdate) { - // Append - this._append(dataUpdate); + clone: function () { + var clone = Base.clone.call(this); + clone.words = this.words.slice(0); - // Process available blocks - return this._process(); + return clone; }, /** - * Finalizes the encryption or decryption process. - * Note that the finalize operation is effectively a destructive, read-once operation. + * Creates a word array filled with random bytes. * - * @param {WordArray|string} dataUpdate The final data to encrypt or decrypt. + * @param {number} nBytes The number of random bytes to generate. * - * @return {WordArray} The data after final processing. + * @return {WordArray} The random word array. + * + * @static * * @example * - * var encrypted = cipher.finalize(); - * var encrypted = cipher.finalize('data'); - * var encrypted = cipher.finalize(wordArray); + * var wordArray = CryptoJS.lib.WordArray.random(16); */ - finalize: function (dataUpdate) { - // Final data update - if (dataUpdate) { - this._append(dataUpdate); - } + random: function (nBytes) { + var words = []; - // Perform concrete-cipher logic - var finalProcessedData = this._doFinalize(); + var r = (function (m_w) { + var m_w = m_w; + var m_z = 0x3ade68b1; + var mask = 0xffffffff; - return finalProcessedData; - }, + return function () { + m_z = (0x9069 * (m_z & 0xFFFF) + (m_z >> 0x10)) & mask; + m_w = (0x4650 * (m_w & 0xFFFF) + (m_w >> 0x10)) & mask; + var result = ((m_z << 0x10) + m_w) & mask; + result /= 0x100000000; + result += 0.5; + return result * (Math.random() > .5 ? 1 : -1); + } + }); - keySize: 128/32, + for (var i = 0, rcache; i < nBytes; i += 4) { + var _r = r((rcache || Math.random()) * 0x100000000); - ivSize: 128/32, + rcache = _r() * 0x3ade67b7; + words.push((_r() * 0x100000000) | 0); + } - _ENC_XFORM_MODE: 1, + return new WordArray.init(words, nBytes); + } + }); - _DEC_XFORM_MODE: 2, + /** + * Encoder namespace. + */ + var C_enc = C.enc = {}; + /** + * Hex encoding strategy. + */ + var Hex = C_enc.Hex = { /** - * Creates shortcut functions to a cipher's object interface. + * Converts a word array to a hex string. * - * @param {Cipher} cipher The cipher to create a helper for. + * @param {WordArray} wordArray The word array. * - * @return {Object} An object with encrypt and decrypt shortcut functions. + * @return {string} The hex string. * * @static * * @example * - * var AES = CryptoJS.lib.Cipher._createHelper(CryptoJS.algo.AES); + * var hexString = CryptoJS.enc.Hex.stringify(wordArray); */ - _createHelper: (function () { - function selectCipherStrategy(key) { - if (typeof key == 'string') { - return PasswordBasedCipher; - } else { - return SerializableCipher; - } - } - - return function (cipher) { - return { - encrypt: function (message, key, cfg) { - return selectCipherStrategy(key).encrypt(cipher, message, key, cfg); - }, - - decrypt: function (ciphertext, key, cfg) { - return selectCipherStrategy(key).decrypt(cipher, ciphertext, key, cfg); - } - }; - }; - }()) - }); + stringify: function (wordArray) { + // Shortcuts + var words = wordArray.words; + var sigBytes = wordArray.sigBytes; - /** - * Abstract base stream cipher template. - * - * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 1 (32 bits) - */ - var StreamCipher = C_lib.StreamCipher = Cipher.extend({ - _doFinalize: function () { - // Process partial blocks - var finalProcessedBlocks = this._process(!!'flush'); + // Convert + var hexChars = []; + for (var i = 0; i < sigBytes; i++) { + var bite = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff; + hexChars.push((bite >>> 4).toString(16)); + hexChars.push((bite & 0x0f).toString(16)); + } - return finalProcessedBlocks; + return hexChars.join(''); }, - blockSize: 1 - }); + /** + * Converts a hex string to a word array. + * + * @param {string} hexStr The hex string. + * + * @return {WordArray} The word array. + * + * @static + * + * @example + * + * var wordArray = CryptoJS.enc.Hex.parse(hexString); + */ + parse: function (hexStr) { + // Shortcut + var hexStrLength = hexStr.length; - /** - * Mode namespace. - */ - var C_mode = C.mode = {}; + // Convert + var words = []; + for (var i = 0; i < hexStrLength; i += 2) { + words[i >>> 3] |= parseInt(hexStr.substr(i, 2), 16) << (24 - (i % 8) * 4); + } + + return new WordArray.init(words, hexStrLength / 2); + } + }; /** - * Abstract base block cipher mode template. + * Latin1 encoding strategy. */ - var BlockCipherMode = C_lib.BlockCipherMode = Base.extend({ + var Latin1 = C_enc.Latin1 = { /** - * Creates this mode for encryption. + * Converts a word array to a Latin1 string. * - * @param {Cipher} cipher A block cipher instance. - * @param {Array} iv The IV words. + * @param {WordArray} wordArray The word array. + * + * @return {string} The Latin1 string. * * @static * * @example * - * var mode = CryptoJS.mode.CBC.createEncryptor(cipher, iv.words); + * var latin1String = CryptoJS.enc.Latin1.stringify(wordArray); */ - createEncryptor: function (cipher, iv) { - return this.Encryptor.create(cipher, iv); + stringify: function (wordArray) { + // Shortcuts + var words = wordArray.words; + var sigBytes = wordArray.sigBytes; + + // Convert + var latin1Chars = []; + for (var i = 0; i < sigBytes; i++) { + var bite = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff; + latin1Chars.push(String.fromCharCode(bite)); + } + + return latin1Chars.join(''); }, /** - * Creates this mode for decryption. + * Converts a Latin1 string to a word array. * - * @param {Cipher} cipher A block cipher instance. - * @param {Array} iv The IV words. + * @param {string} latin1Str The Latin1 string. + * + * @return {WordArray} The word array. * * @static * * @example * - * var mode = CryptoJS.mode.CBC.createDecryptor(cipher, iv.words); + * var wordArray = CryptoJS.enc.Latin1.parse(latin1String); */ - createDecryptor: function (cipher, iv) { - return this.Decryptor.create(cipher, iv); + parse: function (latin1Str) { + // Shortcut + var latin1StrLength = latin1Str.length; + + // Convert + var words = []; + for (var i = 0; i < latin1StrLength; i++) { + words[i >>> 2] |= (latin1Str.charCodeAt(i) & 0xff) << (24 - (i % 4) * 8); + } + + return new WordArray.init(words, latin1StrLength); + } + }; + + /** + * UTF-8 encoding strategy. + */ + var Utf8 = C_enc.Utf8 = { + /** + * Converts a word array to a UTF-8 string. + * + * @param {WordArray} wordArray The word array. + * + * @return {string} The UTF-8 string. + * + * @static + * + * @example + * + * var utf8String = CryptoJS.enc.Utf8.stringify(wordArray); + */ + stringify: function (wordArray) { + try { + return decodeURIComponent(escape(Latin1.stringify(wordArray))); + } catch (e) { + throw new Error('Malformed UTF-8 data'); + } }, /** - * Initializes a newly created mode. + * Converts a UTF-8 string to a word array. * - * @param {Cipher} cipher A block cipher instance. - * @param {Array} iv The IV words. + * @param {string} utf8Str The UTF-8 string. + * + * @return {WordArray} The word array. + * + * @static * * @example * - * var mode = CryptoJS.mode.CBC.Encryptor.create(cipher, iv.words); + * var wordArray = CryptoJS.enc.Utf8.parse(utf8String); */ - init: function (cipher, iv) { - this._cipher = cipher; - this._iv = iv; + parse: function (utf8Str) { + return Latin1.parse(unescape(encodeURIComponent(utf8Str))); } - }); + }; /** - * Cipher Block Chaining mode. + * Abstract buffered block algorithm template. + * + * The property blockSize must be implemented in a concrete subtype. + * + * @property {number} _minBufferSize The number of blocks that should be kept unprocessed in the buffer. Default: 0 */ - var CBC = C_mode.CBC = (function () { + var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm = Base.extend({ /** - * Abstract base CBC mode. + * Resets this block algorithm's data buffer to its initial state. + * + * @example + * + * bufferedBlockAlgorithm.reset(); */ - var CBC = BlockCipherMode.extend(); + reset: function () { + // Initial values + this._data = new WordArray.init(); + this._nDataBytes = 0; + }, /** - * CBC encryptor. + * Adds new data to this block algorithm's buffer. + * + * @param {WordArray|string} data The data to append. Strings are converted to a WordArray using UTF-8. + * + * @example + * + * bufferedBlockAlgorithm._append('data'); + * bufferedBlockAlgorithm._append(wordArray); */ - CBC.Encryptor = CBC.extend({ - /** - * Processes the data block at offset. - * - * @param {Array} words The data words to operate on. - * @param {number} offset The offset where the block starts. - * - * @example - * - * mode.processBlock(data.words, offset); - */ - processBlock: function (words, offset) { - // Shortcuts - var cipher = this._cipher; - var blockSize = cipher.blockSize; - - // XOR and encrypt - xorBlock.call(this, words, offset, blockSize); - cipher.encryptBlock(words, offset); + _append: function (data) { + // Convert string to WordArray, else assume WordArray already + if (typeof data == 'string') { + data = Utf8.parse(data); + } - // Remember this block to use with next block - this._prevBlock = words.slice(offset, offset + blockSize); - } - }); - - /** - * CBC decryptor. - */ - CBC.Decryptor = CBC.extend({ - /** - * Processes the data block at offset. - * - * @param {Array} words The data words to operate on. - * @param {number} offset The offset where the block starts. - * - * @example - * - * mode.processBlock(data.words, offset); - */ - processBlock: function (words, offset) { - // Shortcuts - var cipher = this._cipher; - var blockSize = cipher.blockSize; - - // Remember this block to use with next block - var thisBlock = words.slice(offset, offset + blockSize); - - // Decrypt and XOR - cipher.decryptBlock(words, offset); - xorBlock.call(this, words, offset, blockSize); - - // This block becomes the previous block - this._prevBlock = thisBlock; - } - }); - - function xorBlock(words, offset, blockSize) { - // Shortcut - var iv = this._iv; - - // Choose mixing block - if (iv) { - var block = iv; - - // Remove IV for subsequent blocks - this._iv = undefined; - } else { - var block = this._prevBlock; - } - - // XOR blocks - for (var i = 0; i < blockSize; i++) { - words[offset + i] ^= block[i]; - } - } - - return CBC; - }()); - - /** - * Padding namespace. - */ - var C_pad = C.pad = {}; + // Append + this._data.concat(data); + this._nDataBytes += data.sigBytes; + }, - /** - * PKCS #5/7 padding strategy. - */ - var Pkcs7 = C_pad.Pkcs7 = { /** - * Pads data using the algorithm defined in PKCS #5/7. + * Processes available data blocks. * - * @param {WordArray} data The data to pad. - * @param {number} blockSize The multiple that the data should be padded to. + * This method invokes _doProcessBlock(offset), which must be implemented by a concrete subtype. * - * @static + * @param {boolean} doFlush Whether all blocks and partial blocks should be processed. + * + * @return {WordArray} The processed data. * * @example * - * CryptoJS.pad.Pkcs7.pad(wordArray, 4); + * var processedData = bufferedBlockAlgorithm._process(); + * var processedData = bufferedBlockAlgorithm._process(!!'flush'); */ - pad: function (data, blockSize) { - // Shortcut + _process: function (doFlush) { + // Shortcuts + var data = this._data; + var dataWords = data.words; + var dataSigBytes = data.sigBytes; + var blockSize = this.blockSize; var blockSizeBytes = blockSize * 4; - // Count padding bytes - var nPaddingBytes = blockSizeBytes - data.sigBytes % blockSizeBytes; + // Count blocks ready + var nBlocksReady = dataSigBytes / blockSizeBytes; + if (doFlush) { + // Round up to include partial blocks + nBlocksReady = Math.ceil(nBlocksReady); + } else { + // Round down to include only full blocks, + // less the number of blocks that must remain in the buffer + nBlocksReady = Math.max((nBlocksReady | 0) - this._minBufferSize, 0); + } - // Create padding word - var paddingWord = (nPaddingBytes << 24) | (nPaddingBytes << 16) | (nPaddingBytes << 8) | nPaddingBytes; + // Count words ready + var nWordsReady = nBlocksReady * blockSize; - // Create padding - var paddingWords = []; - for (var i = 0; i < nPaddingBytes; i += 4) { - paddingWords.push(paddingWord); + // Count bytes ready + var nBytesReady = Math.min(nWordsReady * 4, dataSigBytes); + + // Process blocks + if (nWordsReady) { + for (var offset = 0; offset < nWordsReady; offset += blockSize) { + // Perform concrete-algorithm logic + this._doProcessBlock(dataWords, offset); + } + + // Remove processed words + var processedWords = dataWords.splice(0, nWordsReady); + data.sigBytes -= nBytesReady; } - var padding = WordArray.create(paddingWords, nPaddingBytes); - // Add padding - data.concat(padding); + // Return processed words + return new WordArray.init(processedWords, nBytesReady); }, /** - * Unpads data that had been padded using the algorithm defined in PKCS #5/7. - * - * @param {WordArray} data The data to unpad. + * Creates a copy of this object. * - * @static + * @return {Object} The clone. * * @example * - * CryptoJS.pad.Pkcs7.unpad(wordArray); - */ - unpad: function (data) { - // Get number of padding bytes from last byte - var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff; - - // Remove padding - data.sigBytes -= nPaddingBytes; - } - }; - - /** - * Abstract base block cipher template. - * - * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 4 (128 bits) - */ - var BlockCipher = C_lib.BlockCipher = Cipher.extend({ - /** - * Configuration options. - * - * @property {Mode} mode The block mode to use. Default: CBC - * @property {Padding} padding The padding strategy to use. Default: Pkcs7 + * var clone = bufferedBlockAlgorithm.clone(); */ - cfg: Cipher.cfg.extend({ - mode: CBC, - padding: Pkcs7 - }), - - reset: function () { - // Reset cipher - Cipher.reset.call(this); - - // Shortcuts - var cfg = this.cfg; - var iv = cfg.iv; - var mode = cfg.mode; - - // Reset block mode - if (this._xformMode == this._ENC_XFORM_MODE) { - var modeCreator = mode.createEncryptor; - } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ { - var modeCreator = mode.createDecryptor; - - // Keep at least one block in the buffer for unpadding - this._minBufferSize = 1; - } - this._mode = modeCreator.call(mode, this, iv && iv.words); - }, - - _doProcessBlock: function (words, offset) { - this._mode.processBlock(words, offset); - }, - - _doFinalize: function () { - // Shortcut - var padding = this.cfg.padding; - - // Finalize - if (this._xformMode == this._ENC_XFORM_MODE) { - // Pad data - padding.pad(this._data, this.blockSize); - - // Process final blocks - var finalProcessedBlocks = this._process(!!'flush'); - } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ { - // Process final blocks - var finalProcessedBlocks = this._process(!!'flush'); - - // Unpad data - padding.unpad(finalProcessedBlocks); - } + clone: function () { + var clone = Base.clone.call(this); + clone._data = this._data.clone(); - return finalProcessedBlocks; + return clone; }, - blockSize: 128/32 + _minBufferSize: 0 }); /** - * A collection of cipher parameters. + * Abstract hasher template. * - * @property {WordArray} ciphertext The raw ciphertext. - * @property {WordArray} key The key to this ciphertext. - * @property {WordArray} iv The IV used in the ciphering operation. - * @property {WordArray} salt The salt used with a key derivation function. - * @property {Cipher} algorithm The cipher algorithm. - * @property {Mode} mode The block mode used in the ciphering operation. - * @property {Padding} padding The padding scheme used in the ciphering operation. - * @property {number} blockSize The block size of the cipher. - * @property {Format} formatter The default formatting strategy to convert this cipher params object to a string. + * @property {number} blockSize The number of 32-bit words this hasher operates on. Default: 16 (512 bits) */ - var CipherParams = C_lib.CipherParams = Base.extend({ + var Hasher = C_lib.Hasher = BufferedBlockAlgorithm.extend({ /** - * Initializes a newly created cipher params object. - * - * @param {Object} cipherParams An object with any of the possible cipher parameters. - * - * @example - * - * var cipherParams = CryptoJS.lib.CipherParams.create({ - * ciphertext: ciphertextWordArray, - * key: keyWordArray, - * iv: ivWordArray, - * salt: saltWordArray, - * algorithm: CryptoJS.algo.AES, - * mode: CryptoJS.mode.CBC, - * padding: CryptoJS.pad.PKCS7, - * blockSize: 4, - * formatter: CryptoJS.format.OpenSSL - * }); + * Configuration options. */ - init: function (cipherParams) { - this.mixIn(cipherParams); - }, + cfg: Base.extend(), /** - * Converts this cipher params object to a string. - * - * @param {Format} formatter (Optional) The formatting strategy to use. - * - * @return {string} The stringified cipher params. + * Initializes a newly created hasher. * - * @throws Error If neither the formatter nor the default formatter is set. + * @param {Object} cfg (Optional) The configuration options to use for this hash computation. * * @example * - * var string = cipherParams + ''; - * var string = cipherParams.toString(); - * var string = cipherParams.toString(CryptoJS.format.OpenSSL); + * var hasher = CryptoJS.algo.SHA256.create(); */ - toString: function (formatter) { - return (formatter || this.formatter).stringify(this); - } - }); + init: function (cfg) { + // Apply config defaults + this.cfg = this.cfg.extend(cfg); - /** - * Format namespace. - */ - var C_format = C.format = {}; + // Set initial values + this.reset(); + }, - /** - * OpenSSL formatting strategy. - */ - var OpenSSLFormatter = C_format.OpenSSL = { /** - * Converts a cipher params object to an OpenSSL-compatible string. - * - * @param {CipherParams} cipherParams The cipher params object. - * - * @return {string} The OpenSSL-compatible string. - * - * @static + * Resets this hasher to its initial state. * * @example * - * var openSSLString = CryptoJS.format.OpenSSL.stringify(cipherParams); + * hasher.reset(); */ - stringify: function (cipherParams) { - // Shortcuts - var ciphertext = cipherParams.ciphertext; - var salt = cipherParams.salt; - - // Format - if (salt) { - var wordArray = WordArray.create([0x53616c74, 0x65645f5f]).concat(salt).concat(ciphertext); - } else { - var wordArray = ciphertext; - } + reset: function () { + // Reset data buffer + BufferedBlockAlgorithm.reset.call(this); - return wordArray.toString(Base64); + // Perform concrete-hasher logic + this._doReset(); }, /** - * Converts an OpenSSL-compatible string to a cipher params object. - * - * @param {string} openSSLStr The OpenSSL-compatible string. + * Updates this hasher with a message. * - * @return {CipherParams} The cipher params object. + * @param {WordArray|string} messageUpdate The message to append. * - * @static + * @return {Hasher} This hasher. * * @example * - * var cipherParams = CryptoJS.format.OpenSSL.parse(openSSLString); + * hasher.update('message'); + * hasher.update(wordArray); */ - parse: function (openSSLStr) { - // Parse base64 - var ciphertext = Base64.parse(openSSLStr); - - // Shortcut - var ciphertextWords = ciphertext.words; - - // Test for salt - if (ciphertextWords[0] == 0x53616c74 && ciphertextWords[1] == 0x65645f5f) { - // Extract salt - var salt = WordArray.create(ciphertextWords.slice(2, 4)); - - // Remove salt from ciphertext - ciphertextWords.splice(0, 4); - ciphertext.sigBytes -= 16; - } + update: function (messageUpdate) { + // Append + this._append(messageUpdate); - return CipherParams.create({ ciphertext: ciphertext, salt: salt }); - } - }; + // Update the hash + this._process(); - /** - * A cipher wrapper that returns ciphertext as a serializable cipher params object. - */ - var SerializableCipher = C_lib.SerializableCipher = Base.extend({ - /** - * Configuration options. - * - * @property {Formatter} format The formatting strategy to convert cipher param objects to and from a string. Default: OpenSSL - */ - cfg: Base.extend({ - format: OpenSSLFormatter - }), + // Chainable + return this; + }, /** - * Encrypts a message. - * - * @param {Cipher} cipher The cipher algorithm to use. - * @param {WordArray|string} message The message to encrypt. - * @param {WordArray} key The key. - * @param {Object} cfg (Optional) The configuration options to use for this operation. + * Finalizes the hash computation. + * Note that the finalize operation is effectively a destructive, read-once operation. * - * @return {CipherParams} A cipher params object. + * @param {WordArray|string} messageUpdate (Optional) A final message update. * - * @static + * @return {WordArray} The hash. * * @example * - * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key); - * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv }); - * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + * var hash = hasher.finalize(); + * var hash = hasher.finalize('message'); + * var hash = hasher.finalize(wordArray); */ - encrypt: function (cipher, message, key, cfg) { - // Apply config defaults - cfg = this.cfg.extend(cfg); - - // Encrypt - var encryptor = cipher.createEncryptor(key, cfg); - var ciphertext = encryptor.finalize(message); + finalize: function (messageUpdate) { + // Final message update + if (messageUpdate) { + this._append(messageUpdate); + } - // Shortcut - var cipherCfg = encryptor.cfg; + // Perform concrete-hasher logic + var hash = this._doFinalize(); - // Create and return serializable cipher params - return CipherParams.create({ - ciphertext: ciphertext, - key: key, - iv: cipherCfg.iv, - algorithm: cipher, - mode: cipherCfg.mode, - padding: cipherCfg.padding, - blockSize: cipher.blockSize, - formatter: cfg.format - }); + return hash; }, + blockSize: 512/32, + /** - * Decrypts serialized ciphertext. + * Creates a shortcut function to a hasher's object interface. * - * @param {Cipher} cipher The cipher algorithm to use. - * @param {CipherParams|string} ciphertext The ciphertext to decrypt. - * @param {WordArray} key The key. - * @param {Object} cfg (Optional) The configuration options to use for this operation. + * @param {Hasher} hasher The hasher to create a helper for. * - * @return {WordArray} The plaintext. + * @return {Function} The shortcut function. * * @static * * @example * - * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, key, { iv: iv, format: CryptoJS.format.OpenSSL }); - * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + * var SHA256 = CryptoJS.lib.Hasher._createHelper(CryptoJS.algo.SHA256); */ - decrypt: function (cipher, ciphertext, key, cfg) { - // Apply config defaults - cfg = this.cfg.extend(cfg); - - // Convert string to CipherParams - ciphertext = this._parse(ciphertext, cfg.format); - - // Decrypt - var plaintext = cipher.createDecryptor(key, cfg).finalize(ciphertext.ciphertext); - - return plaintext; + _createHelper: function (hasher) { + return function (message, cfg) { + return new hasher.init(cfg).finalize(message); + }; }, /** - * Converts serialized ciphertext to CipherParams, - * else assumed CipherParams already and returns ciphertext unchanged. + * Creates a shortcut function to the HMAC's object interface. * - * @param {CipherParams|string} ciphertext The ciphertext. - * @param {Formatter} format The formatting strategy to use to parse serialized ciphertext. + * @param {Hasher} hasher The hasher to use in this HMAC helper. * - * @return {CipherParams} The unserialized ciphertext. + * @return {Function} The shortcut function. * * @static * * @example * - * var ciphertextParams = CryptoJS.lib.SerializableCipher._parse(ciphertextStringOrParams, format); + * var HmacSHA256 = CryptoJS.lib.Hasher._createHmacHelper(CryptoJS.algo.SHA256); */ - _parse: function (ciphertext, format) { - if (typeof ciphertext == 'string') { - return format.parse(ciphertext, this); - } else { - return ciphertext; - } + _createHmacHelper: function (hasher) { + return function (message, key) { + return new C_algo.HMAC.init(hasher, key).finalize(message); + }; } }); /** - * Key derivation function namespace. + * Algorithm namespace. */ - var C_kdf = C.kdf = {}; + var C_algo = C.algo = {}; - /** - * OpenSSL key derivation function. - */ - var OpenSSLKdf = C_kdf.OpenSSL = { - /** - * Derives a key and IV from a password. - * - * @param {string} password The password to derive from. - * @param {number} keySize The size in words of the key to generate. - * @param {number} ivSize The size in words of the IV to generate. - * @param {WordArray|string} salt (Optional) A 64-bit salt to use. If omitted, a salt will be generated randomly. - * - * @return {CipherParams} A cipher params object with the key, IV, and salt. - * - * @static - * - * @example - * - * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32); - * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32, 'saltsalt'); - */ - execute: function (password, keySize, ivSize, salt) { - // Generate random salt - if (!salt) { - salt = WordArray.random(64/8); - } + return C; + }(Math)); - // Derive key and IV - var key = EvpKDF.create({ keySize: keySize + ivSize }).compute(password, salt); - // Separate key and IV - var iv = WordArray.create(key.words.slice(keySize), ivSize * 4); - key.sigBytes = keySize * 4; + return CryptoJS; - // Return params - return CipherParams.create({ key: key, iv: iv, salt: salt }); - } - }; +})); - /** - * A serializable cipher wrapper that derives the key from a password, - * and returns ciphertext as a serializable cipher params object. - */ - var PasswordBasedCipher = C_lib.PasswordBasedCipher = SerializableCipher.extend({ - /** - * Configuration options. - * - * @property {KDF} kdf The key derivation function to use to generate a key and IV from a password. Default: OpenSSL - */ - cfg: SerializableCipher.cfg.extend({ - kdf: OpenSSLKdf - }), +/***/ }), +/* 7 */ +/***/ (function(module, exports) { - /** - * Encrypts a message using a password. - * - * @param {Cipher} cipher The cipher algorithm to use. - * @param {WordArray|string} message The message to encrypt. - * @param {string} password The password. - * @param {Object} cfg (Optional) The configuration options to use for this operation. - * - * @return {CipherParams} A cipher params object. - * - * @static - * - * @example - * - * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password'); - * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password', { format: CryptoJS.format.OpenSSL }); - */ - encrypt: function (cipher, message, password, cfg) { - // Apply config defaults - cfg = this.cfg.extend(cfg); +module.exports = require("crypto"); - // Derive key and other params - var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize); +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { - // Add IV to config - cfg.iv = derivedParams.iv; +"use strict"; - // Encrypt - var ciphertext = SerializableCipher.encrypt.call(this, cipher, message, derivedParams.key, cfg); +var es5 = __webpack_require__(101); +var canEvaluate = typeof navigator == "undefined"; - // Mix in derived params - ciphertext.mixIn(derivedParams); +var errorObj = {e: {}}; +var tryCatchTarget; +var globalObject = typeof self !== "undefined" ? self : + typeof window !== "undefined" ? window : + typeof global !== "undefined" ? global : + this !== undefined ? this : null; - return ciphertext; - }, +function tryCatcher() { + try { + var target = tryCatchTarget; + tryCatchTarget = null; + return target.apply(this, arguments); + } catch (e) { + errorObj.e = e; + return errorObj; + } +} +function tryCatch(fn) { + tryCatchTarget = fn; + return tryCatcher; +} - /** - * Decrypts serialized ciphertext using a password. - * - * @param {Cipher} cipher The cipher algorithm to use. - * @param {CipherParams|string} ciphertext The ciphertext to decrypt. - * @param {string} password The password. - * @param {Object} cfg (Optional) The configuration options to use for this operation. - * - * @return {WordArray} The plaintext. - * - * @static - * - * @example - * - * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, 'password', { format: CryptoJS.format.OpenSSL }); - * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, 'password', { format: CryptoJS.format.OpenSSL }); - */ - decrypt: function (cipher, ciphertext, password, cfg) { - // Apply config defaults - cfg = this.cfg.extend(cfg); +var inherits = function(Child, Parent) { + var hasProp = {}.hasOwnProperty; - // Convert string to CipherParams - ciphertext = this._parse(ciphertext, cfg.format); + function T() { + this.constructor = Child; + this.constructor$ = Parent; + for (var propertyName in Parent.prototype) { + if (hasProp.call(Parent.prototype, propertyName) && + propertyName.charAt(propertyName.length-1) !== "$" + ) { + this[propertyName + "$"] = Parent.prototype[propertyName]; + } + } + } + T.prototype = Parent.prototype; + Child.prototype = new T(); + return Child.prototype; +}; - // Derive key and other params - var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize, ciphertext.salt); - // Add IV to config - cfg.iv = derivedParams.iv; +function isPrimitive(val) { + return val == null || val === true || val === false || + typeof val === "string" || typeof val === "number"; - // Decrypt - var plaintext = SerializableCipher.decrypt.call(this, cipher, ciphertext, derivedParams.key, cfg); +} - return plaintext; - } - }); - }()); +function isObject(value) { + return typeof value === "function" || + typeof value === "object" && value !== null; +} +function maybeWrapAsError(maybeError) { + if (!isPrimitive(maybeError)) return maybeError; -})); + return new Error(safeToString(maybeError)); +} -/***/ }), -/* 12 */ -/***/ (function(module, exports, __webpack_require__) { +function withAppended(target, appendee) { + var len = target.length; + var ret = new Array(len + 1); + var i; + for (i = 0; i < len; ++i) { + ret[i] = target[i]; + } + ret[i] = appendee; + return ret; +} -/* - This file is part of web3.js. +function getDataPropertyOrDefault(obj, key, defaultValue) { + if (es5.isES5) { + var desc = Object.getOwnPropertyDescriptor(obj, key); - web3.js is free software: you can redistribute it and/or modify - it under the terms of the GNU Lesser General Public License as published by - the Free Software Foundation, either version 3 of the License, or - (at your option) any later version. + if (desc != null) { + return desc.get == null && desc.set == null + ? desc.value + : defaultValue; + } + } else { + return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined; + } +} - web3.js is distributed in the hope that it will be useful, - but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - GNU Lesser General Public License for more details. +function notEnumerableProp(obj, name, value) { + if (isPrimitive(obj)) return obj; + var descriptor = { + value: value, + configurable: true, + enumerable: false, + writable: true + }; + es5.defineProperty(obj, name, descriptor); + return obj; +} - You should have received a copy of the GNU Lesser General Public License - along with web3.js. If not, see . -*/ -/** - * @file utils.js - * @author Marek Kotewicz - * @date 2015 - */ +function thrower(r) { + throw r; +} -/** - * Utils - * - * @module utils - */ +var inheritedDataKeys = (function() { + var excludedPrototypes = [ + Array.prototype, + Object.prototype, + Function.prototype + ]; -/** - * Utility functions - * - * @class [utils] utils - * @constructor - */ + var isExcludedProto = function(val) { + for (var i = 0; i < excludedPrototypes.length; ++i) { + if (excludedPrototypes[i] === val) { + return true; + } + } + return false; + }; + if (es5.isES5) { + var getKeys = Object.getOwnPropertyNames; + return function(obj) { + var ret = []; + var visitedKeys = Object.create(null); + while (obj != null && !isExcludedProto(obj)) { + var keys; + try { + keys = getKeys(obj); + } catch (e) { + return ret; + } + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + if (visitedKeys[key]) continue; + visitedKeys[key] = true; + var desc = Object.getOwnPropertyDescriptor(obj, key); + if (desc != null && desc.get == null && desc.set == null) { + ret.push(key); + } + } + obj = es5.getPrototypeOf(obj); + } + return ret; + }; + } else { + var hasProp = {}.hasOwnProperty; + return function(obj) { + if (isExcludedProto(obj)) return []; + var ret = []; -var BigNumber = __webpack_require__(125); -var sha3 = __webpack_require__(96); -var utf8 = __webpack_require__(153); + /*jshint forin:false */ + enumeration: for (var key in obj) { + if (hasProp.call(obj, key)) { + ret.push(key); + } else { + for (var i = 0; i < excludedPrototypes.length; ++i) { + if (hasProp.call(excludedPrototypes[i], key)) { + continue enumeration; + } + } + ret.push(key); + } + } + return ret; + }; + } -var unitMap = { - 'noether': '0', - 'wei': '1', - 'kwei': '1000', - 'Kwei': '1000', - 'babbage': '1000', - 'femtoether': '1000', - 'mwei': '1000000', - 'Mwei': '1000000', - 'lovelace': '1000000', - 'picoether': '1000000', - 'gwei': '1000000000', - 'Gwei': '1000000000', - 'shannon': '1000000000', - 'nanoether': '1000000000', - 'nano': '1000000000', - 'szabo': '1000000000000', - 'microether': '1000000000000', - 'micro': '1000000000000', - 'finney': '1000000000000000', - 'milliether': '1000000000000000', - 'milli': '1000000000000000', - 'ether': '1000000000000000000', - 'kether': '1000000000000000000000', - 'grand': '1000000000000000000000', - 'mether': '1000000000000000000000000', - 'gether': '1000000000000000000000000000', - 'tether': '1000000000000000000000000000000' -}; +})(); -/** - * Should be called to pad string to expected length - * - * @method padLeft - * @param {String} string to be padded - * @param {Number} characters that result string should have - * @param {String} sign, by default 0 - * @returns {String} right aligned string - */ -var padLeft = function (string, chars, sign) { - return new Array(chars - string.length + 1).join(sign ? sign : "0") + string; -}; +var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/; +function isClass(fn) { + try { + if (typeof fn === "function") { + var keys = es5.names(fn.prototype); -/** - * Should be called to pad string to expected length - * - * @method padRight - * @param {String} string to be padded - * @param {Number} characters that result string should have - * @param {String} sign, by default 0 - * @returns {String} right aligned string - */ -var padRight = function (string, chars, sign) { - return string + (new Array(chars - string.length + 1).join(sign ? sign : "0")); -}; + var hasMethods = es5.isES5 && keys.length > 1; + var hasMethodsOtherThanConstructor = keys.length > 0 && + !(keys.length === 1 && keys[0] === "constructor"); + var hasThisAssignmentAndStaticMethods = + thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0; -/** - * Should be called to get utf8 from it's hex representation - * - * @method toUtf8 - * @param {String} string in hex - * @returns {String} ascii string representation of hex value - */ -var toUtf8 = function(hex) { -// Find termination - var str = ""; - var i = 0, l = hex.length; - if (hex.substring(0, 2) === '0x') { - i = 2; - } - for (; i < l; i+=2) { - var code = parseInt(hex.substr(i, 2), 16); - if (code === 0) - break; - str += String.fromCharCode(code); + if (hasMethods || hasMethodsOtherThanConstructor || + hasThisAssignmentAndStaticMethods) { + return true; + } + } + return false; + } catch (e) { + return false; } +} - return utf8.decode(str); -}; +function toFastProperties(obj) { + /*jshint -W027,-W055,-W031*/ + function FakeConstructor() {} + FakeConstructor.prototype = obj; + var l = 8; + while (l--) new FakeConstructor(); + return obj; + eval(obj); +} -/** - * Should be called to get ascii from it's hex representation - * - * @method toAscii - * @param {String} string in hex - * @returns {String} ascii string representation of hex value - */ -var toAscii = function(hex) { -// Find termination - var str = ""; - var i = 0, l = hex.length; - if (hex.substring(0, 2) === '0x') { - i = 2; +var rident = /^[a-z$_][a-z$_0-9]*$/i; +function isIdentifier(str) { + return rident.test(str); +} + +function filledRange(count, prefix, suffix) { + var ret = new Array(count); + for(var i = 0; i < count; ++i) { + ret[i] = prefix + i + suffix; } - for (; i < l; i+=2) { - var code = parseInt(hex.substr(i, 2), 16); - str += String.fromCharCode(code); + return ret; +} + +function safeToString(obj) { + try { + return obj + ""; + } catch (e) { + return "[no string representation]"; } +} - return str; -}; +function isError(obj) { + return obj !== null && + typeof obj === "object" && + typeof obj.message === "string" && + typeof obj.name === "string"; +} -/** - * Should be called to get hex representation (prefixed by 0x) of utf8 string - * - * @method fromUtf8 - * @param {String} string - * @param {Number} optional padding - * @returns {String} hex representation of input string - */ -var fromUtf8 = function(str) { - str = utf8.encode(str); - var hex = ""; - for(var i = 0; i < str.length; i++) { - var code = str.charCodeAt(i); - if (code === 0) - break; - var n = code.toString(16); - hex += n.length < 2 ? '0' + n : n; +function markAsOriginatingFromRejection(e) { + try { + notEnumerableProp(e, "isOperational", true); } + catch(ignore) {} +} - return "0x" + hex; -}; +function originatesFromRejection(e) { + if (e == null) return false; + return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) || + e["isOperational"] === true); +} -/** - * Should be called to get hex representation (prefixed by 0x) of ascii string - * - * @method fromAscii - * @param {String} string - * @param {Number} optional padding - * @returns {String} hex representation of input string - */ -var fromAscii = function(str) { - var hex = ""; - for(var i = 0; i < str.length; i++) { - var code = str.charCodeAt(i); - var n = code.toString(16); - hex += n.length < 2 ? '0' + n : n; +function canAttachTrace(obj) { + return isError(obj) && es5.propertyIsWritable(obj, "stack"); +} + +var ensureErrorObject = (function() { + if (!("stack" in new Error())) { + return function(value) { + if (canAttachTrace(value)) return value; + try {throw new Error(safeToString(value));} + catch(err) {return err;} + }; + } else { + return function(value) { + if (canAttachTrace(value)) return value; + return new Error(safeToString(value)); + }; } +})(); - return "0x" + hex; -}; +function classString(obj) { + return {}.toString.call(obj); +} -/** - * Should be used to create full function/event name from json abi - * - * @method transformToFullName - * @param {Object} json-abi - * @return {String} full fnction/event name - */ -var transformToFullName = function (json) { - if (json.name.indexOf('(') !== -1) { - return json.name; +function copyDescriptors(from, to, filter) { + var keys = es5.names(from); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + if (filter(key)) { + try { + es5.defineProperty(to, key, es5.getDescriptor(from, key)); + } catch (ignore) {} + } } +} - var typeName = json.inputs.map(function(i){return i.type; }).join(); - return json.name + '(' + typeName + ')'; -}; - -/** - * Should be called to get display name of contract function - * - * @method extractDisplayName - * @param {String} name of function/event - * @returns {String} display name for function/event eg. multiply(uint256) -> multiply - */ -var extractDisplayName = function (name) { - var length = name.indexOf('('); - return length !== -1 ? name.substr(0, length) : name; +var asArray = function(v) { + if (es5.isArray(v)) { + return v; + } + return null; }; -/// @returns overloaded part of function/event name -var extractTypeName = function (name) { - /// TODO: make it invulnerable - var length = name.indexOf('('); - return length !== -1 ? name.substr(length + 1, name.length - 1 - (length + 1)).replace(' ', '') : ""; -}; +if (typeof Symbol !== "undefined" && Symbol.iterator) { + var ArrayFrom = typeof Array.from === "function" ? function(v) { + return Array.from(v); + } : function(v) { + var ret = []; + var it = v[Symbol.iterator](); + var itResult; + while (!((itResult = it.next()).done)) { + ret.push(itResult.value); + } + return ret; + }; -/** - * Converts value to it's decimal representation in string - * - * @method toDecimal - * @param {String|Number|BigNumber} - * @return {String} - */ -var toDecimal = function (value) { - return toBigNumber(value).toNumber(); -}; - -/** - * Converts value to it's hex representation - * - * @method fromDecimal - * @param {String|Number|BigNumber} - * @return {String} - */ -var fromDecimal = function (value) { - var number = toBigNumber(value); - var result = number.toString(16); - - return number.lessThan(0) ? '-0x' + result.substr(1) : '0x' + result; -}; - -/** - * Auto converts any given value into it's hex representation. - * - * And even stringifys objects before. - * - * @method toHex - * @param {String|Number|BigNumber|Object} - * @return {String} - */ -var toHex = function (val) { - /*jshint maxcomplexity: 8 */ + asArray = function(v) { + if (es5.isArray(v)) { + return v; + } else if (v != null && typeof v[Symbol.iterator] === "function") { + return ArrayFrom(v); + } + return null; + }; +} - if (isBoolean(val)) - return fromDecimal(+val); +var isNode = typeof process !== "undefined" && + classString(process).toLowerCase() === "[object process]"; - if (isBigNumber(val)) - return fromDecimal(val); +var hasEnvVariables = typeof process !== "undefined" && + typeof process.env !== "undefined"; - if (isObject(val)) - return fromUtf8(JSON.stringify(val)); +function env(key) { + return hasEnvVariables ? process.env[key] : undefined; +} - // if its a negative number, pass it through fromDecimal - if (isString(val)) { - if (val.indexOf('-0x') === 0) - return fromDecimal(val); - else if(val.indexOf('0x') === 0) - return val; - else if (!isFinite(val)) - return fromAscii(val); +function getNativePromise() { + if (typeof Promise === "function") { + try { + var promise = new Promise(function(){}); + if ({}.toString.call(promise) === "[object Promise]") { + return Promise; + } + } catch (e) {} } +} - return fromDecimal(val); -}; +function domainBind(self, cb) { + return self.bind(cb); +} -/** - * Returns value of unit in Wei - * - * @method getValueOfUnit - * @param {String} unit the unit to convert to, default ether - * @returns {BigNumber} value of the unit (in Wei) - * @throws error if the unit is not correct:w - */ -var getValueOfUnit = function (unit) { - unit = unit ? unit.toLowerCase() : 'ether'; - var unitValue = unitMap[unit]; - if (unitValue === undefined) { - throw new Error('This unit doesn\'t exists, please use the one of the following units' + JSON.stringify(unitMap, null, 2)); - } - return new BigNumber(unitValue, 10); +var ret = { + isClass: isClass, + isIdentifier: isIdentifier, + inheritedDataKeys: inheritedDataKeys, + getDataPropertyOrDefault: getDataPropertyOrDefault, + thrower: thrower, + isArray: es5.isArray, + asArray: asArray, + notEnumerableProp: notEnumerableProp, + isPrimitive: isPrimitive, + isObject: isObject, + isError: isError, + canEvaluate: canEvaluate, + errorObj: errorObj, + tryCatch: tryCatch, + inherits: inherits, + withAppended: withAppended, + maybeWrapAsError: maybeWrapAsError, + toFastProperties: toFastProperties, + filledRange: filledRange, + toString: safeToString, + canAttachTrace: canAttachTrace, + ensureErrorObject: ensureErrorObject, + originatesFromRejection: originatesFromRejection, + markAsOriginatingFromRejection: markAsOriginatingFromRejection, + classString: classString, + copyDescriptors: copyDescriptors, + hasDevTools: typeof chrome !== "undefined" && chrome && + typeof chrome.loadTimes === "function", + isNode: isNode, + hasEnvVariables: hasEnvVariables, + env: env, + global: globalObject, + getNativePromise: getNativePromise, + domainBind: domainBind }; +ret.isRecentNode = ret.isNode && (function() { + var version = process.versions.node.split(".").map(Number); + return (version[0] === 0 && version[1] > 10) || (version[0] > 0); +})(); -/** - * Takes a number of wei and converts it to any other ether unit. - * - * Possible units are: - * SI Short SI Full Effigy Other - * - kwei femtoether babbage - * - mwei picoether lovelace - * - gwei nanoether shannon nano - * - -- microether szabo micro - * - -- milliether finney milli - * - ether -- -- - * - kether -- grand - * - mether - * - gether - * - tether - * - * @method fromWei - * @param {Number|String} number can be a number, number string or a HEX of a decimal - * @param {String} unit the unit to convert to, default ether - * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number -*/ -var fromWei = function(number, unit) { - var returnValue = toBigNumber(number).dividedBy(getValueOfUnit(unit)); - - return isBigNumber(number) ? returnValue : returnValue.toString(10); -}; +if (ret.isNode) ret.toFastProperties(process); -/** - * Takes a number of a unit and converts it to wei. - * - * Possible units are: - * SI Short SI Full Effigy Other - * - kwei femtoether babbage - * - mwei picoether lovelace - * - gwei nanoether shannon nano - * - -- microether szabo micro - * - -- microether szabo micro - * - -- milliether finney milli - * - ether -- -- - * - kether -- grand - * - mether - * - gether - * - tether - * - * @method toWei - * @param {Number|String|BigNumber} number can be a number, number string or a HEX of a decimal - * @param {String} unit the unit to convert from, default ether - * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number -*/ -var toWei = function(number, unit) { - var returnValue = toBigNumber(number).times(getValueOfUnit(unit)); +try {throw new Error(); } catch (e) {ret.lastLineError = e;} +module.exports = ret; - return isBigNumber(number) ? returnValue : returnValue.toString(10); -}; -/** - * Takes an input and transforms it into an bignumber - * - * @method toBigNumber - * @param {Number|String|BigNumber} a number, string, HEX string or BigNumber - * @return {BigNumber} BigNumber -*/ -var toBigNumber = function(number) { - /*jshint maxcomplexity:5 */ - number = number || 0; - if (isBigNumber(number)) - return number; +/***/ }), +/* 9 */ +/***/ (function(module, exports) { - if (isString(number) && (number.indexOf('0x') === 0 || number.indexOf('-0x') === 0)) { - return new BigNumber(number.replace('0x',''), 16); - } +module.exports = require("url"); - return new BigNumber(number.toString(10), 10); -}; +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { -/** - * Takes and input transforms it into bignumber and if it is negative value, into two's complement - * - * @method toTwosComplement - * @param {Number|String|BigNumber} - * @return {BigNumber} - */ -var toTwosComplement = function (number) { - var bigNumber = toBigNumber(number); - if (bigNumber.lessThan(0)) { - return new BigNumber("ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff", 16).plus(bigNumber).plus(1); - } - return bigNumber; -}; +/* WEBPACK VAR INJECTION */(function(module) {var fs = __webpack_require__(2); +var _ = __webpack_require__(30); +var path = __webpack_require__(0); +var Provider = __webpack_require__(1209); +var TruffleError = __webpack_require__(26); +var Module = __webpack_require__(468); +var findUp = __webpack_require__(1207); +var originalrequire = __webpack_require__(469); -/** - * Checks if the given string is strictly an address - * - * @method isStrictAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isStrictAddress = function (address) { - return /^0x[0-9a-f]{40}$/i.test(address); -}; +var DEFAULT_CONFIG_FILENAME = "truffle.js"; +var BACKUP_CONFIG_FILENAME = "truffle-config.js"; // For Windows + Command Prompt -/** - * Checks if the given string is an address - * - * @method isAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isAddress = function (address) { - if (!/^(0x)?[0-9a-f]{40}$/i.test(address)) { - // check if it has the basic requirements of an address - return false; - } else if (/^(0x)?[0-9a-f]{40}$/.test(address) || /^(0x)?[0-9A-F]{40}$/.test(address)) { - // If it's all small caps or all all caps, return true - return true; - } else { - // Otherwise check each case - return isChecksumAddress(address); - } -}; +function Config(truffle_directory, working_directory, network) { + var self = this; + var default_tx_values = { + gas: 4712388, + gasPrice: 100000000000, // 100 Shannon, + from: null + }; + this._values = { + truffle_directory: truffle_directory || path.resolve(path.join(__dirname, "../")), + working_directory: working_directory || process.cwd(), + network: network, + networks: {}, + verboseRpc: false, + gas: null, + gasPrice: null, + from: null, + build: null, + resolver: null, + artifactor: null, + ethpm: { + ipfs_host: "ipfs.infura.io", + ipfs_protocol: "https", + registry: "0x8011df4830b4f696cd81393997e5371b93338878", + install_provider_uri: "https://ropsten.infura.io/truffle" + }, + solc: { + optimizer: { + enabled: true, + runs: 200 + } + }, + logger: { + log: function() {}, + } + }; -/** - * Checks if the given string is a checksummed address - * - * @method isChecksumAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isChecksumAddress = function (address) { - // Check each case - address = address.replace('0x',''); - var addressHash = sha3(address.toLowerCase()); + var props = { + // These are already set. + truffle_directory: function() {}, + working_directory: function() {}, + network: function() {}, + networks: function() {}, + verboseRpc: function() {}, + build: function() {}, + resolver: function() {}, + artifactor: function() {}, + ethpm: function() {}, + solc: function() {}, + logger: function() {}, - for (var i = 0; i < 40; i++ ) { - // the nth letter should be uppercase if the nth digit of casemap is 1 - if ((parseInt(addressHash[i], 16) > 7 && address[i].toUpperCase() !== address[i]) || (parseInt(addressHash[i], 16) <= 7 && address[i].toLowerCase() !== address[i])) { - return false; + build_directory: function() { + return path.join(self.working_directory, "build"); + }, + contracts_directory: function() { + return path.join(self.working_directory, "contracts"); + }, + contracts_build_directory: function() { + return path.join(self.build_directory, "contracts"); + }, + migrations_directory: function() { + return path.join(self.working_directory, "migrations"); + }, + test_directory: function() { + return path.join(self.working_directory, "test"); + }, + test_file_extension_regexp: function() { + return /.*\.(js|es|es6|jsx|sol)$/ + }, + example_project_directory: function() { + return path.join(self.truffle_directory, "example"); + }, + network_id: { + get: function() { + try { + return self.network_config.network_id; + } catch (e) { + return null; } - } - return true; -}; + }, + set: function(val) { + throw new Error("Do not set config.network_id. Instead, set config.networks and then config.networks[].network_id"); + } + }, + network_config: { + get: function() { + var network = self.network; + if (network == null) { + throw new Error("Network not set. Cannot determine network to use."); + } + var conf = self.networks[network]; -/** - * Makes a checksum address - * - * @method toChecksumAddress - * @param {String} address the given HEX adress - * @return {String} -*/ -var toChecksumAddress = function (address) { - if (typeof address === 'undefined') return ''; + if (conf == null) { + config = {}; + } - address = address.toLowerCase().replace('0x',''); - var addressHash = sha3(address); - var checksumAddress = '0x'; + conf = _.extend({}, default_tx_values, conf); - for (var i = 0; i < address.length; i++ ) { - // If ith character is 9 to f then make it uppercase - if (parseInt(addressHash[i], 16) > 7) { - checksumAddress += address[i].toUpperCase(); - } else { - checksumAddress += address[i]; + return conf; + }, + set: function(val) { + throw new Error("Don't set config.network_config. Instead, set config.networks with the desired values."); + } + }, + from: { + get: function() { + try { + return self.network_config.from; + } catch (e) { + return default_tx_values.from; + } + }, + set: function(val) { + throw new Error("Don't set config.from directly. Instead, set config.networks and then config.networks[].from") + } + }, + gas: { + get: function() { + try { + return self.network_config.gas; + } catch (e) { + return default_tx_values.gas; + } + }, + set: function(val) { + throw new Error("Don't set config.gas directly. Instead, set config.networks and then config.networks[].gas") + } + }, + gasPrice: { + get: function() { + try { + return self.network_config.gasPrice; + } catch (e) { + return default_tx_values.gasPrice; + } + }, + set: function(val) { + throw new Error("Don't set config.gasPrice directly. Instead, set config.networks and then config.networks[].gasPrice") + } + }, + provider: { + get: function() { + if (!self.network) { + return null; } - } - return checksumAddress; -}; - -/** - * Transforms given string to valid 20 bytes-length addres with 0x prefix - * - * @method toAddress - * @param {String} address - * @return {String} formatted address - */ -var toAddress = function (address) { - if (isStrictAddress(address)) { - return address; - } - if (/^[0-9a-f]{40}$/.test(address)) { - return '0x' + address; + var options = self.network_config; + options.verboseRpc = self.verboseRpc; + return Provider.create(options); + }, + set: function(val) { + throw new Error("Don't set config.provider directly. Instead, set config.networks and then set config.networks[].provider") + } } + }; - return '0x' + padLeft(toHex(address).substr(2), 40); -}; - -/** - * Returns true if object is BigNumber, otherwise false - * - * @method isBigNumber - * @param {Object} - * @return {Boolean} - */ -var isBigNumber = function (object) { - return object instanceof BigNumber || - (object && object.constructor && object.constructor.name === 'BigNumber'); + Object.keys(props).forEach(function(prop) { + self.addProp(prop, props[prop]); + }); }; -/** - * Returns true if object is string, otherwise false - * - * @method isString - * @param {Object} - * @return {Boolean} - */ -var isString = function (object) { - return typeof object === 'string' || - (object && object.constructor && object.constructor.name === 'String'); +Config.prototype.addProp = function(key, obj) { + Object.defineProperty(this, key, { + get: obj.get || function() { + return this._values[key] || obj(); + }, + set: obj.set || function(val) { + this._values[key] = val; + }, + configurable: true, + enumerable: true + }); }; -/** - * Returns true if object is function, otherwise false - * - * @method isFunction - * @param {Object} - * @return {Boolean} - */ -var isFunction = function (object) { - return typeof object === 'function'; -}; +Config.prototype.normalize = function(obj) { + var clone = {}; + Object.keys(obj).forEach(function(key) { + try { + clone[key] = obj[key]; + } catch (e) { + // Do nothing with values that throw. + } + }); + return clone; +} -/** - * Returns true if object is Objet, otherwise false - * - * @method isObject - * @param {Object} - * @return {Boolean} - */ -var isObject = function (object) { - return typeof object === 'object'; -}; +Config.prototype.with = function(obj) { + var normalized = this.normalize(obj); + var current = this.normalize(this); -/** - * Returns true if object is boolean, otherwise false - * - * @method isBoolean - * @param {Object} - * @return {Boolean} - */ -var isBoolean = function (object) { - return typeof object === 'boolean'; + return _.extend({}, current, normalized); }; -/** - * Returns true if object is array, otherwise false - * - * @method isArray - * @param {Object} - * @return {Boolean} - */ -var isArray = function (object) { - return object instanceof Array; -}; +Config.prototype.merge = function(obj) { + var self = this; + var clone = this.normalize(obj); -/** - * Returns true if given string is valid json object - * - * @method isJson - * @param {String} - * @return {Boolean} - */ -var isJson = function (str) { + // Only set keys for values that don't throw. + Object.keys(obj).forEach(function(key) { try { - return !!JSON.parse(str); + self[key] = clone[key]; } catch (e) { - return false; + // Do nothing. } -}; + }); -module.exports = { - padLeft: padLeft, - padRight: padRight, - toHex: toHex, - toDecimal: toDecimal, - fromDecimal: fromDecimal, - toUtf8: toUtf8, - toAscii: toAscii, - fromUtf8: fromUtf8, - fromAscii: fromAscii, - transformToFullName: transformToFullName, - extractDisplayName: extractDisplayName, - extractTypeName: extractTypeName, - toWei: toWei, - fromWei: fromWei, - toBigNumber: toBigNumber, - toTwosComplement: toTwosComplement, - toAddress: toAddress, - isBigNumber: isBigNumber, - isStrictAddress: isStrictAddress, - isAddress: isAddress, - isChecksumAddress: isChecksumAddress, - toChecksumAddress: toChecksumAddress, - isFunction: isFunction, - isString: isString, - isObject: isObject, - isBoolean: isBoolean, - isArray: isArray, - isJson: isJson + return this; }; +Config.default = function() { + return new Config(); +}; -/***/ }), -/* 13 */ -/***/ (function(module, exports, __webpack_require__) { - -/* - This file is part of web3.js. - - web3.js is free software: you can redistribute it and/or modify - it under the terms of the GNU Lesser General Public License as published by - the Free Software Foundation, either version 3 of the License, or - (at your option) any later version. +Config.detect = function(options, filename) { + // Only attempt to detect the backup if a specific file wasn't asked for. + var checkBackup = false; - web3.js is distributed in the hope that it will be useful, - but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - GNU Lesser General Public License for more details. + if (filename == null) { + filename = DEFAULT_CONFIG_FILENAME; + checkBackup = true; + } - You should have received a copy of the GNU Lesser General Public License - along with web3.js. If not, see . -*/ -/** - * @file utils.js - * @author Marek Kotewicz - * @date 2015 - */ + var file = findUp.sync(filename, {cwd: options.working_directory || options.workingDirectory}); -/** - * Utils - * - * @module utils - */ + if (file == null) { + if (checkBackup == true) { + return this.detect(options, BACKUP_CONFIG_FILENAME); + } else { + throw new TruffleError("Could not find suitable configuration file."); + } + } -/** - * Utility functions - * - * @class [utils] utils - * @constructor - */ + return this.load(file, options); +}; +Config.load = function(file, options) { + var config = new Config(); -var BigNumber = __webpack_require__(95); -var sha3 = __webpack_require__(99); -var utf8 = __webpack_require__(153); + config.working_directory = path.dirname(path.resolve(file)); -var unitMap = { - 'noether': '0', - 'wei': '1', - 'kwei': '1000', - 'Kwei': '1000', - 'babbage': '1000', - 'femtoether': '1000', - 'mwei': '1000000', - 'Mwei': '1000000', - 'lovelace': '1000000', - 'picoether': '1000000', - 'gwei': '1000000000', - 'Gwei': '1000000000', - 'shannon': '1000000000', - 'nanoether': '1000000000', - 'nano': '1000000000', - 'szabo': '1000000000000', - 'microether': '1000000000000', - 'micro': '1000000000000', - 'finney': '1000000000000000', - 'milliether': '1000000000000000', - 'milli': '1000000000000000', - 'ether': '1000000000000000000', - 'kether': '1000000000000000000000', - 'grand': '1000000000000000000000', - 'mether': '1000000000000000000000000', - 'gether': '1000000000000000000000000000', - 'tether': '1000000000000000000000000000000' -}; + // The require-nocache module used to do this for us, but + // it doesn't bundle very well. So we've pulled it out ourselves. + delete __webpack_require__.c[Module._resolveFilename(file, module)]; + var static_config = originalrequire(file); -/** - * Should be called to pad string to expected length - * - * @method padLeft - * @param {String} string to be padded - * @param {Number} characters that result string should have - * @param {String} sign, by default 0 - * @returns {String} right aligned string - */ -var padLeft = function (string, chars, sign) { - return new Array(chars - string.length + 1).join(sign ? sign : "0") + string; -}; + config.merge(static_config); + config.merge(options); -/** - * Should be called to pad string to expected length - * - * @method padRight - * @param {String} string to be padded - * @param {Number} characters that result string should have - * @param {String} sign, by default 0 - * @returns {String} right aligned string - */ -var padRight = function (string, chars, sign) { - return string + (new Array(chars - string.length + 1).join(sign ? sign : "0")); + return config; }; -/** - * Should be called to get utf8 from it's hex representation - * - * @method toUtf8 - * @param {String} string in hex - * @returns {String} ascii string representation of hex value - */ -var toUtf8 = function(hex) { -// Find termination - var str = ""; - var i = 0, l = hex.length; - if (hex.substring(0, 2) === '0x') { - i = 2; - } - for (; i < l; i+=2) { - var code = parseInt(hex.substr(i, 2), 16); - if (code === 0) - break; - str += String.fromCharCode(code); - } - - return utf8.decode(str); -}; +module.exports = Config; -/** - * Should be called to get ascii from it's hex representation - * - * @method toAscii - * @param {String} string in hex - * @returns {String} ascii string representation of hex value - */ -var toAscii = function(hex) { -// Find termination - var str = ""; - var i = 0, l = hex.length; - if (hex.substring(0, 2) === '0x') { - i = 2; - } - for (; i < l; i+=2) { - var code = parseInt(hex.substr(i, 2), 16); - str += String.fromCharCode(code); - } +/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(34)(module))) - return str; -}; +/***/ }), +/* 11 */ +/***/ (function(module, exports) { -/** - * Should be called to get hex representation (prefixed by 0x) of utf8 string - * - * @method fromUtf8 - * @param {String} string - * @param {Number} optional padding - * @returns {String} hex representation of input string - */ -var fromUtf8 = function(str) { - str = utf8.encode(str); - var hex = ""; - for(var i = 0; i < str.length; i++) { - var code = str.charCodeAt(i); - if (code === 0) - break; - var n = code.toString(16); - hex += n.length < 2 ? '0' + n : n; - } +module.exports = require("assert"); - return "0x" + hex; -}; +/***/ }), +/* 12 */ +/***/ (function(module, exports) { -/** - * Should be called to get hex representation (prefixed by 0x) of ascii string - * - * @method fromAscii - * @param {String} string - * @param {Number} optional padding - * @returns {String} hex representation of input string - */ -var fromAscii = function(str) { - var hex = ""; - for(var i = 0; i < str.length; i++) { - var code = str.charCodeAt(i); - var n = code.toString(16); - hex += n.length < 2 ? '0' + n : n; - } +module.exports = require("os"); - return "0x" + hex; -}; +/***/ }), +/* 13 */ +/***/ (function(module, exports, __webpack_require__) { -/** - * Should be used to create full function/event name from json abi - * - * @method transformToFullName - * @param {Object} json-abi - * @return {String} full fnction/event name - */ -var transformToFullName = function (json) { - if (json.name.indexOf('(') !== -1) { - return json.name; - } +// Copyright (c) 2012, Mark Cavage. All rights reserved. +// Copyright 2015 Joyent, Inc. - var typeName = json.inputs.map(function(i){return i.type; }).join(); - return json.name + '(' + typeName + ')'; -}; +var assert = __webpack_require__(11); +var Stream = __webpack_require__(14).Stream; +var util = __webpack_require__(3); -/** - * Should be called to get display name of contract function - * - * @method extractDisplayName - * @param {String} name of function/event - * @returns {String} display name for function/event eg. multiply(uint256) -> multiply - */ -var extractDisplayName = function (name) { - var length = name.indexOf('('); - return length !== -1 ? name.substr(0, length) : name; -}; -/// @returns overloaded part of function/event name -var extractTypeName = function (name) { - /// TODO: make it invulnerable - var length = name.indexOf('('); - return length !== -1 ? name.substr(length + 1, name.length - 1 - (length + 1)).replace(' ', '') : ""; -}; +///--- Globals -/** - * Converts value to it's decimal representation in string - * - * @method toDecimal - * @param {String|Number|BigNumber} - * @return {String} - */ -var toDecimal = function (value) { - return toBigNumber(value).toNumber(); -}; +/* JSSTYLED */ +var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; -/** - * Converts value to it's hex representation - * - * @method fromDecimal - * @param {String|Number|BigNumber} - * @return {String} - */ -var fromDecimal = function (value) { - var number = toBigNumber(value); - var result = number.toString(16); - return number.lessThan(0) ? '-0x' + result.substr(1) : '0x' + result; -}; +///--- Internal -/** - * Auto converts any given value into it's hex representation. - * - * And even stringifys objects before. - * - * @method toHex - * @param {String|Number|BigNumber|Object} - * @return {String} - */ -var toHex = function (val) { - /*jshint maxcomplexity: 8 */ +function _capitalize(str) { + return (str.charAt(0).toUpperCase() + str.slice(1)); +} - if (isBoolean(val)) - return fromDecimal(+val); +function _toss(name, expected, oper, arg, actual) { + throw new assert.AssertionError({ + message: util.format('%s (%s) is required', name, expected), + actual: (actual === undefined) ? typeof (arg) : actual(arg), + expected: expected, + operator: oper || '===', + stackStartFunction: _toss.caller + }); +} - if (isBigNumber(val)) - return fromDecimal(val); +function _getClass(arg) { + return (Object.prototype.toString.call(arg).slice(8, -1)); +} - if (isObject(val)) - return fromUtf8(JSON.stringify(val)); +function noop() { + // Why even bother with asserts? +} - // if its a negative number, pass it through fromDecimal - if (isString(val)) { - if (val.indexOf('-0x') === 0) - return fromDecimal(val); - else if(val.indexOf('0x') === 0) - return val; - else if (!isFinite(val)) - return fromAscii(val); - } - return fromDecimal(val); -}; +///--- Exports -/** - * Returns value of unit in Wei - * - * @method getValueOfUnit - * @param {String} unit the unit to convert to, default ether - * @returns {BigNumber} value of the unit (in Wei) - * @throws error if the unit is not correct:w - */ -var getValueOfUnit = function (unit) { - unit = unit ? unit.toLowerCase() : 'ether'; - var unitValue = unitMap[unit]; - if (unitValue === undefined) { - throw new Error('This unit doesn\'t exists, please use the one of the following units' + JSON.stringify(unitMap, null, 2)); +var types = { + bool: { + check: function (arg) { return typeof (arg) === 'boolean'; } + }, + func: { + check: function (arg) { return typeof (arg) === 'function'; } + }, + string: { + check: function (arg) { return typeof (arg) === 'string'; } + }, + object: { + check: function (arg) { + return typeof (arg) === 'object' && arg !== null; + } + }, + number: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg); + } + }, + finite: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); + } + }, + buffer: { + check: function (arg) { return Buffer.isBuffer(arg); }, + operator: 'Buffer.isBuffer' + }, + array: { + check: function (arg) { return Array.isArray(arg); }, + operator: 'Array.isArray' + }, + stream: { + check: function (arg) { return arg instanceof Stream; }, + operator: 'instanceof', + actual: _getClass + }, + date: { + check: function (arg) { return arg instanceof Date; }, + operator: 'instanceof', + actual: _getClass + }, + regexp: { + check: function (arg) { return arg instanceof RegExp; }, + operator: 'instanceof', + actual: _getClass + }, + uuid: { + check: function (arg) { + return typeof (arg) === 'string' && UUID_REGEXP.test(arg); + }, + operator: 'isUUID' } - return new BigNumber(unitValue, 10); }; -/** - * Takes a number of wei and converts it to any other ether unit. - * - * Possible units are: - * SI Short SI Full Effigy Other - * - kwei femtoether babbage - * - mwei picoether lovelace - * - gwei nanoether shannon nano - * - -- microether szabo micro - * - -- milliether finney milli - * - ether -- -- - * - kether -- grand - * - mether - * - gether - * - tether - * - * @method fromWei - * @param {Number|String} number can be a number, number string or a HEX of a decimal - * @param {String} unit the unit to convert to, default ether - * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number -*/ -var fromWei = function(number, unit) { - var returnValue = toBigNumber(number).dividedBy(getValueOfUnit(unit)); +function _setExports(ndebug) { + var keys = Object.keys(types); + var out; - return isBigNumber(number) ? returnValue : returnValue.toString(10); -}; + /* re-export standard assert */ + if (process.env.NODE_NDEBUG) { + out = noop; + } else { + out = function (arg, msg) { + if (!arg) { + _toss(msg, 'true', arg); + } + }; + } -/** - * Takes a number of a unit and converts it to wei. - * - * Possible units are: - * SI Short SI Full Effigy Other - * - kwei femtoether babbage - * - mwei picoether lovelace - * - gwei nanoether shannon nano - * - -- microether szabo micro - * - -- microether szabo micro - * - -- milliether finney milli - * - ether -- -- - * - kether -- grand - * - mether - * - gether - * - tether - * - * @method toWei - * @param {Number|String|BigNumber} number can be a number, number string or a HEX of a decimal - * @param {String} unit the unit to convert from, default ether - * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number -*/ -var toWei = function(number, unit) { - var returnValue = toBigNumber(number).times(getValueOfUnit(unit)); - - return isBigNumber(number) ? returnValue : returnValue.toString(10); -}; - -/** - * Takes an input and transforms it into an bignumber - * - * @method toBigNumber - * @param {Number|String|BigNumber} a number, string, HEX string or BigNumber - * @return {BigNumber} BigNumber -*/ -var toBigNumber = function(number) { - /*jshint maxcomplexity:5 */ - number = number || 0; - if (isBigNumber(number)) - return number; + /* standard checks */ + keys.forEach(function (k) { + if (ndebug) { + out[k] = noop; + return; + } + var type = types[k]; + out[k] = function (arg, msg) { + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); - if (isString(number) && (number.indexOf('0x') === 0 || number.indexOf('-0x') === 0)) { - return new BigNumber(number.replace('0x',''), 16); - } + /* optional checks */ + keys.forEach(function (k) { + var name = 'optional' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); - return new BigNumber(number.toString(10), 10); -}; + /* arrayOf checks */ + keys.forEach(function (k) { + var name = 'arrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); -/** - * Takes and input transforms it into bignumber and if it is negative value, into two's complement - * - * @method toTwosComplement - * @param {Number|String|BigNumber} - * @return {BigNumber} - */ -var toTwosComplement = function (number) { - var bigNumber = toBigNumber(number).round(); - if (bigNumber.lessThan(0)) { - return new BigNumber("ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff", 16).plus(bigNumber).plus(1); - } - return bigNumber; -}; + /* optionalArrayOf checks */ + keys.forEach(function (k) { + var name = 'optionalArrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); -/** - * Checks if the given string is strictly an address - * - * @method isStrictAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isStrictAddress = function (address) { - return /^0x[0-9a-f]{40}$/i.test(address); -}; + /* re-export built-in assertions */ + Object.keys(assert).forEach(function (k) { + if (k === 'AssertionError') { + out[k] = assert[k]; + return; + } + if (ndebug) { + out[k] = noop; + return; + } + out[k] = assert[k]; + }); -/** - * Checks if the given string is an address - * - * @method isAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isAddress = function (address) { - if (!/^(0x)?[0-9a-f]{40}$/i.test(address)) { - // check if it has the basic requirements of an address - return false; - } else if (/^(0x)?[0-9a-f]{40}$/.test(address) || /^(0x)?[0-9A-F]{40}$/.test(address)) { - // If it's all small caps or all all caps, return true - return true; - } else { - // Otherwise check each case - return isChecksumAddress(address); - } -}; + /* export ourselves (for unit tests _only_) */ + out._setExports = _setExports; -/** - * Checks if the given string is a checksummed address - * - * @method isChecksumAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isChecksumAddress = function (address) { - // Check each case - address = address.replace('0x',''); - var addressHash = sha3(address.toLowerCase()); + return out; +} - for (var i = 0; i < 40; i++ ) { - // the nth letter should be uppercase if the nth digit of casemap is 1 - if ((parseInt(addressHash[i], 16) > 7 && address[i].toUpperCase() !== address[i]) || (parseInt(addressHash[i], 16) <= 7 && address[i].toLowerCase() !== address[i])) { - return false; - } - } - return true; -}; +module.exports = _setExports(process.env.NODE_NDEBUG); +/***/ }), +/* 14 */ +/***/ (function(module, exports) { -/** - * Makes a checksum address - * - * @method toChecksumAddress - * @param {String} address the given HEX adress - * @return {String} -*/ -var toChecksumAddress = function (address) { - if (typeof address === 'undefined') return ''; +module.exports = require("stream"); - address = address.toLowerCase().replace('0x',''); - var addressHash = sha3(address); - var checksumAddress = '0x'; +/***/ }), +/* 15 */ +/***/ (function(module, exports, __webpack_require__) { - for (var i = 0; i < address.length; i++ ) { - // If ith character is 9 to f then make it uppercase - if (parseInt(addressHash[i], 16) > 7) { - checksumAddress += address[i].toUpperCase(); - } else { - checksumAddress += address[i]; - } - } - return checksumAddress; -}; +;(function (root, factory) { + if (true) { + // CommonJS + module.exports = exports = factory(__webpack_require__(4)); + } + else if (typeof define === "function" && define.amd) { + // AMD + define(["./core"], factory); + } + else { + // Global (browser) + factory(root.CryptoJS); + } +}(this, function (CryptoJS) { -/** - * Transforms given string to valid 20 bytes-length addres with 0x prefix - * - * @method toAddress - * @param {String} address - * @return {String} formatted address - */ -var toAddress = function (address) { - if (isStrictAddress(address)) { - return address; - } + /** + * Cipher core components. + */ + CryptoJS.lib.Cipher || (function (undefined) { + // Shortcuts + var C = CryptoJS; + var C_lib = C.lib; + var Base = C_lib.Base; + var WordArray = C_lib.WordArray; + var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm; + var C_enc = C.enc; + var Utf8 = C_enc.Utf8; + var Base64 = C_enc.Base64; + var C_algo = C.algo; + var EvpKDF = C_algo.EvpKDF; - if (/^[0-9a-f]{40}$/.test(address)) { - return '0x' + address; - } + /** + * Abstract base cipher template. + * + * @property {number} keySize This cipher's key size. Default: 4 (128 bits) + * @property {number} ivSize This cipher's IV size. Default: 4 (128 bits) + * @property {number} _ENC_XFORM_MODE A constant representing encryption mode. + * @property {number} _DEC_XFORM_MODE A constant representing decryption mode. + */ + var Cipher = C_lib.Cipher = BufferedBlockAlgorithm.extend({ + /** + * Configuration options. + * + * @property {WordArray} iv The IV to use for this operation. + */ + cfg: Base.extend(), - return '0x' + padLeft(toHex(address).substr(2), 40); -}; + /** + * Creates this cipher in encryption mode. + * + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {Cipher} A cipher instance. + * + * @static + * + * @example + * + * var cipher = CryptoJS.algo.AES.createEncryptor(keyWordArray, { iv: ivWordArray }); + */ + createEncryptor: function (key, cfg) { + return this.create(this._ENC_XFORM_MODE, key, cfg); + }, -/** - * Returns true if object is BigNumber, otherwise false - * - * @method isBigNumber - * @param {Object} - * @return {Boolean} - */ -var isBigNumber = function (object) { - return object instanceof BigNumber || - (object && object.constructor && object.constructor.name === 'BigNumber'); -}; + /** + * Creates this cipher in decryption mode. + * + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {Cipher} A cipher instance. + * + * @static + * + * @example + * + * var cipher = CryptoJS.algo.AES.createDecryptor(keyWordArray, { iv: ivWordArray }); + */ + createDecryptor: function (key, cfg) { + return this.create(this._DEC_XFORM_MODE, key, cfg); + }, -/** - * Returns true if object is string, otherwise false - * - * @method isString - * @param {Object} - * @return {Boolean} - */ -var isString = function (object) { - return typeof object === 'string' || - (object && object.constructor && object.constructor.name === 'String'); -}; + /** + * Initializes a newly created cipher. + * + * @param {number} xformMode Either the encryption or decryption transormation mode constant. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @example + * + * var cipher = CryptoJS.algo.AES.create(CryptoJS.algo.AES._ENC_XFORM_MODE, keyWordArray, { iv: ivWordArray }); + */ + init: function (xformMode, key, cfg) { + // Apply config defaults + this.cfg = this.cfg.extend(cfg); -/** - * Returns true if object is function, otherwise false - * - * @method isFunction - * @param {Object} - * @return {Boolean} - */ -var isFunction = function (object) { - return typeof object === 'function'; -}; + // Store transform mode and key + this._xformMode = xformMode; + this._key = key; -/** - * Returns true if object is Objet, otherwise false - * - * @method isObject - * @param {Object} - * @return {Boolean} - */ -var isObject = function (object) { - return typeof object === 'object'; -}; + // Set initial values + this.reset(); + }, -/** - * Returns true if object is boolean, otherwise false - * - * @method isBoolean - * @param {Object} - * @return {Boolean} - */ -var isBoolean = function (object) { - return typeof object === 'boolean'; -}; + /** + * Resets this cipher to its initial state. + * + * @example + * + * cipher.reset(); + */ + reset: function () { + // Reset data buffer + BufferedBlockAlgorithm.reset.call(this); -/** - * Returns true if object is array, otherwise false - * - * @method isArray - * @param {Object} - * @return {Boolean} - */ -var isArray = function (object) { - return object instanceof Array; -}; + // Perform concrete-cipher logic + this._doReset(); + }, -/** - * Returns true if given string is valid json object - * - * @method isJson - * @param {String} - * @return {Boolean} - */ -var isJson = function (str) { - try { - return !!JSON.parse(str); - } catch (e) { - return false; - } -}; + /** + * Adds data to be encrypted or decrypted. + * + * @param {WordArray|string} dataUpdate The data to encrypt or decrypt. + * + * @return {WordArray} The data after processing. + * + * @example + * + * var encrypted = cipher.process('data'); + * var encrypted = cipher.process(wordArray); + */ + process: function (dataUpdate) { + // Append + this._append(dataUpdate); -/** - * Returns true if given string is a valid Ethereum block header bloom. - * - * @method isBloom - * @param {String} hex encoded bloom filter - * @return {Boolean} - */ -var isBloom = function (bloom) { - if (!/^(0x)?[0-9a-f]{512}$/i.test(bloom)) { - return false; - } else if (/^(0x)?[0-9a-f]{512}$/.test(bloom) || /^(0x)?[0-9A-F]{512}$/.test(bloom)) { - return true; - } - return false; -}; + // Process available blocks + return this._process(); + }, -/** - * Returns true if given string is a valid log topic. - * - * @method isTopic - * @param {String} hex encoded topic - * @return {Boolean} - */ -var isTopic = function (topic) { - if (!/^(0x)?[0-9a-f]{64}$/i.test(topic)) { - return false; - } else if (/^(0x)?[0-9a-f]{64}$/.test(topic) || /^(0x)?[0-9A-F]{64}$/.test(topic)) { - return true; - } - return false; -}; + /** + * Finalizes the encryption or decryption process. + * Note that the finalize operation is effectively a destructive, read-once operation. + * + * @param {WordArray|string} dataUpdate The final data to encrypt or decrypt. + * + * @return {WordArray} The data after final processing. + * + * @example + * + * var encrypted = cipher.finalize(); + * var encrypted = cipher.finalize('data'); + * var encrypted = cipher.finalize(wordArray); + */ + finalize: function (dataUpdate) { + // Final data update + if (dataUpdate) { + this._append(dataUpdate); + } -module.exports = { - padLeft: padLeft, - padRight: padRight, - toHex: toHex, - toDecimal: toDecimal, - fromDecimal: fromDecimal, - toUtf8: toUtf8, - toAscii: toAscii, - fromUtf8: fromUtf8, - fromAscii: fromAscii, - transformToFullName: transformToFullName, - extractDisplayName: extractDisplayName, - extractTypeName: extractTypeName, - toWei: toWei, - fromWei: fromWei, - toBigNumber: toBigNumber, - toTwosComplement: toTwosComplement, - toAddress: toAddress, - isBigNumber: isBigNumber, - isStrictAddress: isStrictAddress, - isAddress: isAddress, - isChecksumAddress: isChecksumAddress, - toChecksumAddress: toChecksumAddress, - isFunction: isFunction, - isString: isString, - isObject: isObject, - isBoolean: isBoolean, - isArray: isArray, - isJson: isJson, - isBloom: isBloom, - isTopic: isTopic, -}; + // Perform concrete-cipher logic + var finalProcessedData = this._doFinalize(); + return finalProcessedData; + }, -/***/ }), -/* 14 */ -/***/ (function(module, exports, __webpack_require__) { + keySize: 128/32, -// Copyright 2015 Joyent, Inc. + ivSize: 128/32, -module.exports = { - bufferSplit: bufferSplit, - addRSAMissing: addRSAMissing, - calculateDSAPublic: calculateDSAPublic, - mpNormalize: mpNormalize, - ecNormalize: ecNormalize, - countZeros: countZeros, - assertCompatible: assertCompatible, - isCompatible: isCompatible, - opensslKeyDeriv: opensslKeyDeriv, - opensshCipherInfo: opensshCipherInfo -}; + _ENC_XFORM_MODE: 1, -var assert = __webpack_require__(10); -var PrivateKey = __webpack_require__(21); -var crypto = __webpack_require__(6); + _DEC_XFORM_MODE: 2, -var MAX_CLASS_DEPTH = 3; + /** + * Creates shortcut functions to a cipher's object interface. + * + * @param {Cipher} cipher The cipher to create a helper for. + * + * @return {Object} An object with encrypt and decrypt shortcut functions. + * + * @static + * + * @example + * + * var AES = CryptoJS.lib.Cipher._createHelper(CryptoJS.algo.AES); + */ + _createHelper: (function () { + function selectCipherStrategy(key) { + if (typeof key == 'string') { + return PasswordBasedCipher; + } else { + return SerializableCipher; + } + } -function isCompatible(obj, klass, needVer) { - if (obj === null || typeof (obj) !== 'object') - return (false); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return (true); - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - if (!proto || ++depth > MAX_CLASS_DEPTH) - return (false); - } - if (proto.constructor.name !== klass.name) - return (false); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - if (ver[0] != needVer[0] || ver[1] < needVer[1]) - return (false); - return (true); -} + return function (cipher) { + return { + encrypt: function (message, key, cfg) { + return selectCipherStrategy(key).encrypt(cipher, message, key, cfg); + }, -function assertCompatible(obj, klass, needVer, name) { - if (name === undefined) - name = 'object'; - assert.ok(obj, name + ' must not be null'); - assert.object(obj, name + ' must be an object'); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return; - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, - name + ' must be a ' + klass.name + ' instance'); - } - assert.strictEqual(proto.constructor.name, klass.name, - name + ' must be a ' + klass.name + ' instance'); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], - name + ' must be compatible with ' + klass.name + ' klass ' + - 'version ' + needVer[0] + '.' + needVer[1]); -} + decrypt: function (ciphertext, key, cfg) { + return selectCipherStrategy(key).decrypt(cipher, ciphertext, key, cfg); + } + }; + }; + }()) + }); -var CIPHER_LEN = { - 'des-ede3-cbc': { key: 7, iv: 8 }, - 'aes-128-cbc': { key: 16, iv: 16 } -}; -var PKCS5_SALT_LEN = 8; + /** + * Abstract base stream cipher template. + * + * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 1 (32 bits) + */ + var StreamCipher = C_lib.StreamCipher = Cipher.extend({ + _doFinalize: function () { + // Process partial blocks + var finalProcessedBlocks = this._process(!!'flush'); -function opensslKeyDeriv(cipher, salt, passphrase, count) { - assert.buffer(salt, 'salt'); - assert.buffer(passphrase, 'passphrase'); - assert.number(count, 'iteration count'); + return finalProcessedBlocks; + }, - var clen = CIPHER_LEN[cipher]; - assert.object(clen, 'supported cipher'); + blockSize: 1 + }); - salt = salt.slice(0, PKCS5_SALT_LEN); + /** + * Mode namespace. + */ + var C_mode = C.mode = {}; - var D, D_prev, bufs; - var material = new Buffer(0); - while (material.length < clen.key + clen.iv) { - bufs = []; - if (D_prev) - bufs.push(D_prev); - bufs.push(passphrase); - bufs.push(salt); - D = Buffer.concat(bufs); - for (var j = 0; j < count; ++j) - D = crypto.createHash('md5').update(D).digest(); - material = Buffer.concat([material, D]); - D_prev = D; - } + /** + * Abstract base block cipher mode template. + */ + var BlockCipherMode = C_lib.BlockCipherMode = Base.extend({ + /** + * Creates this mode for encryption. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @static + * + * @example + * + * var mode = CryptoJS.mode.CBC.createEncryptor(cipher, iv.words); + */ + createEncryptor: function (cipher, iv) { + return this.Encryptor.create(cipher, iv); + }, - return ({ - key: material.slice(0, clen.key), - iv: material.slice(clen.key, clen.key + clen.iv) - }); -} + /** + * Creates this mode for decryption. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @static + * + * @example + * + * var mode = CryptoJS.mode.CBC.createDecryptor(cipher, iv.words); + */ + createDecryptor: function (cipher, iv) { + return this.Decryptor.create(cipher, iv); + }, -/* Count leading zero bits on a buffer */ -function countZeros(buf) { - var o = 0, obit = 8; - while (o < buf.length) { - var mask = (1 << obit); - if ((buf[o] & mask) === mask) - break; - obit--; - if (obit < 0) { - o++; - obit = 8; - } - } - return (o*8 + (8 - obit) - 1); -} + /** + * Initializes a newly created mode. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @example + * + * var mode = CryptoJS.mode.CBC.Encryptor.create(cipher, iv.words); + */ + init: function (cipher, iv) { + this._cipher = cipher; + this._iv = iv; + } + }); -function bufferSplit(buf, chr) { - assert.buffer(buf); - assert.string(chr); + /** + * Cipher Block Chaining mode. + */ + var CBC = C_mode.CBC = (function () { + /** + * Abstract base CBC mode. + */ + var CBC = BlockCipherMode.extend(); - var parts = []; - var lastPart = 0; - var matches = 0; - for (var i = 0; i < buf.length; ++i) { - if (buf[i] === chr.charCodeAt(matches)) - ++matches; - else if (buf[i] === chr.charCodeAt(0)) - matches = 1; - else - matches = 0; + /** + * CBC encryptor. + */ + CBC.Encryptor = CBC.extend({ + /** + * Processes the data block at offset. + * + * @param {Array} words The data words to operate on. + * @param {number} offset The offset where the block starts. + * + * @example + * + * mode.processBlock(data.words, offset); + */ + processBlock: function (words, offset) { + // Shortcuts + var cipher = this._cipher; + var blockSize = cipher.blockSize; - if (matches >= chr.length) { - var newPart = i + 1; - parts.push(buf.slice(lastPart, newPart - matches)); - lastPart = newPart; - matches = 0; - } - } - if (lastPart <= buf.length) - parts.push(buf.slice(lastPart, buf.length)); + // XOR and encrypt + xorBlock.call(this, words, offset, blockSize); + cipher.encryptBlock(words, offset); - return (parts); -} + // Remember this block to use with next block + this._prevBlock = words.slice(offset, offset + blockSize); + } + }); -function ecNormalize(buf, addZero) { - assert.buffer(buf); - if (buf[0] === 0x00 && buf[1] === 0x04) { - if (addZero) - return (buf); - return (buf.slice(1)); - } else if (buf[0] === 0x04) { - if (!addZero) - return (buf); - } else { - while (buf[0] === 0x00) - buf = buf.slice(1); - if (buf[0] === 0x02 || buf[0] === 0x03) - throw (new Error('Compressed elliptic curve points ' + - 'are not supported')); - if (buf[0] !== 0x04) - throw (new Error('Not a valid elliptic curve point')); - if (!addZero) - return (buf); - } - var b = new Buffer(buf.length + 1); - b[0] = 0x0; - buf.copy(b, 1); - return (b); -} + /** + * CBC decryptor. + */ + CBC.Decryptor = CBC.extend({ + /** + * Processes the data block at offset. + * + * @param {Array} words The data words to operate on. + * @param {number} offset The offset where the block starts. + * + * @example + * + * mode.processBlock(data.words, offset); + */ + processBlock: function (words, offset) { + // Shortcuts + var cipher = this._cipher; + var blockSize = cipher.blockSize; -function mpNormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) - buf = buf.slice(1); - if ((buf[0] & 0x80) === 0x80) { - var b = new Buffer(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} + // Remember this block to use with next block + var thisBlock = words.slice(offset, offset + blockSize); -function bigintToMpBuf(bigint) { - var buf = new Buffer(bigint.toByteArray()); - buf = mpNormalize(buf); - return (buf); -} + // Decrypt and XOR + cipher.decryptBlock(words, offset); + xorBlock.call(this, words, offset, blockSize); -function calculateDSAPublic(g, p, x) { - assert.buffer(g); - assert.buffer(p); - assert.buffer(x); - try { - var bigInt = __webpack_require__(65).BigInteger; - } catch (e) { - throw (new Error('To load a PKCS#8 format DSA private key, ' + - 'the node jsbn library is required.')); - } - g = new bigInt(g); - p = new bigInt(p); - x = new bigInt(x); - var y = g.modPow(x, p); - var ybuf = bigintToMpBuf(y); - return (ybuf); -} + // This block becomes the previous block + this._prevBlock = thisBlock; + } + }); -function addRSAMissing(key) { - assert.object(key); - assertCompatible(key, PrivateKey, [1, 1]); - try { - var bigInt = __webpack_require__(65).BigInteger; - } catch (e) { - throw (new Error('To write a PEM private key from ' + - 'this source, the node jsbn lib is required.')); - } + function xorBlock(words, offset, blockSize) { + // Shortcut + var iv = this._iv; - var d = new bigInt(key.part.d.data); - var buf; + // Choose mixing block + if (iv) { + var block = iv; - if (!key.part.dmodp) { - var p = new bigInt(key.part.p.data); - var dmodp = d.mod(p.subtract(1)); + // Remove IV for subsequent blocks + this._iv = undefined; + } else { + var block = this._prevBlock; + } - buf = bigintToMpBuf(dmodp); - key.part.dmodp = {name: 'dmodp', data: buf}; - key.parts.push(key.part.dmodp); - } - if (!key.part.dmodq) { - var q = new bigInt(key.part.q.data); - var dmodq = d.mod(q.subtract(1)); + // XOR blocks + for (var i = 0; i < blockSize; i++) { + words[offset + i] ^= block[i]; + } + } - buf = bigintToMpBuf(dmodq); - key.part.dmodq = {name: 'dmodq', data: buf}; - key.parts.push(key.part.dmodq); - } -} + return CBC; + }()); -function opensshCipherInfo(cipher) { - var inf = {}; - switch (cipher) { - case '3des-cbc': - inf.keySize = 24; - inf.blockSize = 8; - inf.opensslName = 'des-ede3-cbc'; - break; - case 'blowfish-cbc': - inf.keySize = 16; - inf.blockSize = 8; - inf.opensslName = 'bf-cbc'; - break; - case 'aes128-cbc': - case 'aes128-ctr': - case 'aes128-gcm@openssh.com': - inf.keySize = 16; - inf.blockSize = 16; - inf.opensslName = 'aes-128-' + cipher.slice(7, 10); - break; - case 'aes192-cbc': - case 'aes192-ctr': - case 'aes192-gcm@openssh.com': - inf.keySize = 24; - inf.blockSize = 16; - inf.opensslName = 'aes-192-' + cipher.slice(7, 10); - break; - case 'aes256-cbc': - case 'aes256-ctr': - case 'aes256-gcm@openssh.com': - inf.keySize = 32; - inf.blockSize = 16; - inf.opensslName = 'aes-256-' + cipher.slice(7, 10); - break; - default: - throw (new Error( - 'Unsupported openssl cipher "' + cipher + '"')); - } - return (inf); -} + /** + * Padding namespace. + */ + var C_pad = C.pad = {}; + /** + * PKCS #5/7 padding strategy. + */ + var Pkcs7 = C_pad.Pkcs7 = { + /** + * Pads data using the algorithm defined in PKCS #5/7. + * + * @param {WordArray} data The data to pad. + * @param {number} blockSize The multiple that the data should be padded to. + * + * @static + * + * @example + * + * CryptoJS.pad.Pkcs7.pad(wordArray, 4); + */ + pad: function (data, blockSize) { + // Shortcut + var blockSizeBytes = blockSize * 4; -/***/ }), -/* 15 */ -/***/ (function(module, exports, __webpack_require__) { + // Count padding bytes + var nPaddingBytes = blockSizeBytes - data.sigBytes % blockSizeBytes; -/* - This file is part of web3.js. + // Create padding word + var paddingWord = (nPaddingBytes << 24) | (nPaddingBytes << 16) | (nPaddingBytes << 8) | nPaddingBytes; - web3.js is free software: you can redistribute it and/or modify - it under the terms of the GNU Lesser General Public License as published by - the Free Software Foundation, either version 3 of the License, or - (at your option) any later version. + // Create padding + var paddingWords = []; + for (var i = 0; i < nPaddingBytes; i += 4) { + paddingWords.push(paddingWord); + } + var padding = WordArray.create(paddingWords, nPaddingBytes); - web3.js is distributed in the hope that it will be useful, - but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - GNU Lesser General Public License for more details. + // Add padding + data.concat(padding); + }, - You should have received a copy of the GNU Lesser General Public License - along with web3.js. If not, see . -*/ -/** - * @file utils.js - * @author Marek Kotewicz - * @date 2015 - */ - -/** - * Utils - * - * @module utils - */ - -/** - * Utility functions - * - * @class [utils] utils - * @constructor - */ - - -var BigNumber = __webpack_require__(110); -var sha3 = __webpack_require__(111); -var utf8 = __webpack_require__(153); - -var unitMap = { - 'noether': '0', - 'wei': '1', - 'kwei': '1000', - 'Kwei': '1000', - 'babbage': '1000', - 'femtoether': '1000', - 'mwei': '1000000', - 'Mwei': '1000000', - 'lovelace': '1000000', - 'picoether': '1000000', - 'gwei': '1000000000', - 'Gwei': '1000000000', - 'shannon': '1000000000', - 'nanoether': '1000000000', - 'nano': '1000000000', - 'szabo': '1000000000000', - 'microether': '1000000000000', - 'micro': '1000000000000', - 'finney': '1000000000000000', - 'milliether': '1000000000000000', - 'milli': '1000000000000000', - 'ether': '1000000000000000000', - 'kether': '1000000000000000000000', - 'grand': '1000000000000000000000', - 'mether': '1000000000000000000000000', - 'gether': '1000000000000000000000000000', - 'tether': '1000000000000000000000000000000' -}; - -/** - * Should be called to pad string to expected length - * - * @method padLeft - * @param {String} string to be padded - * @param {Number} characters that result string should have - * @param {String} sign, by default 0 - * @returns {String} right aligned string - */ -var padLeft = function (string, chars, sign) { - return new Array(chars - string.length + 1).join(sign ? sign : "0") + string; -}; + /** + * Unpads data that had been padded using the algorithm defined in PKCS #5/7. + * + * @param {WordArray} data The data to unpad. + * + * @static + * + * @example + * + * CryptoJS.pad.Pkcs7.unpad(wordArray); + */ + unpad: function (data) { + // Get number of padding bytes from last byte + var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff; -/** - * Should be called to pad string to expected length - * - * @method padRight - * @param {String} string to be padded - * @param {Number} characters that result string should have - * @param {String} sign, by default 0 - * @returns {String} right aligned string - */ -var padRight = function (string, chars, sign) { - return string + (new Array(chars - string.length + 1).join(sign ? sign : "0")); -}; + // Remove padding + data.sigBytes -= nPaddingBytes; + } + }; -/** - * Should be called to get utf8 from it's hex representation - * - * @method toUtf8 - * @param {String} string in hex - * @returns {String} ascii string representation of hex value - */ -var toUtf8 = function(hex) { -// Find termination - var str = ""; - var i = 0, l = hex.length; - if (hex.substring(0, 2) === '0x') { - i = 2; - } - for (; i < l; i+=2) { - var code = parseInt(hex.substr(i, 2), 16); - if (code === 0) - break; - str += String.fromCharCode(code); - } + /** + * Abstract base block cipher template. + * + * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 4 (128 bits) + */ + var BlockCipher = C_lib.BlockCipher = Cipher.extend({ + /** + * Configuration options. + * + * @property {Mode} mode The block mode to use. Default: CBC + * @property {Padding} padding The padding strategy to use. Default: Pkcs7 + */ + cfg: Cipher.cfg.extend({ + mode: CBC, + padding: Pkcs7 + }), - return utf8.decode(str); -}; + reset: function () { + // Reset cipher + Cipher.reset.call(this); -/** - * Should be called to get ascii from it's hex representation - * - * @method toAscii - * @param {String} string in hex - * @returns {String} ascii string representation of hex value - */ -var toAscii = function(hex) { -// Find termination - var str = ""; - var i = 0, l = hex.length; - if (hex.substring(0, 2) === '0x') { - i = 2; - } - for (; i < l; i+=2) { - var code = parseInt(hex.substr(i, 2), 16); - str += String.fromCharCode(code); - } + // Shortcuts + var cfg = this.cfg; + var iv = cfg.iv; + var mode = cfg.mode; - return str; -}; + // Reset block mode + if (this._xformMode == this._ENC_XFORM_MODE) { + var modeCreator = mode.createEncryptor; + } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ { + var modeCreator = mode.createDecryptor; -/** - * Should be called to get hex representation (prefixed by 0x) of utf8 string - * - * @method fromUtf8 - * @param {String} string - * @param {Number} optional padding - * @returns {String} hex representation of input string - */ -var fromUtf8 = function(str) { - str = utf8.encode(str); - var hex = ""; - for(var i = 0; i < str.length; i++) { - var code = str.charCodeAt(i); - if (code === 0) - break; - var n = code.toString(16); - hex += n.length < 2 ? '0' + n : n; - } + // Keep at least one block in the buffer for unpadding + this._minBufferSize = 1; + } + this._mode = modeCreator.call(mode, this, iv && iv.words); + }, - return "0x" + hex; -}; + _doProcessBlock: function (words, offset) { + this._mode.processBlock(words, offset); + }, -/** - * Should be called to get hex representation (prefixed by 0x) of ascii string - * - * @method fromAscii - * @param {String} string - * @param {Number} optional padding - * @returns {String} hex representation of input string - */ -var fromAscii = function(str) { - var hex = ""; - for(var i = 0; i < str.length; i++) { - var code = str.charCodeAt(i); - var n = code.toString(16); - hex += n.length < 2 ? '0' + n : n; - } + _doFinalize: function () { + // Shortcut + var padding = this.cfg.padding; - return "0x" + hex; -}; + // Finalize + if (this._xformMode == this._ENC_XFORM_MODE) { + // Pad data + padding.pad(this._data, this.blockSize); -/** - * Should be used to create full function/event name from json abi - * - * @method transformToFullName - * @param {Object} json-abi - * @return {String} full fnction/event name - */ -var transformToFullName = function (json) { - if (json.name.indexOf('(') !== -1) { - return json.name; - } + // Process final blocks + var finalProcessedBlocks = this._process(!!'flush'); + } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ { + // Process final blocks + var finalProcessedBlocks = this._process(!!'flush'); - var typeName = json.inputs.map(function(i){return i.type; }).join(); - return json.name + '(' + typeName + ')'; -}; + // Unpad data + padding.unpad(finalProcessedBlocks); + } -/** - * Should be called to get display name of contract function - * - * @method extractDisplayName - * @param {String} name of function/event - * @returns {String} display name for function/event eg. multiply(uint256) -> multiply - */ -var extractDisplayName = function (name) { - var length = name.indexOf('('); - return length !== -1 ? name.substr(0, length) : name; -}; + return finalProcessedBlocks; + }, -/// @returns overloaded part of function/event name -var extractTypeName = function (name) { - /// TODO: make it invulnerable - var length = name.indexOf('('); - return length !== -1 ? name.substr(length + 1, name.length - 1 - (length + 1)).replace(' ', '') : ""; -}; + blockSize: 128/32 + }); -/** - * Converts value to it's decimal representation in string - * - * @method toDecimal - * @param {String|Number|BigNumber} - * @return {String} - */ -var toDecimal = function (value) { - return toBigNumber(value).toNumber(); -}; + /** + * A collection of cipher parameters. + * + * @property {WordArray} ciphertext The raw ciphertext. + * @property {WordArray} key The key to this ciphertext. + * @property {WordArray} iv The IV used in the ciphering operation. + * @property {WordArray} salt The salt used with a key derivation function. + * @property {Cipher} algorithm The cipher algorithm. + * @property {Mode} mode The block mode used in the ciphering operation. + * @property {Padding} padding The padding scheme used in the ciphering operation. + * @property {number} blockSize The block size of the cipher. + * @property {Format} formatter The default formatting strategy to convert this cipher params object to a string. + */ + var CipherParams = C_lib.CipherParams = Base.extend({ + /** + * Initializes a newly created cipher params object. + * + * @param {Object} cipherParams An object with any of the possible cipher parameters. + * + * @example + * + * var cipherParams = CryptoJS.lib.CipherParams.create({ + * ciphertext: ciphertextWordArray, + * key: keyWordArray, + * iv: ivWordArray, + * salt: saltWordArray, + * algorithm: CryptoJS.algo.AES, + * mode: CryptoJS.mode.CBC, + * padding: CryptoJS.pad.PKCS7, + * blockSize: 4, + * formatter: CryptoJS.format.OpenSSL + * }); + */ + init: function (cipherParams) { + this.mixIn(cipherParams); + }, -/** - * Converts value to it's hex representation - * - * @method fromDecimal - * @param {String|Number|BigNumber} - * @return {String} - */ -var fromDecimal = function (value) { - var number = toBigNumber(value); - var result = number.toString(16); + /** + * Converts this cipher params object to a string. + * + * @param {Format} formatter (Optional) The formatting strategy to use. + * + * @return {string} The stringified cipher params. + * + * @throws Error If neither the formatter nor the default formatter is set. + * + * @example + * + * var string = cipherParams + ''; + * var string = cipherParams.toString(); + * var string = cipherParams.toString(CryptoJS.format.OpenSSL); + */ + toString: function (formatter) { + return (formatter || this.formatter).stringify(this); + } + }); - return number.lessThan(0) ? '-0x' + result.substr(1) : '0x' + result; -}; + /** + * Format namespace. + */ + var C_format = C.format = {}; -/** - * Auto converts any given value into it's hex representation. - * - * And even stringifys objects before. - * - * @method toHex - * @param {String|Number|BigNumber|Object} - * @return {String} - */ -var toHex = function (val) { - /*jshint maxcomplexity: 8 */ + /** + * OpenSSL formatting strategy. + */ + var OpenSSLFormatter = C_format.OpenSSL = { + /** + * Converts a cipher params object to an OpenSSL-compatible string. + * + * @param {CipherParams} cipherParams The cipher params object. + * + * @return {string} The OpenSSL-compatible string. + * + * @static + * + * @example + * + * var openSSLString = CryptoJS.format.OpenSSL.stringify(cipherParams); + */ + stringify: function (cipherParams) { + // Shortcuts + var ciphertext = cipherParams.ciphertext; + var salt = cipherParams.salt; - if (isBoolean(val)) - return fromDecimal(+val); + // Format + if (salt) { + var wordArray = WordArray.create([0x53616c74, 0x65645f5f]).concat(salt).concat(ciphertext); + } else { + var wordArray = ciphertext; + } - if (isBigNumber(val)) - return fromDecimal(val); + return wordArray.toString(Base64); + }, - if (typeof val === 'object') - return fromUtf8(JSON.stringify(val)); + /** + * Converts an OpenSSL-compatible string to a cipher params object. + * + * @param {string} openSSLStr The OpenSSL-compatible string. + * + * @return {CipherParams} The cipher params object. + * + * @static + * + * @example + * + * var cipherParams = CryptoJS.format.OpenSSL.parse(openSSLString); + */ + parse: function (openSSLStr) { + // Parse base64 + var ciphertext = Base64.parse(openSSLStr); - // if its a negative number, pass it through fromDecimal - if (isString(val)) { - if (val.indexOf('-0x') === 0) - return fromDecimal(val); - else if(val.indexOf('0x') === 0) - return val; - else if (!isFinite(val)) - return fromAscii(val); - } + // Shortcut + var ciphertextWords = ciphertext.words; - return fromDecimal(val); -}; + // Test for salt + if (ciphertextWords[0] == 0x53616c74 && ciphertextWords[1] == 0x65645f5f) { + // Extract salt + var salt = WordArray.create(ciphertextWords.slice(2, 4)); -/** - * Returns value of unit in Wei - * - * @method getValueOfUnit - * @param {String} unit the unit to convert to, default ether - * @returns {BigNumber} value of the unit (in Wei) - * @throws error if the unit is not correct:w - */ -var getValueOfUnit = function (unit) { - unit = unit ? unit.toLowerCase() : 'ether'; - var unitValue = unitMap[unit]; - if (unitValue === undefined) { - throw new Error('This unit doesn\'t exists, please use the one of the following units' + JSON.stringify(unitMap, null, 2)); - } - return new BigNumber(unitValue, 10); -}; + // Remove salt from ciphertext + ciphertextWords.splice(0, 4); + ciphertext.sigBytes -= 16; + } -/** - * Takes a number of wei and converts it to any other ether unit. - * - * Possible units are: - * SI Short SI Full Effigy Other - * - kwei femtoether babbage - * - mwei picoether lovelace - * - gwei nanoether shannon nano - * - -- microether szabo micro - * - -- milliether finney milli - * - ether -- -- - * - kether -- grand - * - mether - * - gether - * - tether - * - * @method fromWei - * @param {Number|String} number can be a number, number string or a HEX of a decimal - * @param {String} unit the unit to convert to, default ether - * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number -*/ -var fromWei = function(number, unit) { - var returnValue = toBigNumber(number).dividedBy(getValueOfUnit(unit)); + return CipherParams.create({ ciphertext: ciphertext, salt: salt }); + } + }; - return isBigNumber(number) ? returnValue : returnValue.toString(10); -}; + /** + * A cipher wrapper that returns ciphertext as a serializable cipher params object. + */ + var SerializableCipher = C_lib.SerializableCipher = Base.extend({ + /** + * Configuration options. + * + * @property {Formatter} format The formatting strategy to convert cipher param objects to and from a string. Default: OpenSSL + */ + cfg: Base.extend({ + format: OpenSSLFormatter + }), -/** - * Takes a number of a unit and converts it to wei. - * - * Possible units are: - * SI Short SI Full Effigy Other - * - kwei femtoether babbage - * - mwei picoether lovelace - * - gwei nanoether shannon nano - * - -- microether szabo micro - * - -- microether szabo micro - * - -- milliether finney milli - * - ether -- -- - * - kether -- grand - * - mether - * - gether - * - tether - * - * @method toWei - * @param {Number|String|BigNumber} number can be a number, number string or a HEX of a decimal - * @param {String} unit the unit to convert from, default ether - * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number -*/ -var toWei = function(number, unit) { - var returnValue = toBigNumber(number).times(getValueOfUnit(unit)); + /** + * Encrypts a message. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {WordArray|string} message The message to encrypt. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {CipherParams} A cipher params object. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key); + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv }); + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + */ + encrypt: function (cipher, message, key, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); - return isBigNumber(number) ? returnValue : returnValue.toString(10); -}; + // Encrypt + var encryptor = cipher.createEncryptor(key, cfg); + var ciphertext = encryptor.finalize(message); -/** - * Takes an input and transforms it into an bignumber - * - * @method toBigNumber - * @param {Number|String|BigNumber} a number, string, HEX string or BigNumber - * @return {BigNumber} BigNumber -*/ -var toBigNumber = function(number) { - /*jshint maxcomplexity:5 */ - number = number || 0; - if (isBigNumber(number)) - return number; + // Shortcut + var cipherCfg = encryptor.cfg; - if (isString(number) && (number.indexOf('0x') === 0 || number.indexOf('-0x') === 0)) { - return new BigNumber(number.replace('0x',''), 16); - } + // Create and return serializable cipher params + return CipherParams.create({ + ciphertext: ciphertext, + key: key, + iv: cipherCfg.iv, + algorithm: cipher, + mode: cipherCfg.mode, + padding: cipherCfg.padding, + blockSize: cipher.blockSize, + formatter: cfg.format + }); + }, - return new BigNumber(number.toString(10), 10); -}; + /** + * Decrypts serialized ciphertext. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {CipherParams|string} ciphertext The ciphertext to decrypt. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {WordArray} The plaintext. + * + * @static + * + * @example + * + * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + */ + decrypt: function (cipher, ciphertext, key, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); -/** - * Takes and input transforms it into bignumber and if it is negative value, into two's complement - * - * @method toTwosComplement - * @param {Number|String|BigNumber} - * @return {BigNumber} - */ -var toTwosComplement = function (number) { - var bigNumber = toBigNumber(number).round(); - if (bigNumber.lessThan(0)) { - return new BigNumber("ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff", 16).plus(bigNumber).plus(1); - } - return bigNumber; -}; + // Convert string to CipherParams + ciphertext = this._parse(ciphertext, cfg.format); -/** - * Checks if the given string is strictly an address - * - * @method isStrictAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isStrictAddress = function (address) { - return /^0x[0-9a-f]{40}$/i.test(address); -}; + // Decrypt + var plaintext = cipher.createDecryptor(key, cfg).finalize(ciphertext.ciphertext); -/** - * Checks if the given string is an address - * - * @method isAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isAddress = function (address) { - if (!/^(0x)?[0-9a-f]{40}$/i.test(address)) { - // check if it has the basic requirements of an address - return false; - } else if (/^(0x)?[0-9a-f]{40}$/.test(address) || /^(0x)?[0-9A-F]{40}$/.test(address)) { - // If it's all small caps or all all caps, return true - return true; - } else { - // Otherwise check each case - return isChecksumAddress(address); - } -}; + return plaintext; + }, -/** - * Checks if the given string is a checksummed address - * - * @method isChecksumAddress - * @param {String} address the given HEX adress - * @return {Boolean} -*/ -var isChecksumAddress = function (address) { - // Check each case - address = address.replace('0x',''); - var addressHash = sha3(address.toLowerCase()); + /** + * Converts serialized ciphertext to CipherParams, + * else assumed CipherParams already and returns ciphertext unchanged. + * + * @param {CipherParams|string} ciphertext The ciphertext. + * @param {Formatter} format The formatting strategy to use to parse serialized ciphertext. + * + * @return {CipherParams} The unserialized ciphertext. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.SerializableCipher._parse(ciphertextStringOrParams, format); + */ + _parse: function (ciphertext, format) { + if (typeof ciphertext == 'string') { + return format.parse(ciphertext, this); + } else { + return ciphertext; + } + } + }); - for (var i = 0; i < 40; i++ ) { - // the nth letter should be uppercase if the nth digit of casemap is 1 - if ((parseInt(addressHash[i], 16) > 7 && address[i].toUpperCase() !== address[i]) || (parseInt(addressHash[i], 16) <= 7 && address[i].toLowerCase() !== address[i])) { - return false; - } - } - return true; -}; + /** + * Key derivation function namespace. + */ + var C_kdf = C.kdf = {}; + /** + * OpenSSL key derivation function. + */ + var OpenSSLKdf = C_kdf.OpenSSL = { + /** + * Derives a key and IV from a password. + * + * @param {string} password The password to derive from. + * @param {number} keySize The size in words of the key to generate. + * @param {number} ivSize The size in words of the IV to generate. + * @param {WordArray|string} salt (Optional) A 64-bit salt to use. If omitted, a salt will be generated randomly. + * + * @return {CipherParams} A cipher params object with the key, IV, and salt. + * + * @static + * + * @example + * + * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32); + * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32, 'saltsalt'); + */ + execute: function (password, keySize, ivSize, salt) { + // Generate random salt + if (!salt) { + salt = WordArray.random(64/8); + } + // Derive key and IV + var key = EvpKDF.create({ keySize: keySize + ivSize }).compute(password, salt); -/** - * Makes a checksum address - * - * @method toChecksumAddress - * @param {String} address the given HEX adress - * @return {String} -*/ -var toChecksumAddress = function (address) { - if (typeof address === 'undefined') return ''; + // Separate key and IV + var iv = WordArray.create(key.words.slice(keySize), ivSize * 4); + key.sigBytes = keySize * 4; - address = address.toLowerCase().replace('0x',''); - var addressHash = sha3(address); - var checksumAddress = '0x'; + // Return params + return CipherParams.create({ key: key, iv: iv, salt: salt }); + } + }; - for (var i = 0; i < address.length; i++ ) { - // If ith character is 9 to f then make it uppercase - if (parseInt(addressHash[i], 16) > 7) { - checksumAddress += address[i].toUpperCase(); - } else { - checksumAddress += address[i]; - } - } - return checksumAddress; -}; + /** + * A serializable cipher wrapper that derives the key from a password, + * and returns ciphertext as a serializable cipher params object. + */ + var PasswordBasedCipher = C_lib.PasswordBasedCipher = SerializableCipher.extend({ + /** + * Configuration options. + * + * @property {KDF} kdf The key derivation function to use to generate a key and IV from a password. Default: OpenSSL + */ + cfg: SerializableCipher.cfg.extend({ + kdf: OpenSSLKdf + }), -/** - * Transforms given string to valid 20 bytes-length addres with 0x prefix - * - * @method toAddress - * @param {String} address - * @return {String} formatted address - */ -var toAddress = function (address) { - if (isStrictAddress(address)) { - return address; - } + /** + * Encrypts a message using a password. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {WordArray|string} message The message to encrypt. + * @param {string} password The password. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {CipherParams} A cipher params object. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password'); + * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password', { format: CryptoJS.format.OpenSSL }); + */ + encrypt: function (cipher, message, password, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); - if (/^[0-9a-f]{40}$/.test(address)) { - return '0x' + address; - } + // Derive key and other params + var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize); - return '0x' + padLeft(toHex(address).substr(2), 40); -}; + // Add IV to config + cfg.iv = derivedParams.iv; -/** - * Returns true if object is BigNumber, otherwise false - * - * @method isBigNumber - * @param {Object} - * @return {Boolean} - */ -var isBigNumber = function (object) { - return object instanceof BigNumber || - (object && object.constructor && object.constructor.name === 'BigNumber'); -}; + // Encrypt + var ciphertext = SerializableCipher.encrypt.call(this, cipher, message, derivedParams.key, cfg); -/** - * Returns true if object is string, otherwise false - * - * @method isString - * @param {Object} - * @return {Boolean} - */ -var isString = function (object) { - return typeof object === 'string' || - (object && object.constructor && object.constructor.name === 'String'); -}; + // Mix in derived params + ciphertext.mixIn(derivedParams); -/** - * Returns true if object is function, otherwise false - * - * @method isFunction - * @param {Object} - * @return {Boolean} - */ -var isFunction = function (object) { - return typeof object === 'function'; -}; + return ciphertext; + }, -/** - * Returns true if object is Objet, otherwise false - * - * @method isObject - * @param {Object} - * @return {Boolean} - */ -var isObject = function (object) { - return object !== null && !(object instanceof Array) && typeof object === 'object'; -}; + /** + * Decrypts serialized ciphertext using a password. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {CipherParams|string} ciphertext The ciphertext to decrypt. + * @param {string} password The password. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {WordArray} The plaintext. + * + * @static + * + * @example + * + * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, 'password', { format: CryptoJS.format.OpenSSL }); + * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, 'password', { format: CryptoJS.format.OpenSSL }); + */ + decrypt: function (cipher, ciphertext, password, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); -/** - * Returns true if object is boolean, otherwise false - * - * @method isBoolean - * @param {Object} - * @return {Boolean} - */ -var isBoolean = function (object) { - return typeof object === 'boolean'; -}; + // Convert string to CipherParams + ciphertext = this._parse(ciphertext, cfg.format); -/** - * Returns true if object is array, otherwise false - * - * @method isArray - * @param {Object} - * @return {Boolean} - */ -var isArray = function (object) { - return object instanceof Array; -}; + // Derive key and other params + var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize, ciphertext.salt); -/** - * Returns true if given string is valid json object - * - * @method isJson - * @param {String} - * @return {Boolean} - */ -var isJson = function (str) { - try { - return !!JSON.parse(str); - } catch (e) { - return false; - } -}; + // Add IV to config + cfg.iv = derivedParams.iv; -/** - * Returns true if given string is a valid Ethereum block header bloom. - * - * @method isBloom - * @param {String} hex encoded bloom filter - * @return {Boolean} - */ -var isBloom = function (bloom) { - if (!/^(0x)?[0-9a-f]{512}$/i.test(bloom)) { - return false; - } else if (/^(0x)?[0-9a-f]{512}$/.test(bloom) || /^(0x)?[0-9A-F]{512}$/.test(bloom)) { - return true; - } - return false; -}; + // Decrypt + var plaintext = SerializableCipher.decrypt.call(this, cipher, ciphertext, derivedParams.key, cfg); -/** - * Returns true if given string is a valid log topic. - * - * @method isTopic - * @param {String} hex encoded topic - * @return {Boolean} - */ -var isTopic = function (topic) { - if (!/^(0x)?[0-9a-f]{64}$/i.test(topic)) { - return false; - } else if (/^(0x)?[0-9a-f]{64}$/.test(topic) || /^(0x)?[0-9A-F]{64}$/.test(topic)) { - return true; - } - return false; -}; + return plaintext; + } + }); + }()); -module.exports = { - padLeft: padLeft, - padRight: padRight, - toHex: toHex, - toDecimal: toDecimal, - fromDecimal: fromDecimal, - toUtf8: toUtf8, - toAscii: toAscii, - fromUtf8: fromUtf8, - fromAscii: fromAscii, - transformToFullName: transformToFullName, - extractDisplayName: extractDisplayName, - extractTypeName: extractTypeName, - toWei: toWei, - fromWei: fromWei, - toBigNumber: toBigNumber, - toTwosComplement: toTwosComplement, - toAddress: toAddress, - isBigNumber: isBigNumber, - isStrictAddress: isStrictAddress, - isAddress: isAddress, - isChecksumAddress: isChecksumAddress, - toChecksumAddress: toChecksumAddress, - isFunction: isFunction, - isString: isString, - isObject: isObject, - isBoolean: isBoolean, - isArray: isArray, - isJson: isJson, - isBloom: isBloom, - isTopic: isTopic, -}; +})); /***/ }), /* 16 */ /***/ (function(module, exports, __webpack_require__) { -/* - This file is part of web3.js. - - web3.js is free software: you can redistribute it and/or modify - it under the terms of the GNU Lesser General Public License as published by - the Free Software Foundation, either version 3 of the License, or - (at your option) any later version. +;(function (root, factory) { + if (true) { + // CommonJS + module.exports = exports = factory(__webpack_require__(5)); + } + else if (typeof define === "function" && define.amd) { + // AMD + define(["./core"], factory); + } + else { + // Global (browser) + factory(root.CryptoJS); + } +}(this, function (CryptoJS) { - web3.js is distributed in the hope that it will be useful, - but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - GNU Lesser General Public License for more details. + /** + * Cipher core components. + */ + CryptoJS.lib.Cipher || (function (undefined) { + // Shortcuts + var C = CryptoJS; + var C_lib = C.lib; + var Base = C_lib.Base; + var WordArray = C_lib.WordArray; + var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm; + var C_enc = C.enc; + var Utf8 = C_enc.Utf8; + var Base64 = C_enc.Base64; + var C_algo = C.algo; + var EvpKDF = C_algo.EvpKDF; - You should have received a copy of the GNU Lesser General Public License - along with web3.js. If not, see . -*/ -/** - * @file utils.js - * @author Marek Kotewicz - * @date 2015 - */ + /** + * Abstract base cipher template. + * + * @property {number} keySize This cipher's key size. Default: 4 (128 bits) + * @property {number} ivSize This cipher's IV size. Default: 4 (128 bits) + * @property {number} _ENC_XFORM_MODE A constant representing encryption mode. + * @property {number} _DEC_XFORM_MODE A constant representing decryption mode. + */ + var Cipher = C_lib.Cipher = BufferedBlockAlgorithm.extend({ + /** + * Configuration options. + * + * @property {WordArray} iv The IV to use for this operation. + */ + cfg: Base.extend(), -/** - * Utils - * - * @module utils - */ + /** + * Creates this cipher in encryption mode. + * + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {Cipher} A cipher instance. + * + * @static + * + * @example + * + * var cipher = CryptoJS.algo.AES.createEncryptor(keyWordArray, { iv: ivWordArray }); + */ + createEncryptor: function (key, cfg) { + return this.create(this._ENC_XFORM_MODE, key, cfg); + }, + + /** + * Creates this cipher in decryption mode. + * + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {Cipher} A cipher instance. + * + * @static + * + * @example + * + * var cipher = CryptoJS.algo.AES.createDecryptor(keyWordArray, { iv: ivWordArray }); + */ + createDecryptor: function (key, cfg) { + return this.create(this._DEC_XFORM_MODE, key, cfg); + }, + + /** + * Initializes a newly created cipher. + * + * @param {number} xformMode Either the encryption or decryption transormation mode constant. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @example + * + * var cipher = CryptoJS.algo.AES.create(CryptoJS.algo.AES._ENC_XFORM_MODE, keyWordArray, { iv: ivWordArray }); + */ + init: function (xformMode, key, cfg) { + // Apply config defaults + this.cfg = this.cfg.extend(cfg); + + // Store transform mode and key + this._xformMode = xformMode; + this._key = key; + + // Set initial values + this.reset(); + }, + + /** + * Resets this cipher to its initial state. + * + * @example + * + * cipher.reset(); + */ + reset: function () { + // Reset data buffer + BufferedBlockAlgorithm.reset.call(this); + + // Perform concrete-cipher logic + this._doReset(); + }, + + /** + * Adds data to be encrypted or decrypted. + * + * @param {WordArray|string} dataUpdate The data to encrypt or decrypt. + * + * @return {WordArray} The data after processing. + * + * @example + * + * var encrypted = cipher.process('data'); + * var encrypted = cipher.process(wordArray); + */ + process: function (dataUpdate) { + // Append + this._append(dataUpdate); + + // Process available blocks + return this._process(); + }, + + /** + * Finalizes the encryption or decryption process. + * Note that the finalize operation is effectively a destructive, read-once operation. + * + * @param {WordArray|string} dataUpdate The final data to encrypt or decrypt. + * + * @return {WordArray} The data after final processing. + * + * @example + * + * var encrypted = cipher.finalize(); + * var encrypted = cipher.finalize('data'); + * var encrypted = cipher.finalize(wordArray); + */ + finalize: function (dataUpdate) { + // Final data update + if (dataUpdate) { + this._append(dataUpdate); + } + + // Perform concrete-cipher logic + var finalProcessedData = this._doFinalize(); + + return finalProcessedData; + }, + + keySize: 128/32, + + ivSize: 128/32, + + _ENC_XFORM_MODE: 1, + + _DEC_XFORM_MODE: 2, + + /** + * Creates shortcut functions to a cipher's object interface. + * + * @param {Cipher} cipher The cipher to create a helper for. + * + * @return {Object} An object with encrypt and decrypt shortcut functions. + * + * @static + * + * @example + * + * var AES = CryptoJS.lib.Cipher._createHelper(CryptoJS.algo.AES); + */ + _createHelper: (function () { + function selectCipherStrategy(key) { + if (typeof key == 'string') { + return PasswordBasedCipher; + } else { + return SerializableCipher; + } + } + + return function (cipher) { + return { + encrypt: function (message, key, cfg) { + return selectCipherStrategy(key).encrypt(cipher, message, key, cfg); + }, + + decrypt: function (ciphertext, key, cfg) { + return selectCipherStrategy(key).decrypt(cipher, ciphertext, key, cfg); + } + }; + }; + }()) + }); + + /** + * Abstract base stream cipher template. + * + * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 1 (32 bits) + */ + var StreamCipher = C_lib.StreamCipher = Cipher.extend({ + _doFinalize: function () { + // Process partial blocks + var finalProcessedBlocks = this._process(!!'flush'); + + return finalProcessedBlocks; + }, + + blockSize: 1 + }); + + /** + * Mode namespace. + */ + var C_mode = C.mode = {}; + + /** + * Abstract base block cipher mode template. + */ + var BlockCipherMode = C_lib.BlockCipherMode = Base.extend({ + /** + * Creates this mode for encryption. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @static + * + * @example + * + * var mode = CryptoJS.mode.CBC.createEncryptor(cipher, iv.words); + */ + createEncryptor: function (cipher, iv) { + return this.Encryptor.create(cipher, iv); + }, + + /** + * Creates this mode for decryption. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @static + * + * @example + * + * var mode = CryptoJS.mode.CBC.createDecryptor(cipher, iv.words); + */ + createDecryptor: function (cipher, iv) { + return this.Decryptor.create(cipher, iv); + }, + + /** + * Initializes a newly created mode. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @example + * + * var mode = CryptoJS.mode.CBC.Encryptor.create(cipher, iv.words); + */ + init: function (cipher, iv) { + this._cipher = cipher; + this._iv = iv; + } + }); + + /** + * Cipher Block Chaining mode. + */ + var CBC = C_mode.CBC = (function () { + /** + * Abstract base CBC mode. + */ + var CBC = BlockCipherMode.extend(); + + /** + * CBC encryptor. + */ + CBC.Encryptor = CBC.extend({ + /** + * Processes the data block at offset. + * + * @param {Array} words The data words to operate on. + * @param {number} offset The offset where the block starts. + * + * @example + * + * mode.processBlock(data.words, offset); + */ + processBlock: function (words, offset) { + // Shortcuts + var cipher = this._cipher; + var blockSize = cipher.blockSize; + + // XOR and encrypt + xorBlock.call(this, words, offset, blockSize); + cipher.encryptBlock(words, offset); + + // Remember this block to use with next block + this._prevBlock = words.slice(offset, offset + blockSize); + } + }); + + /** + * CBC decryptor. + */ + CBC.Decryptor = CBC.extend({ + /** + * Processes the data block at offset. + * + * @param {Array} words The data words to operate on. + * @param {number} offset The offset where the block starts. + * + * @example + * + * mode.processBlock(data.words, offset); + */ + processBlock: function (words, offset) { + // Shortcuts + var cipher = this._cipher; + var blockSize = cipher.blockSize; + + // Remember this block to use with next block + var thisBlock = words.slice(offset, offset + blockSize); + + // Decrypt and XOR + cipher.decryptBlock(words, offset); + xorBlock.call(this, words, offset, blockSize); + + // This block becomes the previous block + this._prevBlock = thisBlock; + } + }); + + function xorBlock(words, offset, blockSize) { + // Shortcut + var iv = this._iv; + + // Choose mixing block + if (iv) { + var block = iv; + + // Remove IV for subsequent blocks + this._iv = undefined; + } else { + var block = this._prevBlock; + } + + // XOR blocks + for (var i = 0; i < blockSize; i++) { + words[offset + i] ^= block[i]; + } + } + + return CBC; + }()); + + /** + * Padding namespace. + */ + var C_pad = C.pad = {}; + + /** + * PKCS #5/7 padding strategy. + */ + var Pkcs7 = C_pad.Pkcs7 = { + /** + * Pads data using the algorithm defined in PKCS #5/7. + * + * @param {WordArray} data The data to pad. + * @param {number} blockSize The multiple that the data should be padded to. + * + * @static + * + * @example + * + * CryptoJS.pad.Pkcs7.pad(wordArray, 4); + */ + pad: function (data, blockSize) { + // Shortcut + var blockSizeBytes = blockSize * 4; + + // Count padding bytes + var nPaddingBytes = blockSizeBytes - data.sigBytes % blockSizeBytes; + + // Create padding word + var paddingWord = (nPaddingBytes << 24) | (nPaddingBytes << 16) | (nPaddingBytes << 8) | nPaddingBytes; + + // Create padding + var paddingWords = []; + for (var i = 0; i < nPaddingBytes; i += 4) { + paddingWords.push(paddingWord); + } + var padding = WordArray.create(paddingWords, nPaddingBytes); + + // Add padding + data.concat(padding); + }, + + /** + * Unpads data that had been padded using the algorithm defined in PKCS #5/7. + * + * @param {WordArray} data The data to unpad. + * + * @static + * + * @example + * + * CryptoJS.pad.Pkcs7.unpad(wordArray); + */ + unpad: function (data) { + // Get number of padding bytes from last byte + var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff; + + // Remove padding + data.sigBytes -= nPaddingBytes; + } + }; + + /** + * Abstract base block cipher template. + * + * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 4 (128 bits) + */ + var BlockCipher = C_lib.BlockCipher = Cipher.extend({ + /** + * Configuration options. + * + * @property {Mode} mode The block mode to use. Default: CBC + * @property {Padding} padding The padding strategy to use. Default: Pkcs7 + */ + cfg: Cipher.cfg.extend({ + mode: CBC, + padding: Pkcs7 + }), + + reset: function () { + // Reset cipher + Cipher.reset.call(this); + + // Shortcuts + var cfg = this.cfg; + var iv = cfg.iv; + var mode = cfg.mode; + + // Reset block mode + if (this._xformMode == this._ENC_XFORM_MODE) { + var modeCreator = mode.createEncryptor; + } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ { + var modeCreator = mode.createDecryptor; + + // Keep at least one block in the buffer for unpadding + this._minBufferSize = 1; + } + this._mode = modeCreator.call(mode, this, iv && iv.words); + }, + + _doProcessBlock: function (words, offset) { + this._mode.processBlock(words, offset); + }, + + _doFinalize: function () { + // Shortcut + var padding = this.cfg.padding; + + // Finalize + if (this._xformMode == this._ENC_XFORM_MODE) { + // Pad data + padding.pad(this._data, this.blockSize); + + // Process final blocks + var finalProcessedBlocks = this._process(!!'flush'); + } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ { + // Process final blocks + var finalProcessedBlocks = this._process(!!'flush'); + + // Unpad data + padding.unpad(finalProcessedBlocks); + } + + return finalProcessedBlocks; + }, + + blockSize: 128/32 + }); + + /** + * A collection of cipher parameters. + * + * @property {WordArray} ciphertext The raw ciphertext. + * @property {WordArray} key The key to this ciphertext. + * @property {WordArray} iv The IV used in the ciphering operation. + * @property {WordArray} salt The salt used with a key derivation function. + * @property {Cipher} algorithm The cipher algorithm. + * @property {Mode} mode The block mode used in the ciphering operation. + * @property {Padding} padding The padding scheme used in the ciphering operation. + * @property {number} blockSize The block size of the cipher. + * @property {Format} formatter The default formatting strategy to convert this cipher params object to a string. + */ + var CipherParams = C_lib.CipherParams = Base.extend({ + /** + * Initializes a newly created cipher params object. + * + * @param {Object} cipherParams An object with any of the possible cipher parameters. + * + * @example + * + * var cipherParams = CryptoJS.lib.CipherParams.create({ + * ciphertext: ciphertextWordArray, + * key: keyWordArray, + * iv: ivWordArray, + * salt: saltWordArray, + * algorithm: CryptoJS.algo.AES, + * mode: CryptoJS.mode.CBC, + * padding: CryptoJS.pad.PKCS7, + * blockSize: 4, + * formatter: CryptoJS.format.OpenSSL + * }); + */ + init: function (cipherParams) { + this.mixIn(cipherParams); + }, + + /** + * Converts this cipher params object to a string. + * + * @param {Format} formatter (Optional) The formatting strategy to use. + * + * @return {string} The stringified cipher params. + * + * @throws Error If neither the formatter nor the default formatter is set. + * + * @example + * + * var string = cipherParams + ''; + * var string = cipherParams.toString(); + * var string = cipherParams.toString(CryptoJS.format.OpenSSL); + */ + toString: function (formatter) { + return (formatter || this.formatter).stringify(this); + } + }); + + /** + * Format namespace. + */ + var C_format = C.format = {}; + + /** + * OpenSSL formatting strategy. + */ + var OpenSSLFormatter = C_format.OpenSSL = { + /** + * Converts a cipher params object to an OpenSSL-compatible string. + * + * @param {CipherParams} cipherParams The cipher params object. + * + * @return {string} The OpenSSL-compatible string. + * + * @static + * + * @example + * + * var openSSLString = CryptoJS.format.OpenSSL.stringify(cipherParams); + */ + stringify: function (cipherParams) { + // Shortcuts + var ciphertext = cipherParams.ciphertext; + var salt = cipherParams.salt; + + // Format + if (salt) { + var wordArray = WordArray.create([0x53616c74, 0x65645f5f]).concat(salt).concat(ciphertext); + } else { + var wordArray = ciphertext; + } + + return wordArray.toString(Base64); + }, + + /** + * Converts an OpenSSL-compatible string to a cipher params object. + * + * @param {string} openSSLStr The OpenSSL-compatible string. + * + * @return {CipherParams} The cipher params object. + * + * @static + * + * @example + * + * var cipherParams = CryptoJS.format.OpenSSL.parse(openSSLString); + */ + parse: function (openSSLStr) { + // Parse base64 + var ciphertext = Base64.parse(openSSLStr); + + // Shortcut + var ciphertextWords = ciphertext.words; + + // Test for salt + if (ciphertextWords[0] == 0x53616c74 && ciphertextWords[1] == 0x65645f5f) { + // Extract salt + var salt = WordArray.create(ciphertextWords.slice(2, 4)); + + // Remove salt from ciphertext + ciphertextWords.splice(0, 4); + ciphertext.sigBytes -= 16; + } + + return CipherParams.create({ ciphertext: ciphertext, salt: salt }); + } + }; + + /** + * A cipher wrapper that returns ciphertext as a serializable cipher params object. + */ + var SerializableCipher = C_lib.SerializableCipher = Base.extend({ + /** + * Configuration options. + * + * @property {Formatter} format The formatting strategy to convert cipher param objects to and from a string. Default: OpenSSL + */ + cfg: Base.extend({ + format: OpenSSLFormatter + }), + + /** + * Encrypts a message. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {WordArray|string} message The message to encrypt. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {CipherParams} A cipher params object. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key); + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv }); + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + */ + encrypt: function (cipher, message, key, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); + + // Encrypt + var encryptor = cipher.createEncryptor(key, cfg); + var ciphertext = encryptor.finalize(message); + + // Shortcut + var cipherCfg = encryptor.cfg; + + // Create and return serializable cipher params + return CipherParams.create({ + ciphertext: ciphertext, + key: key, + iv: cipherCfg.iv, + algorithm: cipher, + mode: cipherCfg.mode, + padding: cipherCfg.padding, + blockSize: cipher.blockSize, + formatter: cfg.format + }); + }, + + /** + * Decrypts serialized ciphertext. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {CipherParams|string} ciphertext The ciphertext to decrypt. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {WordArray} The plaintext. + * + * @static + * + * @example + * + * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + */ + decrypt: function (cipher, ciphertext, key, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); + + // Convert string to CipherParams + ciphertext = this._parse(ciphertext, cfg.format); + + // Decrypt + var plaintext = cipher.createDecryptor(key, cfg).finalize(ciphertext.ciphertext); + + return plaintext; + }, + + /** + * Converts serialized ciphertext to CipherParams, + * else assumed CipherParams already and returns ciphertext unchanged. + * + * @param {CipherParams|string} ciphertext The ciphertext. + * @param {Formatter} format The formatting strategy to use to parse serialized ciphertext. + * + * @return {CipherParams} The unserialized ciphertext. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.SerializableCipher._parse(ciphertextStringOrParams, format); + */ + _parse: function (ciphertext, format) { + if (typeof ciphertext == 'string') { + return format.parse(ciphertext, this); + } else { + return ciphertext; + } + } + }); + + /** + * Key derivation function namespace. + */ + var C_kdf = C.kdf = {}; + + /** + * OpenSSL key derivation function. + */ + var OpenSSLKdf = C_kdf.OpenSSL = { + /** + * Derives a key and IV from a password. + * + * @param {string} password The password to derive from. + * @param {number} keySize The size in words of the key to generate. + * @param {number} ivSize The size in words of the IV to generate. + * @param {WordArray|string} salt (Optional) A 64-bit salt to use. If omitted, a salt will be generated randomly. + * + * @return {CipherParams} A cipher params object with the key, IV, and salt. + * + * @static + * + * @example + * + * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32); + * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32, 'saltsalt'); + */ + execute: function (password, keySize, ivSize, salt) { + // Generate random salt + if (!salt) { + salt = WordArray.random(64/8); + } + + // Derive key and IV + var key = EvpKDF.create({ keySize: keySize + ivSize }).compute(password, salt); + + // Separate key and IV + var iv = WordArray.create(key.words.slice(keySize), ivSize * 4); + key.sigBytes = keySize * 4; + + // Return params + return CipherParams.create({ key: key, iv: iv, salt: salt }); + } + }; + + /** + * A serializable cipher wrapper that derives the key from a password, + * and returns ciphertext as a serializable cipher params object. + */ + var PasswordBasedCipher = C_lib.PasswordBasedCipher = SerializableCipher.extend({ + /** + * Configuration options. + * + * @property {KDF} kdf The key derivation function to use to generate a key and IV from a password. Default: OpenSSL + */ + cfg: SerializableCipher.cfg.extend({ + kdf: OpenSSLKdf + }), + + /** + * Encrypts a message using a password. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {WordArray|string} message The message to encrypt. + * @param {string} password The password. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {CipherParams} A cipher params object. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password'); + * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password', { format: CryptoJS.format.OpenSSL }); + */ + encrypt: function (cipher, message, password, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); + + // Derive key and other params + var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize); + + // Add IV to config + cfg.iv = derivedParams.iv; + + // Encrypt + var ciphertext = SerializableCipher.encrypt.call(this, cipher, message, derivedParams.key, cfg); + + // Mix in derived params + ciphertext.mixIn(derivedParams); + + return ciphertext; + }, + + /** + * Decrypts serialized ciphertext using a password. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {CipherParams|string} ciphertext The ciphertext to decrypt. + * @param {string} password The password. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {WordArray} The plaintext. + * + * @static + * + * @example + * + * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, 'password', { format: CryptoJS.format.OpenSSL }); + * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, 'password', { format: CryptoJS.format.OpenSSL }); + */ + decrypt: function (cipher, ciphertext, password, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); + + // Convert string to CipherParams + ciphertext = this._parse(ciphertext, cfg.format); + + // Derive key and other params + var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize, ciphertext.salt); + + // Add IV to config + cfg.iv = derivedParams.iv; + + // Decrypt + var plaintext = SerializableCipher.decrypt.call(this, cipher, ciphertext, derivedParams.key, cfg); + + return plaintext; + } + }); + }()); + + +})); + +/***/ }), +/* 17 */ +/***/ (function(module, exports, __webpack_require__) { + +/* + This file is part of web3.js. + + web3.js is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + web3.js is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public License + along with web3.js. If not, see . +*/ +/** + * @file utils.js + * @author Marek Kotewicz + * @date 2015 + */ + +/** + * Utils + * + * @module utils + */ /** * Utility functions @@ -5100,12 +5355,12 @@ module.exports = { */ -var BigNumber = __webpack_require__(93); -var sha3 = __webpack_require__(115); -var utf8 = __webpack_require__(153); +var BigNumber = __webpack_require__(116); +var sha3 = __webpack_require__(117); +var utf8 = __webpack_require__(139); var unitMap = { - 'noether': '0', + 'noether': '0', 'wei': '1', 'kwei': '1000', 'Kwei': '1000', @@ -5325,7 +5580,7 @@ var toHex = function (val) { if (isBigNumber(val)) return fromDecimal(val); - if (typeof val === 'object') + if (isObject(val)) return fromUtf8(JSON.stringify(val)); // if its a negative number, pass it through fromDecimal @@ -5486,18 +5741,18 @@ var isAddress = function (address) { * @param {String} address the given HEX adress * @return {Boolean} */ -var isChecksumAddress = function (address) { +var isChecksumAddress = function (address) { // Check each case address = address.replace('0x',''); var addressHash = sha3(address.toLowerCase()); - for (var i = 0; i < 40; i++ ) { + for (var i = 0; i < 40; i++ ) { // the nth letter should be uppercase if the nth digit of casemap is 1 if ((parseInt(addressHash[i], 16) > 7 && address[i].toUpperCase() !== address[i]) || (parseInt(addressHash[i], 16) <= 7 && address[i].toLowerCase() !== address[i])) { return false; } } - return true; + return true; }; @@ -5509,15 +5764,15 @@ var isChecksumAddress = function (address) { * @param {String} address the given HEX adress * @return {String} */ -var toChecksumAddress = function (address) { +var toChecksumAddress = function (address) { if (typeof address === 'undefined') return ''; address = address.toLowerCase().replace('0x',''); var addressHash = sha3(address); var checksumAddress = '0x'; - for (var i = 0; i < address.length; i++ ) { - // If ith character is 9 to f then make it uppercase + for (var i = 0; i < address.length; i++ ) { + // If ith character is 9 to f then make it uppercase if (parseInt(addressHash[i], 16) > 7) { checksumAddress += address[i].toUpperCase(); } else { @@ -5589,7 +5844,7 @@ var isFunction = function (object) { * @return {Boolean} */ var isObject = function (object) { - return object !== null && !(object instanceof Array) && typeof object === 'object'; + return typeof object === 'object'; }; /** @@ -5641,7 +5896,7 @@ var isBloom = function (bloom) { return false; } else if (/^(0x)?[0-9a-f]{512}$/.test(bloom) || /^(0x)?[0-9A-F]{512}$/.test(bloom)) { return true; - } + } return false; }; @@ -5657,7 +5912,7 @@ var isTopic = function (topic) { return false; } else if (/^(0x)?[0-9a-f]{64}$/.test(topic) || /^(0x)?[0-9A-F]{64}$/.test(topic)) { return true; - } + } return false; }; @@ -5696,19932 +5951,21725 @@ module.exports = { /***/ }), -/* 17 */ -/***/ (function(module, exports) { +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { -module.exports = require("stream"); +/* + This file is part of web3.js. -/***/ }), -/* 18 */ -/***/ (function(module, exports) { + web3.js is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. -module.exports = require("os"); + web3.js is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU Lesser General Public License for more details. -/***/ }), -/* 19 */ -/***/ (function(module, exports) { + You should have received a copy of the GNU Lesser General Public License + along with web3.js. If not, see . +*/ +/** + * @file utils.js + * @author Marek Kotewicz + * @date 2015 + */ -// Copyright 2015 Joyent, Inc. +/** + * Utils + * + * @module utils + */ -var algInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y'], - sizePart: 'p' - }, - 'rsa': { - parts: ['e', 'n'], - sizePart: 'n' - }, - 'ecdsa': { - parts: ['curve', 'Q'], - sizePart: 'Q' - }, - 'ed25519': { - parts: ['R'], - normalize: false, - sizePart: 'R' - } -}; -algInfo['curve25519'] = algInfo['ed25519']; +/** + * Utility functions + * + * @class [utils] utils + * @constructor + */ -var algPrivInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y', 'x'] - }, - 'rsa': { - parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] - }, - 'ecdsa': { - parts: ['curve', 'Q', 'd'] - }, - 'ed25519': { - parts: ['R', 'r'], - normalize: false - } + +var BigNumber = __webpack_require__(156); +var sha3 = __webpack_require__(119); +var utf8 = __webpack_require__(139); + +var unitMap = { + 'noether': '0', + 'wei': '1', + 'kwei': '1000', + 'Kwei': '1000', + 'babbage': '1000', + 'femtoether': '1000', + 'mwei': '1000000', + 'Mwei': '1000000', + 'lovelace': '1000000', + 'picoether': '1000000', + 'gwei': '1000000000', + 'Gwei': '1000000000', + 'shannon': '1000000000', + 'nanoether': '1000000000', + 'nano': '1000000000', + 'szabo': '1000000000000', + 'microether': '1000000000000', + 'micro': '1000000000000', + 'finney': '1000000000000000', + 'milliether': '1000000000000000', + 'milli': '1000000000000000', + 'ether': '1000000000000000000', + 'kether': '1000000000000000000000', + 'grand': '1000000000000000000000', + 'mether': '1000000000000000000000000', + 'gether': '1000000000000000000000000000', + 'tether': '1000000000000000000000000000000' }; -algPrivInfo['curve25519'] = algPrivInfo['ed25519']; -var hashAlgs = { - 'md5': true, - 'sha1': true, - 'sha256': true, - 'sha384': true, - 'sha512': true +/** + * Should be called to pad string to expected length + * + * @method padLeft + * @param {String} string to be padded + * @param {Number} characters that result string should have + * @param {String} sign, by default 0 + * @returns {String} right aligned string + */ +var padLeft = function (string, chars, sign) { + return new Array(chars - string.length + 1).join(sign ? sign : "0") + string; }; -/* - * Taken from - * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf +/** + * Should be called to pad string to expected length + * + * @method padRight + * @param {String} string to be padded + * @param {Number} characters that result string should have + * @param {String} sign, by default 0 + * @returns {String} right aligned string */ -var curves = { - 'nistp256': { - size: 256, - pkcs8oid: '1.2.840.10045.3.1.7', - p: new Buffer(('00' + - 'ffffffff 00000001 00000000 00000000' + - '00000000 ffffffff ffffffff ffffffff'). - replace(/ /g, ''), 'hex'), - a: new Buffer(('00' + - 'FFFFFFFF 00000001 00000000 00000000' + - '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: new Buffer(( - '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + - '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). - replace(/ /g, ''), 'hex'), - s: new Buffer(('00' + - 'c49d3608 86e70493 6a6678e1 139d26b7' + - '819f7e90'). - replace(/ /g, ''), 'hex'), - n: new Buffer(('00' + - 'ffffffff 00000000 ffffffff ffffffff' + - 'bce6faad a7179e84 f3b9cac2 fc632551'). - replace(/ /g, ''), 'hex'), - G: new Buffer(('04' + - '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + - '77037d81 2deb33a0 f4a13945 d898c296' + - '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + - '2bce3357 6b315ece cbb64068 37bf51f5'). - replace(/ /g, ''), 'hex') - }, - 'nistp384': { - size: 384, - pkcs8oid: '1.3.132.0.34', - p: new Buffer(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffe' + - 'ffffffff 00000000 00000000 ffffffff'). - replace(/ /g, ''), 'hex'), - a: new Buffer(('00' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + - 'FFFFFFFF 00000000 00000000 FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: new Buffer(( - 'b3312fa7 e23ee7e4 988e056b e3f82d19' + - '181d9c6e fe814112 0314088f 5013875a' + - 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). - replace(/ /g, ''), 'hex'), - s: new Buffer(('00' + - 'a335926a a319a27a 1d00896a 6773a482' + - '7acdac73'). - replace(/ /g, ''), 'hex'), - n: new Buffer(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff c7634d81 f4372ddf' + - '581a0db2 48b0a77a ecec196a ccc52973'). - replace(/ /g, ''), 'hex'), - G: new Buffer(('04' + - 'aa87ca22 be8b0537 8eb1c71e f320ad74' + - '6e1d3b62 8ba79b98 59f741e0 82542a38' + - '5502f25d bf55296c 3a545e38 72760ab7' + - '3617de4a 96262c6f 5d9e98bf 9292dc29' + - 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + - '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). - replace(/ /g, ''), 'hex') - }, - 'nistp521': { - size: 521, - pkcs8oid: '1.3.132.0.35', - p: new Buffer(( - '01ffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffff').replace(/ /g, ''), 'hex'), - a: new Buffer(('01FF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: new Buffer(('51' + - '953eb961 8e1c9a1f 929a21a0 b68540ee' + - 'a2da725b 99b315f3 b8b48991 8ef109e1' + - '56193951 ec7e937b 1652c0bd 3bb1bf07' + - '3573df88 3d2c34f1 ef451fd4 6b503f00'). - replace(/ /g, ''), 'hex'), - s: new Buffer(('00' + - 'd09e8800 291cb853 96cc6717 393284aa' + - 'a0da64ba').replace(/ /g, ''), 'hex'), - n: new Buffer(('01ff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffa' + - '51868783 bf2f966b 7fcc0148 f709a5d0' + - '3bb5c9b8 899c47ae bb6fb71e 91386409'). - replace(/ /g, ''), 'hex'), - G: new Buffer(('04' + - '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + - '9c648139 053fb521 f828af60 6b4d3dba' + - 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + - '3348b3c1 856a429b f97e7e31 c2e5bd66' + - '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + - '98f54449 579b4468 17afbd17 273e662c' + - '97ee7299 5ef42640 c550b901 3fad0761' + - '353c7086 a272c240 88be9476 9fd16650'). - replace(/ /g, ''), 'hex') - } -}; - -module.exports = { - info: algInfo, - privInfo: algPrivInfo, - hashAlgs: hashAlgs, - curves: curves +var padRight = function (string, chars, sign) { + return string + (new Array(chars - string.length + 1).join(sign ? sign : "0")); }; +/** + * Should be called to get utf8 from it's hex representation + * + * @method toUtf8 + * @param {String} string in hex + * @returns {String} ascii string representation of hex value + */ +var toUtf8 = function(hex) { +// Find termination + var str = ""; + var i = 0, l = hex.length; + if (hex.substring(0, 2) === '0x') { + i = 2; + } + for (; i < l; i+=2) { + var code = parseInt(hex.substr(i, 2), 16); + if (code === 0) + break; + str += String.fromCharCode(code); + } -/***/ }), -/* 20 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = Key; - -var assert = __webpack_require__(10); -var algs = __webpack_require__(19); -var crypto = __webpack_require__(6); -var Fingerprint = __webpack_require__(106); -var Signature = __webpack_require__(51); -var DiffieHellman = __webpack_require__(349).DiffieHellman; -var errs = __webpack_require__(50); -var utils = __webpack_require__(14); -var PrivateKey = __webpack_require__(21); -var edCompat; - -try { - edCompat = __webpack_require__(350); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ -} - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; - -var formats = {}; -formats['auto'] = __webpack_require__(351); -formats['pem'] = __webpack_require__(59); -formats['pkcs1'] = __webpack_require__(197); -formats['pkcs8'] = __webpack_require__(107); -formats['rfc4253'] = __webpack_require__(66); -formats['ssh'] = __webpack_require__(352); -formats['ssh-private'] = __webpack_require__(143); -formats['openssh'] = formats['ssh-private']; - -function Key(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); - assert.optionalString(opts.comment, 'options.comment'); - - var algInfo = algs.info[opts.type]; - if (typeof (algInfo) !== 'object') - throw (new InvalidAlgorithmError(opts.type)); - - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } - - this.type = opts.type; - this.parts = opts.parts; - this.part = partLookup; - this.comment = undefined; - this.source = opts.source; - - /* for speeding up hashing/fingerprint operations */ - this._rfc4253Cache = opts._rfc4253Cache; - this._hashCache = {}; - - var sz; - this.curve = undefined; - if (this.type === 'ecdsa') { - var curve = this.part.curve.data.toString(); - this.curve = curve; - sz = algs.curves[curve].size; - } else if (this.type === 'ed25519' || this.type === 'curve25519') { - sz = 256; - this.curve = 'curve25519'; - } else { - var szPart = this.part[algInfo.sizePart]; - sz = szPart.data.length; - sz = sz * 8 - utils.countZeros(szPart.data); - } - this.size = sz; -} - -Key.formats = formats; - -Key.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'ssh'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - if (format === 'rfc4253') { - if (this._rfc4253Cache === undefined) - this._rfc4253Cache = formats['rfc4253'].write(this); - return (this._rfc4253Cache); - } - - return (formats[format].write(this, options)); -}; - -Key.prototype.toString = function (format, options) { - return (this.toBuffer(format, options).toString()); + return utf8.decode(str); }; -Key.prototype.hash = function (algo) { - assert.string(algo, 'algorithm'); - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); - - if (this._hashCache[algo]) - return (this._hashCache[algo]); +/** + * Should be called to get ascii from it's hex representation + * + * @method toAscii + * @param {String} string in hex + * @returns {String} ascii string representation of hex value + */ +var toAscii = function(hex) { +// Find termination + var str = ""; + var i = 0, l = hex.length; + if (hex.substring(0, 2) === '0x') { + i = 2; + } + for (; i < l; i+=2) { + var code = parseInt(hex.substr(i, 2), 16); + str += String.fromCharCode(code); + } - var hash = crypto.createHash(algo). - update(this.toBuffer('rfc4253')).digest(); - this._hashCache[algo] = hash; - return (hash); + return str; }; -Key.prototype.fingerprint = function (algo) { - if (algo === undefined) - algo = 'sha256'; - assert.string(algo, 'algorithm'); - var opts = { - type: 'key', - hash: this.hash(algo), - algorithm: algo - }; - return (new Fingerprint(opts)); -}; +/** + * Should be called to get hex representation (prefixed by 0x) of utf8 string + * + * @method fromUtf8 + * @param {String} string + * @param {Number} optional padding + * @returns {String} hex representation of input string + */ +var fromUtf8 = function(str) { + str = utf8.encode(str); + var hex = ""; + for(var i = 0; i < str.length; i++) { + var code = str.charCodeAt(i); + if (code === 0) + break; + var n = code.toString(16); + hex += n.length < 2 ? '0' + n : n; + } -Key.prototype.defaultHashAlgorithm = function () { - var hashAlgo = 'sha1'; - if (this.type === 'rsa') - hashAlgo = 'sha256'; - if (this.type === 'dsa' && this.size > 1024) - hashAlgo = 'sha256'; - if (this.type === 'ed25519') - hashAlgo = 'sha512'; - if (this.type === 'ecdsa') { - if (this.size <= 256) - hashAlgo = 'sha256'; - else if (this.size <= 384) - hashAlgo = 'sha384'; - else - hashAlgo = 'sha512'; - } - return (hashAlgo); + return "0x" + hex; }; -Key.prototype.createVerify = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Verifier(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldVerify = v.verify.bind(v); - var key = this.toBuffer('pkcs8'); - var curve = this.curve; - var self = this; - v.verify = function (signature, fmt) { - if (Signature.isSignature(signature, [2, 0])) { - if (signature.type !== self.type) - return (false); - if (signature.hashAlgorithm && - signature.hashAlgorithm !== hashAlgo) - return (false); - if (signature.curve && self.type === 'ecdsa' && - signature.curve !== curve) - return (false); - return (oldVerify(key, signature.toBuffer('asn1'))); - - } else if (typeof (signature) === 'string' || - Buffer.isBuffer(signature)) { - return (oldVerify(key, signature, fmt)); - - /* - * Avoid doing this on valid arguments, walking the prototype - * chain can be quite slow. - */ - } else if (Signature.isSignature(signature, [1, 0])) { - throw (new Error('signature was created by too old ' + - 'a version of sshpk and cannot be verified')); +/** + * Should be called to get hex representation (prefixed by 0x) of ascii string + * + * @method fromAscii + * @param {String} string + * @param {Number} optional padding + * @returns {String} hex representation of input string + */ +var fromAscii = function(str) { + var hex = ""; + for(var i = 0; i < str.length; i++) { + var code = str.charCodeAt(i); + var n = code.toString(16); + hex += n.length < 2 ? '0' + n : n; + } - } else { - throw (new TypeError('signature must be a string, ' + - 'Buffer, or Signature object')); - } - }; - return (v); + return "0x" + hex; }; -Key.prototype.createDiffieHellman = function () { - if (this.type === 'rsa') - throw (new Error('RSA keys do not support Diffie-Hellman')); +/** + * Should be used to create full function/event name from json abi + * + * @method transformToFullName + * @param {Object} json-abi + * @return {String} full fnction/event name + */ +var transformToFullName = function (json) { + if (json.name.indexOf('(') !== -1) { + return json.name; + } - return (new DiffieHellman(this)); + var typeName = json.inputs.map(function(i){return i.type; }).join(); + return json.name + '(' + typeName + ')'; }; -Key.prototype.createDH = Key.prototype.createDiffieHellman; - -Key.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - assert.object(formats[format], 'formats[format]'); +/** + * Should be called to get display name of contract function + * + * @method extractDisplayName + * @param {String} name of function/event + * @returns {String} display name for function/event eg. multiply(uint256) -> multiply + */ +var extractDisplayName = function (name) { + var length = name.indexOf('('); + return length !== -1 ? name.substr(0, length) : name; +}; - try { - var k = formats[format].read(data, options); - if (k instanceof PrivateKey) - k = k.toPublic(); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } +/// @returns overloaded part of function/event name +var extractTypeName = function (name) { + /// TODO: make it invulnerable + var length = name.indexOf('('); + return length !== -1 ? name.substr(length + 1, name.length - 1 - (length + 1)).replace(' ', '') : ""; }; -Key.isKey = function (obj, ver) { - return (utils.isCompatible(obj, Key, ver)); +/** + * Converts value to it's decimal representation in string + * + * @method toDecimal + * @param {String|Number|BigNumber} + * @return {String} + */ +var toDecimal = function (value) { + return toBigNumber(value).toNumber(); }; -/* - * API versions for Key: - * [1,0] -- initial ver, may take Signature for createVerify or may not - * [1,1] -- added pkcs1, pkcs8 formats - * [1,2] -- added auto, ssh-private, openssh formats - * [1,3] -- added defaultHashAlgorithm - * [1,4] -- added ed support, createDH - * [1,5] -- first explicitly tagged version +/** + * Converts value to it's hex representation + * + * @method fromDecimal + * @param {String|Number|BigNumber} + * @return {String} */ -Key.prototype._sshpkApiVersion = [1, 5]; +var fromDecimal = function (value) { + var number = toBigNumber(value); + var result = number.toString(16); -Key._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - assert.func(obj.fingerprint); - if (obj.createDH) - return ([1, 4]); - if (obj.defaultHashAlgorithm) - return ([1, 3]); - if (obj.formats['auto']) - return ([1, 2]); - if (obj.formats['pkcs1']) - return ([1, 1]); - return ([1, 0]); + return number.lessThan(0) ? '-0x' + result.substr(1) : '0x' + result; }; +/** + * Auto converts any given value into it's hex representation. + * + * And even stringifys objects before. + * + * @method toHex + * @param {String|Number|BigNumber|Object} + * @return {String} + */ +var toHex = function (val) { + /*jshint maxcomplexity: 8 */ -/***/ }), -/* 21 */ -/***/ (function(module, exports, __webpack_require__) { + if (isBoolean(val)) + return fromDecimal(+val); -// Copyright 2017 Joyent, Inc. + if (isBigNumber(val)) + return fromDecimal(val); -module.exports = PrivateKey; + if (isObject(val)) + return fromUtf8(JSON.stringify(val)); -var assert = __webpack_require__(10); -var algs = __webpack_require__(19); -var crypto = __webpack_require__(6); -var Fingerprint = __webpack_require__(106); -var Signature = __webpack_require__(51); -var errs = __webpack_require__(50); -var util = __webpack_require__(3); -var utils = __webpack_require__(14); -var dhe = __webpack_require__(349); -var generateECDSA = dhe.generateECDSA; -var generateED25519 = dhe.generateED25519; -var edCompat; -var nacl; + // if its a negative number, pass it through fromDecimal + if (isString(val)) { + if (val.indexOf('-0x') === 0) + return fromDecimal(val); + else if(val.indexOf('0x') === 0) + return val; + else if (!isFinite(val)) + return fromAscii(val); + } -try { - edCompat = __webpack_require__(350); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ -} + return fromDecimal(val); +}; -var Key = __webpack_require__(20); +/** + * Returns value of unit in Wei + * + * @method getValueOfUnit + * @param {String} unit the unit to convert to, default ether + * @returns {BigNumber} value of the unit (in Wei) + * @throws error if the unit is not correct:w + */ +var getValueOfUnit = function (unit) { + unit = unit ? unit.toLowerCase() : 'ether'; + var unitValue = unitMap[unit]; + if (unitValue === undefined) { + throw new Error('This unit doesn\'t exists, please use the one of the following units' + JSON.stringify(unitMap, null, 2)); + } + return new BigNumber(unitValue, 10); +}; -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; -var KeyEncryptedError = errs.KeyEncryptedError; +/** + * Takes a number of wei and converts it to any other ether unit. + * + * Possible units are: + * SI Short SI Full Effigy Other + * - kwei femtoether babbage + * - mwei picoether lovelace + * - gwei nanoether shannon nano + * - -- microether szabo micro + * - -- milliether finney milli + * - ether -- -- + * - kether -- grand + * - mether + * - gether + * - tether + * + * @method fromWei + * @param {Number|String} number can be a number, number string or a HEX of a decimal + * @param {String} unit the unit to convert to, default ether + * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number +*/ +var fromWei = function(number, unit) { + var returnValue = toBigNumber(number).dividedBy(getValueOfUnit(unit)); -var formats = {}; -formats['auto'] = __webpack_require__(351); -formats['pem'] = __webpack_require__(59); -formats['pkcs1'] = __webpack_require__(197); -formats['pkcs8'] = __webpack_require__(107); -formats['rfc4253'] = __webpack_require__(66); -formats['ssh-private'] = __webpack_require__(143); -formats['openssh'] = formats['ssh-private']; -formats['ssh'] = formats['ssh-private']; + return isBigNumber(number) ? returnValue : returnValue.toString(10); +}; -function PrivateKey(opts) { - assert.object(opts, 'options'); - Key.call(this, opts); +/** + * Takes a number of a unit and converts it to wei. + * + * Possible units are: + * SI Short SI Full Effigy Other + * - kwei femtoether babbage + * - mwei picoether lovelace + * - gwei nanoether shannon nano + * - -- microether szabo micro + * - -- microether szabo micro + * - -- milliether finney milli + * - ether -- -- + * - kether -- grand + * - mether + * - gether + * - tether + * + * @method toWei + * @param {Number|String|BigNumber} number can be a number, number string or a HEX of a decimal + * @param {String} unit the unit to convert from, default ether + * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number +*/ +var toWei = function(number, unit) { + var returnValue = toBigNumber(number).times(getValueOfUnit(unit)); - this._pubCache = undefined; -} -util.inherits(PrivateKey, Key); + return isBigNumber(number) ? returnValue : returnValue.toString(10); +}; -PrivateKey.formats = formats; +/** + * Takes an input and transforms it into an bignumber + * + * @method toBigNumber + * @param {Number|String|BigNumber} a number, string, HEX string or BigNumber + * @return {BigNumber} BigNumber +*/ +var toBigNumber = function(number) { + /*jshint maxcomplexity:5 */ + number = number || 0; + if (isBigNumber(number)) + return number; -PrivateKey.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'pkcs1'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); + if (isString(number) && (number.indexOf('0x') === 0 || number.indexOf('-0x') === 0)) { + return new BigNumber(number.replace('0x',''), 16); + } - return (formats[format].write(this, options)); + return new BigNumber(number.toString(10), 10); }; -PrivateKey.prototype.hash = function (algo) { - return (this.toPublic().hash(algo)); +/** + * Takes and input transforms it into bignumber and if it is negative value, into two's complement + * + * @method toTwosComplement + * @param {Number|String|BigNumber} + * @return {BigNumber} + */ +var toTwosComplement = function (number) { + var bigNumber = toBigNumber(number); + if (bigNumber.lessThan(0)) { + return new BigNumber("ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff", 16).plus(bigNumber).plus(1); + } + return bigNumber; }; -PrivateKey.prototype.toPublic = function () { - if (this._pubCache) - return (this._pubCache); - - var algInfo = algs.info[this.type]; - var pubParts = []; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = algInfo.parts[i]; - pubParts.push(this.part[p]); - } +/** + * Checks if the given string is strictly an address + * + * @method isStrictAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isStrictAddress = function (address) { + return /^0x[0-9a-f]{40}$/i.test(address); +}; - this._pubCache = new Key({ - type: this.type, - source: this, - parts: pubParts - }); - if (this.comment) - this._pubCache.comment = this.comment; - return (this._pubCache); +/** + * Checks if the given string is an address + * + * @method isAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isAddress = function (address) { + if (!/^(0x)?[0-9a-f]{40}$/i.test(address)) { + // check if it has the basic requirements of an address + return false; + } else if (/^(0x)?[0-9a-f]{40}$/.test(address) || /^(0x)?[0-9A-F]{40}$/.test(address)) { + // If it's all small caps or all all caps, return true + return true; + } else { + // Otherwise check each case + return isChecksumAddress(address); + } }; -PrivateKey.prototype.derive = function (newType) { - assert.string(newType, 'type'); - var priv, pub, pair; - if (this.type === 'ed25519' && newType === 'curve25519') { - if (nacl === undefined) - nacl = __webpack_require__(70); - priv = this.part.r.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - priv = priv.slice(0, 32); +/** + * Checks if the given string is a checksummed address + * + * @method isChecksumAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isChecksumAddress = function (address) { + // Check each case + address = address.replace('0x',''); + var addressHash = sha3(address.toLowerCase()); - pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); - pub = new Buffer(pair.publicKey); - priv = Buffer.concat([priv, pub]); + for (var i = 0; i < 40; i++ ) { + // the nth letter should be uppercase if the nth digit of casemap is 1 + if ((parseInt(addressHash[i], 16) > 7 && address[i].toUpperCase() !== address[i]) || (parseInt(addressHash[i], 16) <= 7 && address[i].toLowerCase() !== address[i])) { + return false; + } + } + return true; +}; - return (new PrivateKey({ - type: 'curve25519', - parts: [ - { name: 'R', data: utils.mpNormalize(pub) }, - { name: 'r', data: priv } - ] - })); - } else if (this.type === 'curve25519' && newType === 'ed25519') { - if (nacl === undefined) - nacl = __webpack_require__(70); - priv = this.part.r.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - priv = priv.slice(0, 32); - pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); - pub = new Buffer(pair.publicKey); - priv = Buffer.concat([priv, pub]); +/** + * Makes a checksum address + * + * @method toChecksumAddress + * @param {String} address the given HEX adress + * @return {String} +*/ +var toChecksumAddress = function (address) { + if (typeof address === 'undefined') return ''; - return (new PrivateKey({ - type: 'ed25519', - parts: [ - { name: 'R', data: utils.mpNormalize(pub) }, - { name: 'r', data: priv } - ] - })); - } - throw (new Error('Key derivation not supported from ' + this.type + - ' to ' + newType)); -}; + address = address.toLowerCase().replace('0x',''); + var addressHash = sha3(address); + var checksumAddress = '0x'; -PrivateKey.prototype.createVerify = function (hashAlgo) { - return (this.toPublic().createVerify(hashAlgo)); + for (var i = 0; i < address.length; i++ ) { + // If ith character is 9 to f then make it uppercase + if (parseInt(addressHash[i], 16) > 7) { + checksumAddress += address[i].toUpperCase(); + } else { + checksumAddress += address[i]; + } + } + return checksumAddress; }; -PrivateKey.prototype.createSign = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); +/** + * Transforms given string to valid 20 bytes-length addres with 0x prefix + * + * @method toAddress + * @param {String} address + * @return {String} formatted address + */ +var toAddress = function (address) { + if (isStrictAddress(address)) { + return address; + } - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Signer(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); + if (/^[0-9a-f]{40}$/.test(address)) { + return '0x' + address; + } - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldSign = v.sign.bind(v); - var key = this.toBuffer('pkcs1'); - var type = this.type; - var curve = this.curve; - v.sign = function () { - var sig = oldSign(key); - if (typeof (sig) === 'string') - sig = new Buffer(sig, 'binary'); - sig = Signature.parse(sig, type, 'asn1'); - sig.hashAlgorithm = hashAlgo; - sig.curve = curve; - return (sig); - }; - return (v); + return '0x' + padLeft(toHex(address).substr(2), 40); }; -PrivateKey.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; +/** + * Returns true if object is BigNumber, otherwise false + * + * @method isBigNumber + * @param {Object} + * @return {Boolean} + */ +var isBigNumber = function (object) { + return object instanceof BigNumber || + (object && object.constructor && object.constructor.name === 'BigNumber'); +}; - assert.object(formats[format], 'formats[format]'); +/** + * Returns true if object is string, otherwise false + * + * @method isString + * @param {Object} + * @return {Boolean} + */ +var isString = function (object) { + return typeof object === 'string' || + (object && object.constructor && object.constructor.name === 'String'); +}; - try { - var k = formats[format].read(data, options); - assert.ok(k instanceof PrivateKey, 'key is not a private key'); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } +/** + * Returns true if object is function, otherwise false + * + * @method isFunction + * @param {Object} + * @return {Boolean} + */ +var isFunction = function (object) { + return typeof object === 'function'; }; -PrivateKey.isPrivateKey = function (obj, ver) { - return (utils.isCompatible(obj, PrivateKey, ver)); +/** + * Returns true if object is Objet, otherwise false + * + * @method isObject + * @param {Object} + * @return {Boolean} + */ +var isObject = function (object) { + return typeof object === 'object'; }; -PrivateKey.generate = function (type, options) { - if (options === undefined) - options = {}; - assert.object(options, 'options'); +/** + * Returns true if object is boolean, otherwise false + * + * @method isBoolean + * @param {Object} + * @return {Boolean} + */ +var isBoolean = function (object) { + return typeof object === 'boolean'; +}; - switch (type) { - case 'ecdsa': - if (options.curve === undefined) - options.curve = 'nistp256'; - assert.string(options.curve, 'options.curve'); - return (generateECDSA(options.curve)); - case 'ed25519': - return (generateED25519()); - default: - throw (new Error('Key generation not supported with key ' + - 'type "' + type + '"')); - } +/** + * Returns true if object is array, otherwise false + * + * @method isArray + * @param {Object} + * @return {Boolean} + */ +var isArray = function (object) { + return object instanceof Array; }; -/* - * API versions for PrivateKey: - * [1,0] -- initial ver - * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats - * [1,2] -- added defaultHashAlgorithm - * [1,3] -- added derive, ed, createDH - * [1,4] -- first tagged version +/** + * Returns true if given string is valid json object + * + * @method isJson + * @param {String} + * @return {Boolean} */ -PrivateKey.prototype._sshpkApiVersion = [1, 4]; +var isJson = function (str) { + try { + return !!JSON.parse(str); + } catch (e) { + return false; + } +}; -PrivateKey._oldVersionDetect = function (obj) { - assert.func(obj.toPublic); - assert.func(obj.createSign); - if (obj.derive) - return ([1, 3]); - if (obj.defaultHashAlgorithm) - return ([1, 2]); - if (obj.formats['auto']) - return ([1, 1]); - return ([1, 0]); +module.exports = { + padLeft: padLeft, + padRight: padRight, + toHex: toHex, + toDecimal: toDecimal, + fromDecimal: fromDecimal, + toUtf8: toUtf8, + toAscii: toAscii, + fromUtf8: fromUtf8, + fromAscii: fromAscii, + transformToFullName: transformToFullName, + extractDisplayName: extractDisplayName, + extractTypeName: extractTypeName, + toWei: toWei, + fromWei: fromWei, + toBigNumber: toBigNumber, + toTwosComplement: toTwosComplement, + toAddress: toAddress, + isBigNumber: isBigNumber, + isStrictAddress: isStrictAddress, + isAddress: isAddress, + isChecksumAddress: isChecksumAddress, + toChecksumAddress: toChecksumAddress, + isFunction: isFunction, + isString: isString, + isObject: isObject, + isBoolean: isBoolean, + isArray: isArray, + isJson: isJson }; /***/ }), -/* 22 */ +/* 19 */ /***/ (function(module, exports, __webpack_require__) { -var Web3 = __webpack_require__(1158); +/* + This file is part of web3.js. -// dont override global variable -if (typeof window !== 'undefined' && typeof window.Web3 === 'undefined') { - window.Web3 = Web3; -} + web3.js is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. -module.exports = Web3; + web3.js is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU Lesser General Public License for more details. + You should have received a copy of the GNU Lesser General Public License + along with web3.js. If not, see . +*/ +/** + * @file utils.js + * @author Marek Kotewicz + * @date 2015 + */ -/***/ }), -/* 23 */ -/***/ (function(module, exports, __webpack_require__) { +/** + * Utils + * + * @module utils + */ -/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** - * @license - * Lodash - * Copyright JS Foundation and other contributors - * Released under MIT license - * Based on Underscore.js 1.8.3 - * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors +/** + * Utility functions + * + * @class [utils] utils + * @constructor */ -;(function() { - /** Used as a safe reference for `undefined` in pre-ES5 environments. */ - var undefined; - /** Used as the semantic version number. */ - var VERSION = '4.17.4'; +var BigNumber = __webpack_require__(124); +var sha3 = __webpack_require__(122); +var utf8 = __webpack_require__(139); - /** Used as the size to enable large array optimizations. */ - var LARGE_ARRAY_SIZE = 200; +var unitMap = { + 'noether': '0', + 'wei': '1', + 'kwei': '1000', + 'Kwei': '1000', + 'babbage': '1000', + 'femtoether': '1000', + 'mwei': '1000000', + 'Mwei': '1000000', + 'lovelace': '1000000', + 'picoether': '1000000', + 'gwei': '1000000000', + 'Gwei': '1000000000', + 'shannon': '1000000000', + 'nanoether': '1000000000', + 'nano': '1000000000', + 'szabo': '1000000000000', + 'microether': '1000000000000', + 'micro': '1000000000000', + 'finney': '1000000000000000', + 'milliether': '1000000000000000', + 'milli': '1000000000000000', + 'ether': '1000000000000000000', + 'kether': '1000000000000000000000', + 'grand': '1000000000000000000000', + 'mether': '1000000000000000000000000', + 'gether': '1000000000000000000000000000', + 'tether': '1000000000000000000000000000000' +}; - /** Error message constants. */ - var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', - FUNC_ERROR_TEXT = 'Expected a function'; +/** + * Should be called to pad string to expected length + * + * @method padLeft + * @param {String} string to be padded + * @param {Number} characters that result string should have + * @param {String} sign, by default 0 + * @returns {String} right aligned string + */ +var padLeft = function (string, chars, sign) { + return new Array(chars - string.length + 1).join(sign ? sign : "0") + string; +}; - /** Used to stand-in for `undefined` hash values. */ - var HASH_UNDEFINED = '__lodash_hash_undefined__'; +/** + * Should be called to pad string to expected length + * + * @method padRight + * @param {String} string to be padded + * @param {Number} characters that result string should have + * @param {String} sign, by default 0 + * @returns {String} right aligned string + */ +var padRight = function (string, chars, sign) { + return string + (new Array(chars - string.length + 1).join(sign ? sign : "0")); +}; - /** Used as the maximum memoize cache size. */ - var MAX_MEMOIZE_SIZE = 500; +/** + * Should be called to get utf8 from it's hex representation + * + * @method toUtf8 + * @param {String} string in hex + * @returns {String} ascii string representation of hex value + */ +var toUtf8 = function(hex) { +// Find termination + var str = ""; + var i = 0, l = hex.length; + if (hex.substring(0, 2) === '0x') { + i = 2; + } + for (; i < l; i+=2) { + var code = parseInt(hex.substr(i, 2), 16); + if (code === 0) + break; + str += String.fromCharCode(code); + } - /** Used as the internal argument placeholder. */ - var PLACEHOLDER = '__lodash_placeholder__'; + return utf8.decode(str); +}; - /** Used to compose bitmasks for cloning. */ - var CLONE_DEEP_FLAG = 1, - CLONE_FLAT_FLAG = 2, - CLONE_SYMBOLS_FLAG = 4; +/** + * Should be called to get ascii from it's hex representation + * + * @method toAscii + * @param {String} string in hex + * @returns {String} ascii string representation of hex value + */ +var toAscii = function(hex) { +// Find termination + var str = ""; + var i = 0, l = hex.length; + if (hex.substring(0, 2) === '0x') { + i = 2; + } + for (; i < l; i+=2) { + var code = parseInt(hex.substr(i, 2), 16); + str += String.fromCharCode(code); + } - /** Used to compose bitmasks for value comparisons. */ - var COMPARE_PARTIAL_FLAG = 1, - COMPARE_UNORDERED_FLAG = 2; + return str; +}; - /** Used to compose bitmasks for function metadata. */ - var WRAP_BIND_FLAG = 1, - WRAP_BIND_KEY_FLAG = 2, - WRAP_CURRY_BOUND_FLAG = 4, - WRAP_CURRY_FLAG = 8, - WRAP_CURRY_RIGHT_FLAG = 16, - WRAP_PARTIAL_FLAG = 32, - WRAP_PARTIAL_RIGHT_FLAG = 64, - WRAP_ARY_FLAG = 128, - WRAP_REARG_FLAG = 256, - WRAP_FLIP_FLAG = 512; +/** + * Should be called to get hex representation (prefixed by 0x) of utf8 string + * + * @method fromUtf8 + * @param {String} string + * @param {Number} optional padding + * @returns {String} hex representation of input string + */ +var fromUtf8 = function(str) { + str = utf8.encode(str); + var hex = ""; + for(var i = 0; i < str.length; i++) { + var code = str.charCodeAt(i); + if (code === 0) + break; + var n = code.toString(16); + hex += n.length < 2 ? '0' + n : n; + } - /** Used as default options for `_.truncate`. */ - var DEFAULT_TRUNC_LENGTH = 30, - DEFAULT_TRUNC_OMISSION = '...'; + return "0x" + hex; +}; - /** Used to detect hot functions by number of calls within a span of milliseconds. */ - var HOT_COUNT = 800, - HOT_SPAN = 16; +/** + * Should be called to get hex representation (prefixed by 0x) of ascii string + * + * @method fromAscii + * @param {String} string + * @param {Number} optional padding + * @returns {String} hex representation of input string + */ +var fromAscii = function(str) { + var hex = ""; + for(var i = 0; i < str.length; i++) { + var code = str.charCodeAt(i); + var n = code.toString(16); + hex += n.length < 2 ? '0' + n : n; + } - /** Used to indicate the type of lazy iteratees. */ - var LAZY_FILTER_FLAG = 1, - LAZY_MAP_FLAG = 2, - LAZY_WHILE_FLAG = 3; + return "0x" + hex; +}; - /** Used as references for various `Number` constants. */ - var INFINITY = 1 / 0, - MAX_SAFE_INTEGER = 9007199254740991, - MAX_INTEGER = 1.7976931348623157e+308, - NAN = 0 / 0; +/** + * Should be used to create full function/event name from json abi + * + * @method transformToFullName + * @param {Object} json-abi + * @return {String} full fnction/event name + */ +var transformToFullName = function (json) { + if (json.name.indexOf('(') !== -1) { + return json.name; + } - /** Used as references for the maximum length and index of an array. */ - var MAX_ARRAY_LENGTH = 4294967295, - MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, - HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; + var typeName = json.inputs.map(function(i){return i.type; }).join(); + return json.name + '(' + typeName + ')'; +}; - /** Used to associate wrap methods with their bit flags. */ - var wrapFlags = [ - ['ary', WRAP_ARY_FLAG], - ['bind', WRAP_BIND_FLAG], - ['bindKey', WRAP_BIND_KEY_FLAG], - ['curry', WRAP_CURRY_FLAG], - ['curryRight', WRAP_CURRY_RIGHT_FLAG], - ['flip', WRAP_FLIP_FLAG], - ['partial', WRAP_PARTIAL_FLAG], - ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], - ['rearg', WRAP_REARG_FLAG] - ]; +/** + * Should be called to get display name of contract function + * + * @method extractDisplayName + * @param {String} name of function/event + * @returns {String} display name for function/event eg. multiply(uint256) -> multiply + */ +var extractDisplayName = function (name) { + var length = name.indexOf('('); + return length !== -1 ? name.substr(0, length) : name; +}; - /** `Object#toString` result references. */ - var argsTag = '[object Arguments]', - arrayTag = '[object Array]', - asyncTag = '[object AsyncFunction]', - boolTag = '[object Boolean]', - dateTag = '[object Date]', - domExcTag = '[object DOMException]', - errorTag = '[object Error]', - funcTag = '[object Function]', - genTag = '[object GeneratorFunction]', - mapTag = '[object Map]', - numberTag = '[object Number]', - nullTag = '[object Null]', - objectTag = '[object Object]', - promiseTag = '[object Promise]', - proxyTag = '[object Proxy]', - regexpTag = '[object RegExp]', - setTag = '[object Set]', - stringTag = '[object String]', - symbolTag = '[object Symbol]', - undefinedTag = '[object Undefined]', - weakMapTag = '[object WeakMap]', - weakSetTag = '[object WeakSet]'; +/// @returns overloaded part of function/event name +var extractTypeName = function (name) { + /// TODO: make it invulnerable + var length = name.indexOf('('); + return length !== -1 ? name.substr(length + 1, name.length - 1 - (length + 1)).replace(' ', '') : ""; +}; - var arrayBufferTag = '[object ArrayBuffer]', - dataViewTag = '[object DataView]', - float32Tag = '[object Float32Array]', - float64Tag = '[object Float64Array]', - int8Tag = '[object Int8Array]', - int16Tag = '[object Int16Array]', - int32Tag = '[object Int32Array]', - uint8Tag = '[object Uint8Array]', - uint8ClampedTag = '[object Uint8ClampedArray]', - uint16Tag = '[object Uint16Array]', - uint32Tag = '[object Uint32Array]'; +/** + * Converts value to it's decimal representation in string + * + * @method toDecimal + * @param {String|Number|BigNumber} + * @return {String} + */ +var toDecimal = function (value) { + return toBigNumber(value).toNumber(); +}; - /** Used to match empty string literals in compiled template source. */ - var reEmptyStringLeading = /\b__p \+= '';/g, - reEmptyStringMiddle = /\b(__p \+=) '' \+/g, - reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; +/** + * Converts value to it's hex representation + * + * @method fromDecimal + * @param {String|Number|BigNumber} + * @return {String} + */ +var fromDecimal = function (value) { + var number = toBigNumber(value); + var result = number.toString(16); - /** Used to match HTML entities and HTML characters. */ - var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, - reUnescapedHtml = /[&<>"']/g, - reHasEscapedHtml = RegExp(reEscapedHtml.source), - reHasUnescapedHtml = RegExp(reUnescapedHtml.source); + return number.lessThan(0) ? '-0x' + result.substr(1) : '0x' + result; +}; - /** Used to match template delimiters. */ - var reEscape = /<%-([\s\S]+?)%>/g, - reEvaluate = /<%([\s\S]+?)%>/g, - reInterpolate = /<%=([\s\S]+?)%>/g; +/** + * Auto converts any given value into it's hex representation. + * + * And even stringifys objects before. + * + * @method toHex + * @param {String|Number|BigNumber|Object} + * @return {String} + */ +var toHex = function (val) { + /*jshint maxcomplexity: 8 */ - /** Used to match property names within property paths. */ - var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, - reIsPlainProp = /^\w*$/, - reLeadingDot = /^\./, - rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; + if (isBoolean(val)) + return fromDecimal(+val); - /** - * Used to match `RegExp` - * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). - */ - var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, - reHasRegExpChar = RegExp(reRegExpChar.source); + if (isBigNumber(val)) + return fromDecimal(val); - /** Used to match leading and trailing whitespace. */ - var reTrim = /^\s+|\s+$/g, - reTrimStart = /^\s+/, - reTrimEnd = /\s+$/; + if (isObject(val)) + return fromUtf8(JSON.stringify(val)); - /** Used to match wrap detail comments. */ - var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, - reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, - reSplitDetails = /,? & /; + // if its a negative number, pass it through fromDecimal + if (isString(val)) { + if (val.indexOf('-0x') === 0) + return fromDecimal(val); + else if(val.indexOf('0x') === 0) + return val; + else if (!isFinite(val)) + return fromAscii(val); + } - /** Used to match words composed of alphanumeric characters. */ - var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; + return fromDecimal(val); +}; - /** Used to match backslashes in property paths. */ - var reEscapeChar = /\\(\\)?/g; +/** + * Returns value of unit in Wei + * + * @method getValueOfUnit + * @param {String} unit the unit to convert to, default ether + * @returns {BigNumber} value of the unit (in Wei) + * @throws error if the unit is not correct:w + */ +var getValueOfUnit = function (unit) { + unit = unit ? unit.toLowerCase() : 'ether'; + var unitValue = unitMap[unit]; + if (unitValue === undefined) { + throw new Error('This unit doesn\'t exists, please use the one of the following units' + JSON.stringify(unitMap, null, 2)); + } + return new BigNumber(unitValue, 10); +}; - /** - * Used to match - * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). - */ - var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; +/** + * Takes a number of wei and converts it to any other ether unit. + * + * Possible units are: + * SI Short SI Full Effigy Other + * - kwei femtoether babbage + * - mwei picoether lovelace + * - gwei nanoether shannon nano + * - -- microether szabo micro + * - -- milliether finney milli + * - ether -- -- + * - kether -- grand + * - mether + * - gether + * - tether + * + * @method fromWei + * @param {Number|String} number can be a number, number string or a HEX of a decimal + * @param {String} unit the unit to convert to, default ether + * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number +*/ +var fromWei = function(number, unit) { + var returnValue = toBigNumber(number).dividedBy(getValueOfUnit(unit)); - /** Used to match `RegExp` flags from their coerced string values. */ - var reFlags = /\w*$/; + return isBigNumber(number) ? returnValue : returnValue.toString(10); +}; - /** Used to detect bad signed hexadecimal string values. */ - var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; +/** + * Takes a number of a unit and converts it to wei. + * + * Possible units are: + * SI Short SI Full Effigy Other + * - kwei femtoether babbage + * - mwei picoether lovelace + * - gwei nanoether shannon nano + * - -- microether szabo micro + * - -- microether szabo micro + * - -- milliether finney milli + * - ether -- -- + * - kether -- grand + * - mether + * - gether + * - tether + * + * @method toWei + * @param {Number|String|BigNumber} number can be a number, number string or a HEX of a decimal + * @param {String} unit the unit to convert from, default ether + * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number +*/ +var toWei = function(number, unit) { + var returnValue = toBigNumber(number).times(getValueOfUnit(unit)); - /** Used to detect binary string values. */ - var reIsBinary = /^0b[01]+$/i; + return isBigNumber(number) ? returnValue : returnValue.toString(10); +}; - /** Used to detect host constructors (Safari). */ - var reIsHostCtor = /^\[object .+?Constructor\]$/; +/** + * Takes an input and transforms it into an bignumber + * + * @method toBigNumber + * @param {Number|String|BigNumber} a number, string, HEX string or BigNumber + * @return {BigNumber} BigNumber +*/ +var toBigNumber = function(number) { + /*jshint maxcomplexity:5 */ + number = number || 0; + if (isBigNumber(number)) + return number; - /** Used to detect octal string values. */ - var reIsOctal = /^0o[0-7]+$/i; + if (isString(number) && (number.indexOf('0x') === 0 || number.indexOf('-0x') === 0)) { + return new BigNumber(number.replace('0x',''), 16); + } - /** Used to detect unsigned integer values. */ - var reIsUint = /^(?:0|[1-9]\d*)$/; + return new BigNumber(number.toString(10), 10); +}; - /** Used to match Latin Unicode letters (excluding mathematical operators). */ - var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; +/** + * Takes and input transforms it into bignumber and if it is negative value, into two's complement + * + * @method toTwosComplement + * @param {Number|String|BigNumber} + * @return {BigNumber} + */ +var toTwosComplement = function (number) { + var bigNumber = toBigNumber(number).round(); + if (bigNumber.lessThan(0)) { + return new BigNumber("ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff", 16).plus(bigNumber).plus(1); + } + return bigNumber; +}; - /** Used to ensure capturing order of template delimiters. */ - var reNoMatch = /($^)/; +/** + * Checks if the given string is strictly an address + * + * @method isStrictAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isStrictAddress = function (address) { + return /^0x[0-9a-f]{40}$/i.test(address); +}; - /** Used to match unescaped characters in compiled string literals. */ - var reUnescapedString = /['\n\r\u2028\u2029\\]/g; +/** + * Checks if the given string is an address + * + * @method isAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isAddress = function (address) { + if (!/^(0x)?[0-9a-f]{40}$/i.test(address)) { + // check if it has the basic requirements of an address + return false; + } else if (/^(0x)?[0-9a-f]{40}$/.test(address) || /^(0x)?[0-9A-F]{40}$/.test(address)) { + // If it's all small caps or all all caps, return true + return true; + } else { + // Otherwise check each case + return isChecksumAddress(address); + } +}; - /** Used to compose unicode character classes. */ - var rsAstralRange = '\\ud800-\\udfff', - rsComboMarksRange = '\\u0300-\\u036f', - reComboHalfMarksRange = '\\ufe20-\\ufe2f', - rsComboSymbolsRange = '\\u20d0-\\u20ff', - rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, - rsDingbatRange = '\\u2700-\\u27bf', - rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', - rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', - rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', - rsPunctuationRange = '\\u2000-\\u206f', - rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', - rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', - rsVarRange = '\\ufe0e\\ufe0f', - rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; +/** + * Checks if the given string is a checksummed address + * + * @method isChecksumAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isChecksumAddress = function (address) { + // Check each case + address = address.replace('0x',''); + var addressHash = sha3(address.toLowerCase()); - /** Used to compose unicode capture groups. */ - var rsApos = "['\u2019]", - rsAstral = '[' + rsAstralRange + ']', - rsBreak = '[' + rsBreakRange + ']', - rsCombo = '[' + rsComboRange + ']', - rsDigits = '\\d+', - rsDingbat = '[' + rsDingbatRange + ']', - rsLower = '[' + rsLowerRange + ']', - rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', - rsFitz = '\\ud83c[\\udffb-\\udfff]', - rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', - rsNonAstral = '[^' + rsAstralRange + ']', - rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', - rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', - rsUpper = '[' + rsUpperRange + ']', - rsZWJ = '\\u200d'; + for (var i = 0; i < 40; i++ ) { + // the nth letter should be uppercase if the nth digit of casemap is 1 + if ((parseInt(addressHash[i], 16) > 7 && address[i].toUpperCase() !== address[i]) || (parseInt(addressHash[i], 16) <= 7 && address[i].toLowerCase() !== address[i])) { + return false; + } + } + return true; +}; - /** Used to compose unicode regexes. */ - var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', - rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', - rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', - rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', - reOptMod = rsModifier + '?', - rsOptVar = '[' + rsVarRange + ']?', - rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', - rsOrdLower = '\\d*(?:(?:1st|2nd|3rd|(?![123])\\dth)\\b)', - rsOrdUpper = '\\d*(?:(?:1ST|2ND|3RD|(?![123])\\dTH)\\b)', - rsSeq = rsOptVar + reOptMod + rsOptJoin, - rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, - rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; - /** Used to match apostrophes. */ - var reApos = RegExp(rsApos, 'g'); - /** - * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and - * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). - */ - var reComboMark = RegExp(rsCombo, 'g'); +/** + * Makes a checksum address + * + * @method toChecksumAddress + * @param {String} address the given HEX adress + * @return {String} +*/ +var toChecksumAddress = function (address) { + if (typeof address === 'undefined') return ''; - /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ - var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); + address = address.toLowerCase().replace('0x',''); + var addressHash = sha3(address); + var checksumAddress = '0x'; - /** Used to match complex or compound words. */ - var reUnicodeWord = RegExp([ - rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', - rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', - rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, - rsUpper + '+' + rsOptContrUpper, - rsOrdUpper, - rsOrdLower, - rsDigits, - rsEmoji - ].join('|'), 'g'); + for (var i = 0; i < address.length; i++ ) { + // If ith character is 9 to f then make it uppercase + if (parseInt(addressHash[i], 16) > 7) { + checksumAddress += address[i].toUpperCase(); + } else { + checksumAddress += address[i]; + } + } + return checksumAddress; +}; - /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ - var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); +/** + * Transforms given string to valid 20 bytes-length addres with 0x prefix + * + * @method toAddress + * @param {String} address + * @return {String} formatted address + */ +var toAddress = function (address) { + if (isStrictAddress(address)) { + return address; + } - /** Used to detect strings that need a more robust regexp to match words. */ - var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; + if (/^[0-9a-f]{40}$/.test(address)) { + return '0x' + address; + } - /** Used to assign default `context` object properties. */ - var contextProps = [ - 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', - 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', - 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', - 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', - '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' - ]; + return '0x' + padLeft(toHex(address).substr(2), 40); +}; - /** Used to make template sourceURLs easier to identify. */ - var templateCounter = -1; +/** + * Returns true if object is BigNumber, otherwise false + * + * @method isBigNumber + * @param {Object} + * @return {Boolean} + */ +var isBigNumber = function (object) { + return object instanceof BigNumber || + (object && object.constructor && object.constructor.name === 'BigNumber'); +}; - /** Used to identify `toStringTag` values of typed arrays. */ - var typedArrayTags = {}; - typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = - typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = - typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = - typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = - typedArrayTags[uint32Tag] = true; - typedArrayTags[argsTag] = typedArrayTags[arrayTag] = - typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = - typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = - typedArrayTags[errorTag] = typedArrayTags[funcTag] = - typedArrayTags[mapTag] = typedArrayTags[numberTag] = - typedArrayTags[objectTag] = typedArrayTags[regexpTag] = - typedArrayTags[setTag] = typedArrayTags[stringTag] = - typedArrayTags[weakMapTag] = false; +/** + * Returns true if object is string, otherwise false + * + * @method isString + * @param {Object} + * @return {Boolean} + */ +var isString = function (object) { + return typeof object === 'string' || + (object && object.constructor && object.constructor.name === 'String'); +}; - /** Used to identify `toStringTag` values supported by `_.clone`. */ - var cloneableTags = {}; - cloneableTags[argsTag] = cloneableTags[arrayTag] = - cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = - cloneableTags[boolTag] = cloneableTags[dateTag] = - cloneableTags[float32Tag] = cloneableTags[float64Tag] = - cloneableTags[int8Tag] = cloneableTags[int16Tag] = - cloneableTags[int32Tag] = cloneableTags[mapTag] = - cloneableTags[numberTag] = cloneableTags[objectTag] = - cloneableTags[regexpTag] = cloneableTags[setTag] = - cloneableTags[stringTag] = cloneableTags[symbolTag] = - cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = - cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; - cloneableTags[errorTag] = cloneableTags[funcTag] = - cloneableTags[weakMapTag] = false; +/** + * Returns true if object is function, otherwise false + * + * @method isFunction + * @param {Object} + * @return {Boolean} + */ +var isFunction = function (object) { + return typeof object === 'function'; +}; - /** Used to map Latin Unicode letters to basic Latin letters. */ - var deburredLetters = { - // Latin-1 Supplement block. - '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', - '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', - '\xc7': 'C', '\xe7': 'c', - '\xd0': 'D', '\xf0': 'd', - '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', - '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', - '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', - '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', - '\xd1': 'N', '\xf1': 'n', - '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', - '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', - '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', - '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', - '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', - '\xc6': 'Ae', '\xe6': 'ae', - '\xde': 'Th', '\xfe': 'th', - '\xdf': 'ss', - // Latin Extended-A block. - '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', - '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', - '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', - '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', - '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', - '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', - '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', - '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', - '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', - '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', - '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', - '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', - '\u0134': 'J', '\u0135': 'j', - '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', - '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', - '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', - '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', - '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', - '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', - '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', - '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', - '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', - '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', - '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', - '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', - '\u0163': 't', '\u0165': 't', '\u0167': 't', - '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', - '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', - '\u0174': 'W', '\u0175': 'w', - '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', - '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', - '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', - '\u0132': 'IJ', '\u0133': 'ij', - '\u0152': 'Oe', '\u0153': 'oe', - '\u0149': "'n", '\u017f': 's' - }; +/** + * Returns true if object is Objet, otherwise false + * + * @method isObject + * @param {Object} + * @return {Boolean} + */ +var isObject = function (object) { + return typeof object === 'object'; +}; - /** Used to map characters to HTML entities. */ - var htmlEscapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - "'": ''' - }; +/** + * Returns true if object is boolean, otherwise false + * + * @method isBoolean + * @param {Object} + * @return {Boolean} + */ +var isBoolean = function (object) { + return typeof object === 'boolean'; +}; - /** Used to map HTML entities to characters. */ - var htmlUnescapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - ''': "'" - }; +/** + * Returns true if object is array, otherwise false + * + * @method isArray + * @param {Object} + * @return {Boolean} + */ +var isArray = function (object) { + return object instanceof Array; +}; - /** Used to escape characters for inclusion in compiled string literals. */ - var stringEscapes = { - '\\': '\\', - "'": "'", - '\n': 'n', - '\r': 'r', - '\u2028': 'u2028', - '\u2029': 'u2029' - }; +/** + * Returns true if given string is valid json object + * + * @method isJson + * @param {String} + * @return {Boolean} + */ +var isJson = function (str) { + try { + return !!JSON.parse(str); + } catch (e) { + return false; + } +}; - /** Built-in method references without a dependency on `root`. */ - var freeParseFloat = parseFloat, - freeParseInt = parseInt; +/** + * Returns true if given string is a valid Ethereum block header bloom. + * + * @method isBloom + * @param {String} hex encoded bloom filter + * @return {Boolean} + */ +var isBloom = function (bloom) { + if (!/^(0x)?[0-9a-f]{512}$/i.test(bloom)) { + return false; + } else if (/^(0x)?[0-9a-f]{512}$/.test(bloom) || /^(0x)?[0-9A-F]{512}$/.test(bloom)) { + return true; + } + return false; +}; - /** Detect free variable `global` from Node.js. */ - var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; +/** + * Returns true if given string is a valid log topic. + * + * @method isTopic + * @param {String} hex encoded topic + * @return {Boolean} + */ +var isTopic = function (topic) { + if (!/^(0x)?[0-9a-f]{64}$/i.test(topic)) { + return false; + } else if (/^(0x)?[0-9a-f]{64}$/.test(topic) || /^(0x)?[0-9A-F]{64}$/.test(topic)) { + return true; + } + return false; +}; - /** Detect free variable `self`. */ - var freeSelf = typeof self == 'object' && self && self.Object === Object && self; +module.exports = { + padLeft: padLeft, + padRight: padRight, + toHex: toHex, + toDecimal: toDecimal, + fromDecimal: fromDecimal, + toUtf8: toUtf8, + toAscii: toAscii, + fromUtf8: fromUtf8, + fromAscii: fromAscii, + transformToFullName: transformToFullName, + extractDisplayName: extractDisplayName, + extractTypeName: extractTypeName, + toWei: toWei, + fromWei: fromWei, + toBigNumber: toBigNumber, + toTwosComplement: toTwosComplement, + toAddress: toAddress, + isBigNumber: isBigNumber, + isStrictAddress: isStrictAddress, + isAddress: isAddress, + isChecksumAddress: isChecksumAddress, + toChecksumAddress: toChecksumAddress, + isFunction: isFunction, + isString: isString, + isObject: isObject, + isBoolean: isBoolean, + isArray: isArray, + isJson: isJson, + isBloom: isBloom, + isTopic: isTopic, +}; - /** Used as a reference to the global object. */ - var root = freeGlobal || freeSelf || Function('return this')(); - /** Detect free variable `exports`. */ - var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; +/***/ }), +/* 20 */ +/***/ (function(module, exports, __webpack_require__) { - /** Detect free variable `module`. */ - var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; +;(function (root, factory) { + if (true) { + // CommonJS + module.exports = exports = factory(__webpack_require__(6)); + } + else if (typeof define === "function" && define.amd) { + // AMD + define(["./core"], factory); + } + else { + // Global (browser) + factory(root.CryptoJS); + } +}(this, function (CryptoJS) { - /** Detect the popular CommonJS extension `module.exports`. */ - var moduleExports = freeModule && freeModule.exports === freeExports; + /** + * Cipher core components. + */ + CryptoJS.lib.Cipher || (function (undefined) { + // Shortcuts + var C = CryptoJS; + var C_lib = C.lib; + var Base = C_lib.Base; + var WordArray = C_lib.WordArray; + var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm; + var C_enc = C.enc; + var Utf8 = C_enc.Utf8; + var Base64 = C_enc.Base64; + var C_algo = C.algo; + var EvpKDF = C_algo.EvpKDF; - /** Detect free variable `process` from Node.js. */ - var freeProcess = moduleExports && freeGlobal.process; + /** + * Abstract base cipher template. + * + * @property {number} keySize This cipher's key size. Default: 4 (128 bits) + * @property {number} ivSize This cipher's IV size. Default: 4 (128 bits) + * @property {number} _ENC_XFORM_MODE A constant representing encryption mode. + * @property {number} _DEC_XFORM_MODE A constant representing decryption mode. + */ + var Cipher = C_lib.Cipher = BufferedBlockAlgorithm.extend({ + /** + * Configuration options. + * + * @property {WordArray} iv The IV to use for this operation. + */ + cfg: Base.extend(), - /** Used to access faster Node.js helpers. */ - var nodeUtil = (function() { - try { - return freeProcess && freeProcess.binding && freeProcess.binding('util'); - } catch (e) {} - }()); + /** + * Creates this cipher in encryption mode. + * + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {Cipher} A cipher instance. + * + * @static + * + * @example + * + * var cipher = CryptoJS.algo.AES.createEncryptor(keyWordArray, { iv: ivWordArray }); + */ + createEncryptor: function (key, cfg) { + return this.create(this._ENC_XFORM_MODE, key, cfg); + }, - /* Node.js helper references. */ - var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, - nodeIsDate = nodeUtil && nodeUtil.isDate, - nodeIsMap = nodeUtil && nodeUtil.isMap, - nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, - nodeIsSet = nodeUtil && nodeUtil.isSet, - nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; + /** + * Creates this cipher in decryption mode. + * + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {Cipher} A cipher instance. + * + * @static + * + * @example + * + * var cipher = CryptoJS.algo.AES.createDecryptor(keyWordArray, { iv: ivWordArray }); + */ + createDecryptor: function (key, cfg) { + return this.create(this._DEC_XFORM_MODE, key, cfg); + }, - /*--------------------------------------------------------------------------*/ + /** + * Initializes a newly created cipher. + * + * @param {number} xformMode Either the encryption or decryption transormation mode constant. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @example + * + * var cipher = CryptoJS.algo.AES.create(CryptoJS.algo.AES._ENC_XFORM_MODE, keyWordArray, { iv: ivWordArray }); + */ + init: function (xformMode, key, cfg) { + // Apply config defaults + this.cfg = this.cfg.extend(cfg); - /** - * Adds the key-value `pair` to `map`. - * - * @private - * @param {Object} map The map to modify. - * @param {Array} pair The key-value pair to add. - * @returns {Object} Returns `map`. - */ - function addMapEntry(map, pair) { - // Don't return `map.set` because it's not chainable in IE 11. - map.set(pair[0], pair[1]); - return map; - } + // Store transform mode and key + this._xformMode = xformMode; + this._key = key; - /** - * Adds `value` to `set`. - * - * @private - * @param {Object} set The set to modify. - * @param {*} value The value to add. - * @returns {Object} Returns `set`. - */ - function addSetEntry(set, value) { - // Don't return `set.add` because it's not chainable in IE 11. - set.add(value); - return set; - } + // Set initial values + this.reset(); + }, - /** - * A faster alternative to `Function#apply`, this function invokes `func` - * with the `this` binding of `thisArg` and the arguments of `args`. - * - * @private - * @param {Function} func The function to invoke. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} args The arguments to invoke `func` with. - * @returns {*} Returns the result of `func`. - */ - function apply(func, thisArg, args) { - switch (args.length) { - case 0: return func.call(thisArg); - case 1: return func.call(thisArg, args[0]); - case 2: return func.call(thisArg, args[0], args[1]); - case 3: return func.call(thisArg, args[0], args[1], args[2]); - } - return func.apply(thisArg, args); - } + /** + * Resets this cipher to its initial state. + * + * @example + * + * cipher.reset(); + */ + reset: function () { + // Reset data buffer + BufferedBlockAlgorithm.reset.call(this); - /** - * A specialized version of `baseAggregator` for arrays. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function arrayAggregator(array, setter, iteratee, accumulator) { - var index = -1, - length = array == null ? 0 : array.length; + // Perform concrete-cipher logic + this._doReset(); + }, - while (++index < length) { - var value = array[index]; - setter(accumulator, value, iteratee(value), array); - } - return accumulator; - } + /** + * Adds data to be encrypted or decrypted. + * + * @param {WordArray|string} dataUpdate The data to encrypt or decrypt. + * + * @return {WordArray} The data after processing. + * + * @example + * + * var encrypted = cipher.process('data'); + * var encrypted = cipher.process(wordArray); + */ + process: function (dataUpdate) { + // Append + this._append(dataUpdate); - /** - * A specialized version of `_.forEach` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEach(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length; + // Process available blocks + return this._process(); + }, - while (++index < length) { - if (iteratee(array[index], index, array) === false) { - break; - } - } - return array; - } + /** + * Finalizes the encryption or decryption process. + * Note that the finalize operation is effectively a destructive, read-once operation. + * + * @param {WordArray|string} dataUpdate The final data to encrypt or decrypt. + * + * @return {WordArray} The data after final processing. + * + * @example + * + * var encrypted = cipher.finalize(); + * var encrypted = cipher.finalize('data'); + * var encrypted = cipher.finalize(wordArray); + */ + finalize: function (dataUpdate) { + // Final data update + if (dataUpdate) { + this._append(dataUpdate); + } - /** - * A specialized version of `_.forEachRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEachRight(array, iteratee) { - var length = array == null ? 0 : array.length; + // Perform concrete-cipher logic + var finalProcessedData = this._doFinalize(); - while (length--) { - if (iteratee(array[length], length, array) === false) { - break; - } - } - return array; - } + return finalProcessedData; + }, - /** - * A specialized version of `_.every` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - */ - function arrayEvery(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; + keySize: 128/32, - while (++index < length) { - if (!predicate(array[index], index, array)) { - return false; - } - } - return true; - } + ivSize: 128/32, - /** - * A specialized version of `_.filter` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function arrayFilter(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; + _ENC_XFORM_MODE: 1, - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result[resIndex++] = value; - } - } - return result; - } + _DEC_XFORM_MODE: 2, - /** - * A specialized version of `_.includes` for arrays without support for - * specifying an index to search from. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludes(array, value) { - var length = array == null ? 0 : array.length; - return !!length && baseIndexOf(array, value, 0) > -1; - } + /** + * Creates shortcut functions to a cipher's object interface. + * + * @param {Cipher} cipher The cipher to create a helper for. + * + * @return {Object} An object with encrypt and decrypt shortcut functions. + * + * @static + * + * @example + * + * var AES = CryptoJS.lib.Cipher._createHelper(CryptoJS.algo.AES); + */ + _createHelper: (function () { + function selectCipherStrategy(key) { + if (typeof key == 'string') { + return PasswordBasedCipher; + } else { + return SerializableCipher; + } + } - /** - * This function is like `arrayIncludes` except that it accepts a comparator. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @param {Function} comparator The comparator invoked per element. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludesWith(array, value, comparator) { - var index = -1, - length = array == null ? 0 : array.length; + return function (cipher) { + return { + encrypt: function (message, key, cfg) { + return selectCipherStrategy(key).encrypt(cipher, message, key, cfg); + }, - while (++index < length) { - if (comparator(value, array[index])) { - return true; - } - } - return false; - } + decrypt: function (ciphertext, key, cfg) { + return selectCipherStrategy(key).decrypt(cipher, ciphertext, key, cfg); + } + }; + }; + }()) + }); - /** - * A specialized version of `_.map` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function arrayMap(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length, - result = Array(length); + /** + * Abstract base stream cipher template. + * + * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 1 (32 bits) + */ + var StreamCipher = C_lib.StreamCipher = Cipher.extend({ + _doFinalize: function () { + // Process partial blocks + var finalProcessedBlocks = this._process(!!'flush'); - while (++index < length) { - result[index] = iteratee(array[index], index, array); - } - return result; - } + return finalProcessedBlocks; + }, - /** - * Appends the elements of `values` to `array`. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to append. - * @returns {Array} Returns `array`. - */ - function arrayPush(array, values) { - var index = -1, - length = values.length, - offset = array.length; + blockSize: 1 + }); - while (++index < length) { - array[offset + index] = values[index]; - } - return array; - } + /** + * Mode namespace. + */ + var C_mode = C.mode = {}; - /** - * A specialized version of `_.reduce` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the first element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduce(array, iteratee, accumulator, initAccum) { - var index = -1, - length = array == null ? 0 : array.length; + /** + * Abstract base block cipher mode template. + */ + var BlockCipherMode = C_lib.BlockCipherMode = Base.extend({ + /** + * Creates this mode for encryption. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @static + * + * @example + * + * var mode = CryptoJS.mode.CBC.createEncryptor(cipher, iv.words); + */ + createEncryptor: function (cipher, iv) { + return this.Encryptor.create(cipher, iv); + }, - if (initAccum && length) { - accumulator = array[++index]; - } - while (++index < length) { - accumulator = iteratee(accumulator, array[index], index, array); - } - return accumulator; - } + /** + * Creates this mode for decryption. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @static + * + * @example + * + * var mode = CryptoJS.mode.CBC.createDecryptor(cipher, iv.words); + */ + createDecryptor: function (cipher, iv) { + return this.Decryptor.create(cipher, iv); + }, - /** - * A specialized version of `_.reduceRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the last element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduceRight(array, iteratee, accumulator, initAccum) { - var length = array == null ? 0 : array.length; - if (initAccum && length) { - accumulator = array[--length]; - } - while (length--) { - accumulator = iteratee(accumulator, array[length], length, array); - } - return accumulator; - } + /** + * Initializes a newly created mode. + * + * @param {Cipher} cipher A block cipher instance. + * @param {Array} iv The IV words. + * + * @example + * + * var mode = CryptoJS.mode.CBC.Encryptor.create(cipher, iv.words); + */ + init: function (cipher, iv) { + this._cipher = cipher; + this._iv = iv; + } + }); - /** - * A specialized version of `_.some` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function arraySome(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; + /** + * Cipher Block Chaining mode. + */ + var CBC = C_mode.CBC = (function () { + /** + * Abstract base CBC mode. + */ + var CBC = BlockCipherMode.extend(); - while (++index < length) { - if (predicate(array[index], index, array)) { - return true; - } - } - return false; - } + /** + * CBC encryptor. + */ + CBC.Encryptor = CBC.extend({ + /** + * Processes the data block at offset. + * + * @param {Array} words The data words to operate on. + * @param {number} offset The offset where the block starts. + * + * @example + * + * mode.processBlock(data.words, offset); + */ + processBlock: function (words, offset) { + // Shortcuts + var cipher = this._cipher; + var blockSize = cipher.blockSize; - /** - * Gets the size of an ASCII `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - var asciiSize = baseProperty('length'); + // XOR and encrypt + xorBlock.call(this, words, offset, blockSize); + cipher.encryptBlock(words, offset); - /** - * Converts an ASCII `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function asciiToArray(string) { - return string.split(''); - } + // Remember this block to use with next block + this._prevBlock = words.slice(offset, offset + blockSize); + } + }); - /** - * Splits an ASCII `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function asciiWords(string) { - return string.match(reAsciiWord) || []; - } + /** + * CBC decryptor. + */ + CBC.Decryptor = CBC.extend({ + /** + * Processes the data block at offset. + * + * @param {Array} words The data words to operate on. + * @param {number} offset The offset where the block starts. + * + * @example + * + * mode.processBlock(data.words, offset); + */ + processBlock: function (words, offset) { + // Shortcuts + var cipher = this._cipher; + var blockSize = cipher.blockSize; - /** - * The base implementation of methods like `_.findKey` and `_.findLastKey`, - * without support for iteratee shorthands, which iterates over `collection` - * using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the found element or its key, else `undefined`. - */ - function baseFindKey(collection, predicate, eachFunc) { - var result; - eachFunc(collection, function(value, key, collection) { - if (predicate(value, key, collection)) { - result = key; - return false; - } - }); - return result; - } + // Remember this block to use with next block + var thisBlock = words.slice(offset, offset + blockSize); - /** - * The base implementation of `_.findIndex` and `_.findLastIndex` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {number} fromIndex The index to search from. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseFindIndex(array, predicate, fromIndex, fromRight) { - var length = array.length, - index = fromIndex + (fromRight ? 1 : -1); + // Decrypt and XOR + cipher.decryptBlock(words, offset); + xorBlock.call(this, words, offset, blockSize); - while ((fromRight ? index-- : ++index < length)) { - if (predicate(array[index], index, array)) { - return index; - } - } - return -1; - } + // This block becomes the previous block + this._prevBlock = thisBlock; + } + }); - /** - * The base implementation of `_.indexOf` without `fromIndex` bounds checks. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOf(array, value, fromIndex) { - return value === value - ? strictIndexOf(array, value, fromIndex) - : baseFindIndex(array, baseIsNaN, fromIndex); - } + function xorBlock(words, offset, blockSize) { + // Shortcut + var iv = this._iv; - /** - * This function is like `baseIndexOf` except that it accepts a comparator. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @param {Function} comparator The comparator invoked per element. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOfWith(array, value, fromIndex, comparator) { - var index = fromIndex - 1, - length = array.length; + // Choose mixing block + if (iv) { + var block = iv; - while (++index < length) { - if (comparator(array[index], value)) { - return index; - } - } - return -1; - } + // Remove IV for subsequent blocks + this._iv = undefined; + } else { + var block = this._prevBlock; + } - /** - * The base implementation of `_.isNaN` without support for number objects. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - */ - function baseIsNaN(value) { - return value !== value; - } + // XOR blocks + for (var i = 0; i < blockSize; i++) { + words[offset + i] ^= block[i]; + } + } - /** - * The base implementation of `_.mean` and `_.meanBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the mean. - */ - function baseMean(array, iteratee) { - var length = array == null ? 0 : array.length; - return length ? (baseSum(array, iteratee) / length) : NAN; - } + return CBC; + }()); - /** - * The base implementation of `_.property` without support for deep paths. - * - * @private - * @param {string} key The key of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function baseProperty(key) { - return function(object) { - return object == null ? undefined : object[key]; - }; - } + /** + * Padding namespace. + */ + var C_pad = C.pad = {}; - /** - * The base implementation of `_.propertyOf` without support for deep paths. - * - * @private - * @param {Object} object The object to query. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyOf(object) { - return function(key) { - return object == null ? undefined : object[key]; - }; - } + /** + * PKCS #5/7 padding strategy. + */ + var Pkcs7 = C_pad.Pkcs7 = { + /** + * Pads data using the algorithm defined in PKCS #5/7. + * + * @param {WordArray} data The data to pad. + * @param {number} blockSize The multiple that the data should be padded to. + * + * @static + * + * @example + * + * CryptoJS.pad.Pkcs7.pad(wordArray, 4); + */ + pad: function (data, blockSize) { + // Shortcut + var blockSizeBytes = blockSize * 4; - /** - * The base implementation of `_.reduce` and `_.reduceRight`, without support - * for iteratee shorthands, which iterates over `collection` using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} accumulator The initial value. - * @param {boolean} initAccum Specify using the first or last element of - * `collection` as the initial value. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the accumulated value. - */ - function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { - eachFunc(collection, function(value, index, collection) { - accumulator = initAccum - ? (initAccum = false, value) - : iteratee(accumulator, value, index, collection); - }); - return accumulator; - } + // Count padding bytes + var nPaddingBytes = blockSizeBytes - data.sigBytes % blockSizeBytes; - /** - * The base implementation of `_.sortBy` which uses `comparer` to define the - * sort order of `array` and replaces criteria objects with their corresponding - * values. - * - * @private - * @param {Array} array The array to sort. - * @param {Function} comparer The function to define sort order. - * @returns {Array} Returns `array`. - */ - function baseSortBy(array, comparer) { - var length = array.length; + // Create padding word + var paddingWord = (nPaddingBytes << 24) | (nPaddingBytes << 16) | (nPaddingBytes << 8) | nPaddingBytes; - array.sort(comparer); - while (length--) { - array[length] = array[length].value; - } - return array; - } + // Create padding + var paddingWords = []; + for (var i = 0; i < nPaddingBytes; i += 4) { + paddingWords.push(paddingWord); + } + var padding = WordArray.create(paddingWords, nPaddingBytes); - /** - * The base implementation of `_.sum` and `_.sumBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the sum. - */ - function baseSum(array, iteratee) { - var result, - index = -1, - length = array.length; + // Add padding + data.concat(padding); + }, - while (++index < length) { - var current = iteratee(array[index]); - if (current !== undefined) { - result = result === undefined ? current : (result + current); - } - } - return result; - } + /** + * Unpads data that had been padded using the algorithm defined in PKCS #5/7. + * + * @param {WordArray} data The data to unpad. + * + * @static + * + * @example + * + * CryptoJS.pad.Pkcs7.unpad(wordArray); + */ + unpad: function (data) { + // Get number of padding bytes from last byte + var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff; - /** - * The base implementation of `_.times` without support for iteratee shorthands - * or max array length checks. - * - * @private - * @param {number} n The number of times to invoke `iteratee`. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the array of results. - */ - function baseTimes(n, iteratee) { - var index = -1, - result = Array(n); + // Remove padding + data.sigBytes -= nPaddingBytes; + } + }; - while (++index < n) { - result[index] = iteratee(index); - } - return result; - } + /** + * Abstract base block cipher template. + * + * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 4 (128 bits) + */ + var BlockCipher = C_lib.BlockCipher = Cipher.extend({ + /** + * Configuration options. + * + * @property {Mode} mode The block mode to use. Default: CBC + * @property {Padding} padding The padding strategy to use. Default: Pkcs7 + */ + cfg: Cipher.cfg.extend({ + mode: CBC, + padding: Pkcs7 + }), - /** - * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array - * of key-value pairs for `object` corresponding to the property names of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the key-value pairs. - */ - function baseToPairs(object, props) { - return arrayMap(props, function(key) { - return [key, object[key]]; - }); - } + reset: function () { + // Reset cipher + Cipher.reset.call(this); - /** - * The base implementation of `_.unary` without support for storing metadata. - * - * @private - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - */ - function baseUnary(func) { - return function(value) { - return func(value); - }; - } + // Shortcuts + var cfg = this.cfg; + var iv = cfg.iv; + var mode = cfg.mode; - /** - * The base implementation of `_.values` and `_.valuesIn` which creates an - * array of `object` property values corresponding to the property names - * of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the array of property values. - */ - function baseValues(object, props) { - return arrayMap(props, function(key) { - return object[key]; - }); - } + // Reset block mode + if (this._xformMode == this._ENC_XFORM_MODE) { + var modeCreator = mode.createEncryptor; + } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ { + var modeCreator = mode.createDecryptor; - /** - * Checks if a `cache` value for `key` exists. - * - * @private - * @param {Object} cache The cache to query. - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function cacheHas(cache, key) { - return cache.has(key); - } + // Keep at least one block in the buffer for unpadding + this._minBufferSize = 1; + } + this._mode = modeCreator.call(mode, this, iv && iv.words); + }, - /** - * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the first unmatched string symbol. - */ - function charsStartIndex(strSymbols, chrSymbols) { - var index = -1, - length = strSymbols.length; + _doProcessBlock: function (words, offset) { + this._mode.processBlock(words, offset); + }, - while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } + _doFinalize: function () { + // Shortcut + var padding = this.cfg.padding; - /** - * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the last unmatched string symbol. - */ - function charsEndIndex(strSymbols, chrSymbols) { - var index = strSymbols.length; + // Finalize + if (this._xformMode == this._ENC_XFORM_MODE) { + // Pad data + padding.pad(this._data, this.blockSize); - while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } + // Process final blocks + var finalProcessedBlocks = this._process(!!'flush'); + } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ { + // Process final blocks + var finalProcessedBlocks = this._process(!!'flush'); - /** - * Gets the number of `placeholder` occurrences in `array`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} placeholder The placeholder to search for. - * @returns {number} Returns the placeholder count. - */ - function countHolders(array, placeholder) { - var length = array.length, - result = 0; + // Unpad data + padding.unpad(finalProcessedBlocks); + } - while (length--) { - if (array[length] === placeholder) { - ++result; - } - } - return result; - } + return finalProcessedBlocks; + }, - /** - * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A - * letters to basic Latin letters. - * - * @private - * @param {string} letter The matched letter to deburr. - * @returns {string} Returns the deburred letter. - */ - var deburrLetter = basePropertyOf(deburredLetters); + blockSize: 128/32 + }); - /** - * Used by `_.escape` to convert characters to HTML entities. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - var escapeHtmlChar = basePropertyOf(htmlEscapes); + /** + * A collection of cipher parameters. + * + * @property {WordArray} ciphertext The raw ciphertext. + * @property {WordArray} key The key to this ciphertext. + * @property {WordArray} iv The IV used in the ciphering operation. + * @property {WordArray} salt The salt used with a key derivation function. + * @property {Cipher} algorithm The cipher algorithm. + * @property {Mode} mode The block mode used in the ciphering operation. + * @property {Padding} padding The padding scheme used in the ciphering operation. + * @property {number} blockSize The block size of the cipher. + * @property {Format} formatter The default formatting strategy to convert this cipher params object to a string. + */ + var CipherParams = C_lib.CipherParams = Base.extend({ + /** + * Initializes a newly created cipher params object. + * + * @param {Object} cipherParams An object with any of the possible cipher parameters. + * + * @example + * + * var cipherParams = CryptoJS.lib.CipherParams.create({ + * ciphertext: ciphertextWordArray, + * key: keyWordArray, + * iv: ivWordArray, + * salt: saltWordArray, + * algorithm: CryptoJS.algo.AES, + * mode: CryptoJS.mode.CBC, + * padding: CryptoJS.pad.PKCS7, + * blockSize: 4, + * formatter: CryptoJS.format.OpenSSL + * }); + */ + init: function (cipherParams) { + this.mixIn(cipherParams); + }, - /** - * Used by `_.template` to escape characters for inclusion in compiled string literals. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - function escapeStringChar(chr) { - return '\\' + stringEscapes[chr]; - } + /** + * Converts this cipher params object to a string. + * + * @param {Format} formatter (Optional) The formatting strategy to use. + * + * @return {string} The stringified cipher params. + * + * @throws Error If neither the formatter nor the default formatter is set. + * + * @example + * + * var string = cipherParams + ''; + * var string = cipherParams.toString(); + * var string = cipherParams.toString(CryptoJS.format.OpenSSL); + */ + toString: function (formatter) { + return (formatter || this.formatter).stringify(this); + } + }); - /** - * Gets the value at `key` of `object`. - * - * @private - * @param {Object} [object] The object to query. - * @param {string} key The key of the property to get. - * @returns {*} Returns the property value. - */ - function getValue(object, key) { - return object == null ? undefined : object[key]; - } + /** + * Format namespace. + */ + var C_format = C.format = {}; - /** - * Checks if `string` contains Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a symbol is found, else `false`. - */ - function hasUnicode(string) { - return reHasUnicode.test(string); - } + /** + * OpenSSL formatting strategy. + */ + var OpenSSLFormatter = C_format.OpenSSL = { + /** + * Converts a cipher params object to an OpenSSL-compatible string. + * + * @param {CipherParams} cipherParams The cipher params object. + * + * @return {string} The OpenSSL-compatible string. + * + * @static + * + * @example + * + * var openSSLString = CryptoJS.format.OpenSSL.stringify(cipherParams); + */ + stringify: function (cipherParams) { + // Shortcuts + var ciphertext = cipherParams.ciphertext; + var salt = cipherParams.salt; - /** - * Checks if `string` contains a word composed of Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a word is found, else `false`. - */ - function hasUnicodeWord(string) { - return reHasUnicodeWord.test(string); - } + // Format + if (salt) { + var wordArray = WordArray.create([0x53616c74, 0x65645f5f]).concat(salt).concat(ciphertext); + } else { + var wordArray = ciphertext; + } - /** - * Converts `iterator` to an array. - * - * @private - * @param {Object} iterator The iterator to convert. - * @returns {Array} Returns the converted array. - */ - function iteratorToArray(iterator) { - var data, - result = []; + return wordArray.toString(Base64); + }, - while (!(data = iterator.next()).done) { - result.push(data.value); - } - return result; - } + /** + * Converts an OpenSSL-compatible string to a cipher params object. + * + * @param {string} openSSLStr The OpenSSL-compatible string. + * + * @return {CipherParams} The cipher params object. + * + * @static + * + * @example + * + * var cipherParams = CryptoJS.format.OpenSSL.parse(openSSLString); + */ + parse: function (openSSLStr) { + // Parse base64 + var ciphertext = Base64.parse(openSSLStr); - /** - * Converts `map` to its key-value pairs. - * - * @private - * @param {Object} map The map to convert. - * @returns {Array} Returns the key-value pairs. - */ - function mapToArray(map) { - var index = -1, - result = Array(map.size); + // Shortcut + var ciphertextWords = ciphertext.words; - map.forEach(function(value, key) { - result[++index] = [key, value]; - }); - return result; - } + // Test for salt + if (ciphertextWords[0] == 0x53616c74 && ciphertextWords[1] == 0x65645f5f) { + // Extract salt + var salt = WordArray.create(ciphertextWords.slice(2, 4)); - /** - * Creates a unary function that invokes `func` with its argument transformed. - * - * @private - * @param {Function} func The function to wrap. - * @param {Function} transform The argument transform. - * @returns {Function} Returns the new function. - */ - function overArg(func, transform) { - return function(arg) { - return func(transform(arg)); - }; - } + // Remove salt from ciphertext + ciphertextWords.splice(0, 4); + ciphertext.sigBytes -= 16; + } - /** - * Replaces all `placeholder` elements in `array` with an internal placeholder - * and returns an array of their indexes. - * - * @private - * @param {Array} array The array to modify. - * @param {*} placeholder The placeholder to replace. - * @returns {Array} Returns the new array of placeholder indexes. - */ - function replaceHolders(array, placeholder) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; + return CipherParams.create({ ciphertext: ciphertext, salt: salt }); + } + }; - while (++index < length) { - var value = array[index]; - if (value === placeholder || value === PLACEHOLDER) { - array[index] = PLACEHOLDER; - result[resIndex++] = index; - } - } - return result; - } + /** + * A cipher wrapper that returns ciphertext as a serializable cipher params object. + */ + var SerializableCipher = C_lib.SerializableCipher = Base.extend({ + /** + * Configuration options. + * + * @property {Formatter} format The formatting strategy to convert cipher param objects to and from a string. Default: OpenSSL + */ + cfg: Base.extend({ + format: OpenSSLFormatter + }), - /** - * Converts `set` to an array of its values. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the values. - */ - function setToArray(set) { - var index = -1, - result = Array(set.size); + /** + * Encrypts a message. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {WordArray|string} message The message to encrypt. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {CipherParams} A cipher params object. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key); + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv }); + * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + */ + encrypt: function (cipher, message, key, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); - set.forEach(function(value) { - result[++index] = value; - }); - return result; - } + // Encrypt + var encryptor = cipher.createEncryptor(key, cfg); + var ciphertext = encryptor.finalize(message); - /** - * Converts `set` to its value-value pairs. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the value-value pairs. - */ - function setToPairs(set) { - var index = -1, - result = Array(set.size); + // Shortcut + var cipherCfg = encryptor.cfg; - set.forEach(function(value) { - result[++index] = [value, value]; - }); - return result; - } + // Create and return serializable cipher params + return CipherParams.create({ + ciphertext: ciphertext, + key: key, + iv: cipherCfg.iv, + algorithm: cipher, + mode: cipherCfg.mode, + padding: cipherCfg.padding, + blockSize: cipher.blockSize, + formatter: cfg.format + }); + }, - /** - * A specialized version of `_.indexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictIndexOf(array, value, fromIndex) { - var index = fromIndex - 1, - length = array.length; + /** + * Decrypts serialized ciphertext. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {CipherParams|string} ciphertext The ciphertext to decrypt. + * @param {WordArray} key The key. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {WordArray} The plaintext. + * + * @static + * + * @example + * + * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, key, { iv: iv, format: CryptoJS.format.OpenSSL }); + */ + decrypt: function (cipher, ciphertext, key, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); - while (++index < length) { - if (array[index] === value) { - return index; - } - } - return -1; - } + // Convert string to CipherParams + ciphertext = this._parse(ciphertext, cfg.format); - /** - * A specialized version of `_.lastIndexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictLastIndexOf(array, value, fromIndex) { - var index = fromIndex + 1; - while (index--) { - if (array[index] === value) { - return index; - } - } - return index; - } + // Decrypt + var plaintext = cipher.createDecryptor(key, cfg).finalize(ciphertext.ciphertext); - /** - * Gets the number of symbols in `string`. - * - * @private - * @param {string} string The string to inspect. - * @returns {number} Returns the string size. - */ - function stringSize(string) { - return hasUnicode(string) - ? unicodeSize(string) - : asciiSize(string); - } + return plaintext; + }, - /** - * Converts `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function stringToArray(string) { - return hasUnicode(string) - ? unicodeToArray(string) - : asciiToArray(string); - } + /** + * Converts serialized ciphertext to CipherParams, + * else assumed CipherParams already and returns ciphertext unchanged. + * + * @param {CipherParams|string} ciphertext The ciphertext. + * @param {Formatter} format The formatting strategy to use to parse serialized ciphertext. + * + * @return {CipherParams} The unserialized ciphertext. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.SerializableCipher._parse(ciphertextStringOrParams, format); + */ + _parse: function (ciphertext, format) { + if (typeof ciphertext == 'string') { + return format.parse(ciphertext, this); + } else { + return ciphertext; + } + } + }); - /** - * Used by `_.unescape` to convert HTML entities to characters. - * - * @private - * @param {string} chr The matched character to unescape. - * @returns {string} Returns the unescaped character. - */ - var unescapeHtmlChar = basePropertyOf(htmlUnescapes); + /** + * Key derivation function namespace. + */ + var C_kdf = C.kdf = {}; - /** - * Gets the size of a Unicode `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - function unicodeSize(string) { - var result = reUnicode.lastIndex = 0; - while (reUnicode.test(string)) { - ++result; - } - return result; - } + /** + * OpenSSL key derivation function. + */ + var OpenSSLKdf = C_kdf.OpenSSL = { + /** + * Derives a key and IV from a password. + * + * @param {string} password The password to derive from. + * @param {number} keySize The size in words of the key to generate. + * @param {number} ivSize The size in words of the IV to generate. + * @param {WordArray|string} salt (Optional) A 64-bit salt to use. If omitted, a salt will be generated randomly. + * + * @return {CipherParams} A cipher params object with the key, IV, and salt. + * + * @static + * + * @example + * + * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32); + * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32, 'saltsalt'); + */ + execute: function (password, keySize, ivSize, salt) { + // Generate random salt + if (!salt) { + salt = WordArray.random(64/8); + } - /** - * Converts a Unicode `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function unicodeToArray(string) { - return string.match(reUnicode) || []; - } + // Derive key and IV + var key = EvpKDF.create({ keySize: keySize + ivSize }).compute(password, salt); - /** - * Splits a Unicode `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function unicodeWords(string) { - return string.match(reUnicodeWord) || []; - } + // Separate key and IV + var iv = WordArray.create(key.words.slice(keySize), ivSize * 4); + key.sigBytes = keySize * 4; - /*--------------------------------------------------------------------------*/ + // Return params + return CipherParams.create({ key: key, iv: iv, salt: salt }); + } + }; - /** - * Create a new pristine `lodash` function using the `context` object. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Util - * @param {Object} [context=root] The context object. - * @returns {Function} Returns a new `lodash` function. - * @example - * - * _.mixin({ 'foo': _.constant('foo') }); - * - * var lodash = _.runInContext(); - * lodash.mixin({ 'bar': lodash.constant('bar') }); - * - * _.isFunction(_.foo); - * // => true - * _.isFunction(_.bar); - * // => false - * - * lodash.isFunction(lodash.foo); - * // => false - * lodash.isFunction(lodash.bar); - * // => true - * - * // Create a suped-up `defer` in Node.js. - * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; - */ - var runInContext = (function runInContext(context) { - context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); + /** + * A serializable cipher wrapper that derives the key from a password, + * and returns ciphertext as a serializable cipher params object. + */ + var PasswordBasedCipher = C_lib.PasswordBasedCipher = SerializableCipher.extend({ + /** + * Configuration options. + * + * @property {KDF} kdf The key derivation function to use to generate a key and IV from a password. Default: OpenSSL + */ + cfg: SerializableCipher.cfg.extend({ + kdf: OpenSSLKdf + }), - /** Built-in constructor references. */ - var Array = context.Array, - Date = context.Date, - Error = context.Error, - Function = context.Function, - Math = context.Math, - Object = context.Object, - RegExp = context.RegExp, - String = context.String, - TypeError = context.TypeError; + /** + * Encrypts a message using a password. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {WordArray|string} message The message to encrypt. + * @param {string} password The password. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {CipherParams} A cipher params object. + * + * @static + * + * @example + * + * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password'); + * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password', { format: CryptoJS.format.OpenSSL }); + */ + encrypt: function (cipher, message, password, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); - /** Used for built-in method references. */ - var arrayProto = Array.prototype, - funcProto = Function.prototype, - objectProto = Object.prototype; + // Derive key and other params + var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize); - /** Used to detect overreaching core-js shims. */ - var coreJsData = context['__core-js_shared__']; + // Add IV to config + cfg.iv = derivedParams.iv; - /** Used to resolve the decompiled source of functions. */ - var funcToString = funcProto.toString; + // Encrypt + var ciphertext = SerializableCipher.encrypt.call(this, cipher, message, derivedParams.key, cfg); - /** Used to check objects for own properties. */ - var hasOwnProperty = objectProto.hasOwnProperty; + // Mix in derived params + ciphertext.mixIn(derivedParams); - /** Used to generate unique IDs. */ - var idCounter = 0; + return ciphertext; + }, - /** Used to detect methods masquerading as native. */ - var maskSrcKey = (function() { - var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); - return uid ? ('Symbol(src)_1.' + uid) : ''; - }()); + /** + * Decrypts serialized ciphertext using a password. + * + * @param {Cipher} cipher The cipher algorithm to use. + * @param {CipherParams|string} ciphertext The ciphertext to decrypt. + * @param {string} password The password. + * @param {Object} cfg (Optional) The configuration options to use for this operation. + * + * @return {WordArray} The plaintext. + * + * @static + * + * @example + * + * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, 'password', { format: CryptoJS.format.OpenSSL }); + * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, 'password', { format: CryptoJS.format.OpenSSL }); + */ + decrypt: function (cipher, ciphertext, password, cfg) { + // Apply config defaults + cfg = this.cfg.extend(cfg); - /** - * Used to resolve the - * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) - * of values. - */ - var nativeObjectToString = objectProto.toString; + // Convert string to CipherParams + ciphertext = this._parse(ciphertext, cfg.format); - /** Used to infer the `Object` constructor. */ - var objectCtorString = funcToString.call(Object); + // Derive key and other params + var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize, ciphertext.salt); - /** Used to restore the original `_` reference in `_.noConflict`. */ - var oldDash = root._; + // Add IV to config + cfg.iv = derivedParams.iv; - /** Used to detect if a method is native. */ - var reIsNative = RegExp('^' + - funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') - .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' - ); + // Decrypt + var plaintext = SerializableCipher.decrypt.call(this, cipher, ciphertext, derivedParams.key, cfg); - /** Built-in value references. */ - var Buffer = moduleExports ? context.Buffer : undefined, - Symbol = context.Symbol, - Uint8Array = context.Uint8Array, - allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, - getPrototype = overArg(Object.getPrototypeOf, Object), - objectCreate = Object.create, - propertyIsEnumerable = objectProto.propertyIsEnumerable, - splice = arrayProto.splice, - spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, - symIterator = Symbol ? Symbol.iterator : undefined, - symToStringTag = Symbol ? Symbol.toStringTag : undefined; + return plaintext; + } + }); + }()); - var defineProperty = (function() { - try { - var func = getNative(Object, 'defineProperty'); - func({}, '', {}); - return func; - } catch (e) {} - }()); - /** Mocked built-ins. */ - var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, - ctxNow = Date && Date.now !== root.Date.now && Date.now, - ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; +})); - /* Built-in method references for those with the same name as other `lodash` methods. */ - var nativeCeil = Math.ceil, - nativeFloor = Math.floor, - nativeGetSymbols = Object.getOwnPropertySymbols, - nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, - nativeIsFinite = context.isFinite, - nativeJoin = arrayProto.join, - nativeKeys = overArg(Object.keys, Object), - nativeMax = Math.max, - nativeMin = Math.min, - nativeNow = Date.now, - nativeParseInt = context.parseInt, - nativeRandom = Math.random, - nativeReverse = arrayProto.reverse; +/***/ }), +/* 21 */ +/***/ (function(module, exports, __webpack_require__) { - /* Built-in method references that are verified to be native. */ - var DataView = getNative(context, 'DataView'), - Map = getNative(context, 'Map'), - Promise = getNative(context, 'Promise'), - Set = getNative(context, 'Set'), - WeakMap = getNative(context, 'WeakMap'), - nativeCreate = getNative(Object, 'create'); +// Copyright 2015 Joyent, Inc. - /** Used to store function metadata. */ - var metaMap = WeakMap && new WeakMap; +module.exports = { + bufferSplit: bufferSplit, + addRSAMissing: addRSAMissing, + calculateDSAPublic: calculateDSAPublic, + mpNormalize: mpNormalize, + ecNormalize: ecNormalize, + countZeros: countZeros, + assertCompatible: assertCompatible, + isCompatible: isCompatible, + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo +}; - /** Used to lookup unminified function names. */ - var realNames = {}; +var assert = __webpack_require__(13); +var PrivateKey = __webpack_require__(29); +var crypto = __webpack_require__(7); - /** Used to detect maps, sets, and weakmaps. */ - var dataViewCtorString = toSource(DataView), - mapCtorString = toSource(Map), - promiseCtorString = toSource(Promise), - setCtorString = toSource(Set), - weakMapCtorString = toSource(WeakMap); +var MAX_CLASS_DEPTH = 3; - /** Used to convert symbols to primitives and strings. */ - var symbolProto = Symbol ? Symbol.prototype : undefined, - symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, - symbolToString = symbolProto ? symbolProto.toString : undefined; +function isCompatible(obj, klass, needVer) { + if (obj === null || typeof (obj) !== 'object') + return (false); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return (true); + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + if (!proto || ++depth > MAX_CLASS_DEPTH) + return (false); + } + if (proto.constructor.name !== klass.name) + return (false); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + if (ver[0] != needVer[0] || ver[1] < needVer[1]) + return (false); + return (true); +} - /*------------------------------------------------------------------------*/ +function assertCompatible(obj, klass, needVer, name) { + if (name === undefined) + name = 'object'; + assert.ok(obj, name + ' must not be null'); + assert.object(obj, name + ' must be an object'); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, + name + ' must be a ' + klass.name + ' instance'); + } + assert.strictEqual(proto.constructor.name, klass.name, + name + ' must be a ' + klass.name + ' instance'); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], + name + ' must be compatible with ' + klass.name + ' klass ' + + 'version ' + needVer[0] + '.' + needVer[1]); +} - /** - * Creates a `lodash` object which wraps `value` to enable implicit method - * chain sequences. Methods that operate on and return arrays, collections, - * and functions can be chained together. Methods that retrieve a single value - * or may return a primitive value will automatically end the chain sequence - * and return the unwrapped value. Otherwise, the value must be unwrapped - * with `_#value`. - * - * Explicit chain sequences, which must be unwrapped with `_#value`, may be - * enabled using `_.chain`. - * - * The execution of chained methods is lazy, that is, it's deferred until - * `_#value` is implicitly or explicitly called. - * - * Lazy evaluation allows several methods to support shortcut fusion. - * Shortcut fusion is an optimization to merge iteratee calls; this avoids - * the creation of intermediate arrays and can greatly reduce the number of - * iteratee executions. Sections of a chain sequence qualify for shortcut - * fusion if the section is applied to an array and iteratees accept only - * one argument. The heuristic for whether a section qualifies for shortcut - * fusion is subject to change. - * - * Chaining is supported in custom builds as long as the `_#value` method is - * directly or indirectly included in the build. - * - * In addition to lodash methods, wrappers have `Array` and `String` methods. - * - * The wrapper `Array` methods are: - * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` - * - * The wrapper `String` methods are: - * `replace` and `split` - * - * The wrapper methods that support shortcut fusion are: - * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, - * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, - * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` - * - * The chainable wrapper methods are: - * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, - * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, - * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, - * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, - * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, - * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, - * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, - * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, - * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, - * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, - * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, - * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, - * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, - * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, - * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, - * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, - * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, - * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, - * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, - * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, - * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, - * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, - * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, - * `zipObject`, `zipObjectDeep`, and `zipWith` - * - * The wrapper methods that are **not** chainable by default are: - * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, - * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, - * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, - * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, - * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, - * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, - * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, - * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, - * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, - * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, - * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, - * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, - * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, - * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, - * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, - * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, - * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, - * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, - * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, - * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, - * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, - * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, - * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, - * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, - * `upperFirst`, `value`, and `words` - * - * @name _ - * @constructor - * @category Seq - * @param {*} value The value to wrap in a `lodash` instance. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2, 3]); - * - * // Returns an unwrapped value. - * wrapped.reduce(_.add); - * // => 6 - * - * // Returns a wrapped value. - * var squares = wrapped.map(square); - * - * _.isArray(squares); - * // => false - * - * _.isArray(squares.value()); - * // => true - */ - function lodash(value) { - if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { - if (value instanceof LodashWrapper) { - return value; - } - if (hasOwnProperty.call(value, '__wrapped__')) { - return wrapperClone(value); - } - } - return new LodashWrapper(value); - } +var CIPHER_LEN = { + 'des-ede3-cbc': { key: 7, iv: 8 }, + 'aes-128-cbc': { key: 16, iv: 16 } +}; +var PKCS5_SALT_LEN = 8; - /** - * The base implementation of `_.create` without support for assigning - * properties to the created object. - * - * @private - * @param {Object} proto The object to inherit from. - * @returns {Object} Returns the new object. - */ - var baseCreate = (function() { - function object() {} - return function(proto) { - if (!isObject(proto)) { - return {}; - } - if (objectCreate) { - return objectCreate(proto); - } - object.prototype = proto; - var result = new object; - object.prototype = undefined; - return result; - }; - }()); +function opensslKeyDeriv(cipher, salt, passphrase, count) { + assert.buffer(salt, 'salt'); + assert.buffer(passphrase, 'passphrase'); + assert.number(count, 'iteration count'); - /** - * The function whose prototype chain sequence wrappers inherit from. - * - * @private - */ - function baseLodash() { - // No operation performed. - } + var clen = CIPHER_LEN[cipher]; + assert.object(clen, 'supported cipher'); - /** - * The base constructor for creating `lodash` wrapper objects. - * - * @private - * @param {*} value The value to wrap. - * @param {boolean} [chainAll] Enable explicit method chain sequences. - */ - function LodashWrapper(value, chainAll) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__chain__ = !!chainAll; - this.__index__ = 0; - this.__values__ = undefined; - } + salt = salt.slice(0, PKCS5_SALT_LEN); - /** - * By default, the template delimiters used by lodash are like those in - * embedded Ruby (ERB) as well as ES2015 template strings. Change the - * following template settings to use alternative delimiters. - * - * @static - * @memberOf _ - * @type {Object} - */ - lodash.templateSettings = { + var D, D_prev, bufs; + var material = new Buffer(0); + while (material.length < clen.key + clen.iv) { + bufs = []; + if (D_prev) + bufs.push(D_prev); + bufs.push(passphrase); + bufs.push(salt); + D = Buffer.concat(bufs); + for (var j = 0; j < count; ++j) + D = crypto.createHash('md5').update(D).digest(); + material = Buffer.concat([material, D]); + D_prev = D; + } - /** - * Used to detect `data` property values to be HTML-escaped. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'escape': reEscape, + return ({ + key: material.slice(0, clen.key), + iv: material.slice(clen.key, clen.key + clen.iv) + }); +} - /** - * Used to detect code to be evaluated. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'evaluate': reEvaluate, +/* Count leading zero bits on a buffer */ +function countZeros(buf) { + var o = 0, obit = 8; + while (o < buf.length) { + var mask = (1 << obit); + if ((buf[o] & mask) === mask) + break; + obit--; + if (obit < 0) { + o++; + obit = 8; + } + } + return (o*8 + (8 - obit) - 1); +} - /** - * Used to detect `data` property values to inject. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'interpolate': reInterpolate, +function bufferSplit(buf, chr) { + assert.buffer(buf); + assert.string(chr); - /** - * Used to reference the data object in the template text. - * - * @memberOf _.templateSettings - * @type {string} - */ - 'variable': '', + var parts = []; + var lastPart = 0; + var matches = 0; + for (var i = 0; i < buf.length; ++i) { + if (buf[i] === chr.charCodeAt(matches)) + ++matches; + else if (buf[i] === chr.charCodeAt(0)) + matches = 1; + else + matches = 0; - /** - * Used to import variables into the compiled template. - * - * @memberOf _.templateSettings - * @type {Object} - */ - 'imports': { + if (matches >= chr.length) { + var newPart = i + 1; + parts.push(buf.slice(lastPart, newPart - matches)); + lastPart = newPart; + matches = 0; + } + } + if (lastPart <= buf.length) + parts.push(buf.slice(lastPart, buf.length)); - /** - * A reference to the `lodash` function. - * - * @memberOf _.templateSettings.imports - * @type {Function} - */ - '_': lodash - } - }; + return (parts); +} - // Ensure wrappers are instances of `baseLodash`. - lodash.prototype = baseLodash.prototype; - lodash.prototype.constructor = lodash; +function ecNormalize(buf, addZero) { + assert.buffer(buf); + if (buf[0] === 0x00 && buf[1] === 0x04) { + if (addZero) + return (buf); + return (buf.slice(1)); + } else if (buf[0] === 0x04) { + if (!addZero) + return (buf); + } else { + while (buf[0] === 0x00) + buf = buf.slice(1); + if (buf[0] === 0x02 || buf[0] === 0x03) + throw (new Error('Compressed elliptic curve points ' + + 'are not supported')); + if (buf[0] !== 0x04) + throw (new Error('Not a valid elliptic curve point')); + if (!addZero) + return (buf); + } + var b = new Buffer(buf.length + 1); + b[0] = 0x0; + buf.copy(b, 1); + return (b); +} - LodashWrapper.prototype = baseCreate(baseLodash.prototype); - LodashWrapper.prototype.constructor = LodashWrapper; - - /*------------------------------------------------------------------------*/ +function mpNormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) + buf = buf.slice(1); + if ((buf[0] & 0x80) === 0x80) { + var b = new Buffer(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} - /** - * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. - * - * @private - * @constructor - * @param {*} value The value to wrap. - */ - function LazyWrapper(value) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__dir__ = 1; - this.__filtered__ = false; - this.__iteratees__ = []; - this.__takeCount__ = MAX_ARRAY_LENGTH; - this.__views__ = []; - } +function bigintToMpBuf(bigint) { + var buf = new Buffer(bigint.toByteArray()); + buf = mpNormalize(buf); + return (buf); +} - /** - * Creates a clone of the lazy wrapper object. - * - * @private - * @name clone - * @memberOf LazyWrapper - * @returns {Object} Returns the cloned `LazyWrapper` object. - */ - function lazyClone() { - var result = new LazyWrapper(this.__wrapped__); - result.__actions__ = copyArray(this.__actions__); - result.__dir__ = this.__dir__; - result.__filtered__ = this.__filtered__; - result.__iteratees__ = copyArray(this.__iteratees__); - result.__takeCount__ = this.__takeCount__; - result.__views__ = copyArray(this.__views__); - return result; - } +function calculateDSAPublic(g, p, x) { + assert.buffer(g); + assert.buffer(p); + assert.buffer(x); + try { + var bigInt = __webpack_require__(76).BigInteger; + } catch (e) { + throw (new Error('To load a PKCS#8 format DSA private key, ' + + 'the node jsbn library is required.')); + } + g = new bigInt(g); + p = new bigInt(p); + x = new bigInt(x); + var y = g.modPow(x, p); + var ybuf = bigintToMpBuf(y); + return (ybuf); +} - /** - * Reverses the direction of lazy iteration. - * - * @private - * @name reverse - * @memberOf LazyWrapper - * @returns {Object} Returns the new reversed `LazyWrapper` object. - */ - function lazyReverse() { - if (this.__filtered__) { - var result = new LazyWrapper(this); - result.__dir__ = -1; - result.__filtered__ = true; - } else { - result = this.clone(); - result.__dir__ *= -1; - } - return result; - } +function addRSAMissing(key) { + assert.object(key); + assertCompatible(key, PrivateKey, [1, 1]); + try { + var bigInt = __webpack_require__(76).BigInteger; + } catch (e) { + throw (new Error('To write a PEM private key from ' + + 'this source, the node jsbn lib is required.')); + } - /** - * Extracts the unwrapped value from its lazy wrapper. - * - * @private - * @name value - * @memberOf LazyWrapper - * @returns {*} Returns the unwrapped value. - */ - function lazyValue() { - var array = this.__wrapped__.value(), - dir = this.__dir__, - isArr = isArray(array), - isRight = dir < 0, - arrLength = isArr ? array.length : 0, - view = getView(0, arrLength, this.__views__), - start = view.start, - end = view.end, - length = end - start, - index = isRight ? end : (start - 1), - iteratees = this.__iteratees__, - iterLength = iteratees.length, - resIndex = 0, - takeCount = nativeMin(length, this.__takeCount__); + var d = new bigInt(key.part.d.data); + var buf; - if (!isArr || (!isRight && arrLength == length && takeCount == length)) { - return baseWrapperValue(array, this.__actions__); - } - var result = []; + if (!key.part.dmodp) { + var p = new bigInt(key.part.p.data); + var dmodp = d.mod(p.subtract(1)); - outer: - while (length-- && resIndex < takeCount) { - index += dir; + buf = bigintToMpBuf(dmodp); + key.part.dmodp = {name: 'dmodp', data: buf}; + key.parts.push(key.part.dmodp); + } + if (!key.part.dmodq) { + var q = new bigInt(key.part.q.data); + var dmodq = d.mod(q.subtract(1)); - var iterIndex = -1, - value = array[index]; + buf = bigintToMpBuf(dmodq); + key.part.dmodq = {name: 'dmodq', data: buf}; + key.parts.push(key.part.dmodq); + } +} - while (++iterIndex < iterLength) { - var data = iteratees[iterIndex], - iteratee = data.iteratee, - type = data.type, - computed = iteratee(value); +function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw (new Error( + 'Unsupported openssl cipher "' + cipher + '"')); + } + return (inf); +} - if (type == LAZY_MAP_FLAG) { - value = computed; - } else if (!computed) { - if (type == LAZY_FILTER_FLAG) { - continue outer; - } else { - break outer; - } - } - } - result[resIndex++] = value; - } - return result; - } - // Ensure `LazyWrapper` is an instance of `baseLodash`. - LazyWrapper.prototype = baseCreate(baseLodash.prototype); - LazyWrapper.prototype.constructor = LazyWrapper; +/***/ }), +/* 22 */ +/***/ (function(module, exports, __webpack_require__) { - /*------------------------------------------------------------------------*/ +/* + This file is part of web3.js. - /** - * Creates a hash object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Hash(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; + web3.js is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } + web3.js is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU Lesser General Public License for more details. - /** - * Removes all key-value entries from the hash. - * - * @private - * @name clear - * @memberOf Hash - */ - function hashClear() { - this.__data__ = nativeCreate ? nativeCreate(null) : {}; - this.size = 0; - } + You should have received a copy of the GNU Lesser General Public License + along with web3.js. If not, see . +*/ +/** + * @file utils.js + * @author Marek Kotewicz + * @date 2015 + */ - /** - * Removes `key` and its value from the hash. - * - * @private - * @name delete - * @memberOf Hash - * @param {Object} hash The hash to modify. - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function hashDelete(key) { - var result = this.has(key) && delete this.__data__[key]; - this.size -= result ? 1 : 0; - return result; - } +/** + * Utils + * + * @module utils + */ - /** - * Gets the hash value for `key`. - * - * @private - * @name get - * @memberOf Hash - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function hashGet(key) { - var data = this.__data__; - if (nativeCreate) { - var result = data[key]; - return result === HASH_UNDEFINED ? undefined : result; - } - return hasOwnProperty.call(data, key) ? data[key] : undefined; - } +/** + * Utility functions + * + * @class [utils] utils + * @constructor + */ - /** - * Checks if a hash value for `key` exists. - * - * @private - * @name has - * @memberOf Hash - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function hashHas(key) { - var data = this.__data__; - return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); - } - /** - * Sets the hash `key` to `value`. - * - * @private - * @name set - * @memberOf Hash - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the hash instance. - */ - function hashSet(key, value) { - var data = this.__data__; - this.size += this.has(key) ? 0 : 1; - data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; - return this; - } +var BigNumber = __webpack_require__(135); +var sha3 = __webpack_require__(136); +var utf8 = __webpack_require__(139); - // Add methods to `Hash`. - Hash.prototype.clear = hashClear; - Hash.prototype['delete'] = hashDelete; - Hash.prototype.get = hashGet; - Hash.prototype.has = hashHas; - Hash.prototype.set = hashSet; +var unitMap = { + 'noether': '0', + 'wei': '1', + 'kwei': '1000', + 'Kwei': '1000', + 'babbage': '1000', + 'femtoether': '1000', + 'mwei': '1000000', + 'Mwei': '1000000', + 'lovelace': '1000000', + 'picoether': '1000000', + 'gwei': '1000000000', + 'Gwei': '1000000000', + 'shannon': '1000000000', + 'nanoether': '1000000000', + 'nano': '1000000000', + 'szabo': '1000000000000', + 'microether': '1000000000000', + 'micro': '1000000000000', + 'finney': '1000000000000000', + 'milliether': '1000000000000000', + 'milli': '1000000000000000', + 'ether': '1000000000000000000', + 'kether': '1000000000000000000000', + 'grand': '1000000000000000000000', + 'mether': '1000000000000000000000000', + 'gether': '1000000000000000000000000000', + 'tether': '1000000000000000000000000000000' +}; - /*------------------------------------------------------------------------*/ +/** + * Should be called to pad string to expected length + * + * @method padLeft + * @param {String} string to be padded + * @param {Number} characters that result string should have + * @param {String} sign, by default 0 + * @returns {String} right aligned string + */ +var padLeft = function (string, chars, sign) { + return new Array(chars - string.length + 1).join(sign ? sign : "0") + string; +}; - /** - * Creates an list cache object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function ListCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; +/** + * Should be called to pad string to expected length + * + * @method padRight + * @param {String} string to be padded + * @param {Number} characters that result string should have + * @param {String} sign, by default 0 + * @returns {String} right aligned string + */ +var padRight = function (string, chars, sign) { + return string + (new Array(chars - string.length + 1).join(sign ? sign : "0")); +}; - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } +/** + * Should be called to get utf8 from it's hex representation + * + * @method toUtf8 + * @param {String} string in hex + * @returns {String} ascii string representation of hex value + */ +var toUtf8 = function(hex) { +// Find termination + var str = ""; + var i = 0, l = hex.length; + if (hex.substring(0, 2) === '0x') { + i = 2; } - - /** - * Removes all key-value entries from the list cache. - * - * @private - * @name clear - * @memberOf ListCache - */ - function listCacheClear() { - this.__data__ = []; - this.size = 0; + for (; i < l; i+=2) { + var code = parseInt(hex.substr(i, 2), 16); + if (code === 0) + break; + str += String.fromCharCode(code); } - /** - * Removes `key` and its value from the list cache. - * - * @private - * @name delete - * @memberOf ListCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function listCacheDelete(key) { - var data = this.__data__, - index = assocIndexOf(data, key); + return utf8.decode(str); +}; - if (index < 0) { - return false; - } - var lastIndex = data.length - 1; - if (index == lastIndex) { - data.pop(); - } else { - splice.call(data, index, 1); - } - --this.size; - return true; +/** + * Should be called to get ascii from it's hex representation + * + * @method toAscii + * @param {String} string in hex + * @returns {String} ascii string representation of hex value + */ +var toAscii = function(hex) { +// Find termination + var str = ""; + var i = 0, l = hex.length; + if (hex.substring(0, 2) === '0x') { + i = 2; + } + for (; i < l; i+=2) { + var code = parseInt(hex.substr(i, 2), 16); + str += String.fromCharCode(code); } - /** - * Gets the list cache value for `key`. - * - * @private - * @name get - * @memberOf ListCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function listCacheGet(key) { - var data = this.__data__, - index = assocIndexOf(data, key); + return str; +}; - return index < 0 ? undefined : data[index][1]; +/** + * Should be called to get hex representation (prefixed by 0x) of utf8 string + * + * @method fromUtf8 + * @param {String} string + * @param {Number} optional padding + * @returns {String} hex representation of input string + */ +var fromUtf8 = function(str) { + str = utf8.encode(str); + var hex = ""; + for(var i = 0; i < str.length; i++) { + var code = str.charCodeAt(i); + if (code === 0) + break; + var n = code.toString(16); + hex += n.length < 2 ? '0' + n : n; } - /** - * Checks if a list cache value for `key` exists. - * - * @private - * @name has - * @memberOf ListCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function listCacheHas(key) { - return assocIndexOf(this.__data__, key) > -1; + return "0x" + hex; +}; + +/** + * Should be called to get hex representation (prefixed by 0x) of ascii string + * + * @method fromAscii + * @param {String} string + * @param {Number} optional padding + * @returns {String} hex representation of input string + */ +var fromAscii = function(str) { + var hex = ""; + for(var i = 0; i < str.length; i++) { + var code = str.charCodeAt(i); + var n = code.toString(16); + hex += n.length < 2 ? '0' + n : n; } - /** - * Sets the list cache `key` to `value`. - * - * @private - * @name set - * @memberOf ListCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the list cache instance. - */ - function listCacheSet(key, value) { - var data = this.__data__, - index = assocIndexOf(data, key); + return "0x" + hex; +}; - if (index < 0) { - ++this.size; - data.push([key, value]); - } else { - data[index][1] = value; - } - return this; +/** + * Should be used to create full function/event name from json abi + * + * @method transformToFullName + * @param {Object} json-abi + * @return {String} full fnction/event name + */ +var transformToFullName = function (json) { + if (json.name.indexOf('(') !== -1) { + return json.name; } - // Add methods to `ListCache`. - ListCache.prototype.clear = listCacheClear; - ListCache.prototype['delete'] = listCacheDelete; - ListCache.prototype.get = listCacheGet; - ListCache.prototype.has = listCacheHas; - ListCache.prototype.set = listCacheSet; - - /*------------------------------------------------------------------------*/ + var typeName = json.inputs.map(function(i){return i.type; }).join(); + return json.name + '(' + typeName + ')'; +}; - /** - * Creates a map cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function MapCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; +/** + * Should be called to get display name of contract function + * + * @method extractDisplayName + * @param {String} name of function/event + * @returns {String} display name for function/event eg. multiply(uint256) -> multiply + */ +var extractDisplayName = function (name) { + var length = name.indexOf('('); + return length !== -1 ? name.substr(0, length) : name; +}; - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } +/// @returns overloaded part of function/event name +var extractTypeName = function (name) { + /// TODO: make it invulnerable + var length = name.indexOf('('); + return length !== -1 ? name.substr(length + 1, name.length - 1 - (length + 1)).replace(' ', '') : ""; +}; - /** - * Removes all key-value entries from the map. - * - * @private - * @name clear - * @memberOf MapCache - */ - function mapCacheClear() { - this.size = 0; - this.__data__ = { - 'hash': new Hash, - 'map': new (Map || ListCache), - 'string': new Hash - }; - } +/** + * Converts value to it's decimal representation in string + * + * @method toDecimal + * @param {String|Number|BigNumber} + * @return {String} + */ +var toDecimal = function (value) { + return toBigNumber(value).toNumber(); +}; - /** - * Removes `key` and its value from the map. - * - * @private - * @name delete - * @memberOf MapCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function mapCacheDelete(key) { - var result = getMapData(this, key)['delete'](key); - this.size -= result ? 1 : 0; - return result; - } +/** + * Converts value to it's hex representation + * + * @method fromDecimal + * @param {String|Number|BigNumber} + * @return {String} + */ +var fromDecimal = function (value) { + var number = toBigNumber(value); + var result = number.toString(16); - /** - * Gets the map value for `key`. - * - * @private - * @name get - * @memberOf MapCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function mapCacheGet(key) { - return getMapData(this, key).get(key); - } + return number.lessThan(0) ? '-0x' + result.substr(1) : '0x' + result; +}; - /** - * Checks if a map value for `key` exists. - * - * @private - * @name has - * @memberOf MapCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function mapCacheHas(key) { - return getMapData(this, key).has(key); - } +/** + * Auto converts any given value into it's hex representation. + * + * And even stringifys objects before. + * + * @method toHex + * @param {String|Number|BigNumber|Object} + * @return {String} + */ +var toHex = function (val) { + /*jshint maxcomplexity: 8 */ - /** - * Sets the map `key` to `value`. - * - * @private - * @name set - * @memberOf MapCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the map cache instance. - */ - function mapCacheSet(key, value) { - var data = getMapData(this, key), - size = data.size; + if (isBoolean(val)) + return fromDecimal(+val); - data.set(key, value); - this.size += data.size == size ? 0 : 1; - return this; - } + if (isBigNumber(val)) + return fromDecimal(val); - // Add methods to `MapCache`. - MapCache.prototype.clear = mapCacheClear; - MapCache.prototype['delete'] = mapCacheDelete; - MapCache.prototype.get = mapCacheGet; - MapCache.prototype.has = mapCacheHas; - MapCache.prototype.set = mapCacheSet; + if (typeof val === 'object') + return fromUtf8(JSON.stringify(val)); - /*------------------------------------------------------------------------*/ + // if its a negative number, pass it through fromDecimal + if (isString(val)) { + if (val.indexOf('-0x') === 0) + return fromDecimal(val); + else if(val.indexOf('0x') === 0) + return val; + else if (!isFinite(val)) + return fromAscii(val); + } - /** - * - * Creates an array cache object to store unique values. - * - * @private - * @constructor - * @param {Array} [values] The values to cache. - */ - function SetCache(values) { - var index = -1, - length = values == null ? 0 : values.length; + return fromDecimal(val); +}; - this.__data__ = new MapCache; - while (++index < length) { - this.add(values[index]); - } +/** + * Returns value of unit in Wei + * + * @method getValueOfUnit + * @param {String} unit the unit to convert to, default ether + * @returns {BigNumber} value of the unit (in Wei) + * @throws error if the unit is not correct:w + */ +var getValueOfUnit = function (unit) { + unit = unit ? unit.toLowerCase() : 'ether'; + var unitValue = unitMap[unit]; + if (unitValue === undefined) { + throw new Error('This unit doesn\'t exists, please use the one of the following units' + JSON.stringify(unitMap, null, 2)); } + return new BigNumber(unitValue, 10); +}; - /** - * Adds `value` to the array cache. - * - * @private - * @name add - * @memberOf SetCache - * @alias push - * @param {*} value The value to cache. - * @returns {Object} Returns the cache instance. - */ - function setCacheAdd(value) { - this.__data__.set(value, HASH_UNDEFINED); - return this; - } +/** + * Takes a number of wei and converts it to any other ether unit. + * + * Possible units are: + * SI Short SI Full Effigy Other + * - kwei femtoether babbage + * - mwei picoether lovelace + * - gwei nanoether shannon nano + * - -- microether szabo micro + * - -- milliether finney milli + * - ether -- -- + * - kether -- grand + * - mether + * - gether + * - tether + * + * @method fromWei + * @param {Number|String} number can be a number, number string or a HEX of a decimal + * @param {String} unit the unit to convert to, default ether + * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number +*/ +var fromWei = function(number, unit) { + var returnValue = toBigNumber(number).dividedBy(getValueOfUnit(unit)); - /** - * Checks if `value` is in the array cache. - * - * @private - * @name has - * @memberOf SetCache - * @param {*} value The value to search for. - * @returns {number} Returns `true` if `value` is found, else `false`. - */ - function setCacheHas(value) { - return this.__data__.has(value); - } + return isBigNumber(number) ? returnValue : returnValue.toString(10); +}; - // Add methods to `SetCache`. - SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; - SetCache.prototype.has = setCacheHas; +/** + * Takes a number of a unit and converts it to wei. + * + * Possible units are: + * SI Short SI Full Effigy Other + * - kwei femtoether babbage + * - mwei picoether lovelace + * - gwei nanoether shannon nano + * - -- microether szabo micro + * - -- microether szabo micro + * - -- milliether finney milli + * - ether -- -- + * - kether -- grand + * - mether + * - gether + * - tether + * + * @method toWei + * @param {Number|String|BigNumber} number can be a number, number string or a HEX of a decimal + * @param {String} unit the unit to convert from, default ether + * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number +*/ +var toWei = function(number, unit) { + var returnValue = toBigNumber(number).times(getValueOfUnit(unit)); - /*------------------------------------------------------------------------*/ + return isBigNumber(number) ? returnValue : returnValue.toString(10); +}; - /** - * Creates a stack cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Stack(entries) { - var data = this.__data__ = new ListCache(entries); - this.size = data.size; - } +/** + * Takes an input and transforms it into an bignumber + * + * @method toBigNumber + * @param {Number|String|BigNumber} a number, string, HEX string or BigNumber + * @return {BigNumber} BigNumber +*/ +var toBigNumber = function(number) { + /*jshint maxcomplexity:5 */ + number = number || 0; + if (isBigNumber(number)) + return number; - /** - * Removes all key-value entries from the stack. - * - * @private - * @name clear - * @memberOf Stack - */ - function stackClear() { - this.__data__ = new ListCache; - this.size = 0; + if (isString(number) && (number.indexOf('0x') === 0 || number.indexOf('-0x') === 0)) { + return new BigNumber(number.replace('0x',''), 16); } - /** - * Removes `key` and its value from the stack. - * - * @private - * @name delete - * @memberOf Stack - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function stackDelete(key) { - var data = this.__data__, - result = data['delete'](key); + return new BigNumber(number.toString(10), 10); +}; - this.size = data.size; - return result; +/** + * Takes and input transforms it into bignumber and if it is negative value, into two's complement + * + * @method toTwosComplement + * @param {Number|String|BigNumber} + * @return {BigNumber} + */ +var toTwosComplement = function (number) { + var bigNumber = toBigNumber(number).round(); + if (bigNumber.lessThan(0)) { + return new BigNumber("ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff", 16).plus(bigNumber).plus(1); } + return bigNumber; +}; - /** - * Gets the stack value for `key`. - * - * @private - * @name get - * @memberOf Stack - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function stackGet(key) { - return this.__data__.get(key); - } +/** + * Checks if the given string is strictly an address + * + * @method isStrictAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isStrictAddress = function (address) { + return /^0x[0-9a-f]{40}$/i.test(address); +}; - /** - * Checks if a stack value for `key` exists. - * - * @private - * @name has - * @memberOf Stack - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function stackHas(key) { - return this.__data__.has(key); +/** + * Checks if the given string is an address + * + * @method isAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isAddress = function (address) { + if (!/^(0x)?[0-9a-f]{40}$/i.test(address)) { + // check if it has the basic requirements of an address + return false; + } else if (/^(0x)?[0-9a-f]{40}$/.test(address) || /^(0x)?[0-9A-F]{40}$/.test(address)) { + // If it's all small caps or all all caps, return true + return true; + } else { + // Otherwise check each case + return isChecksumAddress(address); } +}; - /** - * Sets the stack `key` to `value`. - * - * @private - * @name set - * @memberOf Stack - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the stack cache instance. - */ - function stackSet(key, value) { - var data = this.__data__; - if (data instanceof ListCache) { - var pairs = data.__data__; - if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { - pairs.push([key, value]); - this.size = ++data.size; - return this; +/** + * Checks if the given string is a checksummed address + * + * @method isChecksumAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isChecksumAddress = function (address) { + // Check each case + address = address.replace('0x',''); + var addressHash = sha3(address.toLowerCase()); + + for (var i = 0; i < 40; i++ ) { + // the nth letter should be uppercase if the nth digit of casemap is 1 + if ((parseInt(addressHash[i], 16) > 7 && address[i].toUpperCase() !== address[i]) || (parseInt(addressHash[i], 16) <= 7 && address[i].toLowerCase() !== address[i])) { + return false; } - data = this.__data__ = new MapCache(pairs); - } - data.set(key, value); - this.size = data.size; - return this; } + return true; +}; - // Add methods to `Stack`. - Stack.prototype.clear = stackClear; - Stack.prototype['delete'] = stackDelete; - Stack.prototype.get = stackGet; - Stack.prototype.has = stackHas; - Stack.prototype.set = stackSet; - /*------------------------------------------------------------------------*/ - /** - * Creates an array of the enumerable property names of the array-like `value`. - * - * @private - * @param {*} value The value to query. - * @param {boolean} inherited Specify returning inherited property names. - * @returns {Array} Returns the array of property names. - */ - function arrayLikeKeys(value, inherited) { - var isArr = isArray(value), - isArg = !isArr && isArguments(value), - isBuff = !isArr && !isArg && isBuffer(value), - isType = !isArr && !isArg && !isBuff && isTypedArray(value), - skipIndexes = isArr || isArg || isBuff || isType, - result = skipIndexes ? baseTimes(value.length, String) : [], - length = result.length; +/** + * Makes a checksum address + * + * @method toChecksumAddress + * @param {String} address the given HEX adress + * @return {String} +*/ +var toChecksumAddress = function (address) { + if (typeof address === 'undefined') return ''; - for (var key in value) { - if ((inherited || hasOwnProperty.call(value, key)) && - !(skipIndexes && ( - // Safari 9 has enumerable `arguments.length` in strict mode. - key == 'length' || - // Node.js 0.10 has enumerable non-index properties on buffers. - (isBuff && (key == 'offset' || key == 'parent')) || - // PhantomJS 2 has enumerable non-index properties on typed arrays. - (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || - // Skip index properties. - isIndex(key, length) - ))) { - result.push(key); + address = address.toLowerCase().replace('0x',''); + var addressHash = sha3(address); + var checksumAddress = '0x'; + + for (var i = 0; i < address.length; i++ ) { + // If ith character is 9 to f then make it uppercase + if (parseInt(addressHash[i], 16) > 7) { + checksumAddress += address[i].toUpperCase(); + } else { + checksumAddress += address[i]; } - } - return result; } + return checksumAddress; +}; - /** - * A specialized version of `_.sample` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @returns {*} Returns the random element. - */ - function arraySample(array) { - var length = array.length; - return length ? array[baseRandom(0, length - 1)] : undefined; +/** + * Transforms given string to valid 20 bytes-length addres with 0x prefix + * + * @method toAddress + * @param {String} address + * @return {String} formatted address + */ +var toAddress = function (address) { + if (isStrictAddress(address)) { + return address; } - /** - * A specialized version of `_.sampleSize` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function arraySampleSize(array, n) { - return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); + if (/^[0-9a-f]{40}$/.test(address)) { + return '0x' + address; } - /** - * A specialized version of `_.shuffle` for arrays. - * - * @private - * @param {Array} array The array to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function arrayShuffle(array) { - return shuffleSelf(copyArray(array)); - } + return '0x' + padLeft(toHex(address).substr(2), 40); +}; - /** - * This function is like `assignValue` except that it doesn't assign - * `undefined` values. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignMergeValue(object, key, value) { - if ((value !== undefined && !eq(object[key], value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } +/** + * Returns true if object is BigNumber, otherwise false + * + * @method isBigNumber + * @param {Object} + * @return {Boolean} + */ +var isBigNumber = function (object) { + return object instanceof BigNumber || + (object && object.constructor && object.constructor.name === 'BigNumber'); +}; - /** - * Assigns `value` to `key` of `object` if the existing value is not equivalent - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignValue(object, key, value) { - var objValue = object[key]; - if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } +/** + * Returns true if object is string, otherwise false + * + * @method isString + * @param {Object} + * @return {Boolean} + */ +var isString = function (object) { + return typeof object === 'string' || + (object && object.constructor && object.constructor.name === 'String'); +}; - /** - * Gets the index at which the `key` is found in `array` of key-value pairs. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} key The key to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function assocIndexOf(array, key) { - var length = array.length; - while (length--) { - if (eq(array[length][0], key)) { - return length; - } - } - return -1; - } +/** + * Returns true if object is function, otherwise false + * + * @method isFunction + * @param {Object} + * @return {Boolean} + */ +var isFunction = function (object) { + return typeof object === 'function'; +}; - /** - * Aggregates elements of `collection` on `accumulator` with keys transformed - * by `iteratee` and values set by `setter`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function baseAggregator(collection, setter, iteratee, accumulator) { - baseEach(collection, function(value, key, collection) { - setter(accumulator, value, iteratee(value), collection); - }); - return accumulator; - } +/** + * Returns true if object is Objet, otherwise false + * + * @method isObject + * @param {Object} + * @return {Boolean} + */ +var isObject = function (object) { + return object !== null && !(object instanceof Array) && typeof object === 'object'; +}; - /** - * The base implementation of `_.assign` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssign(object, source) { - return object && copyObject(source, keys(source), object); - } +/** + * Returns true if object is boolean, otherwise false + * + * @method isBoolean + * @param {Object} + * @return {Boolean} + */ +var isBoolean = function (object) { + return typeof object === 'boolean'; +}; - /** - * The base implementation of `_.assignIn` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssignIn(object, source) { - return object && copyObject(source, keysIn(source), object); - } +/** + * Returns true if object is array, otherwise false + * + * @method isArray + * @param {Object} + * @return {Boolean} + */ +var isArray = function (object) { + return object instanceof Array; +}; - /** - * The base implementation of `assignValue` and `assignMergeValue` without - * value checks. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function baseAssignValue(object, key, value) { - if (key == '__proto__' && defineProperty) { - defineProperty(object, key, { - 'configurable': true, - 'enumerable': true, - 'value': value, - 'writable': true - }); - } else { - object[key] = value; - } +/** + * Returns true if given string is valid json object + * + * @method isJson + * @param {String} + * @return {Boolean} + */ +var isJson = function (str) { + try { + return !!JSON.parse(str); + } catch (e) { + return false; } +}; - /** - * The base implementation of `_.at` without support for individual paths. - * - * @private - * @param {Object} object The object to iterate over. - * @param {string[]} paths The property paths to pick. - * @returns {Array} Returns the picked elements. - */ - function baseAt(object, paths) { - var index = -1, - length = paths.length, - result = Array(length), - skip = object == null; - - while (++index < length) { - result[index] = skip ? undefined : get(object, paths[index]); - } - return result; +/** + * Returns true if given string is a valid Ethereum block header bloom. + * + * @method isBloom + * @param {String} hex encoded bloom filter + * @return {Boolean} + */ +var isBloom = function (bloom) { + if (!/^(0x)?[0-9a-f]{512}$/i.test(bloom)) { + return false; + } else if (/^(0x)?[0-9a-f]{512}$/.test(bloom) || /^(0x)?[0-9A-F]{512}$/.test(bloom)) { + return true; } + return false; +}; - /** - * The base implementation of `_.clamp` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. - */ - function baseClamp(number, lower, upper) { - if (number === number) { - if (upper !== undefined) { - number = number <= upper ? number : upper; - } - if (lower !== undefined) { - number = number >= lower ? number : lower; - } - } - return number; +/** + * Returns true if given string is a valid log topic. + * + * @method isTopic + * @param {String} hex encoded topic + * @return {Boolean} + */ +var isTopic = function (topic) { + if (!/^(0x)?[0-9a-f]{64}$/i.test(topic)) { + return false; + } else if (/^(0x)?[0-9a-f]{64}$/.test(topic) || /^(0x)?[0-9A-F]{64}$/.test(topic)) { + return true; } + return false; +}; - /** - * The base implementation of `_.clone` and `_.cloneDeep` which tracks - * traversed objects. - * - * @private - * @param {*} value The value to clone. - * @param {boolean} bitmask The bitmask flags. - * 1 - Deep clone - * 2 - Flatten inherited properties - * 4 - Clone symbols - * @param {Function} [customizer] The function to customize cloning. - * @param {string} [key] The key of `value`. - * @param {Object} [object] The parent object of `value`. - * @param {Object} [stack] Tracks traversed objects and their clone counterparts. - * @returns {*} Returns the cloned value. - */ - function baseClone(value, bitmask, customizer, key, object, stack) { - var result, - isDeep = bitmask & CLONE_DEEP_FLAG, - isFlat = bitmask & CLONE_FLAT_FLAG, - isFull = bitmask & CLONE_SYMBOLS_FLAG; +module.exports = { + padLeft: padLeft, + padRight: padRight, + toHex: toHex, + toDecimal: toDecimal, + fromDecimal: fromDecimal, + toUtf8: toUtf8, + toAscii: toAscii, + fromUtf8: fromUtf8, + fromAscii: fromAscii, + transformToFullName: transformToFullName, + extractDisplayName: extractDisplayName, + extractTypeName: extractTypeName, + toWei: toWei, + fromWei: fromWei, + toBigNumber: toBigNumber, + toTwosComplement: toTwosComplement, + toAddress: toAddress, + isBigNumber: isBigNumber, + isStrictAddress: isStrictAddress, + isAddress: isAddress, + isChecksumAddress: isChecksumAddress, + toChecksumAddress: toChecksumAddress, + isFunction: isFunction, + isString: isString, + isObject: isObject, + isBoolean: isBoolean, + isArray: isArray, + isJson: isJson, + isBloom: isBloom, + isTopic: isTopic, +}; - if (customizer) { - result = object ? customizer(value, key, object, stack) : customizer(value); - } - if (result !== undefined) { - return result; - } - if (!isObject(value)) { - return value; - } - var isArr = isArray(value); - if (isArr) { - result = initCloneArray(value); - if (!isDeep) { - return copyArray(value, result); - } - } else { - var tag = getTag(value), - isFunc = tag == funcTag || tag == genTag; - if (isBuffer(value)) { - return cloneBuffer(value, isDeep); - } - if (tag == objectTag || tag == argsTag || (isFunc && !object)) { - result = (isFlat || isFunc) ? {} : initCloneObject(value); - if (!isDeep) { - return isFlat - ? copySymbolsIn(value, baseAssignIn(result, value)) - : copySymbols(value, baseAssign(result, value)); - } - } else { - if (!cloneableTags[tag]) { - return object ? value : {}; - } - result = initCloneByTag(value, tag, baseClone, isDeep); - } - } - // Check for circular references and return its corresponding clone. - stack || (stack = new Stack); - var stacked = stack.get(value); - if (stacked) { - return stacked; - } - stack.set(value, result); +/***/ }), +/* 23 */ +/***/ (function(module, exports, __webpack_require__) { - var keysFunc = isFull - ? (isFlat ? getAllKeysIn : getAllKeys) - : (isFlat ? keysIn : keys); +/* + This file is part of web3.js. - var props = isArr ? undefined : keysFunc(value); - arrayEach(props || value, function(subValue, key) { - if (props) { - key = subValue; - subValue = value[key]; - } - // Recursively populate clone (susceptible to call stack limits). - assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); - }); - return result; - } + web3.js is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. - /** - * The base implementation of `_.conforms` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property predicates to conform to. - * @returns {Function} Returns the new spec function. - */ - function baseConforms(source) { - var props = keys(source); - return function(object) { - return baseConformsTo(object, source, props); - }; - } + web3.js is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU Lesser General Public License for more details. - /** - * The base implementation of `_.conformsTo` which accepts `props` to check. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - */ - function baseConformsTo(object, source, props) { - var length = props.length; - if (object == null) { - return !length; - } - object = Object(object); - while (length--) { - var key = props[length], - predicate = source[key], - value = object[key]; + You should have received a copy of the GNU Lesser General Public License + along with web3.js. If not, see . +*/ +/** + * @file utils.js + * @author Marek Kotewicz + * @date 2015 + */ - if ((value === undefined && !(key in object)) || !predicate(value)) { - return false; - } - } - return true; - } +/** + * Utils + * + * @module utils + */ - /** - * The base implementation of `_.delay` and `_.defer` which accepts `args` - * to provide to `func`. - * - * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {Array} args The arguments to provide to `func`. - * @returns {number|Object} Returns the timer id or timeout object. - */ - function baseDelay(func, wait, args) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return setTimeout(function() { func.apply(undefined, args); }, wait); - } +/** + * Utility functions + * + * @class [utils] utils + * @constructor + */ - /** - * The base implementation of methods like `_.difference` without support - * for excluding multiple arrays or iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Array} values The values to exclude. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - */ - function baseDifference(array, values, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - isCommon = true, - length = array.length, - result = [], - valuesLength = values.length; - if (!length) { - return result; - } - if (iteratee) { - values = arrayMap(values, baseUnary(iteratee)); - } - if (comparator) { - includes = arrayIncludesWith; - isCommon = false; - } - else if (values.length >= LARGE_ARRAY_SIZE) { - includes = cacheHas; - isCommon = false; - values = new SetCache(values); - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee == null ? value : iteratee(value); +var BigNumber = __webpack_require__(115); +var sha3 = __webpack_require__(140); +var utf8 = __webpack_require__(139); - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var valuesIndex = valuesLength; - while (valuesIndex--) { - if (values[valuesIndex] === computed) { - continue outer; - } - } - result.push(value); - } - else if (!includes(values, computed, comparator)) { - result.push(value); - } - } - return result; - } +var unitMap = { + 'noether': '0', + 'wei': '1', + 'kwei': '1000', + 'Kwei': '1000', + 'babbage': '1000', + 'femtoether': '1000', + 'mwei': '1000000', + 'Mwei': '1000000', + 'lovelace': '1000000', + 'picoether': '1000000', + 'gwei': '1000000000', + 'Gwei': '1000000000', + 'shannon': '1000000000', + 'nanoether': '1000000000', + 'nano': '1000000000', + 'szabo': '1000000000000', + 'microether': '1000000000000', + 'micro': '1000000000000', + 'finney': '1000000000000000', + 'milliether': '1000000000000000', + 'milli': '1000000000000000', + 'ether': '1000000000000000000', + 'kether': '1000000000000000000000', + 'grand': '1000000000000000000000', + 'mether': '1000000000000000000000000', + 'gether': '1000000000000000000000000000', + 'tether': '1000000000000000000000000000000' +}; - /** - * The base implementation of `_.forEach` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEach = createBaseEach(baseForOwn); +/** + * Should be called to pad string to expected length + * + * @method padLeft + * @param {String} string to be padded + * @param {Number} characters that result string should have + * @param {String} sign, by default 0 + * @returns {String} right aligned string + */ +var padLeft = function (string, chars, sign) { + return new Array(chars - string.length + 1).join(sign ? sign : "0") + string; +}; - /** - * The base implementation of `_.forEachRight` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEachRight = createBaseEach(baseForOwnRight, true); +/** + * Should be called to pad string to expected length + * + * @method padRight + * @param {String} string to be padded + * @param {Number} characters that result string should have + * @param {String} sign, by default 0 + * @returns {String} right aligned string + */ +var padRight = function (string, chars, sign) { + return string + (new Array(chars - string.length + 1).join(sign ? sign : "0")); +}; - /** - * The base implementation of `_.every` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false` - */ - function baseEvery(collection, predicate) { - var result = true; - baseEach(collection, function(value, index, collection) { - result = !!predicate(value, index, collection); - return result; - }); - return result; +/** + * Should be called to get utf8 from it's hex representation + * + * @method toUtf8 + * @param {String} string in hex + * @returns {String} ascii string representation of hex value + */ +var toUtf8 = function(hex) { +// Find termination + var str = ""; + var i = 0, l = hex.length; + if (hex.substring(0, 2) === '0x') { + i = 2; + } + for (; i < l; i+=2) { + var code = parseInt(hex.substr(i, 2), 16); + if (code === 0) + break; + str += String.fromCharCode(code); } - /** - * The base implementation of methods like `_.max` and `_.min` which accepts a - * `comparator` to determine the extremum value. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The iteratee invoked per iteration. - * @param {Function} comparator The comparator used to compare values. - * @returns {*} Returns the extremum value. - */ - function baseExtremum(array, iteratee, comparator) { - var index = -1, - length = array.length; + return utf8.decode(str); +}; - while (++index < length) { - var value = array[index], - current = iteratee(value); +/** + * Should be called to get ascii from it's hex representation + * + * @method toAscii + * @param {String} string in hex + * @returns {String} ascii string representation of hex value + */ +var toAscii = function(hex) { +// Find termination + var str = ""; + var i = 0, l = hex.length; + if (hex.substring(0, 2) === '0x') { + i = 2; + } + for (; i < l; i+=2) { + var code = parseInt(hex.substr(i, 2), 16); + str += String.fromCharCode(code); + } - if (current != null && (computed === undefined - ? (current === current && !isSymbol(current)) - : comparator(current, computed) - )) { - var computed = current, - result = value; - } - } - return result; + return str; +}; + +/** + * Should be called to get hex representation (prefixed by 0x) of utf8 string + * + * @method fromUtf8 + * @param {String} string + * @param {Number} optional padding + * @returns {String} hex representation of input string + */ +var fromUtf8 = function(str) { + str = utf8.encode(str); + var hex = ""; + for(var i = 0; i < str.length; i++) { + var code = str.charCodeAt(i); + if (code === 0) + break; + var n = code.toString(16); + hex += n.length < 2 ? '0' + n : n; } - /** - * The base implementation of `_.fill` without an iteratee call guard. - * - * @private - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - */ - function baseFill(array, value, start, end) { - var length = array.length; + return "0x" + hex; +}; - start = toInteger(start); - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = (end === undefined || end > length) ? length : toInteger(end); - if (end < 0) { - end += length; - } - end = start > end ? 0 : toLength(end); - while (start < end) { - array[start++] = value; - } - return array; +/** + * Should be called to get hex representation (prefixed by 0x) of ascii string + * + * @method fromAscii + * @param {String} string + * @param {Number} optional padding + * @returns {String} hex representation of input string + */ +var fromAscii = function(str) { + var hex = ""; + for(var i = 0; i < str.length; i++) { + var code = str.charCodeAt(i); + var n = code.toString(16); + hex += n.length < 2 ? '0' + n : n; } - /** - * The base implementation of `_.filter` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function baseFilter(collection, predicate) { - var result = []; - baseEach(collection, function(value, index, collection) { - if (predicate(value, index, collection)) { - result.push(value); - } - }); - return result; + return "0x" + hex; +}; + +/** + * Should be used to create full function/event name from json abi + * + * @method transformToFullName + * @param {Object} json-abi + * @return {String} full fnction/event name + */ +var transformToFullName = function (json) { + if (json.name.indexOf('(') !== -1) { + return json.name; } - /** - * The base implementation of `_.flatten` with support for restricting flattening. - * - * @private - * @param {Array} array The array to flatten. - * @param {number} depth The maximum recursion depth. - * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. - * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. - * @param {Array} [result=[]] The initial result value. - * @returns {Array} Returns the new flattened array. - */ - function baseFlatten(array, depth, predicate, isStrict, result) { - var index = -1, - length = array.length; + var typeName = json.inputs.map(function(i){return i.type; }).join(); + return json.name + '(' + typeName + ')'; +}; - predicate || (predicate = isFlattenable); - result || (result = []); +/** + * Should be called to get display name of contract function + * + * @method extractDisplayName + * @param {String} name of function/event + * @returns {String} display name for function/event eg. multiply(uint256) -> multiply + */ +var extractDisplayName = function (name) { + var length = name.indexOf('('); + return length !== -1 ? name.substr(0, length) : name; +}; - while (++index < length) { - var value = array[index]; - if (depth > 0 && predicate(value)) { - if (depth > 1) { - // Recursively flatten arrays (susceptible to call stack limits). - baseFlatten(value, depth - 1, predicate, isStrict, result); - } else { - arrayPush(result, value); - } - } else if (!isStrict) { - result[result.length] = value; - } - } - return result; - } +/// @returns overloaded part of function/event name +var extractTypeName = function (name) { + /// TODO: make it invulnerable + var length = name.indexOf('('); + return length !== -1 ? name.substr(length + 1, name.length - 1 - (length + 1)).replace(' ', '') : ""; +}; - /** - * The base implementation of `baseForOwn` which iterates over `object` - * properties returned by `keysFunc` and invokes `iteratee` for each property. - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseFor = createBaseFor(); +/** + * Converts value to it's decimal representation in string + * + * @method toDecimal + * @param {String|Number|BigNumber} + * @return {String} + */ +var toDecimal = function (value) { + return toBigNumber(value).toNumber(); +}; - /** - * This function is like `baseFor` except that it iterates over properties - * in the opposite order. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseForRight = createBaseFor(true); +/** + * Converts value to it's hex representation + * + * @method fromDecimal + * @param {String|Number|BigNumber} + * @return {String} + */ +var fromDecimal = function (value) { + var number = toBigNumber(value); + var result = number.toString(16); - /** - * The base implementation of `_.forOwn` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwn(object, iteratee) { - return object && baseFor(object, iteratee, keys); - } + return number.lessThan(0) ? '-0x' + result.substr(1) : '0x' + result; +}; - /** - * The base implementation of `_.forOwnRight` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwnRight(object, iteratee) { - return object && baseForRight(object, iteratee, keys); - } +/** + * Auto converts any given value into it's hex representation. + * + * And even stringifys objects before. + * + * @method toHex + * @param {String|Number|BigNumber|Object} + * @return {String} + */ +var toHex = function (val) { + /*jshint maxcomplexity: 8 */ - /** - * The base implementation of `_.functions` which creates an array of - * `object` function property names filtered from `props`. - * - * @private - * @param {Object} object The object to inspect. - * @param {Array} props The property names to filter. - * @returns {Array} Returns the function names. - */ - function baseFunctions(object, props) { - return arrayFilter(props, function(key) { - return isFunction(object[key]); - }); - } + if (isBoolean(val)) + return fromDecimal(+val); - /** - * The base implementation of `_.get` without support for default values. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @returns {*} Returns the resolved value. - */ - function baseGet(object, path) { - path = castPath(path, object); + if (isBigNumber(val)) + return fromDecimal(val); - var index = 0, - length = path.length; + if (typeof val === 'object') + return fromUtf8(JSON.stringify(val)); - while (object != null && index < length) { - object = object[toKey(path[index++])]; - } - return (index && index == length) ? object : undefined; + // if its a negative number, pass it through fromDecimal + if (isString(val)) { + if (val.indexOf('-0x') === 0) + return fromDecimal(val); + else if(val.indexOf('0x') === 0) + return val; + else if (!isFinite(val)) + return fromAscii(val); } - /** - * The base implementation of `getAllKeys` and `getAllKeysIn` which uses - * `keysFunc` and `symbolsFunc` to get the enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Function} keysFunc The function to get the keys of `object`. - * @param {Function} symbolsFunc The function to get the symbols of `object`. - * @returns {Array} Returns the array of property names and symbols. - */ - function baseGetAllKeys(object, keysFunc, symbolsFunc) { - var result = keysFunc(object); - return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); - } + return fromDecimal(val); +}; - /** - * The base implementation of `getTag` without fallbacks for buggy environments. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - function baseGetTag(value) { - if (value == null) { - return value === undefined ? undefinedTag : nullTag; - } - return (symToStringTag && symToStringTag in Object(value)) - ? getRawTag(value) - : objectToString(value); +/** + * Returns value of unit in Wei + * + * @method getValueOfUnit + * @param {String} unit the unit to convert to, default ether + * @returns {BigNumber} value of the unit (in Wei) + * @throws error if the unit is not correct:w + */ +var getValueOfUnit = function (unit) { + unit = unit ? unit.toLowerCase() : 'ether'; + var unitValue = unitMap[unit]; + if (unitValue === undefined) { + throw new Error('This unit doesn\'t exists, please use the one of the following units' + JSON.stringify(unitMap, null, 2)); } + return new BigNumber(unitValue, 10); +}; - /** - * The base implementation of `_.gt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - */ - function baseGt(value, other) { - return value > other; - } +/** + * Takes a number of wei and converts it to any other ether unit. + * + * Possible units are: + * SI Short SI Full Effigy Other + * - kwei femtoether babbage + * - mwei picoether lovelace + * - gwei nanoether shannon nano + * - -- microether szabo micro + * - -- milliether finney milli + * - ether -- -- + * - kether -- grand + * - mether + * - gether + * - tether + * + * @method fromWei + * @param {Number|String} number can be a number, number string or a HEX of a decimal + * @param {String} unit the unit to convert to, default ether + * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number +*/ +var fromWei = function(number, unit) { + var returnValue = toBigNumber(number).dividedBy(getValueOfUnit(unit)); - /** - * The base implementation of `_.has` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHas(object, key) { - return object != null && hasOwnProperty.call(object, key); - } + return isBigNumber(number) ? returnValue : returnValue.toString(10); +}; - /** - * The base implementation of `_.hasIn` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHasIn(object, key) { - return object != null && key in Object(object); - } +/** + * Takes a number of a unit and converts it to wei. + * + * Possible units are: + * SI Short SI Full Effigy Other + * - kwei femtoether babbage + * - mwei picoether lovelace + * - gwei nanoether shannon nano + * - -- microether szabo micro + * - -- microether szabo micro + * - -- milliether finney milli + * - ether -- -- + * - kether -- grand + * - mether + * - gether + * - tether + * + * @method toWei + * @param {Number|String|BigNumber} number can be a number, number string or a HEX of a decimal + * @param {String} unit the unit to convert from, default ether + * @return {String|Object} When given a BigNumber object it returns one as well, otherwise a number +*/ +var toWei = function(number, unit) { + var returnValue = toBigNumber(number).times(getValueOfUnit(unit)); - /** - * The base implementation of `_.inRange` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to check. - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - */ - function baseInRange(number, start, end) { - return number >= nativeMin(start, end) && number < nativeMax(start, end); + return isBigNumber(number) ? returnValue : returnValue.toString(10); +}; + +/** + * Takes an input and transforms it into an bignumber + * + * @method toBigNumber + * @param {Number|String|BigNumber} a number, string, HEX string or BigNumber + * @return {BigNumber} BigNumber +*/ +var toBigNumber = function(number) { + /*jshint maxcomplexity:5 */ + number = number || 0; + if (isBigNumber(number)) + return number; + + if (isString(number) && (number.indexOf('0x') === 0 || number.indexOf('-0x') === 0)) { + return new BigNumber(number.replace('0x',''), 16); } - /** - * The base implementation of methods like `_.intersection`, without support - * for iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of shared values. - */ - function baseIntersection(arrays, iteratee, comparator) { - var includes = comparator ? arrayIncludesWith : arrayIncludes, - length = arrays[0].length, - othLength = arrays.length, - othIndex = othLength, - caches = Array(othLength), - maxLength = Infinity, - result = []; + return new BigNumber(number.toString(10), 10); +}; - while (othIndex--) { - var array = arrays[othIndex]; - if (othIndex && iteratee) { - array = arrayMap(array, baseUnary(iteratee)); - } - maxLength = nativeMin(array.length, maxLength); - caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) - ? new SetCache(othIndex && array) - : undefined; - } - array = arrays[0]; +/** + * Takes and input transforms it into bignumber and if it is negative value, into two's complement + * + * @method toTwosComplement + * @param {Number|String|BigNumber} + * @return {BigNumber} + */ +var toTwosComplement = function (number) { + var bigNumber = toBigNumber(number).round(); + if (bigNumber.lessThan(0)) { + return new BigNumber("ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff", 16).plus(bigNumber).plus(1); + } + return bigNumber; +}; - var index = -1, - seen = caches[0]; +/** + * Checks if the given string is strictly an address + * + * @method isStrictAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isStrictAddress = function (address) { + return /^0x[0-9a-f]{40}$/i.test(address); +}; - outer: - while (++index < length && result.length < maxLength) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; +/** + * Checks if the given string is an address + * + * @method isAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isAddress = function (address) { + if (!/^(0x)?[0-9a-f]{40}$/i.test(address)) { + // check if it has the basic requirements of an address + return false; + } else if (/^(0x)?[0-9a-f]{40}$/.test(address) || /^(0x)?[0-9A-F]{40}$/.test(address)) { + // If it's all small caps or all all caps, return true + return true; + } else { + // Otherwise check each case + return isChecksumAddress(address); + } +}; - value = (comparator || value !== 0) ? value : 0; - if (!(seen - ? cacheHas(seen, computed) - : includes(result, computed, comparator) - )) { - othIndex = othLength; - while (--othIndex) { - var cache = caches[othIndex]; - if (!(cache - ? cacheHas(cache, computed) - : includes(arrays[othIndex], computed, comparator)) - ) { - continue outer; - } - } - if (seen) { - seen.push(computed); - } - result.push(value); +/** + * Checks if the given string is a checksummed address + * + * @method isChecksumAddress + * @param {String} address the given HEX adress + * @return {Boolean} +*/ +var isChecksumAddress = function (address) { + // Check each case + address = address.replace('0x',''); + var addressHash = sha3(address.toLowerCase()); + + for (var i = 0; i < 40; i++ ) { + // the nth letter should be uppercase if the nth digit of casemap is 1 + if ((parseInt(addressHash[i], 16) > 7 && address[i].toUpperCase() !== address[i]) || (parseInt(addressHash[i], 16) <= 7 && address[i].toLowerCase() !== address[i])) { + return false; } - } - return result; } + return true; +}; - /** - * The base implementation of `_.invert` and `_.invertBy` which inverts - * `object` with values transformed by `iteratee` and set by `setter`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform values. - * @param {Object} accumulator The initial inverted object. - * @returns {Function} Returns `accumulator`. - */ - function baseInverter(object, setter, iteratee, accumulator) { - baseForOwn(object, function(value, key, object) { - setter(accumulator, iteratee(value), key, object); - }); - return accumulator; - } - /** - * The base implementation of `_.invoke` without support for individual - * method arguments. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {Array} args The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. - */ - function baseInvoke(object, path, args) { - path = castPath(path, object); - object = parent(object, path); - var func = object == null ? object : object[toKey(last(path))]; - return func == null ? undefined : apply(func, object, args); - } - /** - * The base implementation of `_.isArguments`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - */ - function baseIsArguments(value) { - return isObjectLike(value) && baseGetTag(value) == argsTag; - } +/** + * Makes a checksum address + * + * @method toChecksumAddress + * @param {String} address the given HEX adress + * @return {String} +*/ +var toChecksumAddress = function (address) { + if (typeof address === 'undefined') return ''; - /** - * The base implementation of `_.isArrayBuffer` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - */ - function baseIsArrayBuffer(value) { - return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; - } + address = address.toLowerCase().replace('0x',''); + var addressHash = sha3(address); + var checksumAddress = '0x'; - /** - * The base implementation of `_.isDate` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - */ - function baseIsDate(value) { - return isObjectLike(value) && baseGetTag(value) == dateTag; + for (var i = 0; i < address.length; i++ ) { + // If ith character is 9 to f then make it uppercase + if (parseInt(addressHash[i], 16) > 7) { + checksumAddress += address[i].toUpperCase(); + } else { + checksumAddress += address[i]; + } } + return checksumAddress; +}; - /** - * The base implementation of `_.isEqual` which supports partial comparisons - * and tracks traversed objects. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {boolean} bitmask The bitmask flags. - * 1 - Unordered comparison - * 2 - Partial comparison - * @param {Function} [customizer] The function to customize comparisons. - * @param {Object} [stack] Tracks traversed `value` and `other` objects. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - */ - function baseIsEqual(value, other, bitmask, customizer, stack) { - if (value === other) { - return true; - } - if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { - return value !== value && other !== other; - } - return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); +/** + * Transforms given string to valid 20 bytes-length addres with 0x prefix + * + * @method toAddress + * @param {String} address + * @return {String} formatted address + */ +var toAddress = function (address) { + if (isStrictAddress(address)) { + return address; } - /** - * A specialized version of `baseIsEqual` for arrays and objects which performs - * deep comparisons and tracks traversed objects enabling objects with circular - * references to be compared. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} [stack] Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { - var objIsArr = isArray(object), - othIsArr = isArray(other), - objTag = objIsArr ? arrayTag : getTag(object), - othTag = othIsArr ? arrayTag : getTag(other); - - objTag = objTag == argsTag ? objectTag : objTag; - othTag = othTag == argsTag ? objectTag : othTag; + if (/^[0-9a-f]{40}$/.test(address)) { + return '0x' + address; + } - var objIsObj = objTag == objectTag, - othIsObj = othTag == objectTag, - isSameTag = objTag == othTag; + return '0x' + padLeft(toHex(address).substr(2), 40); +}; - if (isSameTag && isBuffer(object)) { - if (!isBuffer(other)) { - return false; - } - objIsArr = true; - objIsObj = false; - } - if (isSameTag && !objIsObj) { - stack || (stack = new Stack); - return (objIsArr || isTypedArray(object)) - ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) - : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); - } - if (!(bitmask & COMPARE_PARTIAL_FLAG)) { - var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), - othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); +/** + * Returns true if object is BigNumber, otherwise false + * + * @method isBigNumber + * @param {Object} + * @return {Boolean} + */ +var isBigNumber = function (object) { + return object instanceof BigNumber || + (object && object.constructor && object.constructor.name === 'BigNumber'); +}; - if (objIsWrapped || othIsWrapped) { - var objUnwrapped = objIsWrapped ? object.value() : object, - othUnwrapped = othIsWrapped ? other.value() : other; +/** + * Returns true if object is string, otherwise false + * + * @method isString + * @param {Object} + * @return {Boolean} + */ +var isString = function (object) { + return typeof object === 'string' || + (object && object.constructor && object.constructor.name === 'String'); +}; - stack || (stack = new Stack); - return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); - } - } - if (!isSameTag) { - return false; - } - stack || (stack = new Stack); - return equalObjects(object, other, bitmask, customizer, equalFunc, stack); - } +/** + * Returns true if object is function, otherwise false + * + * @method isFunction + * @param {Object} + * @return {Boolean} + */ +var isFunction = function (object) { + return typeof object === 'function'; +}; - /** - * The base implementation of `_.isMap` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - */ - function baseIsMap(value) { - return isObjectLike(value) && getTag(value) == mapTag; - } +/** + * Returns true if object is Objet, otherwise false + * + * @method isObject + * @param {Object} + * @return {Boolean} + */ +var isObject = function (object) { + return object !== null && !(object instanceof Array) && typeof object === 'object'; +}; - /** - * The base implementation of `_.isMatch` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Array} matchData The property names, values, and compare flags to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - */ - function baseIsMatch(object, source, matchData, customizer) { - var index = matchData.length, - length = index, - noCustomizer = !customizer; +/** + * Returns true if object is boolean, otherwise false + * + * @method isBoolean + * @param {Object} + * @return {Boolean} + */ +var isBoolean = function (object) { + return typeof object === 'boolean'; +}; - if (object == null) { - return !length; - } - object = Object(object); - while (index--) { - var data = matchData[index]; - if ((noCustomizer && data[2]) - ? data[1] !== object[data[0]] - : !(data[0] in object) - ) { - return false; - } - } - while (++index < length) { - data = matchData[index]; - var key = data[0], - objValue = object[key], - srcValue = data[1]; +/** + * Returns true if object is array, otherwise false + * + * @method isArray + * @param {Object} + * @return {Boolean} + */ +var isArray = function (object) { + return object instanceof Array; +}; - if (noCustomizer && data[2]) { - if (objValue === undefined && !(key in object)) { - return false; - } - } else { - var stack = new Stack; - if (customizer) { - var result = customizer(objValue, srcValue, key, object, source, stack); - } - if (!(result === undefined - ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) - : result - )) { - return false; - } - } - } - return true; +/** + * Returns true if given string is valid json object + * + * @method isJson + * @param {String} + * @return {Boolean} + */ +var isJson = function (str) { + try { + return !!JSON.parse(str); + } catch (e) { + return false; } +}; - /** - * The base implementation of `_.isNative` without bad shim checks. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - */ - function baseIsNative(value) { - if (!isObject(value) || isMasked(value)) { +/** + * Returns true if given string is a valid Ethereum block header bloom. + * + * @method isBloom + * @param {String} hex encoded bloom filter + * @return {Boolean} + */ +var isBloom = function (bloom) { + if (!/^(0x)?[0-9a-f]{512}$/i.test(bloom)) { return false; - } - var pattern = isFunction(value) ? reIsNative : reIsHostCtor; - return pattern.test(toSource(value)); + } else if (/^(0x)?[0-9a-f]{512}$/.test(bloom) || /^(0x)?[0-9A-F]{512}$/.test(bloom)) { + return true; } + return false; +}; - /** - * The base implementation of `_.isRegExp` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - */ - function baseIsRegExp(value) { - return isObjectLike(value) && baseGetTag(value) == regexpTag; +/** + * Returns true if given string is a valid log topic. + * + * @method isTopic + * @param {String} hex encoded topic + * @return {Boolean} + */ +var isTopic = function (topic) { + if (!/^(0x)?[0-9a-f]{64}$/i.test(topic)) { + return false; + } else if (/^(0x)?[0-9a-f]{64}$/.test(topic) || /^(0x)?[0-9A-F]{64}$/.test(topic)) { + return true; } + return false; +}; - /** - * The base implementation of `_.isSet` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - */ - function baseIsSet(value) { - return isObjectLike(value) && getTag(value) == setTag; - } +module.exports = { + padLeft: padLeft, + padRight: padRight, + toHex: toHex, + toDecimal: toDecimal, + fromDecimal: fromDecimal, + toUtf8: toUtf8, + toAscii: toAscii, + fromUtf8: fromUtf8, + fromAscii: fromAscii, + transformToFullName: transformToFullName, + extractDisplayName: extractDisplayName, + extractTypeName: extractTypeName, + toWei: toWei, + fromWei: fromWei, + toBigNumber: toBigNumber, + toTwosComplement: toTwosComplement, + toAddress: toAddress, + isBigNumber: isBigNumber, + isStrictAddress: isStrictAddress, + isAddress: isAddress, + isChecksumAddress: isChecksumAddress, + toChecksumAddress: toChecksumAddress, + isFunction: isFunction, + isString: isString, + isObject: isObject, + isBoolean: isBoolean, + isArray: isArray, + isJson: isJson, + isBloom: isBloom, + isTopic: isTopic, +}; - /** - * The base implementation of `_.isTypedArray` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - */ - function baseIsTypedArray(value) { - return isObjectLike(value) && - isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; - } - /** - * The base implementation of `_.iteratee`. - * - * @private - * @param {*} [value=_.identity] The value to convert to an iteratee. - * @returns {Function} Returns the iteratee. - */ - function baseIteratee(value) { - // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. - // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. - if (typeof value == 'function') { - return value; - } - if (value == null) { - return identity; - } - if (typeof value == 'object') { - return isArray(value) - ? baseMatchesProperty(value[0], value[1]) - : baseMatches(value); - } - return property(value); - } +/***/ }), +/* 24 */ +/***/ (function(module, exports) { - /** - * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeys(object) { - if (!isPrototype(object)) { - return nativeKeys(object); - } - var result = []; - for (var key in Object(object)) { - if (hasOwnProperty.call(object, key) && key != 'constructor') { - result.push(key); - } +var Expect = { + options: function(options, expected_keys) { + expected_keys.forEach(function(key) { + if (options[key] == null) { + throw new Error("Expected parameter '" + key + "' not passed to function."); } - return result; - } + }); + }, - /** - * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeysIn(object) { - if (!isObject(object)) { - return nativeKeysIn(object); - } - var isProto = isPrototype(object), - result = []; + one: function(options, expected_keys) { + var found = []; - for (var key in object) { - if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { - result.push(key); - } + expected_keys.forEach(function(key) { + if (options[key] != null) { + found.push(1); + } else { + found.push(0); } - return result; - } - - /** - * The base implementation of `_.lt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - */ - function baseLt(value, other) { - return value < other; - } + }); - /** - * The base implementation of `_.map` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function baseMap(collection, iteratee) { - var index = -1, - result = isArrayLike(collection) ? Array(collection.length) : []; + var total = found.reduce(function(t, value) { + return t + value; + }); - baseEach(collection, function(value, key, collection) { - result[++index] = iteratee(value, key, collection); - }); - return result; - } + // If this doesn't work in all cases, perhaps we should + // create an expect.onlyOne() function. + if (total >= 1) return; - /** - * The base implementation of `_.matches` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property values to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatches(source) { - var matchData = getMatchData(source); - if (matchData.length == 1 && matchData[0][2]) { - return matchesStrictComparable(matchData[0][0], matchData[0][1]); - } - return function(object) { - return object === source || baseIsMatch(object, source, matchData); - }; - } + throw new Error("Expected one of the following parameters, but found none: " + expected_keys.join(", ")); + } +} - /** - * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. - * - * @private - * @param {string} path The path of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatchesProperty(path, srcValue) { - if (isKey(path) && isStrictComparable(srcValue)) { - return matchesStrictComparable(toKey(path), srcValue); - } - return function(object) { - var objValue = get(object, path); - return (objValue === undefined && objValue === srcValue) - ? hasIn(object, path) - : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); - }; - } +module.exports = Expect; - /** - * The base implementation of `_.merge` without support for multiple sources. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {number} srcIndex The index of `source`. - * @param {Function} [customizer] The function to customize merged values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMerge(object, source, srcIndex, customizer, stack) { - if (object === source) { - return; - } - baseFor(source, function(srcValue, key) { - if (isObject(srcValue)) { - stack || (stack = new Stack); - baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); - } - else { - var newValue = customizer - ? customizer(object[key], srcValue, (key + ''), object, source, stack) - : undefined; - if (newValue === undefined) { - newValue = srcValue; - } - assignMergeValue(object, key, newValue); - } - }, keysIn); - } +/***/ }), +/* 25 */ +/***/ (function(module, exports, __webpack_require__) { - /** - * A specialized version of `baseMerge` for arrays and objects which performs - * deep merges and tracks traversed objects enabling objects with circular - * references to be merged. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {string} key The key of the value to merge. - * @param {number} srcIndex The index of `source`. - * @param {Function} mergeFunc The function to merge values. - * @param {Function} [customizer] The function to customize assigned values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { - var objValue = object[key], - srcValue = source[key], - stacked = stack.get(srcValue); +var Web3 = __webpack_require__(1338); - if (stacked) { - assignMergeValue(object, key, stacked); - return; - } - var newValue = customizer - ? customizer(objValue, srcValue, (key + ''), object, source, stack) - : undefined; +// dont override global variable +if (typeof window !== 'undefined' && typeof window.Web3 === 'undefined') { + window.Web3 = Web3; +} - var isCommon = newValue === undefined; +module.exports = Web3; - if (isCommon) { - var isArr = isArray(srcValue), - isBuff = !isArr && isBuffer(srcValue), - isTyped = !isArr && !isBuff && isTypedArray(srcValue); - newValue = srcValue; - if (isArr || isBuff || isTyped) { - if (isArray(objValue)) { - newValue = objValue; - } - else if (isArrayLikeObject(objValue)) { - newValue = copyArray(objValue); - } - else if (isBuff) { - isCommon = false; - newValue = cloneBuffer(srcValue, true); - } - else if (isTyped) { - isCommon = false; - newValue = cloneTypedArray(srcValue, true); - } - else { - newValue = []; - } - } - else if (isPlainObject(srcValue) || isArguments(srcValue)) { - newValue = objValue; - if (isArguments(objValue)) { - newValue = toPlainObject(objValue); - } - else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { - newValue = initCloneObject(srcValue); - } - } - else { - isCommon = false; - } - } - if (isCommon) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, newValue); - mergeFunc(newValue, srcValue, srcIndex, customizer, stack); - stack['delete'](srcValue); - } - assignMergeValue(object, key, newValue); - } +/***/ }), +/* 26 */ +/***/ (function(module, exports, __webpack_require__) { - /** - * The base implementation of `_.nth` which doesn't coerce arguments. - * - * @private - * @param {Array} array The array to query. - * @param {number} n The index of the element to return. - * @returns {*} Returns the nth element of `array`. - */ - function baseNth(array, n) { - var length = array.length; - if (!length) { - return; - } - n += n < 0 ? length : 0; - return isIndex(n, length) ? array[n] : undefined; - } +var ExtendableBuiltin = __webpack_require__(1289); +var inherits = __webpack_require__(3).inherits; - /** - * The base implementation of `_.orderBy` without param guards. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. - * @param {string[]} orders The sort orders of `iteratees`. - * @returns {Array} Returns the new sorted array. - */ - function baseOrderBy(collection, iteratees, orders) { - var index = -1; - iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); +inherits(ExtendableError, ExtendableBuiltin(Error)); - var result = baseMap(collection, function(value, key, collection) { - var criteria = arrayMap(iteratees, function(iteratee) { - return iteratee(value); - }); - return { 'criteria': criteria, 'index': ++index, 'value': value }; - }); +// From: http://stackoverflow.com/questions/31089801/extending-error-in-javascript-with-es6-syntax +function ExtendableError(message) { + ExtendableError.super_.call(this); + this.message = message; + this.stack = (new Error(message)).stack; + this.name = this.constructor.name; +}; - return baseSortBy(result, function(object, other) { - return compareMultiple(object, other, orders); - }); - } +// Hack. Likely won't be formatted correctly when there are +// 10 or more errors. But if there's 10 or more errors, I'm guessing +// formatting won't matter so much. +ExtendableError.prototype.formatForMocha = function() { + this.message = this.message.replace(/\n/g, "\n "); +}; - /** - * The base implementation of `_.pick` without support for individual - * property identifiers. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @returns {Object} Returns the new object. - */ - function basePick(object, paths) { - return basePickBy(object, paths, function(value, path) { - return hasIn(object, path); - }); - } +module.exports = ExtendableError; - /** - * The base implementation of `_.pickBy` without support for iteratee shorthands. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @param {Function} predicate The function invoked per property. - * @returns {Object} Returns the new object. - */ - function basePickBy(object, paths, predicate) { - var index = -1, - length = paths.length, - result = {}; - while (++index < length) { - var path = paths[index], - value = baseGet(object, path); +/***/ }), +/* 27 */ +/***/ (function(module, exports) { - if (predicate(value, path)) { - baseSet(result, castPath(path, object), value); - } - } - return result; - } +// Copyright 2015 Joyent, Inc. - /** - * A specialized version of `baseProperty` which supports deep paths. - * - * @private - * @param {Array|string} path The path of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyDeep(path) { - return function(object) { - return baseGet(object, path); - }; - } +var algInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y'], + sizePart: 'p' + }, + 'rsa': { + parts: ['e', 'n'], + sizePart: 'n' + }, + 'ecdsa': { + parts: ['curve', 'Q'], + sizePart: 'Q' + }, + 'ed25519': { + parts: ['R'], + normalize: false, + sizePart: 'R' + } +}; +algInfo['curve25519'] = algInfo['ed25519']; - /** - * The base implementation of `_.pullAllBy` without support for iteratee - * shorthands. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - */ - function basePullAll(array, values, iteratee, comparator) { - var indexOf = comparator ? baseIndexOfWith : baseIndexOf, - index = -1, - length = values.length, - seen = array; +var algPrivInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y', 'x'] + }, + 'rsa': { + parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] + }, + 'ecdsa': { + parts: ['curve', 'Q', 'd'] + }, + 'ed25519': { + parts: ['R', 'r'], + normalize: false + } +}; +algPrivInfo['curve25519'] = algPrivInfo['ed25519']; - if (array === values) { - values = copyArray(values); - } - if (iteratee) { - seen = arrayMap(array, baseUnary(iteratee)); - } - while (++index < length) { - var fromIndex = 0, - value = values[index], - computed = iteratee ? iteratee(value) : value; +var hashAlgs = { + 'md5': true, + 'sha1': true, + 'sha256': true, + 'sha384': true, + 'sha512': true +}; - while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { - if (seen !== array) { - splice.call(seen, fromIndex, 1); - } - splice.call(array, fromIndex, 1); - } - } - return array; - } +/* + * Taken from + * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf + */ +var curves = { + 'nistp256': { + size: 256, + pkcs8oid: '1.2.840.10045.3.1.7', + p: new Buffer(('00' + + 'ffffffff 00000001 00000000 00000000' + + '00000000 ffffffff ffffffff ffffffff'). + replace(/ /g, ''), 'hex'), + a: new Buffer(('00' + + 'FFFFFFFF 00000001 00000000 00000000' + + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(( + '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'c49d3608 86e70493 6a6678e1 139d26b7' + + '819f7e90'). + replace(/ /g, ''), 'hex'), + n: new Buffer(('00' + + 'ffffffff 00000000 ffffffff ffffffff' + + 'bce6faad a7179e84 f3b9cac2 fc632551'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + + '77037d81 2deb33a0 f4a13945 d898c296' + + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + + '2bce3357 6b315ece cbb64068 37bf51f5'). + replace(/ /g, ''), 'hex') + }, + 'nistp384': { + size: 384, + pkcs8oid: '1.3.132.0.34', + p: new Buffer(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffe' + + 'ffffffff 00000000 00000000 ffffffff'). + replace(/ /g, ''), 'hex'), + a: new Buffer(('00' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(( + 'b3312fa7 e23ee7e4 988e056b e3f82d19' + + '181d9c6e fe814112 0314088f 5013875a' + + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'a335926a a319a27a 1d00896a 6773a482' + + '7acdac73'). + replace(/ /g, ''), 'hex'), + n: new Buffer(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff c7634d81 f4372ddf' + + '581a0db2 48b0a77a ecec196a ccc52973'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + + '6e1d3b62 8ba79b98 59f741e0 82542a38' + + '5502f25d bf55296c 3a545e38 72760ab7' + + '3617de4a 96262c6f 5d9e98bf 9292dc29' + + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). + replace(/ /g, ''), 'hex') + }, + 'nistp521': { + size: 521, + pkcs8oid: '1.3.132.0.35', + p: new Buffer(( + '01ffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffff').replace(/ /g, ''), 'hex'), + a: new Buffer(('01FF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(('51' + + '953eb961 8e1c9a1f 929a21a0 b68540ee' + + 'a2da725b 99b315f3 b8b48991 8ef109e1' + + '56193951 ec7e937b 1652c0bd 3bb1bf07' + + '3573df88 3d2c34f1 ef451fd4 6b503f00'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'd09e8800 291cb853 96cc6717 393284aa' + + 'a0da64ba').replace(/ /g, ''), 'hex'), + n: new Buffer(('01ff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffa' + + '51868783 bf2f966b 7fcc0148 f709a5d0' + + '3bb5c9b8 899c47ae bb6fb71e 91386409'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + + '9c648139 053fb521 f828af60 6b4d3dba' + + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + + '3348b3c1 856a429b f97e7e31 c2e5bd66' + + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + + '98f54449 579b4468 17afbd17 273e662c' + + '97ee7299 5ef42640 c550b901 3fad0761' + + '353c7086 a272c240 88be9476 9fd16650'). + replace(/ /g, ''), 'hex') + } +}; - /** - * The base implementation of `_.pullAt` without support for individual - * indexes or capturing the removed elements. - * - * @private - * @param {Array} array The array to modify. - * @param {number[]} indexes The indexes of elements to remove. - * @returns {Array} Returns `array`. - */ - function basePullAt(array, indexes) { - var length = array ? indexes.length : 0, - lastIndex = length - 1; +module.exports = { + info: algInfo, + privInfo: algPrivInfo, + hashAlgs: hashAlgs, + curves: curves +}; - while (length--) { - var index = indexes[length]; - if (length == lastIndex || index !== previous) { - var previous = index; - if (isIndex(index)) { - splice.call(array, index, 1); - } else { - baseUnset(array, index); - } - } - } - return array; - } - /** - * The base implementation of `_.random` without support for returning - * floating-point numbers. - * - * @private - * @param {number} lower The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the random number. - */ - function baseRandom(lower, upper) { - return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); - } +/***/ }), +/* 28 */ +/***/ (function(module, exports, __webpack_require__) { - /** - * The base implementation of `_.range` and `_.rangeRight` which doesn't - * coerce arguments. - * - * @private - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @param {number} step The value to increment or decrement by. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the range of numbers. - */ - function baseRange(start, end, step, fromRight) { - var index = -1, - length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), - result = Array(length); +// Copyright 2017 Joyent, Inc. - while (length--) { - result[fromRight ? length : ++index] = start; - start += step; - } - return result; - } +module.exports = Key; - /** - * The base implementation of `_.repeat` which doesn't coerce arguments. - * - * @private - * @param {string} string The string to repeat. - * @param {number} n The number of times to repeat the string. - * @returns {string} Returns the repeated string. - */ - function baseRepeat(string, n) { - var result = ''; - if (!string || n < 1 || n > MAX_SAFE_INTEGER) { - return result; - } - // Leverage the exponentiation by squaring algorithm for a faster repeat. - // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. - do { - if (n % 2) { - result += string; - } - n = nativeFloor(n / 2); - if (n) { - string += string; - } - } while (n); +var assert = __webpack_require__(13); +var algs = __webpack_require__(27); +var crypto = __webpack_require__(7); +var Fingerprint = __webpack_require__(131); +var Signature = __webpack_require__(59); +var DiffieHellman = __webpack_require__(403).DiffieHellman; +var errs = __webpack_require__(58); +var utils = __webpack_require__(21); +var PrivateKey = __webpack_require__(29); +var edCompat; - return result; - } +try { + edCompat = __webpack_require__(404); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} - /** - * The base implementation of `_.rest` which doesn't validate or coerce arguments. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - */ - function baseRest(func, start) { - return setToString(overRest(func, start, identity), func + ''); - } +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; - /** - * The base implementation of `_.sample`. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - */ - function baseSample(collection) { - return arraySample(values(collection)); - } +var formats = {}; +formats['auto'] = __webpack_require__(405); +formats['pem'] = __webpack_require__(68); +formats['pkcs1'] = __webpack_require__(236); +formats['pkcs8'] = __webpack_require__(132); +formats['rfc4253'] = __webpack_require__(77); +formats['ssh'] = __webpack_require__(406); +formats['ssh-private'] = __webpack_require__(172); +formats['openssh'] = formats['ssh-private']; - /** - * The base implementation of `_.sampleSize` without param guards. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function baseSampleSize(collection, n) { - var array = values(collection); - return shuffleSelf(array, baseClamp(n, 0, array.length)); - } +function Key(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + assert.optionalString(opts.comment, 'options.comment'); - /** - * The base implementation of `_.set`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseSet(object, path, value, customizer) { - if (!isObject(object)) { - return object; - } - path = castPath(path, object); + var algInfo = algs.info[opts.type]; + if (typeof (algInfo) !== 'object') + throw (new InvalidAlgorithmError(opts.type)); - var index = -1, - length = path.length, - lastIndex = length - 1, - nested = object; + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } - while (nested != null && ++index < length) { - var key = toKey(path[index]), - newValue = value; + this.type = opts.type; + this.parts = opts.parts; + this.part = partLookup; + this.comment = undefined; + this.source = opts.source; - if (index != lastIndex) { - var objValue = nested[key]; - newValue = customizer ? customizer(objValue, key, nested) : undefined; - if (newValue === undefined) { - newValue = isObject(objValue) - ? objValue - : (isIndex(path[index + 1]) ? [] : {}); - } - } - assignValue(nested, key, newValue); - nested = nested[key]; - } - return object; - } + /* for speeding up hashing/fingerprint operations */ + this._rfc4253Cache = opts._rfc4253Cache; + this._hashCache = {}; - /** - * The base implementation of `setData` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. - */ - var baseSetData = !metaMap ? identity : function(func, data) { - metaMap.set(func, data); - return func; - }; + var sz; + this.curve = undefined; + if (this.type === 'ecdsa') { + var curve = this.part.curve.data.toString(); + this.curve = curve; + sz = algs.curves[curve].size; + } else if (this.type === 'ed25519' || this.type === 'curve25519') { + sz = 256; + this.curve = 'curve25519'; + } else { + var szPart = this.part[algInfo.sizePart]; + sz = szPart.data.length; + sz = sz * 8 - utils.countZeros(szPart.data); + } + this.size = sz; +} - /** - * The base implementation of `setToString` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. - */ - var baseSetToString = !defineProperty ? identity : function(func, string) { - return defineProperty(func, 'toString', { - 'configurable': true, - 'enumerable': false, - 'value': constant(string), - 'writable': true - }); - }; +Key.formats = formats; - /** - * The base implementation of `_.shuffle`. - * - * @private - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function baseShuffle(collection) { - return shuffleSelf(values(collection)); - } +Key.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'ssh'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); - /** - * The base implementation of `_.slice` without an iteratee call guard. - * - * @private - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. - */ - function baseSlice(array, start, end) { - var index = -1, - length = array.length; + if (format === 'rfc4253') { + if (this._rfc4253Cache === undefined) + this._rfc4253Cache = formats['rfc4253'].write(this); + return (this._rfc4253Cache); + } - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = end > length ? length : end; - if (end < 0) { - end += length; - } - length = start > end ? 0 : ((end - start) >>> 0); - start >>>= 0; + return (formats[format].write(this, options)); +}; - var result = Array(length); - while (++index < length) { - result[index] = array[index + start]; - } - return result; - } +Key.prototype.toString = function (format, options) { + return (this.toBuffer(format, options).toString()); +}; - /** - * The base implementation of `_.some` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function baseSome(collection, predicate) { - var result; +Key.prototype.hash = function (algo) { + assert.string(algo, 'algorithm'); + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw (new InvalidAlgorithmError(algo)); - baseEach(collection, function(value, index, collection) { - result = predicate(value, index, collection); - return !result; - }); - return !!result; - } + if (this._hashCache[algo]) + return (this._hashCache[algo]); - /** - * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which - * performs a binary search of `array` to determine the index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndex(array, value, retHighest) { - var low = 0, - high = array == null ? low : array.length; + var hash = crypto.createHash(algo). + update(this.toBuffer('rfc4253')).digest(); + this._hashCache[algo] = hash; + return (hash); +}; - if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { - while (low < high) { - var mid = (low + high) >>> 1, - computed = array[mid]; +Key.prototype.fingerprint = function (algo) { + if (algo === undefined) + algo = 'sha256'; + assert.string(algo, 'algorithm'); + var opts = { + type: 'key', + hash: this.hash(algo), + algorithm: algo + }; + return (new Fingerprint(opts)); +}; - if (computed !== null && !isSymbol(computed) && - (retHighest ? (computed <= value) : (computed < value))) { - low = mid + 1; - } else { - high = mid; - } - } - return high; - } - return baseSortedIndexBy(array, value, identity, retHighest); - } +Key.prototype.defaultHashAlgorithm = function () { + var hashAlgo = 'sha1'; + if (this.type === 'rsa') + hashAlgo = 'sha256'; + if (this.type === 'dsa' && this.size > 1024) + hashAlgo = 'sha256'; + if (this.type === 'ed25519') + hashAlgo = 'sha512'; + if (this.type === 'ecdsa') { + if (this.size <= 256) + hashAlgo = 'sha256'; + else if (this.size <= 384) + hashAlgo = 'sha384'; + else + hashAlgo = 'sha512'; + } + return (hashAlgo); +}; - /** - * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` - * which invokes `iteratee` for `value` and each element of `array` to compute - * their sort ranking. The iteratee is invoked with one argument; (value). - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} iteratee The iteratee invoked per element. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndexBy(array, value, iteratee, retHighest) { - value = iteratee(value); +Key.prototype.createVerify = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); - var low = 0, - high = array == null ? 0 : array.length, - valIsNaN = value !== value, - valIsNull = value === null, - valIsSymbol = isSymbol(value), - valIsUndefined = value === undefined; + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Verifier(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); - while (low < high) { - var mid = nativeFloor((low + high) / 2), - computed = iteratee(array[mid]), - othIsDefined = computed !== undefined, - othIsNull = computed === null, - othIsReflexive = computed === computed, - othIsSymbol = isSymbol(computed); + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldVerify = v.verify.bind(v); + var key = this.toBuffer('pkcs8'); + var curve = this.curve; + var self = this; + v.verify = function (signature, fmt) { + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== self.type) + return (false); + if (signature.hashAlgorithm && + signature.hashAlgorithm !== hashAlgo) + return (false); + if (signature.curve && self.type === 'ecdsa' && + signature.curve !== curve) + return (false); + return (oldVerify(key, signature.toBuffer('asn1'))); - if (valIsNaN) { - var setLow = retHighest || othIsReflexive; - } else if (valIsUndefined) { - setLow = othIsReflexive && (retHighest || othIsDefined); - } else if (valIsNull) { - setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); - } else if (valIsSymbol) { - setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); - } else if (othIsNull || othIsSymbol) { - setLow = false; - } else { - setLow = retHighest ? (computed <= value) : (computed < value); - } - if (setLow) { - low = mid + 1; - } else { - high = mid; - } - } - return nativeMin(high, MAX_ARRAY_INDEX); - } + } else if (typeof (signature) === 'string' || + Buffer.isBuffer(signature)) { + return (oldVerify(key, signature, fmt)); - /** - * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseSortedUniq(array, iteratee) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; + /* + * Avoid doing this on valid arguments, walking the prototype + * chain can be quite slow. + */ + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; + } else { + throw (new TypeError('signature must be a string, ' + + 'Buffer, or Signature object')); + } + }; + return (v); +}; - if (!index || !eq(computed, seen)) { - var seen = computed; - result[resIndex++] = value === 0 ? 0 : value; - } - } - return result; - } +Key.prototype.createDiffieHellman = function () { + if (this.type === 'rsa') + throw (new Error('RSA keys do not support Diffie-Hellman')); - /** - * The base implementation of `_.toNumber` which doesn't ensure correct - * conversions of binary, hexadecimal, or octal string values. - * - * @private - * @param {*} value The value to process. - * @returns {number} Returns the number. - */ - function baseToNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - return +value; - } + return (new DiffieHellman(this)); +}; +Key.prototype.createDH = Key.prototype.createDiffieHellman; - /** - * The base implementation of `_.toString` which doesn't convert nullish - * values to empty strings. - * - * @private - * @param {*} value The value to process. - * @returns {string} Returns the string. - */ - function baseToString(value) { - // Exit early for strings to avoid a performance hit in some environments. - if (typeof value == 'string') { - return value; - } - if (isArray(value)) { - // Recursively convert values (susceptible to call stack limits). - return arrayMap(value, baseToString) + ''; - } - if (isSymbol(value)) { - return symbolToString ? symbolToString.call(value) : ''; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; - } +Key.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; - /** - * The base implementation of `_.uniqBy` without support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseUniq(array, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - length = array.length, - isCommon = true, - result = [], - seen = result; + assert.object(formats[format], 'formats[format]'); - if (comparator) { - isCommon = false; - includes = arrayIncludesWith; - } - else if (length >= LARGE_ARRAY_SIZE) { - var set = iteratee ? null : createSet(array); - if (set) { - return setToArray(set); - } - isCommon = false; - includes = cacheHas; - seen = new SetCache; - } - else { - seen = iteratee ? [] : result; - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; + try { + var k = formats[format].read(data, options); + if (k instanceof PrivateKey) + k = k.toPublic(); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var seenIndex = seen.length; - while (seenIndex--) { - if (seen[seenIndex] === computed) { - continue outer; - } - } - if (iteratee) { - seen.push(computed); - } - result.push(value); - } - else if (!includes(seen, computed, comparator)) { - if (seen !== result) { - seen.push(computed); - } - result.push(value); - } - } - return result; - } +Key.isKey = function (obj, ver) { + return (utils.isCompatible(obj, Key, ver)); +}; - /** - * The base implementation of `_.unset`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The property path to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. - */ - function baseUnset(object, path) { - path = castPath(path, object); - object = parent(object, path); - return object == null || delete object[toKey(last(path))]; - } +/* + * API versions for Key: + * [1,0] -- initial ver, may take Signature for createVerify or may not + * [1,1] -- added pkcs1, pkcs8 formats + * [1,2] -- added auto, ssh-private, openssh formats + * [1,3] -- added defaultHashAlgorithm + * [1,4] -- added ed support, createDH + * [1,5] -- first explicitly tagged version + */ +Key.prototype._sshpkApiVersion = [1, 5]; - /** - * The base implementation of `_.update`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to update. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseUpdate(object, path, updater, customizer) { - return baseSet(object, path, updater(baseGet(object, path)), customizer); - } +Key._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + assert.func(obj.fingerprint); + if (obj.createDH) + return ([1, 4]); + if (obj.defaultHashAlgorithm) + return ([1, 3]); + if (obj.formats['auto']) + return ([1, 2]); + if (obj.formats['pkcs1']) + return ([1, 1]); + return ([1, 0]); +}; - /** - * The base implementation of methods like `_.dropWhile` and `_.takeWhile` - * without support for iteratee shorthands. - * - * @private - * @param {Array} array The array to query. - * @param {Function} predicate The function invoked per iteration. - * @param {boolean} [isDrop] Specify dropping elements instead of taking them. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the slice of `array`. - */ - function baseWhile(array, predicate, isDrop, fromRight) { - var length = array.length, - index = fromRight ? length : -1; - while ((fromRight ? index-- : ++index < length) && - predicate(array[index], index, array)) {} +/***/ }), +/* 29 */ +/***/ (function(module, exports, __webpack_require__) { - return isDrop - ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) - : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); - } +// Copyright 2017 Joyent, Inc. - /** - * The base implementation of `wrapperValue` which returns the result of - * performing a sequence of actions on the unwrapped `value`, where each - * successive action is supplied the return value of the previous. - * - * @private - * @param {*} value The unwrapped value. - * @param {Array} actions Actions to perform to resolve the unwrapped value. - * @returns {*} Returns the resolved value. - */ - function baseWrapperValue(value, actions) { - var result = value; - if (result instanceof LazyWrapper) { - result = result.value(); - } - return arrayReduce(actions, function(result, action) { - return action.func.apply(action.thisArg, arrayPush([result], action.args)); - }, result); - } +module.exports = PrivateKey; - /** - * The base implementation of methods like `_.xor`, without support for - * iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of values. - */ - function baseXor(arrays, iteratee, comparator) { - var length = arrays.length; - if (length < 2) { - return length ? baseUniq(arrays[0]) : []; - } - var index = -1, - result = Array(length); +var assert = __webpack_require__(13); +var algs = __webpack_require__(27); +var crypto = __webpack_require__(7); +var Fingerprint = __webpack_require__(131); +var Signature = __webpack_require__(59); +var errs = __webpack_require__(58); +var util = __webpack_require__(3); +var utils = __webpack_require__(21); +var dhe = __webpack_require__(403); +var generateECDSA = dhe.generateECDSA; +var generateED25519 = dhe.generateED25519; +var edCompat; +var nacl; - while (++index < length) { - var array = arrays[index], - othIndex = -1; +try { + edCompat = __webpack_require__(404); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} - while (++othIndex < length) { - if (othIndex != index) { - result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); - } - } - } - return baseUniq(baseFlatten(result, 1), iteratee, comparator); - } +var Key = __webpack_require__(28); - /** - * This base implementation of `_.zipObject` which assigns values using `assignFunc`. - * - * @private - * @param {Array} props The property identifiers. - * @param {Array} values The property values. - * @param {Function} assignFunc The function to assign values. - * @returns {Object} Returns the new object. - */ - function baseZipObject(props, values, assignFunc) { - var index = -1, - length = props.length, - valsLength = values.length, - result = {}; +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; +var KeyEncryptedError = errs.KeyEncryptedError; - while (++index < length) { - var value = index < valsLength ? values[index] : undefined; - assignFunc(result, props[index], value); - } - return result; - } +var formats = {}; +formats['auto'] = __webpack_require__(405); +formats['pem'] = __webpack_require__(68); +formats['pkcs1'] = __webpack_require__(236); +formats['pkcs8'] = __webpack_require__(132); +formats['rfc4253'] = __webpack_require__(77); +formats['ssh-private'] = __webpack_require__(172); +formats['openssh'] = formats['ssh-private']; +formats['ssh'] = formats['ssh-private']; - /** - * Casts `value` to an empty array if it's not an array like object. - * - * @private - * @param {*} value The value to inspect. - * @returns {Array|Object} Returns the cast array-like object. - */ - function castArrayLikeObject(value) { - return isArrayLikeObject(value) ? value : []; - } +function PrivateKey(opts) { + assert.object(opts, 'options'); + Key.call(this, opts); - /** - * Casts `value` to `identity` if it's not a function. - * - * @private - * @param {*} value The value to inspect. - * @returns {Function} Returns cast function. - */ - function castFunction(value) { - return typeof value == 'function' ? value : identity; - } + this._pubCache = undefined; +} +util.inherits(PrivateKey, Key); - /** - * Casts `value` to a path array if it's not one. - * - * @private - * @param {*} value The value to inspect. - * @param {Object} [object] The object to query keys on. - * @returns {Array} Returns the cast property path array. - */ - function castPath(value, object) { - if (isArray(value)) { - return value; - } - return isKey(value, object) ? [value] : stringToPath(toString(value)); - } +PrivateKey.formats = formats; - /** - * A `baseRest` alias which can be replaced with `identity` by module - * replacement plugins. - * - * @private - * @type {Function} - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. - */ - var castRest = baseRest; +PrivateKey.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'pkcs1'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); - /** - * Casts `array` to a slice if it's needed. - * - * @private - * @param {Array} array The array to inspect. - * @param {number} start The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the cast slice. - */ - function castSlice(array, start, end) { - var length = array.length; - end = end === undefined ? length : end; - return (!start && end >= length) ? array : baseSlice(array, start, end); - } + return (formats[format].write(this, options)); +}; - /** - * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). - * - * @private - * @param {number|Object} id The timer id or timeout object of the timer to clear. - */ - var clearTimeout = ctxClearTimeout || function(id) { - return root.clearTimeout(id); - }; +PrivateKey.prototype.hash = function (algo) { + return (this.toPublic().hash(algo)); +}; - /** - * Creates a clone of `buffer`. - * - * @private - * @param {Buffer} buffer The buffer to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Buffer} Returns the cloned buffer. - */ - function cloneBuffer(buffer, isDeep) { - if (isDeep) { - return buffer.slice(); - } - var length = buffer.length, - result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); +PrivateKey.prototype.toPublic = function () { + if (this._pubCache) + return (this._pubCache); - buffer.copy(result); - return result; - } + var algInfo = algs.info[this.type]; + var pubParts = []; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = algInfo.parts[i]; + pubParts.push(this.part[p]); + } - /** - * Creates a clone of `arrayBuffer`. - * - * @private - * @param {ArrayBuffer} arrayBuffer The array buffer to clone. - * @returns {ArrayBuffer} Returns the cloned array buffer. - */ - function cloneArrayBuffer(arrayBuffer) { - var result = new arrayBuffer.constructor(arrayBuffer.byteLength); - new Uint8Array(result).set(new Uint8Array(arrayBuffer)); - return result; - } + this._pubCache = new Key({ + type: this.type, + source: this, + parts: pubParts + }); + if (this.comment) + this._pubCache.comment = this.comment; + return (this._pubCache); +}; - /** - * Creates a clone of `dataView`. - * - * @private - * @param {Object} dataView The data view to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned data view. - */ - function cloneDataView(dataView, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; - return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); - } +PrivateKey.prototype.derive = function (newType) { + assert.string(newType, 'type'); + var priv, pub, pair; - /** - * Creates a clone of `map`. - * - * @private - * @param {Object} map The map to clone. - * @param {Function} cloneFunc The function to clone values. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned map. - */ - function cloneMap(map, isDeep, cloneFunc) { - var array = isDeep ? cloneFunc(mapToArray(map), CLONE_DEEP_FLAG) : mapToArray(map); - return arrayReduce(array, addMapEntry, new map.constructor); - } + if (this.type === 'ed25519' && newType === 'curve25519') { + if (nacl === undefined) + nacl = __webpack_require__(79); - /** - * Creates a clone of `regexp`. - * - * @private - * @param {Object} regexp The regexp to clone. - * @returns {Object} Returns the cloned regexp. - */ - function cloneRegExp(regexp) { - var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); - result.lastIndex = regexp.lastIndex; - return result; - } + priv = this.part.r.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + priv = priv.slice(0, 32); - /** - * Creates a clone of `set`. - * - * @private - * @param {Object} set The set to clone. - * @param {Function} cloneFunc The function to clone values. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned set. - */ - function cloneSet(set, isDeep, cloneFunc) { - var array = isDeep ? cloneFunc(setToArray(set), CLONE_DEEP_FLAG) : setToArray(set); - return arrayReduce(array, addSetEntry, new set.constructor); - } + pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); + pub = new Buffer(pair.publicKey); + priv = Buffer.concat([priv, pub]); - /** - * Creates a clone of the `symbol` object. - * - * @private - * @param {Object} symbol The symbol object to clone. - * @returns {Object} Returns the cloned symbol object. - */ - function cloneSymbol(symbol) { - return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; - } + return (new PrivateKey({ + type: 'curve25519', + parts: [ + { name: 'R', data: utils.mpNormalize(pub) }, + { name: 'r', data: priv } + ] + })); + } else if (this.type === 'curve25519' && newType === 'ed25519') { + if (nacl === undefined) + nacl = __webpack_require__(79); - /** - * Creates a clone of `typedArray`. - * - * @private - * @param {Object} typedArray The typed array to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned typed array. - */ - function cloneTypedArray(typedArray, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; - return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); - } + priv = this.part.r.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + priv = priv.slice(0, 32); - /** - * Compares values to sort them in ascending order. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {number} Returns the sort order indicator for `value`. - */ - function compareAscending(value, other) { - if (value !== other) { - var valIsDefined = value !== undefined, - valIsNull = value === null, - valIsReflexive = value === value, - valIsSymbol = isSymbol(value); + pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); + pub = new Buffer(pair.publicKey); + priv = Buffer.concat([priv, pub]); - var othIsDefined = other !== undefined, - othIsNull = other === null, - othIsReflexive = other === other, - othIsSymbol = isSymbol(other); + return (new PrivateKey({ + type: 'ed25519', + parts: [ + { name: 'R', data: utils.mpNormalize(pub) }, + { name: 'r', data: priv } + ] + })); + } + throw (new Error('Key derivation not supported from ' + this.type + + ' to ' + newType)); +}; - if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || - (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || - (valIsNull && othIsDefined && othIsReflexive) || - (!valIsDefined && othIsReflexive) || - !valIsReflexive) { - return 1; - } - if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || - (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || - (othIsNull && valIsDefined && valIsReflexive) || - (!othIsDefined && valIsReflexive) || - !othIsReflexive) { - return -1; - } - } - return 0; - } +PrivateKey.prototype.createVerify = function (hashAlgo) { + return (this.toPublic().createVerify(hashAlgo)); +}; - /** - * Used by `_.orderBy` to compare multiple properties of a value to another - * and stable sort them. - * - * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, - * specify an order of "desc" for descending or "asc" for ascending sort order - * of corresponding values. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {boolean[]|string[]} orders The order to sort by for each property. - * @returns {number} Returns the sort order indicator for `object`. - */ - function compareMultiple(object, other, orders) { - var index = -1, - objCriteria = object.criteria, - othCriteria = other.criteria, - length = objCriteria.length, - ordersLength = orders.length; +PrivateKey.prototype.createSign = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); - while (++index < length) { - var result = compareAscending(objCriteria[index], othCriteria[index]); - if (result) { - if (index >= ordersLength) { - return result; - } - var order = orders[index]; - return result * (order == 'desc' ? -1 : 1); - } - } - // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications - // that causes it, under certain circumstances, to provide the same value for - // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 - // for more details. - // - // This also ensures a stable sort in V8 and other engines. - // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. - return object.index - other.index; - } + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Signer(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); - /** - * Creates an array that is the composition of partially applied arguments, - * placeholders, and provided arguments into a single array of arguments. - * - * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to prepend to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. - */ - function composeArgs(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersLength = holders.length, - leftIndex = -1, - leftLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(leftLength + rangeLength), - isUncurried = !isCurried; + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldSign = v.sign.bind(v); + var key = this.toBuffer('pkcs1'); + var type = this.type; + var curve = this.curve; + v.sign = function () { + var sig = oldSign(key); + if (typeof (sig) === 'string') + sig = new Buffer(sig, 'binary'); + sig = Signature.parse(sig, type, 'asn1'); + sig.hashAlgorithm = hashAlgo; + sig.curve = curve; + return (sig); + }; + return (v); +}; - while (++leftIndex < leftLength) { - result[leftIndex] = partials[leftIndex]; - } - while (++argsIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[holders[argsIndex]] = args[argsIndex]; - } - } - while (rangeLength--) { - result[leftIndex++] = args[argsIndex++]; - } - return result; - } +PrivateKey.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; - /** - * This function is like `composeArgs` except that the arguments composition - * is tailored for `_.partialRight`. - * - * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to append to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. - */ - function composeArgsRight(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersIndex = -1, - holdersLength = holders.length, - rightIndex = -1, - rightLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(rangeLength + rightLength), - isUncurried = !isCurried; + assert.object(formats[format], 'formats[format]'); - while (++argsIndex < rangeLength) { - result[argsIndex] = args[argsIndex]; - } - var offset = argsIndex; - while (++rightIndex < rightLength) { - result[offset + rightIndex] = partials[rightIndex]; - } - while (++holdersIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[offset + holders[holdersIndex]] = args[argsIndex++]; - } - } - return result; - } + try { + var k = formats[format].read(data, options); + assert.ok(k instanceof PrivateKey, 'key is not a private key'); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; - /** - * Copies the values of `source` to `array`. - * - * @private - * @param {Array} source The array to copy values from. - * @param {Array} [array=[]] The array to copy values to. - * @returns {Array} Returns `array`. - */ - function copyArray(source, array) { - var index = -1, - length = source.length; +PrivateKey.isPrivateKey = function (obj, ver) { + return (utils.isCompatible(obj, PrivateKey, ver)); +}; - array || (array = Array(length)); - while (++index < length) { - array[index] = source[index]; - } - return array; - } +PrivateKey.generate = function (type, options) { + if (options === undefined) + options = {}; + assert.object(options, 'options'); - /** - * Copies properties of `source` to `object`. - * - * @private - * @param {Object} source The object to copy properties from. - * @param {Array} props The property identifiers to copy. - * @param {Object} [object={}] The object to copy properties to. - * @param {Function} [customizer] The function to customize copied values. - * @returns {Object} Returns `object`. - */ - function copyObject(source, props, object, customizer) { - var isNew = !object; - object || (object = {}); + switch (type) { + case 'ecdsa': + if (options.curve === undefined) + options.curve = 'nistp256'; + assert.string(options.curve, 'options.curve'); + return (generateECDSA(options.curve)); + case 'ed25519': + return (generateED25519()); + default: + throw (new Error('Key generation not supported with key ' + + 'type "' + type + '"')); + } +}; - var index = -1, - length = props.length; +/* + * API versions for PrivateKey: + * [1,0] -- initial ver + * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats + * [1,2] -- added defaultHashAlgorithm + * [1,3] -- added derive, ed, createDH + * [1,4] -- first tagged version + */ +PrivateKey.prototype._sshpkApiVersion = [1, 4]; - while (++index < length) { - var key = props[index]; +PrivateKey._oldVersionDetect = function (obj) { + assert.func(obj.toPublic); + assert.func(obj.createSign); + if (obj.derive) + return ([1, 3]); + if (obj.defaultHashAlgorithm) + return ([1, 2]); + if (obj.formats['auto']) + return ([1, 1]); + return ([1, 0]); +}; - var newValue = customizer - ? customizer(object[key], source[key], key, object, source) - : undefined; - if (newValue === undefined) { - newValue = source[key]; - } - if (isNew) { - baseAssignValue(object, key, newValue); - } else { - assignValue(object, key, newValue); - } - } - return object; - } +/***/ }), +/* 30 */ +/***/ (function(module, exports, __webpack_require__) { - /** - * Copies own symbols of `source` to `object`. - * - * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. - */ - function copySymbols(source, object) { - return copyObject(source, getSymbols(source), object); - } +/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** + * @license + * Lodash + * Copyright JS Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ +;(function() { - /** - * Copies own and inherited symbols of `source` to `object`. - * - * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. - */ - function copySymbolsIn(source, object) { - return copyObject(source, getSymbolsIn(source), object); - } + /** Used as a safe reference for `undefined` in pre-ES5 environments. */ + var undefined; - /** - * Creates a function like `_.groupBy`. - * - * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} [initializer] The accumulator object initializer. - * @returns {Function} Returns the new aggregator function. - */ - function createAggregator(setter, initializer) { - return function(collection, iteratee) { - var func = isArray(collection) ? arrayAggregator : baseAggregator, - accumulator = initializer ? initializer() : {}; + /** Used as the semantic version number. */ + var VERSION = '4.17.4'; - return func(collection, setter, getIteratee(iteratee, 2), accumulator); - }; - } + /** Used as the size to enable large array optimizations. */ + var LARGE_ARRAY_SIZE = 200; - /** - * Creates a function like `_.assign`. - * - * @private - * @param {Function} assigner The function to assign values. - * @returns {Function} Returns the new assigner function. - */ - function createAssigner(assigner) { - return baseRest(function(object, sources) { - var index = -1, - length = sources.length, - customizer = length > 1 ? sources[length - 1] : undefined, - guard = length > 2 ? sources[2] : undefined; + /** Error message constants. */ + var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', + FUNC_ERROR_TEXT = 'Expected a function'; - customizer = (assigner.length > 3 && typeof customizer == 'function') - ? (length--, customizer) - : undefined; + /** Used to stand-in for `undefined` hash values. */ + var HASH_UNDEFINED = '__lodash_hash_undefined__'; - if (guard && isIterateeCall(sources[0], sources[1], guard)) { - customizer = length < 3 ? undefined : customizer; - length = 1; - } - object = Object(object); - while (++index < length) { - var source = sources[index]; - if (source) { - assigner(object, source, index, customizer); - } - } - return object; - }); - } + /** Used as the maximum memoize cache size. */ + var MAX_MEMOIZE_SIZE = 500; - /** - * Creates a `baseEach` or `baseEachRight` function. - * - * @private - * @param {Function} eachFunc The function to iterate over a collection. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. - */ - function createBaseEach(eachFunc, fromRight) { - return function(collection, iteratee) { - if (collection == null) { - return collection; - } - if (!isArrayLike(collection)) { - return eachFunc(collection, iteratee); - } - var length = collection.length, - index = fromRight ? length : -1, - iterable = Object(collection); + /** Used as the internal argument placeholder. */ + var PLACEHOLDER = '__lodash_placeholder__'; - while ((fromRight ? index-- : ++index < length)) { - if (iteratee(iterable[index], index, iterable) === false) { - break; - } - } - return collection; - }; - } + /** Used to compose bitmasks for cloning. */ + var CLONE_DEEP_FLAG = 1, + CLONE_FLAT_FLAG = 2, + CLONE_SYMBOLS_FLAG = 4; - /** - * Creates a base function for methods like `_.forIn` and `_.forOwn`. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. - */ - function createBaseFor(fromRight) { - return function(object, iteratee, keysFunc) { - var index = -1, - iterable = Object(object), - props = keysFunc(object), - length = props.length; + /** Used to compose bitmasks for value comparisons. */ + var COMPARE_PARTIAL_FLAG = 1, + COMPARE_UNORDERED_FLAG = 2; - while (length--) { - var key = props[fromRight ? length : ++index]; - if (iteratee(iterable[key], key, iterable) === false) { - break; - } - } - return object; - }; - } + /** Used to compose bitmasks for function metadata. */ + var WRAP_BIND_FLAG = 1, + WRAP_BIND_KEY_FLAG = 2, + WRAP_CURRY_BOUND_FLAG = 4, + WRAP_CURRY_FLAG = 8, + WRAP_CURRY_RIGHT_FLAG = 16, + WRAP_PARTIAL_FLAG = 32, + WRAP_PARTIAL_RIGHT_FLAG = 64, + WRAP_ARY_FLAG = 128, + WRAP_REARG_FLAG = 256, + WRAP_FLIP_FLAG = 512; - /** - * Creates a function that wraps `func` to invoke it with the optional `this` - * binding of `thisArg`. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createBind(func, bitmask, thisArg) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); + /** Used as default options for `_.truncate`. */ + var DEFAULT_TRUNC_LENGTH = 30, + DEFAULT_TRUNC_OMISSION = '...'; - function wrapper() { - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return fn.apply(isBind ? thisArg : this, arguments); - } - return wrapper; - } + /** Used to detect hot functions by number of calls within a span of milliseconds. */ + var HOT_COUNT = 800, + HOT_SPAN = 16; - /** - * Creates a function like `_.lowerFirst`. - * - * @private - * @param {string} methodName The name of the `String` case method to use. - * @returns {Function} Returns the new case function. - */ - function createCaseFirst(methodName) { - return function(string) { - string = toString(string); + /** Used to indicate the type of lazy iteratees. */ + var LAZY_FILTER_FLAG = 1, + LAZY_MAP_FLAG = 2, + LAZY_WHILE_FLAG = 3; - var strSymbols = hasUnicode(string) - ? stringToArray(string) - : undefined; + /** Used as references for various `Number` constants. */ + var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; - var chr = strSymbols - ? strSymbols[0] - : string.charAt(0); + /** Used as references for the maximum length and index of an array. */ + var MAX_ARRAY_LENGTH = 4294967295, + MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, + HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; - var trailing = strSymbols - ? castSlice(strSymbols, 1).join('') - : string.slice(1); + /** Used to associate wrap methods with their bit flags. */ + var wrapFlags = [ + ['ary', WRAP_ARY_FLAG], + ['bind', WRAP_BIND_FLAG], + ['bindKey', WRAP_BIND_KEY_FLAG], + ['curry', WRAP_CURRY_FLAG], + ['curryRight', WRAP_CURRY_RIGHT_FLAG], + ['flip', WRAP_FLIP_FLAG], + ['partial', WRAP_PARTIAL_FLAG], + ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], + ['rearg', WRAP_REARG_FLAG] + ]; - return chr[methodName]() + trailing; - }; - } + /** `Object#toString` result references. */ + var argsTag = '[object Arguments]', + arrayTag = '[object Array]', + asyncTag = '[object AsyncFunction]', + boolTag = '[object Boolean]', + dateTag = '[object Date]', + domExcTag = '[object DOMException]', + errorTag = '[object Error]', + funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + mapTag = '[object Map]', + numberTag = '[object Number]', + nullTag = '[object Null]', + objectTag = '[object Object]', + promiseTag = '[object Promise]', + proxyTag = '[object Proxy]', + regexpTag = '[object RegExp]', + setTag = '[object Set]', + stringTag = '[object String]', + symbolTag = '[object Symbol]', + undefinedTag = '[object Undefined]', + weakMapTag = '[object WeakMap]', + weakSetTag = '[object WeakSet]'; - /** - * Creates a function like `_.camelCase`. - * - * @private - * @param {Function} callback The function to combine each word. - * @returns {Function} Returns the new compounder function. - */ - function createCompounder(callback) { - return function(string) { - return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); - }; - } + var arrayBufferTag = '[object ArrayBuffer]', + dataViewTag = '[object DataView]', + float32Tag = '[object Float32Array]', + float64Tag = '[object Float64Array]', + int8Tag = '[object Int8Array]', + int16Tag = '[object Int16Array]', + int32Tag = '[object Int32Array]', + uint8Tag = '[object Uint8Array]', + uint8ClampedTag = '[object Uint8ClampedArray]', + uint16Tag = '[object Uint16Array]', + uint32Tag = '[object Uint32Array]'; - /** - * Creates a function that produces an instance of `Ctor` regardless of - * whether it was invoked as part of a `new` expression or by `call` or `apply`. - * - * @private - * @param {Function} Ctor The constructor to wrap. - * @returns {Function} Returns the new wrapped function. - */ - function createCtor(Ctor) { - return function() { - // Use a `switch` statement to work with class constructors. See - // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist - // for more details. - var args = arguments; - switch (args.length) { - case 0: return new Ctor; - case 1: return new Ctor(args[0]); - case 2: return new Ctor(args[0], args[1]); - case 3: return new Ctor(args[0], args[1], args[2]); - case 4: return new Ctor(args[0], args[1], args[2], args[3]); - case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); - case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); - case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); - } - var thisBinding = baseCreate(Ctor.prototype), - result = Ctor.apply(thisBinding, args); + /** Used to match empty string literals in compiled template source. */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; - // Mimic the constructor's `return` behavior. - // See https://es5.github.io/#x13.2.2 for more details. - return isObject(result) ? result : thisBinding; - }; - } + /** Used to match HTML entities and HTML characters. */ + var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, + reUnescapedHtml = /[&<>"']/g, + reHasEscapedHtml = RegExp(reEscapedHtml.source), + reHasUnescapedHtml = RegExp(reUnescapedHtml.source); - /** - * Creates a function that wraps `func` to enable currying. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {number} arity The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createCurry(func, bitmask, arity) { - var Ctor = createCtor(func); + /** Used to match template delimiters. */ + var reEscape = /<%-([\s\S]+?)%>/g, + reEvaluate = /<%([\s\S]+?)%>/g, + reInterpolate = /<%=([\s\S]+?)%>/g; - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length, - placeholder = getHolder(wrapper); + /** Used to match property names within property paths. */ + var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, + reIsPlainProp = /^\w*$/, + reLeadingDot = /^\./, + rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; - while (index--) { - args[index] = arguments[index]; - } - var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) - ? [] - : replaceHolders(args, placeholder); + /** + * Used to match `RegExp` + * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). + */ + var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, + reHasRegExpChar = RegExp(reRegExpChar.source); - length -= holders.length; - if (length < arity) { - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, undefined, - args, holders, undefined, undefined, arity - length); - } - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return apply(fn, this, args); - } - return wrapper; - } + /** Used to match leading and trailing whitespace. */ + var reTrim = /^\s+|\s+$/g, + reTrimStart = /^\s+/, + reTrimEnd = /\s+$/; - /** - * Creates a `_.find` or `_.findLast` function. - * - * @private - * @param {Function} findIndexFunc The function to find the collection index. - * @returns {Function} Returns the new find function. - */ - function createFind(findIndexFunc) { - return function(collection, predicate, fromIndex) { - var iterable = Object(collection); - if (!isArrayLike(collection)) { - var iteratee = getIteratee(predicate, 3); - collection = keys(collection); - predicate = function(key) { return iteratee(iterable[key], key, iterable); }; - } - var index = findIndexFunc(collection, predicate, fromIndex); - return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; - }; - } + /** Used to match wrap detail comments. */ + var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, + reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, + reSplitDetails = /,? & /; - /** - * Creates a `_.flow` or `_.flowRight` function. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new flow function. - */ - function createFlow(fromRight) { - return flatRest(function(funcs) { - var length = funcs.length, - index = length, - prereq = LodashWrapper.prototype.thru; + /** Used to match words composed of alphanumeric characters. */ + var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; - if (fromRight) { - funcs.reverse(); - } - while (index--) { - var func = funcs[index]; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (prereq && !wrapper && getFuncName(func) == 'wrapper') { - var wrapper = new LodashWrapper([], true); - } - } - index = wrapper ? index : length; - while (++index < length) { - func = funcs[index]; + /** Used to match backslashes in property paths. */ + var reEscapeChar = /\\(\\)?/g; - var funcName = getFuncName(func), - data = funcName == 'wrapper' ? getData(func) : undefined; + /** + * Used to match + * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). + */ + var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; - if (data && isLaziable(data[0]) && - data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && - !data[4].length && data[9] == 1 - ) { - wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); - } else { - wrapper = (func.length == 1 && isLaziable(func)) - ? wrapper[funcName]() - : wrapper.thru(func); - } - } - return function() { - var args = arguments, - value = args[0]; + /** Used to match `RegExp` flags from their coerced string values. */ + var reFlags = /\w*$/; - if (wrapper && args.length == 1 && isArray(value)) { - return wrapper.plant(value).value(); - } - var index = 0, - result = length ? funcs[index].apply(this, args) : value; + /** Used to detect bad signed hexadecimal string values. */ + var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; - while (++index < length) { - result = funcs[index].call(this, result); - } - return result; - }; - }); - } + /** Used to detect binary string values. */ + var reIsBinary = /^0b[01]+$/i; - /** - * Creates a function that wraps `func` to invoke it with optional `this` - * binding of `thisArg`, partial application, and currying. - * - * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [partialsRight] The arguments to append to those provided - * to the new function. - * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { - var isAry = bitmask & WRAP_ARY_FLAG, - isBind = bitmask & WRAP_BIND_FLAG, - isBindKey = bitmask & WRAP_BIND_KEY_FLAG, - isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), - isFlip = bitmask & WRAP_FLIP_FLAG, - Ctor = isBindKey ? undefined : createCtor(func); + /** Used to detect host constructors (Safari). */ + var reIsHostCtor = /^\[object .+?Constructor\]$/; - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length; + /** Used to detect octal string values. */ + var reIsOctal = /^0o[0-7]+$/i; - while (index--) { - args[index] = arguments[index]; - } - if (isCurried) { - var placeholder = getHolder(wrapper), - holdersCount = countHolders(args, placeholder); - } - if (partials) { - args = composeArgs(args, partials, holders, isCurried); - } - if (partialsRight) { - args = composeArgsRight(args, partialsRight, holdersRight, isCurried); - } - length -= holdersCount; - if (isCurried && length < arity) { - var newHolders = replaceHolders(args, placeholder); - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, thisArg, - args, newHolders, argPos, ary, arity - length - ); - } - var thisBinding = isBind ? thisArg : this, - fn = isBindKey ? thisBinding[func] : func; - - length = args.length; - if (argPos) { - args = reorder(args, argPos); - } else if (isFlip && length > 1) { - args.reverse(); - } - if (isAry && ary < length) { - args.length = ary; - } - if (this && this !== root && this instanceof wrapper) { - fn = Ctor || createCtor(fn); - } - return fn.apply(thisBinding, args); - } - return wrapper; - } - - /** - * Creates a function like `_.invertBy`. - * - * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} toIteratee The function to resolve iteratees. - * @returns {Function} Returns the new inverter function. - */ - function createInverter(setter, toIteratee) { - return function(object, iteratee) { - return baseInverter(object, setter, toIteratee(iteratee), {}); - }; - } - - /** - * Creates a function that performs a mathematical operation on two values. - * - * @private - * @param {Function} operator The function to perform the operation. - * @param {number} [defaultValue] The value used for `undefined` arguments. - * @returns {Function} Returns the new mathematical operation function. - */ - function createMathOperation(operator, defaultValue) { - return function(value, other) { - var result; - if (value === undefined && other === undefined) { - return defaultValue; - } - if (value !== undefined) { - result = value; - } - if (other !== undefined) { - if (result === undefined) { - return other; - } - if (typeof value == 'string' || typeof other == 'string') { - value = baseToString(value); - other = baseToString(other); - } else { - value = baseToNumber(value); - other = baseToNumber(other); - } - result = operator(value, other); - } - return result; - }; - } + /** Used to detect unsigned integer values. */ + var reIsUint = /^(?:0|[1-9]\d*)$/; - /** - * Creates a function like `_.over`. - * - * @private - * @param {Function} arrayFunc The function to iterate over iteratees. - * @returns {Function} Returns the new over function. - */ - function createOver(arrayFunc) { - return flatRest(function(iteratees) { - iteratees = arrayMap(iteratees, baseUnary(getIteratee())); - return baseRest(function(args) { - var thisArg = this; - return arrayFunc(iteratees, function(iteratee) { - return apply(iteratee, thisArg, args); - }); - }); - }); - } + /** Used to match Latin Unicode letters (excluding mathematical operators). */ + var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; - /** - * Creates the padding for `string` based on `length`. The `chars` string - * is truncated if the number of characters exceeds `length`. - * - * @private - * @param {number} length The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padding for `string`. - */ - function createPadding(length, chars) { - chars = chars === undefined ? ' ' : baseToString(chars); + /** Used to ensure capturing order of template delimiters. */ + var reNoMatch = /($^)/; - var charsLength = chars.length; - if (charsLength < 2) { - return charsLength ? baseRepeat(chars, length) : chars; - } - var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); - return hasUnicode(chars) - ? castSlice(stringToArray(result), 0, length).join('') - : result.slice(0, length); - } + /** Used to match unescaped characters in compiled string literals. */ + var reUnescapedString = /['\n\r\u2028\u2029\\]/g; - /** - * Creates a function that wraps `func` to invoke it with the `this` binding - * of `thisArg` and `partials` prepended to the arguments it receives. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} partials The arguments to prepend to those provided to - * the new function. - * @returns {Function} Returns the new wrapped function. - */ - function createPartial(func, bitmask, thisArg, partials) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); + /** Used to compose unicode character classes. */ + var rsAstralRange = '\\ud800-\\udfff', + rsComboMarksRange = '\\u0300-\\u036f', + reComboHalfMarksRange = '\\ufe20-\\ufe2f', + rsComboSymbolsRange = '\\u20d0-\\u20ff', + rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, + rsDingbatRange = '\\u2700-\\u27bf', + rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', + rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', + rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', + rsPunctuationRange = '\\u2000-\\u206f', + rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', + rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', + rsVarRange = '\\ufe0e\\ufe0f', + rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; - function wrapper() { - var argsIndex = -1, - argsLength = arguments.length, - leftIndex = -1, - leftLength = partials.length, - args = Array(leftLength + argsLength), - fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + /** Used to compose unicode capture groups. */ + var rsApos = "['\u2019]", + rsAstral = '[' + rsAstralRange + ']', + rsBreak = '[' + rsBreakRange + ']', + rsCombo = '[' + rsComboRange + ']', + rsDigits = '\\d+', + rsDingbat = '[' + rsDingbatRange + ']', + rsLower = '[' + rsLowerRange + ']', + rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', + rsFitz = '\\ud83c[\\udffb-\\udfff]', + rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', + rsNonAstral = '[^' + rsAstralRange + ']', + rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', + rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', + rsUpper = '[' + rsUpperRange + ']', + rsZWJ = '\\u200d'; - while (++leftIndex < leftLength) { - args[leftIndex] = partials[leftIndex]; - } - while (argsLength--) { - args[leftIndex++] = arguments[++argsIndex]; - } - return apply(fn, isBind ? thisArg : this, args); - } - return wrapper; - } + /** Used to compose unicode regexes. */ + var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', + rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', + rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', + rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', + reOptMod = rsModifier + '?', + rsOptVar = '[' + rsVarRange + ']?', + rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', + rsOrdLower = '\\d*(?:(?:1st|2nd|3rd|(?![123])\\dth)\\b)', + rsOrdUpper = '\\d*(?:(?:1ST|2ND|3RD|(?![123])\\dTH)\\b)', + rsSeq = rsOptVar + reOptMod + rsOptJoin, + rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, + rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; - /** - * Creates a `_.range` or `_.rangeRight` function. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new range function. - */ - function createRange(fromRight) { - return function(start, end, step) { - if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { - end = step = undefined; - } - // Ensure the sign of `-0` is preserved. - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); - } - step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); - return baseRange(start, end, step, fromRight); - }; - } + /** Used to match apostrophes. */ + var reApos = RegExp(rsApos, 'g'); - /** - * Creates a function that performs a relational operation on two values. - * - * @private - * @param {Function} operator The function to perform the operation. - * @returns {Function} Returns the new relational operation function. - */ - function createRelationalOperation(operator) { - return function(value, other) { - if (!(typeof value == 'string' && typeof other == 'string')) { - value = toNumber(value); - other = toNumber(other); - } - return operator(value, other); - }; - } + /** + * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and + * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). + */ + var reComboMark = RegExp(rsCombo, 'g'); - /** - * Creates a function that wraps `func` to continue currying. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {Function} wrapFunc The function to create the `func` wrapper. - * @param {*} placeholder The placeholder value. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { - var isCurry = bitmask & WRAP_CURRY_FLAG, - newHolders = isCurry ? holders : undefined, - newHoldersRight = isCurry ? undefined : holders, - newPartials = isCurry ? partials : undefined, - newPartialsRight = isCurry ? undefined : partials; + /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ + var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); - bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); - bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); + /** Used to match complex or compound words. */ + var reUnicodeWord = RegExp([ + rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', + rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', + rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, + rsUpper + '+' + rsOptContrUpper, + rsOrdUpper, + rsOrdLower, + rsDigits, + rsEmoji + ].join('|'), 'g'); - if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { - bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); - } - var newData = [ - func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, - newHoldersRight, argPos, ary, arity - ]; + /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ + var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); - var result = wrapFunc.apply(undefined, newData); - if (isLaziable(func)) { - setData(result, newData); - } - result.placeholder = placeholder; - return setWrapToString(result, func, bitmask); - } + /** Used to detect strings that need a more robust regexp to match words. */ + var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; - /** - * Creates a function like `_.round`. - * - * @private - * @param {string} methodName The name of the `Math` method to use when rounding. - * @returns {Function} Returns the new round function. - */ - function createRound(methodName) { - var func = Math[methodName]; - return function(number, precision) { - number = toNumber(number); - precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); - if (precision) { - // Shift with exponential notation to avoid floating-point issues. - // See [MDN](https://mdn.io/round#Examples) for more details. - var pair = (toString(number) + 'e').split('e'), - value = func(pair[0] + 'e' + (+pair[1] + precision)); + /** Used to assign default `context` object properties. */ + var contextProps = [ + 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', + 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', + 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', + 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', + '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' + ]; - pair = (toString(value) + 'e').split('e'); - return +(pair[0] + 'e' + (+pair[1] - precision)); - } - return func(number); - }; - } + /** Used to make template sourceURLs easier to identify. */ + var templateCounter = -1; - /** - * Creates a set object of `values`. - * - * @private - * @param {Array} values The values to add to the set. - * @returns {Object} Returns the new set. - */ - var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { - return new Set(values); - }; + /** Used to identify `toStringTag` values of typed arrays. */ + var typedArrayTags = {}; + typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = + typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = + typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = + typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = + typedArrayTags[uint32Tag] = true; + typedArrayTags[argsTag] = typedArrayTags[arrayTag] = + typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = + typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = + typedArrayTags[errorTag] = typedArrayTags[funcTag] = + typedArrayTags[mapTag] = typedArrayTags[numberTag] = + typedArrayTags[objectTag] = typedArrayTags[regexpTag] = + typedArrayTags[setTag] = typedArrayTags[stringTag] = + typedArrayTags[weakMapTag] = false; - /** - * Creates a `_.toPairs` or `_.toPairsIn` function. - * - * @private - * @param {Function} keysFunc The function to get the keys of a given object. - * @returns {Function} Returns the new pairs function. - */ - function createToPairs(keysFunc) { - return function(object) { - var tag = getTag(object); - if (tag == mapTag) { - return mapToArray(object); - } - if (tag == setTag) { - return setToPairs(object); - } - return baseToPairs(object, keysFunc(object)); - }; - } + /** Used to identify `toStringTag` values supported by `_.clone`. */ + var cloneableTags = {}; + cloneableTags[argsTag] = cloneableTags[arrayTag] = + cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = + cloneableTags[boolTag] = cloneableTags[dateTag] = + cloneableTags[float32Tag] = cloneableTags[float64Tag] = + cloneableTags[int8Tag] = cloneableTags[int16Tag] = + cloneableTags[int32Tag] = cloneableTags[mapTag] = + cloneableTags[numberTag] = cloneableTags[objectTag] = + cloneableTags[regexpTag] = cloneableTags[setTag] = + cloneableTags[stringTag] = cloneableTags[symbolTag] = + cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = + cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; + cloneableTags[errorTag] = cloneableTags[funcTag] = + cloneableTags[weakMapTag] = false; - /** - * Creates a function that either curries or invokes `func` with optional - * `this` binding and partially applied arguments. - * - * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. - * 1 - `_.bind` - * 2 - `_.bindKey` - * 4 - `_.curry` or `_.curryRight` of a bound function - * 8 - `_.curry` - * 16 - `_.curryRight` - * 32 - `_.partial` - * 64 - `_.partialRight` - * 128 - `_.rearg` - * 256 - `_.ary` - * 512 - `_.flip` - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to be partially applied. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { - var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; - if (!isBindKey && typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - var length = partials ? partials.length : 0; - if (!length) { - bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); - partials = holders = undefined; - } - ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); - arity = arity === undefined ? arity : toInteger(arity); - length -= holders ? holders.length : 0; + /** Used to map Latin Unicode letters to basic Latin letters. */ + var deburredLetters = { + // Latin-1 Supplement block. + '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', + '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', + '\xc7': 'C', '\xe7': 'c', + '\xd0': 'D', '\xf0': 'd', + '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', + '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', + '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', + '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', + '\xd1': 'N', '\xf1': 'n', + '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', + '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', + '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', + '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', + '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', + '\xc6': 'Ae', '\xe6': 'ae', + '\xde': 'Th', '\xfe': 'th', + '\xdf': 'ss', + // Latin Extended-A block. + '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', + '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', + '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', + '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', + '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', + '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', + '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', + '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', + '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', + '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', + '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', + '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', + '\u0134': 'J', '\u0135': 'j', + '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', + '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', + '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', + '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', + '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', + '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', + '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', + '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', + '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', + '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', + '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', + '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', + '\u0163': 't', '\u0165': 't', '\u0167': 't', + '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', + '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', + '\u0174': 'W', '\u0175': 'w', + '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', + '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', + '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', + '\u0132': 'IJ', '\u0133': 'ij', + '\u0152': 'Oe', '\u0153': 'oe', + '\u0149': "'n", '\u017f': 's' + }; - if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { - var partialsRight = partials, - holdersRight = holders; + /** Used to map characters to HTML entities. */ + var htmlEscapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''' + }; - partials = holders = undefined; - } - var data = isBindKey ? undefined : getData(func); + /** Used to map HTML entities to characters. */ + var htmlUnescapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + ''': "'" + }; - var newData = [ - func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, - argPos, ary, arity - ]; + /** Used to escape characters for inclusion in compiled string literals. */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\u2028': 'u2028', + '\u2029': 'u2029' + }; - if (data) { - mergeData(newData, data); - } - func = newData[0]; - bitmask = newData[1]; - thisArg = newData[2]; - partials = newData[3]; - holders = newData[4]; - arity = newData[9] = newData[9] === undefined - ? (isBindKey ? 0 : func.length) - : nativeMax(newData[9] - length, 0); + /** Built-in method references without a dependency on `root`. */ + var freeParseFloat = parseFloat, + freeParseInt = parseInt; - if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { - bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); - } - if (!bitmask || bitmask == WRAP_BIND_FLAG) { - var result = createBind(func, bitmask, thisArg); - } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { - result = createCurry(func, bitmask, arity); - } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { - result = createPartial(func, bitmask, thisArg, partials); - } else { - result = createHybrid.apply(undefined, newData); - } - var setter = data ? baseSetData : setData; - return setWrapToString(setter(result, newData), func, bitmask); - } + /** Detect free variable `global` from Node.js. */ + var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; - /** - * Used by `_.defaults` to customize its `_.assignIn` use to assign properties - * of source objects to the destination object for all destination properties - * that resolve to `undefined`. - * - * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to assign. - * @param {Object} object The parent object of `objValue`. - * @returns {*} Returns the value to assign. - */ - function customDefaultsAssignIn(objValue, srcValue, key, object) { - if (objValue === undefined || - (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { - return srcValue; - } - return objValue; - } + /** Detect free variable `self`. */ + var freeSelf = typeof self == 'object' && self && self.Object === Object && self; - /** - * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source - * objects into destination objects that are passed thru. - * - * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to merge. - * @param {Object} object The parent object of `objValue`. - * @param {Object} source The parent object of `srcValue`. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - * @returns {*} Returns the value to assign. - */ - function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { - if (isObject(objValue) && isObject(srcValue)) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, objValue); - baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); - stack['delete'](srcValue); - } - return objValue; - } + /** Used as a reference to the global object. */ + var root = freeGlobal || freeSelf || Function('return this')(); - /** - * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain - * objects. - * - * @private - * @param {*} value The value to inspect. - * @param {string} key The key of the property to inspect. - * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. - */ - function customOmitClone(value) { - return isPlainObject(value) ? undefined : value; - } + /** Detect free variable `exports`. */ + var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; - /** - * A specialized version of `baseIsEqualDeep` for arrays with support for - * partial deep comparisons. - * - * @private - * @param {Array} array The array to compare. - * @param {Array} other The other array to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `array` and `other` objects. - * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. - */ - function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - arrLength = array.length, - othLength = other.length; + /** Detect free variable `module`. */ + var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; - if (arrLength != othLength && !(isPartial && othLength > arrLength)) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(array); - if (stacked && stack.get(other)) { - return stacked == other; - } - var index = -1, - result = true, - seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; + /** Detect the popular CommonJS extension `module.exports`. */ + var moduleExports = freeModule && freeModule.exports === freeExports; - stack.set(array, other); - stack.set(other, array); + /** Detect free variable `process` from Node.js. */ + var freeProcess = moduleExports && freeGlobal.process; - // Ignore non-index properties. - while (++index < arrLength) { - var arrValue = array[index], - othValue = other[index]; + /** Used to access faster Node.js helpers. */ + var nodeUtil = (function() { + try { + return freeProcess && freeProcess.binding && freeProcess.binding('util'); + } catch (e) {} + }()); - if (customizer) { - var compared = isPartial - ? customizer(othValue, arrValue, index, other, array, stack) - : customizer(arrValue, othValue, index, array, other, stack); - } - if (compared !== undefined) { - if (compared) { - continue; - } - result = false; - break; - } - // Recursively compare arrays (susceptible to call stack limits). - if (seen) { - if (!arraySome(other, function(othValue, othIndex) { - if (!cacheHas(seen, othIndex) && - (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { - return seen.push(othIndex); - } - })) { - result = false; - break; - } - } else if (!( - arrValue === othValue || - equalFunc(arrValue, othValue, bitmask, customizer, stack) - )) { - result = false; - break; - } - } - stack['delete'](array); - stack['delete'](other); - return result; - } + /* Node.js helper references. */ + var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, + nodeIsDate = nodeUtil && nodeUtil.isDate, + nodeIsMap = nodeUtil && nodeUtil.isMap, + nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, + nodeIsSet = nodeUtil && nodeUtil.isSet, + nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; - /** - * A specialized version of `baseIsEqualDeep` for comparing objects of - * the same `toStringTag`. - * - * **Note:** This function only supports comparing values with tags of - * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {string} tag The `toStringTag` of the objects to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { - switch (tag) { - case dataViewTag: - if ((object.byteLength != other.byteLength) || - (object.byteOffset != other.byteOffset)) { - return false; - } - object = object.buffer; - other = other.buffer; + /*--------------------------------------------------------------------------*/ - case arrayBufferTag: - if ((object.byteLength != other.byteLength) || - !equalFunc(new Uint8Array(object), new Uint8Array(other))) { - return false; - } - return true; + /** + * Adds the key-value `pair` to `map`. + * + * @private + * @param {Object} map The map to modify. + * @param {Array} pair The key-value pair to add. + * @returns {Object} Returns `map`. + */ + function addMapEntry(map, pair) { + // Don't return `map.set` because it's not chainable in IE 11. + map.set(pair[0], pair[1]); + return map; + } - case boolTag: - case dateTag: - case numberTag: - // Coerce booleans to `1` or `0` and dates to milliseconds. - // Invalid dates are coerced to `NaN`. - return eq(+object, +other); + /** + * Adds `value` to `set`. + * + * @private + * @param {Object} set The set to modify. + * @param {*} value The value to add. + * @returns {Object} Returns `set`. + */ + function addSetEntry(set, value) { + // Don't return `set.add` because it's not chainable in IE 11. + set.add(value); + return set; + } - case errorTag: - return object.name == other.name && object.message == other.message; + /** + * A faster alternative to `Function#apply`, this function invokes `func` + * with the `this` binding of `thisArg` and the arguments of `args`. + * + * @private + * @param {Function} func The function to invoke. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} args The arguments to invoke `func` with. + * @returns {*} Returns the result of `func`. + */ + function apply(func, thisArg, args) { + switch (args.length) { + case 0: return func.call(thisArg); + case 1: return func.call(thisArg, args[0]); + case 2: return func.call(thisArg, args[0], args[1]); + case 3: return func.call(thisArg, args[0], args[1], args[2]); + } + return func.apply(thisArg, args); + } - case regexpTag: - case stringTag: - // Coerce regexes to strings and treat strings, primitives and objects, - // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring - // for more details. - return object == (other + ''); + /** + * A specialized version of `baseAggregator` for arrays. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function arrayAggregator(array, setter, iteratee, accumulator) { + var index = -1, + length = array == null ? 0 : array.length; - case mapTag: - var convert = mapToArray; + while (++index < length) { + var value = array[index]; + setter(accumulator, value, iteratee(value), array); + } + return accumulator; + } - case setTag: - var isPartial = bitmask & COMPARE_PARTIAL_FLAG; - convert || (convert = setToArray); + /** + * A specialized version of `_.forEach` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEach(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length; - if (object.size != other.size && !isPartial) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked) { - return stacked == other; - } - bitmask |= COMPARE_UNORDERED_FLAG; + while (++index < length) { + if (iteratee(array[index], index, array) === false) { + break; + } + } + return array; + } - // Recursively compare objects (susceptible to call stack limits). - stack.set(object, other); - var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); - stack['delete'](object); - return result; + /** + * A specialized version of `_.forEachRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEachRight(array, iteratee) { + var length = array == null ? 0 : array.length; - case symbolTag: - if (symbolValueOf) { - return symbolValueOf.call(object) == symbolValueOf.call(other); - } + while (length--) { + if (iteratee(array[length], length, array) === false) { + break; } - return false; } + return array; + } - /** - * A specialized version of `baseIsEqualDeep` for objects with support for - * partial deep comparisons. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - objProps = getAllKeys(object), - objLength = objProps.length, - othProps = getAllKeys(other), - othLength = othProps.length; + /** + * A specialized version of `_.every` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + */ + function arrayEvery(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; - if (objLength != othLength && !isPartial) { + while (++index < length) { + if (!predicate(array[index], index, array)) { return false; } - var index = objLength; - while (index--) { - var key = objProps[index]; - if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { - return false; - } - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked && stack.get(other)) { - return stacked == other; - } - var result = true; - stack.set(object, other); - stack.set(other, object); - - var skipCtor = isPartial; - while (++index < objLength) { - key = objProps[index]; - var objValue = object[key], - othValue = other[key]; + } + return true; + } - if (customizer) { - var compared = isPartial - ? customizer(othValue, objValue, key, other, object, stack) - : customizer(objValue, othValue, key, object, other, stack); - } - // Recursively compare objects (susceptible to call stack limits). - if (!(compared === undefined - ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) - : compared - )) { - result = false; - break; - } - skipCtor || (skipCtor = key == 'constructor'); - } - if (result && !skipCtor) { - var objCtor = object.constructor, - othCtor = other.constructor; + /** + * A specialized version of `_.filter` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function arrayFilter(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; - // Non `Object` object instances with different constructors are not equal. - if (objCtor != othCtor && - ('constructor' in object && 'constructor' in other) && - !(typeof objCtor == 'function' && objCtor instanceof objCtor && - typeof othCtor == 'function' && othCtor instanceof othCtor)) { - result = false; - } + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result[resIndex++] = value; } - stack['delete'](object); - stack['delete'](other); - return result; } + return result; + } - /** - * A specialized version of `baseRest` which flattens the rest array. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. - */ - function flatRest(func) { - return setToString(overRest(func, undefined, flatten), func + ''); + /** + * A specialized version of `_.includes` for arrays without support for + * specifying an index to search from. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludes(array, value) { + var length = array == null ? 0 : array.length; + return !!length && baseIndexOf(array, value, 0) > -1; + } + + /** + * This function is like `arrayIncludes` except that it accepts a comparator. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @param {Function} comparator The comparator invoked per element. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludesWith(array, value, comparator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (comparator(value, array[index])) { + return true; + } } + return false; + } - /** - * Creates an array of own enumerable property names and symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. - */ - function getAllKeys(object) { - return baseGetAllKeys(object, keys, getSymbols); - } + /** + * A specialized version of `_.map` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function arrayMap(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length, + result = Array(length); - /** - * Creates an array of own and inherited enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. - */ - function getAllKeysIn(object) { - return baseGetAllKeys(object, keysIn, getSymbolsIn); + while (++index < length) { + result[index] = iteratee(array[index], index, array); } + return result; + } - /** - * Gets metadata for `func`. - * - * @private - * @param {Function} func The function to query. - * @returns {*} Returns the metadata for `func`. - */ - var getData = !metaMap ? noop : function(func) { - return metaMap.get(func); - }; - - /** - * Gets the name of `func`. - * - * @private - * @param {Function} func The function to query. - * @returns {string} Returns the function name. - */ - function getFuncName(func) { - var result = (func.name + ''), - array = realNames[result], - length = hasOwnProperty.call(realNames, result) ? array.length : 0; + /** + * Appends the elements of `values` to `array`. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to append. + * @returns {Array} Returns `array`. + */ + function arrayPush(array, values) { + var index = -1, + length = values.length, + offset = array.length; - while (length--) { - var data = array[length], - otherFunc = data.func; - if (otherFunc == null || otherFunc == func) { - return data.name; - } - } - return result; + while (++index < length) { + array[offset + index] = values[index]; } + return array; + } - /** - * Gets the argument placeholder value for `func`. - * - * @private - * @param {Function} func The function to inspect. - * @returns {*} Returns the placeholder value. - */ - function getHolder(func) { - var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; - return object.placeholder; - } + /** + * A specialized version of `_.reduce` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the first element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduce(array, iteratee, accumulator, initAccum) { + var index = -1, + length = array == null ? 0 : array.length; - /** - * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, - * this function returns the custom method, otherwise it returns `baseIteratee`. - * If arguments are provided, the chosen function is invoked with them and - * its result is returned. - * - * @private - * @param {*} [value] The value to convert to an iteratee. - * @param {number} [arity] The arity of the created iteratee. - * @returns {Function} Returns the chosen function or its result. - */ - function getIteratee() { - var result = lodash.iteratee || iteratee; - result = result === iteratee ? baseIteratee : result; - return arguments.length ? result(arguments[0], arguments[1]) : result; + if (initAccum && length) { + accumulator = array[++index]; } - - /** - * Gets the data for `map`. - * - * @private - * @param {Object} map The map to query. - * @param {string} key The reference key. - * @returns {*} Returns the map data. - */ - function getMapData(map, key) { - var data = map.__data__; - return isKeyable(key) - ? data[typeof key == 'string' ? 'string' : 'hash'] - : data.map; + while (++index < length) { + accumulator = iteratee(accumulator, array[index], index, array); } + return accumulator; + } - /** - * Gets the property names, values, and compare flags of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the match data of `object`. - */ - function getMatchData(object) { - var result = keys(object), - length = result.length; + /** + * A specialized version of `_.reduceRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the last element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduceRight(array, iteratee, accumulator, initAccum) { + var length = array == null ? 0 : array.length; + if (initAccum && length) { + accumulator = array[--length]; + } + while (length--) { + accumulator = iteratee(accumulator, array[length], length, array); + } + return accumulator; + } - while (length--) { - var key = result[length], - value = object[key]; + /** + * A specialized version of `_.some` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function arraySome(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; - result[length] = [key, value, isStrictComparable(value)]; + while (++index < length) { + if (predicate(array[index], index, array)) { + return true; } - return result; } + return false; + } - /** - * Gets the native function at `key` of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {string} key The key of the method to get. - * @returns {*} Returns the function if it's native, else `undefined`. - */ - function getNative(object, key) { - var value = getValue(object, key); - return baseIsNative(value) ? value : undefined; - } + /** + * Gets the size of an ASCII `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + var asciiSize = baseProperty('length'); - /** - * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the raw `toStringTag`. - */ - function getRawTag(value) { - var isOwn = hasOwnProperty.call(value, symToStringTag), - tag = value[symToStringTag]; + /** + * Converts an ASCII `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function asciiToArray(string) { + return string.split(''); + } - try { - value[symToStringTag] = undefined; - var unmasked = true; - } catch (e) {} + /** + * Splits an ASCII `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function asciiWords(string) { + return string.match(reAsciiWord) || []; + } - var result = nativeObjectToString.call(value); - if (unmasked) { - if (isOwn) { - value[symToStringTag] = tag; - } else { - delete value[symToStringTag]; - } + /** + * The base implementation of methods like `_.findKey` and `_.findLastKey`, + * without support for iteratee shorthands, which iterates over `collection` + * using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the found element or its key, else `undefined`. + */ + function baseFindKey(collection, predicate, eachFunc) { + var result; + eachFunc(collection, function(value, key, collection) { + if (predicate(value, key, collection)) { + result = key; + return false; } - return result; - } + }); + return result; + } - /** - * Creates an array of the own enumerable symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbols = !nativeGetSymbols ? stubArray : function(object) { - if (object == null) { - return []; - } - object = Object(object); - return arrayFilter(nativeGetSymbols(object), function(symbol) { - return propertyIsEnumerable.call(object, symbol); - }); - }; + /** + * The base implementation of `_.findIndex` and `_.findLastIndex` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {number} fromIndex The index to search from. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseFindIndex(array, predicate, fromIndex, fromRight) { + var length = array.length, + index = fromIndex + (fromRight ? 1 : -1); - /** - * Creates an array of the own and inherited enumerable symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { - var result = []; - while (object) { - arrayPush(result, getSymbols(object)); - object = getPrototype(object); + while ((fromRight ? index-- : ++index < length)) { + if (predicate(array[index], index, array)) { + return index; } - return result; - }; + } + return -1; + } - /** - * Gets the `toStringTag` of `value`. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - var getTag = baseGetTag; + /** + * The base implementation of `_.indexOf` without `fromIndex` bounds checks. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOf(array, value, fromIndex) { + return value === value + ? strictIndexOf(array, value, fromIndex) + : baseFindIndex(array, baseIsNaN, fromIndex); + } - // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. - if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || - (Map && getTag(new Map) != mapTag) || - (Promise && getTag(Promise.resolve()) != promiseTag) || - (Set && getTag(new Set) != setTag) || - (WeakMap && getTag(new WeakMap) != weakMapTag)) { - getTag = function(value) { - var result = baseGetTag(value), - Ctor = result == objectTag ? value.constructor : undefined, - ctorString = Ctor ? toSource(Ctor) : ''; + /** + * This function is like `baseIndexOf` except that it accepts a comparator. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @param {Function} comparator The comparator invoked per element. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOfWith(array, value, fromIndex, comparator) { + var index = fromIndex - 1, + length = array.length; - if (ctorString) { - switch (ctorString) { - case dataViewCtorString: return dataViewTag; - case mapCtorString: return mapTag; - case promiseCtorString: return promiseTag; - case setCtorString: return setTag; - case weakMapCtorString: return weakMapTag; - } - } - return result; - }; + while (++index < length) { + if (comparator(array[index], value)) { + return index; + } } + return -1; + } - /** - * Gets the view, applying any `transforms` to the `start` and `end` positions. - * - * @private - * @param {number} start The start of the view. - * @param {number} end The end of the view. - * @param {Array} transforms The transformations to apply to the view. - * @returns {Object} Returns an object containing the `start` and `end` - * positions of the view. - */ - function getView(start, end, transforms) { - var index = -1, - length = transforms.length; + /** + * The base implementation of `_.isNaN` without support for number objects. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + */ + function baseIsNaN(value) { + return value !== value; + } - while (++index < length) { - var data = transforms[index], - size = data.size; + /** + * The base implementation of `_.mean` and `_.meanBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the mean. + */ + function baseMean(array, iteratee) { + var length = array == null ? 0 : array.length; + return length ? (baseSum(array, iteratee) / length) : NAN; + } - switch (data.type) { - case 'drop': start += size; break; - case 'dropRight': end -= size; break; - case 'take': end = nativeMin(end, start + size); break; - case 'takeRight': start = nativeMax(start, end - size); break; - } - } - return { 'start': start, 'end': end }; - } + /** + * The base implementation of `_.property` without support for deep paths. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; + } - /** - * Extracts wrapper details from the `source` body comment. - * - * @private - * @param {string} source The source to inspect. - * @returns {Array} Returns the wrapper details. - */ - function getWrapDetails(source) { - var match = source.match(reWrapDetails); - return match ? match[1].split(reSplitDetails) : []; - } + /** + * The base implementation of `_.propertyOf` without support for deep paths. + * + * @private + * @param {Object} object The object to query. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyOf(object) { + return function(key) { + return object == null ? undefined : object[key]; + }; + } - /** - * Checks if `path` exists on `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @param {Function} hasFunc The function to check properties. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - */ - function hasPath(object, path, hasFunc) { - path = castPath(path, object); + /** + * The base implementation of `_.reduce` and `_.reduceRight`, without support + * for iteratee shorthands, which iterates over `collection` using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} accumulator The initial value. + * @param {boolean} initAccum Specify using the first or last element of + * `collection` as the initial value. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the accumulated value. + */ + function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { + eachFunc(collection, function(value, index, collection) { + accumulator = initAccum + ? (initAccum = false, value) + : iteratee(accumulator, value, index, collection); + }); + return accumulator; + } - var index = -1, - length = path.length, - result = false; + /** + * The base implementation of `_.sortBy` which uses `comparer` to define the + * sort order of `array` and replaces criteria objects with their corresponding + * values. + * + * @private + * @param {Array} array The array to sort. + * @param {Function} comparer The function to define sort order. + * @returns {Array} Returns `array`. + */ + function baseSortBy(array, comparer) { + var length = array.length; - while (++index < length) { - var key = toKey(path[index]); - if (!(result = object != null && hasFunc(object, key))) { - break; - } - object = object[key]; - } - if (result || ++index != length) { - return result; - } - length = object == null ? 0 : object.length; - return !!length && isLength(length) && isIndex(key, length) && - (isArray(object) || isArguments(object)); + array.sort(comparer); + while (length--) { + array[length] = array[length].value; } + return array; + } - /** - * Initializes an array clone. - * - * @private - * @param {Array} array The array to clone. - * @returns {Array} Returns the initialized clone. - */ - function initCloneArray(array) { - var length = array.length, - result = array.constructor(length); + /** + * The base implementation of `_.sum` and `_.sumBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the sum. + */ + function baseSum(array, iteratee) { + var result, + index = -1, + length = array.length; - // Add properties assigned by `RegExp#exec`. - if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { - result.index = array.index; - result.input = array.input; + while (++index < length) { + var current = iteratee(array[index]); + if (current !== undefined) { + result = result === undefined ? current : (result + current); } - return result; } + return result; + } - /** - * Initializes an object clone. - * - * @private - * @param {Object} object The object to clone. - * @returns {Object} Returns the initialized clone. - */ - function initCloneObject(object) { - return (typeof object.constructor == 'function' && !isPrototype(object)) - ? baseCreate(getPrototype(object)) - : {}; + /** + * The base implementation of `_.times` without support for iteratee shorthands + * or max array length checks. + * + * @private + * @param {number} n The number of times to invoke `iteratee`. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the array of results. + */ + function baseTimes(n, iteratee) { + var index = -1, + result = Array(n); + + while (++index < n) { + result[index] = iteratee(index); } + return result; + } - /** - * Initializes an object clone based on its `toStringTag`. - * - * **Note:** This function only supports cloning values with tags of - * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. - * - * @private - * @param {Object} object The object to clone. - * @param {string} tag The `toStringTag` of the object to clone. - * @param {Function} cloneFunc The function to clone values. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the initialized clone. - */ - function initCloneByTag(object, tag, cloneFunc, isDeep) { - var Ctor = object.constructor; - switch (tag) { - case arrayBufferTag: - return cloneArrayBuffer(object); + /** + * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array + * of key-value pairs for `object` corresponding to the property names of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the key-value pairs. + */ + function baseToPairs(object, props) { + return arrayMap(props, function(key) { + return [key, object[key]]; + }); + } - case boolTag: - case dateTag: - return new Ctor(+object); + /** + * The base implementation of `_.unary` without support for storing metadata. + * + * @private + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + */ + function baseUnary(func) { + return function(value) { + return func(value); + }; + } - case dataViewTag: - return cloneDataView(object, isDeep); + /** + * The base implementation of `_.values` and `_.valuesIn` which creates an + * array of `object` property values corresponding to the property names + * of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the array of property values. + */ + function baseValues(object, props) { + return arrayMap(props, function(key) { + return object[key]; + }); + } - case float32Tag: case float64Tag: - case int8Tag: case int16Tag: case int32Tag: - case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: - return cloneTypedArray(object, isDeep); + /** + * Checks if a `cache` value for `key` exists. + * + * @private + * @param {Object} cache The cache to query. + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function cacheHas(cache, key) { + return cache.has(key); + } - case mapTag: - return cloneMap(object, isDeep, cloneFunc); + /** + * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the first unmatched string symbol. + */ + function charsStartIndex(strSymbols, chrSymbols) { + var index = -1, + length = strSymbols.length; - case numberTag: - case stringTag: - return new Ctor(object); + while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } - case regexpTag: - return cloneRegExp(object); + /** + * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the last unmatched string symbol. + */ + function charsEndIndex(strSymbols, chrSymbols) { + var index = strSymbols.length; - case setTag: - return cloneSet(object, isDeep, cloneFunc); + while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } - case symbolTag: - return cloneSymbol(object); - } - } + /** + * Gets the number of `placeholder` occurrences in `array`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} placeholder The placeholder to search for. + * @returns {number} Returns the placeholder count. + */ + function countHolders(array, placeholder) { + var length = array.length, + result = 0; - /** - * Inserts wrapper `details` in a comment at the top of the `source` body. - * - * @private - * @param {string} source The source to modify. - * @returns {Array} details The details to insert. - * @returns {string} Returns the modified source. - */ - function insertWrapDetails(source, details) { - var length = details.length; - if (!length) { - return source; + while (length--) { + if (array[length] === placeholder) { + ++result; } - var lastIndex = length - 1; - details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; - details = details.join(length > 2 ? ', ' : ' '); - return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); } + return result; + } - /** - * Checks if `value` is a flattenable `arguments` object or array. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. - */ - function isFlattenable(value) { - return isArray(value) || isArguments(value) || - !!(spreadableSymbol && value && value[spreadableSymbol]); - } + /** + * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A + * letters to basic Latin letters. + * + * @private + * @param {string} letter The matched letter to deburr. + * @returns {string} Returns the deburred letter. + */ + var deburrLetter = basePropertyOf(deburredLetters); - /** - * Checks if `value` is a valid array-like index. - * - * @private - * @param {*} value The value to check. - * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. - * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. - */ - function isIndex(value, length) { - length = length == null ? MAX_SAFE_INTEGER : length; - return !!length && - (typeof value == 'number' || reIsUint.test(value)) && - (value > -1 && value % 1 == 0 && value < length); - } + /** + * Used by `_.escape` to convert characters to HTML entities. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + var escapeHtmlChar = basePropertyOf(htmlEscapes); - /** - * Checks if the given arguments are from an iteratee call. - * - * @private - * @param {*} value The potential iteratee value argument. - * @param {*} index The potential iteratee index or key argument. - * @param {*} object The potential iteratee object argument. - * @returns {boolean} Returns `true` if the arguments are from an iteratee call, - * else `false`. - */ - function isIterateeCall(value, index, object) { - if (!isObject(object)) { - return false; - } - var type = typeof index; - if (type == 'number' - ? (isArrayLike(object) && isIndex(index, object.length)) - : (type == 'string' && index in object) - ) { - return eq(object[index], value); - } - return false; - } + /** + * Used by `_.template` to escape characters for inclusion in compiled string literals. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + function escapeStringChar(chr) { + return '\\' + stringEscapes[chr]; + } - /** - * Checks if `value` is a property name and not a property path. - * - * @private - * @param {*} value The value to check. - * @param {Object} [object] The object to query keys on. - * @returns {boolean} Returns `true` if `value` is a property name, else `false`. - */ - function isKey(value, object) { - if (isArray(value)) { - return false; - } - var type = typeof value; - if (type == 'number' || type == 'symbol' || type == 'boolean' || - value == null || isSymbol(value)) { - return true; - } - return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || - (object != null && value in Object(object)); - } + /** + * Gets the value at `key` of `object`. + * + * @private + * @param {Object} [object] The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function getValue(object, key) { + return object == null ? undefined : object[key]; + } - /** - * Checks if `value` is suitable for use as unique object key. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is suitable, else `false`. - */ - function isKeyable(value) { - var type = typeof value; - return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') - ? (value !== '__proto__') - : (value === null); - } + /** + * Checks if `string` contains Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a symbol is found, else `false`. + */ + function hasUnicode(string) { + return reHasUnicode.test(string); + } - /** - * Checks if `func` has a lazy counterpart. - * - * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` has a lazy counterpart, - * else `false`. - */ - function isLaziable(func) { - var funcName = getFuncName(func), - other = lodash[funcName]; + /** + * Checks if `string` contains a word composed of Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a word is found, else `false`. + */ + function hasUnicodeWord(string) { + return reHasUnicodeWord.test(string); + } - if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { - return false; - } - if (func === other) { - return true; - } - var data = getData(other); - return !!data && func === data[0]; - } + /** + * Converts `iterator` to an array. + * + * @private + * @param {Object} iterator The iterator to convert. + * @returns {Array} Returns the converted array. + */ + function iteratorToArray(iterator) { + var data, + result = []; - /** - * Checks if `func` has its source masked. - * - * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` is masked, else `false`. - */ - function isMasked(func) { - return !!maskSrcKey && (maskSrcKey in func); + while (!(data = iterator.next()).done) { + result.push(data.value); } + return result; + } - /** - * Checks if `func` is capable of being masked. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `func` is maskable, else `false`. - */ - var isMaskable = coreJsData ? isFunction : stubFalse; + /** + * Converts `map` to its key-value pairs. + * + * @private + * @param {Object} map The map to convert. + * @returns {Array} Returns the key-value pairs. + */ + function mapToArray(map) { + var index = -1, + result = Array(map.size); - /** - * Checks if `value` is likely a prototype object. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. - */ - function isPrototype(value) { - var Ctor = value && value.constructor, - proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; + map.forEach(function(value, key) { + result[++index] = [key, value]; + }); + return result; + } - return value === proto; - } + /** + * Creates a unary function that invokes `func` with its argument transformed. + * + * @private + * @param {Function} func The function to wrap. + * @param {Function} transform The argument transform. + * @returns {Function} Returns the new function. + */ + function overArg(func, transform) { + return function(arg) { + return func(transform(arg)); + }; + } - /** - * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` if suitable for strict - * equality comparisons, else `false`. - */ - function isStrictComparable(value) { - return value === value && !isObject(value); + /** + * Replaces all `placeholder` elements in `array` with an internal placeholder + * and returns an array of their indexes. + * + * @private + * @param {Array} array The array to modify. + * @param {*} placeholder The placeholder to replace. + * @returns {Array} Returns the new array of placeholder indexes. + */ + function replaceHolders(array, placeholder) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value === placeholder || value === PLACEHOLDER) { + array[index] = PLACEHOLDER; + result[resIndex++] = index; + } } + return result; + } - /** - * A specialized version of `matchesProperty` for source values suitable - * for strict equality comparisons, i.e. `===`. - * - * @private - * @param {string} key The key of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function matchesStrictComparable(key, srcValue) { - return function(object) { - if (object == null) { - return false; - } - return object[key] === srcValue && - (srcValue !== undefined || (key in Object(object))); - }; - } + /** + * Converts `set` to an array of its values. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the values. + */ + function setToArray(set) { + var index = -1, + result = Array(set.size); - /** - * A specialized version of `_.memoize` which clears the memoized function's - * cache when it exceeds `MAX_MEMOIZE_SIZE`. - * - * @private - * @param {Function} func The function to have its output memoized. - * @returns {Function} Returns the new memoized function. - */ - function memoizeCapped(func) { - var result = memoize(func, function(key) { - if (cache.size === MAX_MEMOIZE_SIZE) { - cache.clear(); - } - return key; - }); + set.forEach(function(value) { + result[++index] = value; + }); + return result; + } - var cache = result.cache; - return result; - } + /** + * Converts `set` to its value-value pairs. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the value-value pairs. + */ + function setToPairs(set) { + var index = -1, + result = Array(set.size); - /** - * Merges the function metadata of `source` into `data`. - * - * Merging metadata reduces the number of wrappers used to invoke a function. - * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` - * may be applied regardless of execution order. Methods like `_.ary` and - * `_.rearg` modify function arguments, making the order in which they are - * executed important, preventing the merging of metadata. However, we make - * an exception for a safe combined case where curried functions have `_.ary` - * and or `_.rearg` applied. - * - * @private - * @param {Array} data The destination metadata. - * @param {Array} source The source metadata. - * @returns {Array} Returns `data`. - */ - function mergeData(data, source) { - var bitmask = data[1], - srcBitmask = source[1], - newBitmask = bitmask | srcBitmask, - isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); + set.forEach(function(value) { + result[++index] = [value, value]; + }); + return result; + } - var isCombo = - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || - ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); + /** + * A specialized version of `_.indexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictIndexOf(array, value, fromIndex) { + var index = fromIndex - 1, + length = array.length; - // Exit early if metadata can't be merged. - if (!(isCommon || isCombo)) { - return data; - } - // Use source `thisArg` if available. - if (srcBitmask & WRAP_BIND_FLAG) { - data[2] = source[2]; - // Set when currying a bound function. - newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; - } - // Compose partial arguments. - var value = source[3]; - if (value) { - var partials = data[3]; - data[3] = partials ? composeArgs(partials, value, source[4]) : value; - data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; - } - // Compose partial right arguments. - value = source[5]; - if (value) { - partials = data[5]; - data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; - data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; - } - // Use source `argPos` if available. - value = source[7]; - if (value) { - data[7] = value; - } - // Use source `ary` if it's smaller. - if (srcBitmask & WRAP_ARY_FLAG) { - data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); + while (++index < length) { + if (array[index] === value) { + return index; } - // Use source `arity` if one is not provided. - if (data[9] == null) { - data[9] = source[9]; + } + return -1; + } + + /** + * A specialized version of `_.lastIndexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictLastIndexOf(array, value, fromIndex) { + var index = fromIndex + 1; + while (index--) { + if (array[index] === value) { + return index; } - // Use source `func` and merge bitmasks. - data[0] = source[0]; - data[1] = newBitmask; + } + return index; + } - return data; + /** + * Gets the number of symbols in `string`. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the string size. + */ + function stringSize(string) { + return hasUnicode(string) + ? unicodeSize(string) + : asciiSize(string); + } + + /** + * Converts `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function stringToArray(string) { + return hasUnicode(string) + ? unicodeToArray(string) + : asciiToArray(string); + } + + /** + * Used by `_.unescape` to convert HTML entities to characters. + * + * @private + * @param {string} chr The matched character to unescape. + * @returns {string} Returns the unescaped character. + */ + var unescapeHtmlChar = basePropertyOf(htmlUnescapes); + + /** + * Gets the size of a Unicode `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + function unicodeSize(string) { + var result = reUnicode.lastIndex = 0; + while (reUnicode.test(string)) { + ++result; } + return result; + } + + /** + * Converts a Unicode `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function unicodeToArray(string) { + return string.match(reUnicode) || []; + } + + /** + * Splits a Unicode `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function unicodeWords(string) { + return string.match(reUnicodeWord) || []; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Create a new pristine `lodash` function using the `context` object. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Util + * @param {Object} [context=root] The context object. + * @returns {Function} Returns a new `lodash` function. + * @example + * + * _.mixin({ 'foo': _.constant('foo') }); + * + * var lodash = _.runInContext(); + * lodash.mixin({ 'bar': lodash.constant('bar') }); + * + * _.isFunction(_.foo); + * // => true + * _.isFunction(_.bar); + * // => false + * + * lodash.isFunction(lodash.foo); + * // => false + * lodash.isFunction(lodash.bar); + * // => true + * + * // Create a suped-up `defer` in Node.js. + * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; + */ + var runInContext = (function runInContext(context) { + context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); + + /** Built-in constructor references. */ + var Array = context.Array, + Date = context.Date, + Error = context.Error, + Function = context.Function, + Math = context.Math, + Object = context.Object, + RegExp = context.RegExp, + String = context.String, + TypeError = context.TypeError; + + /** Used for built-in method references. */ + var arrayProto = Array.prototype, + funcProto = Function.prototype, + objectProto = Object.prototype; + + /** Used to detect overreaching core-js shims. */ + var coreJsData = context['__core-js_shared__']; + + /** Used to resolve the decompiled source of functions. */ + var funcToString = funcProto.toString; + + /** Used to check objects for own properties. */ + var hasOwnProperty = objectProto.hasOwnProperty; + + /** Used to generate unique IDs. */ + var idCounter = 0; + + /** Used to detect methods masquerading as native. */ + var maskSrcKey = (function() { + var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); + return uid ? ('Symbol(src)_1.' + uid) : ''; + }()); /** - * This function is like - * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * except that it includes inherited enumerable properties. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. */ - function nativeKeysIn(object) { - var result = []; - if (object != null) { - for (var key in Object(object)) { - result.push(key); - } - } - return result; - } + var nativeObjectToString = objectProto.toString; + + /** Used to infer the `Object` constructor. */ + var objectCtorString = funcToString.call(Object); + + /** Used to restore the original `_` reference in `_.noConflict`. */ + var oldDash = root._; + + /** Used to detect if a method is native. */ + var reIsNative = RegExp('^' + + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') + .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' + ); + + /** Built-in value references. */ + var Buffer = moduleExports ? context.Buffer : undefined, + Symbol = context.Symbol, + Uint8Array = context.Uint8Array, + allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, + getPrototype = overArg(Object.getPrototypeOf, Object), + objectCreate = Object.create, + propertyIsEnumerable = objectProto.propertyIsEnumerable, + splice = arrayProto.splice, + spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, + symIterator = Symbol ? Symbol.iterator : undefined, + symToStringTag = Symbol ? Symbol.toStringTag : undefined; + + var defineProperty = (function() { + try { + var func = getNative(Object, 'defineProperty'); + func({}, '', {}); + return func; + } catch (e) {} + }()); + + /** Mocked built-ins. */ + var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, + ctxNow = Date && Date.now !== root.Date.now && Date.now, + ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; + + /* Built-in method references for those with the same name as other `lodash` methods. */ + var nativeCeil = Math.ceil, + nativeFloor = Math.floor, + nativeGetSymbols = Object.getOwnPropertySymbols, + nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, + nativeIsFinite = context.isFinite, + nativeJoin = arrayProto.join, + nativeKeys = overArg(Object.keys, Object), + nativeMax = Math.max, + nativeMin = Math.min, + nativeNow = Date.now, + nativeParseInt = context.parseInt, + nativeRandom = Math.random, + nativeReverse = arrayProto.reverse; + + /* Built-in method references that are verified to be native. */ + var DataView = getNative(context, 'DataView'), + Map = getNative(context, 'Map'), + Promise = getNative(context, 'Promise'), + Set = getNative(context, 'Set'), + WeakMap = getNative(context, 'WeakMap'), + nativeCreate = getNative(Object, 'create'); + + /** Used to store function metadata. */ + var metaMap = WeakMap && new WeakMap; + + /** Used to lookup unminified function names. */ + var realNames = {}; + + /** Used to detect maps, sets, and weakmaps. */ + var dataViewCtorString = toSource(DataView), + mapCtorString = toSource(Map), + promiseCtorString = toSource(Promise), + setCtorString = toSource(Set), + weakMapCtorString = toSource(WeakMap); + + /** Used to convert symbols to primitives and strings. */ + var symbolProto = Symbol ? Symbol.prototype : undefined, + symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, + symbolToString = symbolProto ? symbolProto.toString : undefined; + + /*------------------------------------------------------------------------*/ /** - * Converts `value` to a string using `Object.prototype.toString`. + * Creates a `lodash` object which wraps `value` to enable implicit method + * chain sequences. Methods that operate on and return arrays, collections, + * and functions can be chained together. Methods that retrieve a single value + * or may return a primitive value will automatically end the chain sequence + * and return the unwrapped value. Otherwise, the value must be unwrapped + * with `_#value`. * - * @private - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. + * Explicit chain sequences, which must be unwrapped with `_#value`, may be + * enabled using `_.chain`. + * + * The execution of chained methods is lazy, that is, it's deferred until + * `_#value` is implicitly or explicitly called. + * + * Lazy evaluation allows several methods to support shortcut fusion. + * Shortcut fusion is an optimization to merge iteratee calls; this avoids + * the creation of intermediate arrays and can greatly reduce the number of + * iteratee executions. Sections of a chain sequence qualify for shortcut + * fusion if the section is applied to an array and iteratees accept only + * one argument. The heuristic for whether a section qualifies for shortcut + * fusion is subject to change. + * + * Chaining is supported in custom builds as long as the `_#value` method is + * directly or indirectly included in the build. + * + * In addition to lodash methods, wrappers have `Array` and `String` methods. + * + * The wrapper `Array` methods are: + * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` + * + * The wrapper `String` methods are: + * `replace` and `split` + * + * The wrapper methods that support shortcut fusion are: + * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, + * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, + * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` + * + * The chainable wrapper methods are: + * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, + * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, + * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, + * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, + * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, + * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, + * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, + * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, + * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, + * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, + * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, + * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, + * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, + * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, + * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, + * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, + * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, + * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, + * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, + * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, + * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, + * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, + * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, + * `zipObject`, `zipObjectDeep`, and `zipWith` + * + * The wrapper methods that are **not** chainable by default are: + * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, + * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, + * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, + * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, + * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, + * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, + * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, + * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, + * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, + * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, + * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, + * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, + * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, + * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, + * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, + * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, + * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, + * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, + * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, + * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, + * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, + * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, + * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, + * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, + * `upperFirst`, `value`, and `words` + * + * @name _ + * @constructor + * @category Seq + * @param {*} value The value to wrap in a `lodash` instance. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2, 3]); + * + * // Returns an unwrapped value. + * wrapped.reduce(_.add); + * // => 6 + * + * // Returns a wrapped value. + * var squares = wrapped.map(square); + * + * _.isArray(squares); + * // => false + * + * _.isArray(squares.value()); + * // => true */ - function objectToString(value) { - return nativeObjectToString.call(value); + function lodash(value) { + if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { + if (value instanceof LodashWrapper) { + return value; + } + if (hasOwnProperty.call(value, '__wrapped__')) { + return wrapperClone(value); + } + } + return new LodashWrapper(value); } /** - * A specialized version of `baseRest` which transforms the rest array. + * The base implementation of `_.create` without support for assigning + * properties to the created object. * * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @param {Function} transform The rest array transform. - * @returns {Function} Returns the new function. + * @param {Object} proto The object to inherit from. + * @returns {Object} Returns the new object. */ - function overRest(func, start, transform) { - start = nativeMax(start === undefined ? (func.length - 1) : start, 0); - return function() { - var args = arguments, - index = -1, - length = nativeMax(args.length - start, 0), - array = Array(length); - - while (++index < length) { - array[index] = args[start + index]; + var baseCreate = (function() { + function object() {} + return function(proto) { + if (!isObject(proto)) { + return {}; } - index = -1; - var otherArgs = Array(start + 1); - while (++index < start) { - otherArgs[index] = args[index]; + if (objectCreate) { + return objectCreate(proto); } - otherArgs[start] = transform(array); - return apply(func, this, otherArgs); + object.prototype = proto; + var result = new object; + object.prototype = undefined; + return result; }; - } + }()); /** - * Gets the parent value at `path` of `object`. + * The function whose prototype chain sequence wrappers inherit from. * * @private - * @param {Object} object The object to query. - * @param {Array} path The path to get the parent value of. - * @returns {*} Returns the parent value. */ - function parent(object, path) { - return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); + function baseLodash() { + // No operation performed. } /** - * Reorder `array` according to the specified indexes where the element at - * the first index is assigned as the first element, the element at - * the second index is assigned as the second element, and so on. + * The base constructor for creating `lodash` wrapper objects. * * @private - * @param {Array} array The array to reorder. - * @param {Array} indexes The arranged array indexes. - * @returns {Array} Returns `array`. + * @param {*} value The value to wrap. + * @param {boolean} [chainAll] Enable explicit method chain sequences. */ - function reorder(array, indexes) { - var arrLength = array.length, - length = nativeMin(indexes.length, arrLength), - oldArray = copyArray(array); - - while (length--) { - var index = indexes[length]; - array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; - } - return array; + function LodashWrapper(value, chainAll) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__chain__ = !!chainAll; + this.__index__ = 0; + this.__values__ = undefined; } /** - * Sets metadata for `func`. - * - * **Note:** If this function becomes hot, i.e. is invoked a lot in a short - * period of time, it will trip its breaker and transition to an identity - * function to avoid garbage collection pauses in V8. See - * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) - * for more details. + * By default, the template delimiters used by lodash are like those in + * embedded Ruby (ERB) as well as ES2015 template strings. Change the + * following template settings to use alternative delimiters. * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. + * @static + * @memberOf _ + * @type {Object} */ - var setData = shortOut(baseSetData); + lodash.templateSettings = { + + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'escape': reEscape, + + /** + * Used to detect code to be evaluated. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'evaluate': reEvaluate, + + /** + * Used to detect `data` property values to inject. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'interpolate': reInterpolate, + + /** + * Used to reference the data object in the template text. + * + * @memberOf _.templateSettings + * @type {string} + */ + 'variable': '', + + /** + * Used to import variables into the compiled template. + * + * @memberOf _.templateSettings + * @type {Object} + */ + 'imports': { + + /** + * A reference to the `lodash` function. + * + * @memberOf _.templateSettings.imports + * @type {Function} + */ + '_': lodash + } + }; + + // Ensure wrappers are instances of `baseLodash`. + lodash.prototype = baseLodash.prototype; + lodash.prototype.constructor = lodash; + + LodashWrapper.prototype = baseCreate(baseLodash.prototype); + LodashWrapper.prototype.constructor = LodashWrapper; + + /*------------------------------------------------------------------------*/ /** - * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). + * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. * * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @returns {number|Object} Returns the timer id or timeout object. + * @constructor + * @param {*} value The value to wrap. */ - var setTimeout = ctxSetTimeout || function(func, wait) { - return root.setTimeout(func, wait); - }; + function LazyWrapper(value) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__dir__ = 1; + this.__filtered__ = false; + this.__iteratees__ = []; + this.__takeCount__ = MAX_ARRAY_LENGTH; + this.__views__ = []; + } /** - * Sets the `toString` method of `func` to return `string`. + * Creates a clone of the lazy wrapper object. * * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. + * @name clone + * @memberOf LazyWrapper + * @returns {Object} Returns the cloned `LazyWrapper` object. */ - var setToString = shortOut(baseSetToString); + function lazyClone() { + var result = new LazyWrapper(this.__wrapped__); + result.__actions__ = copyArray(this.__actions__); + result.__dir__ = this.__dir__; + result.__filtered__ = this.__filtered__; + result.__iteratees__ = copyArray(this.__iteratees__); + result.__takeCount__ = this.__takeCount__; + result.__views__ = copyArray(this.__views__); + return result; + } /** - * Sets the `toString` method of `wrapper` to mimic the source of `reference` - * with wrapper details in a comment at the top of the source body. + * Reverses the direction of lazy iteration. * * @private - * @param {Function} wrapper The function to modify. - * @param {Function} reference The reference function. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Function} Returns `wrapper`. + * @name reverse + * @memberOf LazyWrapper + * @returns {Object} Returns the new reversed `LazyWrapper` object. */ - function setWrapToString(wrapper, reference, bitmask) { - var source = (reference + ''); - return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); + function lazyReverse() { + if (this.__filtered__) { + var result = new LazyWrapper(this); + result.__dir__ = -1; + result.__filtered__ = true; + } else { + result = this.clone(); + result.__dir__ *= -1; + } + return result; } /** - * Creates a function that'll short out and invoke `identity` instead - * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` - * milliseconds. + * Extracts the unwrapped value from its lazy wrapper. * * @private - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new shortable function. + * @name value + * @memberOf LazyWrapper + * @returns {*} Returns the unwrapped value. */ - function shortOut(func) { - var count = 0, - lastCalled = 0; + function lazyValue() { + var array = this.__wrapped__.value(), + dir = this.__dir__, + isArr = isArray(array), + isRight = dir < 0, + arrLength = isArr ? array.length : 0, + view = getView(0, arrLength, this.__views__), + start = view.start, + end = view.end, + length = end - start, + index = isRight ? end : (start - 1), + iteratees = this.__iteratees__, + iterLength = iteratees.length, + resIndex = 0, + takeCount = nativeMin(length, this.__takeCount__); - return function() { - var stamp = nativeNow(), - remaining = HOT_SPAN - (stamp - lastCalled); + if (!isArr || (!isRight && arrLength == length && takeCount == length)) { + return baseWrapperValue(array, this.__actions__); + } + var result = []; - lastCalled = stamp; - if (remaining > 0) { - if (++count >= HOT_COUNT) { - return arguments[0]; + outer: + while (length-- && resIndex < takeCount) { + index += dir; + + var iterIndex = -1, + value = array[index]; + + while (++iterIndex < iterLength) { + var data = iteratees[iterIndex], + iteratee = data.iteratee, + type = data.type, + computed = iteratee(value); + + if (type == LAZY_MAP_FLAG) { + value = computed; + } else if (!computed) { + if (type == LAZY_FILTER_FLAG) { + continue outer; + } else { + break outer; + } } - } else { - count = 0; } - return func.apply(undefined, arguments); - }; + result[resIndex++] = value; + } + return result; } + // Ensure `LazyWrapper` is an instance of `baseLodash`. + LazyWrapper.prototype = baseCreate(baseLodash.prototype); + LazyWrapper.prototype.constructor = LazyWrapper; + + /*------------------------------------------------------------------------*/ + /** - * A specialized version of `_.shuffle` which mutates and sets the size of `array`. + * Creates a hash object. * * @private - * @param {Array} array The array to shuffle. - * @param {number} [size=array.length] The size of `array`. - * @returns {Array} Returns `array`. + * @constructor + * @param {Array} [entries] The key-value pairs to cache. */ - function shuffleSelf(array, size) { + function Hash(entries) { var index = -1, - length = array.length, - lastIndex = length - 1; - - size = size === undefined ? length : size; - while (++index < size) { - var rand = baseRandom(index, lastIndex), - value = array[rand]; + length = entries == null ? 0 : entries.length; - array[rand] = array[index]; - array[index] = value; + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); } - array.length = size; - return array; } /** - * Converts `string` to a property path array. + * Removes all key-value entries from the hash. * * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the property path array. + * @name clear + * @memberOf Hash */ - var stringToPath = memoizeCapped(function(string) { - var result = []; - if (reLeadingDot.test(string)) { - result.push(''); - } - string.replace(rePropName, function(match, number, quote, string) { - result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match)); - }); - return result; - }); + function hashClear() { + this.__data__ = nativeCreate ? nativeCreate(null) : {}; + this.size = 0; + } /** - * Converts `value` to a string key if it's not a string or symbol. + * Removes `key` and its value from the hash. * * @private - * @param {*} value The value to inspect. - * @returns {string|symbol} Returns the key. + * @name delete + * @memberOf Hash + * @param {Object} hash The hash to modify. + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ - function toKey(value) { - if (typeof value == 'string' || isSymbol(value)) { - return value; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + function hashDelete(key) { + var result = this.has(key) && delete this.__data__[key]; + this.size -= result ? 1 : 0; + return result; } /** - * Converts `func` to its source code. + * Gets the hash value for `key`. * * @private - * @param {Function} func The function to convert. - * @returns {string} Returns the source code. + * @name get + * @memberOf Hash + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. */ - function toSource(func) { - if (func != null) { - try { - return funcToString.call(func); - } catch (e) {} - try { - return (func + ''); - } catch (e) {} + function hashGet(key) { + var data = this.__data__; + if (nativeCreate) { + var result = data[key]; + return result === HASH_UNDEFINED ? undefined : result; } - return ''; + return hasOwnProperty.call(data, key) ? data[key] : undefined; } /** - * Updates wrapper `details` based on `bitmask` flags. + * Checks if a hash value for `key` exists. * * @private - * @returns {Array} details The details to modify. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Array} Returns `details`. + * @name has + * @memberOf Hash + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ - function updateWrapDetails(details, bitmask) { - arrayEach(wrapFlags, function(pair) { - var value = '_.' + pair[0]; - if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { - details.push(value); - } - }); - return details.sort(); + function hashHas(key) { + var data = this.__data__; + return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); } /** - * Creates a clone of `wrapper`. + * Sets the hash `key` to `value`. * * @private - * @param {Object} wrapper The wrapper to clone. - * @returns {Object} Returns the cloned wrapper. + * @name set + * @memberOf Hash + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the hash instance. */ - function wrapperClone(wrapper) { - if (wrapper instanceof LazyWrapper) { - return wrapper.clone(); - } - var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); - result.__actions__ = copyArray(wrapper.__actions__); - result.__index__ = wrapper.__index__; - result.__values__ = wrapper.__values__; - return result; + function hashSet(key, value) { + var data = this.__data__; + this.size += this.has(key) ? 0 : 1; + data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; + return this; } + // Add methods to `Hash`. + Hash.prototype.clear = hashClear; + Hash.prototype['delete'] = hashDelete; + Hash.prototype.get = hashGet; + Hash.prototype.has = hashHas; + Hash.prototype.set = hashSet; + /*------------------------------------------------------------------------*/ /** - * Creates an array of elements split into groups the length of `size`. - * If `array` can't be split evenly, the final chunk will be the remaining - * elements. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to process. - * @param {number} [size=1] The length of each chunk - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the new array of chunks. - * @example - * - * _.chunk(['a', 'b', 'c', 'd'], 2); - * // => [['a', 'b'], ['c', 'd']] + * Creates an list cache object. * - * _.chunk(['a', 'b', 'c', 'd'], 3); - * // => [['a', 'b', 'c'], ['d']] + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. */ - function chunk(array, size, guard) { - if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { - size = 1; - } else { - size = nativeMax(toInteger(size), 0); - } - var length = array == null ? 0 : array.length; - if (!length || size < 1) { - return []; - } - var index = 0, - resIndex = 0, - result = Array(nativeCeil(length / size)); + function ListCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; - while (index < length) { - result[resIndex++] = baseSlice(array, index, (index += size)); + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); } - return result; } /** - * Creates an array with all falsey values removed. The values `false`, `null`, - * `0`, `""`, `undefined`, and `NaN` are falsey. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to compact. - * @returns {Array} Returns the new array of filtered values. - * @example + * Removes all key-value entries from the list cache. * - * _.compact([0, 1, false, 2, '', 3]); - * // => [1, 2, 3] + * @private + * @name clear + * @memberOf ListCache */ - function compact(array) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; + function listCacheClear() { + this.__data__ = []; + this.size = 0; + } - while (++index < length) { - var value = array[index]; - if (value) { - result[resIndex++] = value; - } + /** + * Removes `key` and its value from the list cache. + * + * @private + * @name delete + * @memberOf ListCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function listCacheDelete(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + return false; } - return result; + var lastIndex = data.length - 1; + if (index == lastIndex) { + data.pop(); + } else { + splice.call(data, index, 1); + } + --this.size; + return true; } /** - * Creates a new array concatenating `array` with any additional arrays - * and/or values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to concatenate. - * @param {...*} [values] The values to concatenate. - * @returns {Array} Returns the new concatenated array. - * @example - * - * var array = [1]; - * var other = _.concat(array, 2, [3], [[4]]); - * - * console.log(other); - * // => [1, 2, 3, [4]] + * Gets the list cache value for `key`. * - * console.log(array); - * // => [1] + * @private + * @name get + * @memberOf ListCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. */ - function concat() { - var length = arguments.length; - if (!length) { - return []; - } - var args = Array(length - 1), - array = arguments[0], - index = length; + function listCacheGet(key) { + var data = this.__data__, + index = assocIndexOf(data, key); - while (index--) { - args[index - 1] = arguments[index]; - } - return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); + return index < 0 ? undefined : data[index][1]; } /** - * Creates an array of `array` values not included in the other given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * **Note:** Unlike `_.pullAll`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.without, _.xor - * @example + * Checks if a list cache value for `key` exists. * - * _.difference([2, 1], [2, 3]); - * // => [1] + * @private + * @name has + * @memberOf ListCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ - var difference = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) - : []; - }); + function listCacheHas(key) { + return assocIndexOf(this.__data__, key) > -1; + } /** - * This method is like `_.difference` except that it accepts `iteratee` which - * is invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * **Note:** Unlike `_.pullAllBy`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2] + * Sets the list cache `key` to `value`. * - * // The `_.property` iteratee shorthand. - * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] + * @private + * @name set + * @memberOf ListCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the list cache instance. */ - var differenceBy = baseRest(function(array, values) { - var iteratee = last(values); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; + function listCacheSet(key, value) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + ++this.size; + data.push([key, value]); + } else { + data[index][1] = value; } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) - : []; - }); + return this; + } + + // Add methods to `ListCache`. + ListCache.prototype.clear = listCacheClear; + ListCache.prototype['delete'] = listCacheDelete; + ListCache.prototype.get = listCacheGet; + ListCache.prototype.has = listCacheHas; + ListCache.prototype.set = listCacheSet; + + /*------------------------------------------------------------------------*/ /** - * This method is like `_.difference` except that it accepts `comparator` - * which is invoked to compare elements of `array` to `values`. The order and - * references of result values are determined by the first array. The comparator - * is invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.pullAllWith`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * Creates a map cache object to store key-value pairs. * - * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); - * // => [{ 'x': 2, 'y': 1 }] + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. */ - var differenceWith = baseRest(function(array, values) { - var comparator = last(values); - if (isArrayLikeObject(comparator)) { - comparator = undefined; + function MapCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) - : []; - }); + } /** - * Creates a slice of `array` with `n` elements dropped from the beginning. - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.drop([1, 2, 3]); - * // => [2, 3] - * - * _.drop([1, 2, 3], 2); - * // => [3] - * - * _.drop([1, 2, 3], 5); - * // => [] + * Removes all key-value entries from the map. * - * _.drop([1, 2, 3], 0); - * // => [1, 2, 3] + * @private + * @name clear + * @memberOf MapCache */ - function drop(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, n < 0 ? 0 : n, length); + function mapCacheClear() { + this.size = 0; + this.__data__ = { + 'hash': new Hash, + 'map': new (Map || ListCache), + 'string': new Hash + }; } /** - * Creates a slice of `array` with `n` elements dropped from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.dropRight([1, 2, 3]); - * // => [1, 2] - * - * _.dropRight([1, 2, 3], 2); - * // => [1] - * - * _.dropRight([1, 2, 3], 5); - * // => [] + * Removes `key` and its value from the map. * - * _.dropRight([1, 2, 3], 0); - * // => [1, 2, 3] + * @private + * @name delete + * @memberOf MapCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ - function dropRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, 0, n < 0 ? 0 : n); + function mapCacheDelete(key) { + var result = getMapData(this, key)['delete'](key); + this.size -= result ? 1 : 0; + return result; } /** - * Creates a slice of `array` excluding elements dropped from the end. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.dropRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney'] - * - * // The `_.matches` iteratee shorthand. - * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropRightWhile(users, ['active', false]); - * // => objects for ['barney'] + * Gets the map value for `key`. * - * // The `_.property` iteratee shorthand. - * _.dropRightWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] + * @private + * @name get + * @memberOf MapCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. */ - function dropRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true, true) - : []; + function mapCacheGet(key) { + return getMapData(this, key).get(key); } /** - * Creates a slice of `array` excluding elements dropped from the beginning. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.dropWhile(users, function(o) { return !o.active; }); - * // => objects for ['pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.dropWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropWhile(users, ['active', false]); - * // => objects for ['pebbles'] + * Checks if a map value for `key` exists. * - * // The `_.property` iteratee shorthand. - * _.dropWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] + * @private + * @name has + * @memberOf MapCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ - function dropWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true) - : []; + function mapCacheHas(key) { + return getMapData(this, key).has(key); } /** - * Fills elements of `array` with `value` from `start` up to, but not - * including, `end`. - * - * **Note:** This method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Array - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.fill(array, 'a'); - * console.log(array); - * // => ['a', 'a', 'a'] - * - * _.fill(Array(3), 2); - * // => [2, 2, 2] + * Sets the map `key` to `value`. * - * _.fill([4, 6, 8, 10], '*', 1, 3); - * // => [4, '*', '*', 10] + * @private + * @name set + * @memberOf MapCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the map cache instance. */ - function fill(array, value, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { - start = 0; - end = length; - } - return baseFill(array, value, start, end); + function mapCacheSet(key, value) { + var data = getMapData(this, key), + size = data.size; + + data.set(key, value); + this.size += data.size == size ? 0 : 1; + return this; } + // Add methods to `MapCache`. + MapCache.prototype.clear = mapCacheClear; + MapCache.prototype['delete'] = mapCacheDelete; + MapCache.prototype.get = mapCacheGet; + MapCache.prototype.has = mapCacheHas; + MapCache.prototype.set = mapCacheSet; + + /*------------------------------------------------------------------------*/ + /** - * This method is like `_.find` except that it returns the index of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.findIndex(users, function(o) { return o.user == 'barney'; }); - * // => 0 - * - * // The `_.matches` iteratee shorthand. - * _.findIndex(users, { 'user': 'fred', 'active': false }); - * // => 1 * - * // The `_.matchesProperty` iteratee shorthand. - * _.findIndex(users, ['active', false]); - * // => 0 + * Creates an array cache object to store unique values. * - * // The `_.property` iteratee shorthand. - * _.findIndex(users, 'active'); - * // => 2 + * @private + * @constructor + * @param {Array} [values] The values to cache. */ - function findIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); + function SetCache(values) { + var index = -1, + length = values == null ? 0 : values.length; + + this.__data__ = new MapCache; + while (++index < length) { + this.add(values[index]); } - return baseFindIndex(array, getIteratee(predicate, 3), index); } /** - * This method is like `_.findIndex` except that it iterates over elements - * of `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); - * // => 2 - * - * // The `_.matches` iteratee shorthand. - * _.findLastIndex(users, { 'user': 'barney', 'active': true }); - * // => 0 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastIndex(users, ['active', false]); - * // => 2 + * Adds `value` to the array cache. * - * // The `_.property` iteratee shorthand. - * _.findLastIndex(users, 'active'); - * // => 0 + * @private + * @name add + * @memberOf SetCache + * @alias push + * @param {*} value The value to cache. + * @returns {Object} Returns the cache instance. */ - function findLastIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length - 1; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = fromIndex < 0 - ? nativeMax(length + index, 0) - : nativeMin(index, length - 1); - } - return baseFindIndex(array, getIteratee(predicate, 3), index, true); + function setCacheAdd(value) { + this.__data__.set(value, HASH_UNDEFINED); + return this; } /** - * Flattens `array` a single level deep. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example + * Checks if `value` is in the array cache. * - * _.flatten([1, [2, [3, [4]], 5]]); - * // => [1, 2, [3, [4]], 5] + * @private + * @name has + * @memberOf SetCache + * @param {*} value The value to search for. + * @returns {number} Returns `true` if `value` is found, else `false`. */ - function flatten(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, 1) : []; + function setCacheHas(value) { + return this.__data__.has(value); } + // Add methods to `SetCache`. + SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; + SetCache.prototype.has = setCacheHas; + + /*------------------------------------------------------------------------*/ + /** - * Recursively flattens `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example + * Creates a stack cache object to store key-value pairs. * - * _.flattenDeep([1, [2, [3, [4]], 5]]); - * // => [1, 2, 3, 4, 5] + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. */ - function flattenDeep(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, INFINITY) : []; + function Stack(entries) { + var data = this.__data__ = new ListCache(entries); + this.size = data.size; } /** - * Recursively flatten `array` up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Array - * @param {Array} array The array to flatten. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * var array = [1, [2, [3, [4]], 5]]; - * - * _.flattenDepth(array, 1); - * // => [1, 2, [3, [4]], 5] + * Removes all key-value entries from the stack. * - * _.flattenDepth(array, 2); - * // => [1, 2, 3, [4], 5] + * @private + * @name clear + * @memberOf Stack */ - function flattenDepth(array, depth) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(array, depth); + function stackClear() { + this.__data__ = new ListCache; + this.size = 0; } /** - * The inverse of `_.toPairs`; this method returns an object composed - * from key-value `pairs`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} pairs The key-value pairs. - * @returns {Object} Returns the new object. - * @example + * Removes `key` and its value from the stack. * - * _.fromPairs([['a', 1], ['b', 2]]); - * // => { 'a': 1, 'b': 2 } + * @private + * @name delete + * @memberOf Stack + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ - function fromPairs(pairs) { - var index = -1, - length = pairs == null ? 0 : pairs.length, - result = {}; + function stackDelete(key) { + var data = this.__data__, + result = data['delete'](key); - while (++index < length) { - var pair = pairs[index]; - result[pair[0]] = pair[1]; - } + this.size = data.size; return result; } /** - * Gets the first element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias first - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the first element of `array`. - * @example - * - * _.head([1, 2, 3]); - * // => 1 + * Gets the stack value for `key`. * - * _.head([]); - * // => undefined + * @private + * @name get + * @memberOf Stack + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. */ - function head(array) { - return (array && array.length) ? array[0] : undefined; + function stackGet(key) { + return this.__data__.get(key); } /** - * Gets the index at which the first occurrence of `value` is found in `array` - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. If `fromIndex` is negative, it's used as the - * offset from the end of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example + * Checks if a stack value for `key` exists. * - * _.indexOf([1, 2, 1, 2], 2); - * // => 1 + * @private + * @name has + * @memberOf Stack + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function stackHas(key) { + return this.__data__.has(key); + } + + /** + * Sets the stack `key` to `value`. * - * // Search from the `fromIndex`. - * _.indexOf([1, 2, 1, 2], 2, 2); - * // => 3 + * @private + * @name set + * @memberOf Stack + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the stack cache instance. */ - function indexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); + function stackSet(key, value) { + var data = this.__data__; + if (data instanceof ListCache) { + var pairs = data.__data__; + if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { + pairs.push([key, value]); + this.size = ++data.size; + return this; + } + data = this.__data__ = new MapCache(pairs); } - return baseIndexOf(array, value, index); + data.set(key, value); + this.size = data.size; + return this; } + // Add methods to `Stack`. + Stack.prototype.clear = stackClear; + Stack.prototype['delete'] = stackDelete; + Stack.prototype.get = stackGet; + Stack.prototype.has = stackHas; + Stack.prototype.set = stackSet; + + /*------------------------------------------------------------------------*/ + /** - * Gets all but the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example + * Creates an array of the enumerable property names of the array-like `value`. * - * _.initial([1, 2, 3]); - * // => [1, 2] + * @private + * @param {*} value The value to query. + * @param {boolean} inherited Specify returning inherited property names. + * @returns {Array} Returns the array of property names. */ - function initial(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 0, -1) : []; + function arrayLikeKeys(value, inherited) { + var isArr = isArray(value), + isArg = !isArr && isArguments(value), + isBuff = !isArr && !isArg && isBuffer(value), + isType = !isArr && !isArg && !isBuff && isTypedArray(value), + skipIndexes = isArr || isArg || isBuff || isType, + result = skipIndexes ? baseTimes(value.length, String) : [], + length = result.length; + + for (var key in value) { + if ((inherited || hasOwnProperty.call(value, key)) && + !(skipIndexes && ( + // Safari 9 has enumerable `arguments.length` in strict mode. + key == 'length' || + // Node.js 0.10 has enumerable non-index properties on buffers. + (isBuff && (key == 'offset' || key == 'parent')) || + // PhantomJS 2 has enumerable non-index properties on typed arrays. + (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || + // Skip index properties. + isIndex(key, length) + ))) { + result.push(key); + } + } + return result; } /** - * Creates an array of unique values that are included in all given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of intersecting values. - * @example + * A specialized version of `_.sample` for arrays. * - * _.intersection([2, 1], [2, 3]); - * // => [2] + * @private + * @param {Array} array The array to sample. + * @returns {*} Returns the random element. */ - var intersection = baseRest(function(arrays) { - var mapped = arrayMap(arrays, castArrayLikeObject); - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped) - : []; - }); + function arraySample(array) { + var length = array.length; + return length ? array[baseRandom(0, length - 1)] : undefined; + } /** - * This method is like `_.intersection` except that it accepts `iteratee` - * which is invoked for each element of each `arrays` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [2.1] + * A specialized version of `_.sampleSize` for arrays. * - * // The `_.property` iteratee shorthand. - * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }] + * @private + * @param {Array} array The array to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. */ - var intersectionBy = baseRest(function(arrays) { - var iteratee = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); - - if (iteratee === last(mapped)) { - iteratee = undefined; - } else { - mapped.pop(); - } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, getIteratee(iteratee, 2)) - : []; - }); + function arraySampleSize(array, n) { + return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); + } /** - * This method is like `_.intersection` except that it accepts `comparator` - * which is invoked to compare elements of `arrays`. The order and references - * of result values are determined by the first array. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * A specialized version of `_.shuffle` for arrays. * - * _.intersectionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }] + * @private + * @param {Array} array The array to shuffle. + * @returns {Array} Returns the new shuffled array. */ - var intersectionWith = baseRest(function(arrays) { - var comparator = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); - - comparator = typeof comparator == 'function' ? comparator : undefined; - if (comparator) { - mapped.pop(); - } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, undefined, comparator) - : []; - }); + function arrayShuffle(array) { + return shuffleSelf(copyArray(array)); + } /** - * Converts all elements in `array` into a string separated by `separator`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to convert. - * @param {string} [separator=','] The element separator. - * @returns {string} Returns the joined string. - * @example + * This function is like `assignValue` except that it doesn't assign + * `undefined` values. * - * _.join(['a', 'b', 'c'], '~'); - * // => 'a~b~c' + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. */ - function join(array, separator) { - return array == null ? '' : nativeJoin.call(array, separator); + function assignMergeValue(object, key, value) { + if ((value !== undefined && !eq(object[key], value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } } /** - * Gets the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the last element of `array`. - * @example + * Assigns `value` to `key` of `object` if the existing value is not equivalent + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. * - * _.last([1, 2, 3]); - * // => 3 + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. */ - function last(array) { - var length = array == null ? 0 : array.length; - return length ? array[length - 1] : undefined; + function assignValue(object, key, value) { + var objValue = object[key]; + if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } } /** - * This method is like `_.indexOf` except that it iterates over elements of - * `array` from right to left. + * Gets the index at which the `key` is found in `array` of key-value pairs. * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array + * @private * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=array.length-1] The index to search from. + * @param {*} key The key to search for. * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.lastIndexOf([1, 2, 1, 2], 2); - * // => 3 - * - * // Search from the `fromIndex`. - * _.lastIndexOf([1, 2, 1, 2], 2, 2); - * // => 1 */ - function lastIndexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); + function assocIndexOf(array, key) { + var length = array.length; + while (length--) { + if (eq(array[length][0], key)) { + return length; + } } - return value === value - ? strictLastIndexOf(array, value, index) - : baseFindIndex(array, baseIsNaN, index, true); + return -1; } /** - * Gets the element at index `n` of `array`. If `n` is negative, the nth - * element from the end is returned. - * - * @static - * @memberOf _ - * @since 4.11.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=0] The index of the element to return. - * @returns {*} Returns the nth element of `array`. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * - * _.nth(array, 1); - * // => 'b' + * Aggregates elements of `collection` on `accumulator` with keys transformed + * by `iteratee` and values set by `setter`. * - * _.nth(array, -2); - * // => 'c'; + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. */ - function nth(array, n) { - return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; + function baseAggregator(collection, setter, iteratee, accumulator) { + baseEach(collection, function(value, key, collection) { + setter(accumulator, value, iteratee(value), collection); + }); + return accumulator; } /** - * Removes all given values from `array` using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` - * to remove elements from an array by predicate. + * The base implementation of `_.assign` without support for multiple sources + * or `customizer` functions. * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...*} [values] The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; - * - * _.pull(array, 'a', 'c'); - * console.log(array); - * // => ['b', 'b'] + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. */ - var pull = baseRest(pullAll); + function baseAssign(object, source) { + return object && copyObject(source, keys(source), object); + } /** - * This method is like `_.pull` except that it accepts an array of values to remove. - * - * **Note:** Unlike `_.difference`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * The base implementation of `_.assignIn` without support for multiple sources + * or `customizer` functions. * - * _.pullAll(array, ['a', 'c']); - * console.log(array); - * // => ['b', 'b'] + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. */ - function pullAll(array, values) { - return (array && array.length && values && values.length) - ? basePullAll(array, values) - : array; + function baseAssignIn(object, source) { + return object && copyObject(source, keysIn(source), object); } /** - * This method is like `_.pullAll` except that it accepts `iteratee` which is - * invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The iteratee is invoked with one argument: (value). - * - * **Note:** Unlike `_.differenceBy`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; + * The base implementation of `assignValue` and `assignMergeValue` without + * value checks. * - * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); - * console.log(array); - * // => [{ 'x': 2 }] + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. */ - function pullAllBy(array, values, iteratee) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, getIteratee(iteratee, 2)) - : array; + function baseAssignValue(object, key, value) { + if (key == '__proto__' && defineProperty) { + defineProperty(object, key, { + 'configurable': true, + 'enumerable': true, + 'value': value, + 'writable': true + }); + } else { + object[key] = value; + } } /** - * This method is like `_.pullAll` except that it accepts `comparator` which - * is invoked to compare elements of `array` to `values`. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.differenceWith`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; + * The base implementation of `_.at` without support for individual paths. * - * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); - * console.log(array); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] + * @private + * @param {Object} object The object to iterate over. + * @param {string[]} paths The property paths to pick. + * @returns {Array} Returns the picked elements. */ - function pullAllWith(array, values, comparator) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, undefined, comparator) - : array; + function baseAt(object, paths) { + var index = -1, + length = paths.length, + result = Array(length), + skip = object == null; + + while (++index < length) { + result[index] = skip ? undefined : get(object, paths[index]); + } + return result; } /** - * Removes elements from `array` corresponding to `indexes` and returns an - * array of removed elements. - * - * **Note:** Unlike `_.at`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...(number|number[])} [indexes] The indexes of elements to remove. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * var pulled = _.pullAt(array, [1, 3]); + * The base implementation of `_.clamp` which doesn't coerce arguments. * - * console.log(array); - * // => ['a', 'c'] + * @private + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + */ + function baseClamp(number, lower, upper) { + if (number === number) { + if (upper !== undefined) { + number = number <= upper ? number : upper; + } + if (lower !== undefined) { + number = number >= lower ? number : lower; + } + } + return number; + } + + /** + * The base implementation of `_.clone` and `_.cloneDeep` which tracks + * traversed objects. * - * console.log(pulled); - * // => ['b', 'd'] + * @private + * @param {*} value The value to clone. + * @param {boolean} bitmask The bitmask flags. + * 1 - Deep clone + * 2 - Flatten inherited properties + * 4 - Clone symbols + * @param {Function} [customizer] The function to customize cloning. + * @param {string} [key] The key of `value`. + * @param {Object} [object] The parent object of `value`. + * @param {Object} [stack] Tracks traversed objects and their clone counterparts. + * @returns {*} Returns the cloned value. */ - var pullAt = flatRest(function(array, indexes) { - var length = array == null ? 0 : array.length, - result = baseAt(array, indexes); + function baseClone(value, bitmask, customizer, key, object, stack) { + var result, + isDeep = bitmask & CLONE_DEEP_FLAG, + isFlat = bitmask & CLONE_FLAT_FLAG, + isFull = bitmask & CLONE_SYMBOLS_FLAG; - basePullAt(array, arrayMap(indexes, function(index) { - return isIndex(index, length) ? +index : index; - }).sort(compareAscending)); + if (customizer) { + result = object ? customizer(value, key, object, stack) : customizer(value); + } + if (result !== undefined) { + return result; + } + if (!isObject(value)) { + return value; + } + var isArr = isArray(value); + if (isArr) { + result = initCloneArray(value); + if (!isDeep) { + return copyArray(value, result); + } + } else { + var tag = getTag(value), + isFunc = tag == funcTag || tag == genTag; + + if (isBuffer(value)) { + return cloneBuffer(value, isDeep); + } + if (tag == objectTag || tag == argsTag || (isFunc && !object)) { + result = (isFlat || isFunc) ? {} : initCloneObject(value); + if (!isDeep) { + return isFlat + ? copySymbolsIn(value, baseAssignIn(result, value)) + : copySymbols(value, baseAssign(result, value)); + } + } else { + if (!cloneableTags[tag]) { + return object ? value : {}; + } + result = initCloneByTag(value, tag, baseClone, isDeep); + } + } + // Check for circular references and return its corresponding clone. + stack || (stack = new Stack); + var stacked = stack.get(value); + if (stacked) { + return stacked; + } + stack.set(value, result); + + var keysFunc = isFull + ? (isFlat ? getAllKeysIn : getAllKeys) + : (isFlat ? keysIn : keys); + var props = isArr ? undefined : keysFunc(value); + arrayEach(props || value, function(subValue, key) { + if (props) { + key = subValue; + subValue = value[key]; + } + // Recursively populate clone (susceptible to call stack limits). + assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); + }); return result; - }); + } /** - * Removes all elements from `array` that `predicate` returns truthy for - * and returns an array of the removed elements. The predicate is invoked - * with three arguments: (value, index, array). - * - * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` - * to pull elements from an array by value. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = [1, 2, 3, 4]; - * var evens = _.remove(array, function(n) { - * return n % 2 == 0; - * }); + * The base implementation of `_.conforms` which doesn't clone `source`. * - * console.log(array); - * // => [1, 3] + * @private + * @param {Object} source The object of property predicates to conform to. + * @returns {Function} Returns the new spec function. + */ + function baseConforms(source) { + var props = keys(source); + return function(object) { + return baseConformsTo(object, source, props); + }; + } + + /** + * The base implementation of `_.conformsTo` which accepts `props` to check. * - * console.log(evens); - * // => [2, 4] + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. */ - function remove(array, predicate) { - var result = []; - if (!(array && array.length)) { - return result; + function baseConformsTo(object, source, props) { + var length = props.length; + if (object == null) { + return !length; } - var index = -1, - indexes = [], - length = array.length; + object = Object(object); + while (length--) { + var key = props[length], + predicate = source[key], + value = object[key]; - predicate = getIteratee(predicate, 3); - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result.push(value); - indexes.push(index); + if ((value === undefined && !(key in object)) || !predicate(value)) { + return false; } } - basePullAt(array, indexes); - return result; + return true; } /** - * Reverses `array` so that the first element becomes the last, the second - * element becomes the second to last, and so on. - * - * **Note:** This method mutates `array` and is based on - * [`Array#reverse`](https://mdn.io/Array/reverse). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.reverse(array); - * // => [3, 2, 1] + * The base implementation of `_.delay` and `_.defer` which accepts `args` + * to provide to `func`. * - * console.log(array); - * // => [3, 2, 1] + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {Array} args The arguments to provide to `func`. + * @returns {number|Object} Returns the timer id or timeout object. */ - function reverse(array) { - return array == null ? array : nativeReverse.call(array); + function baseDelay(func, wait, args) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return setTimeout(function() { func.apply(undefined, args); }, wait); } /** - * Creates a slice of `array` from `start` up to, but not including, `end`. - * - * **Note:** This method is used instead of - * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are - * returned. + * The base implementation of methods like `_.difference` without support + * for excluding multiple arrays or iteratee shorthands. * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. + * @private + * @param {Array} array The array to inspect. + * @param {Array} values The values to exclude. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. */ - function slice(array, start, end) { - var length = array == null ? 0 : array.length; + function baseDifference(array, values, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + isCommon = true, + length = array.length, + result = [], + valuesLength = values.length; + if (!length) { - return []; + return result; } - if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { - start = 0; - end = length; + if (iteratee) { + values = arrayMap(values, baseUnary(iteratee)); } - else { - start = start == null ? 0 : toInteger(start); - end = end === undefined ? length : toInteger(end); + if (comparator) { + includes = arrayIncludesWith; + isCommon = false; } - return baseSlice(array, start, end); + else if (values.length >= LARGE_ARRAY_SIZE) { + includes = cacheHas; + isCommon = false; + values = new SetCache(values); + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee == null ? value : iteratee(value); + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var valuesIndex = valuesLength; + while (valuesIndex--) { + if (values[valuesIndex] === computed) { + continue outer; + } + } + result.push(value); + } + else if (!includes(values, computed, comparator)) { + result.push(value); + } + } + return result; } /** - * Uses a binary search to determine the lowest index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example + * The base implementation of `_.forEach` without support for iteratee shorthands. * - * _.sortedIndex([30, 50], 40); - * // => 1 + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. */ - function sortedIndex(array, value) { - return baseSortedIndex(array, value); - } + var baseEach = createBaseEach(baseForOwn); /** - * This method is like `_.sortedIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * The base implementation of `_.forEachRight` without support for iteratee shorthands. * - * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 0 + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEachRight = createBaseEach(baseForOwnRight, true); + + /** + * The base implementation of `_.every` without support for iteratee shorthands. * - * // The `_.property` iteratee shorthand. - * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); - * // => 0 + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false` */ - function sortedIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); + function baseEvery(collection, predicate) { + var result = true; + baseEach(collection, function(value, index, collection) { + result = !!predicate(value, index, collection); + return result; + }); + return result; } /** - * This method is like `_.indexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example + * The base implementation of methods like `_.max` and `_.min` which accepts a + * `comparator` to determine the extremum value. * - * _.sortedIndexOf([4, 5, 5, 5, 6], 5); - * // => 1 + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The iteratee invoked per iteration. + * @param {Function} comparator The comparator used to compare values. + * @returns {*} Returns the extremum value. */ - function sortedIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value); - if (index < length && eq(array[index], value)) { - return index; + function baseExtremum(array, iteratee, comparator) { + var index = -1, + length = array.length; + + while (++index < length) { + var value = array[index], + current = iteratee(value); + + if (current != null && (computed === undefined + ? (current === current && !isSymbol(current)) + : comparator(current, computed) + )) { + var computed = current, + result = value; } } - return -1; + return result; } /** - * This method is like `_.sortedIndex` except that it returns the highest - * index at which `value` should be inserted into `array` in order to - * maintain its sort order. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example + * The base implementation of `_.fill` without an iteratee call guard. * - * _.sortedLastIndex([4, 5, 5, 5, 6], 5); - * // => 4 + * @private + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. */ - function sortedLastIndex(array, value) { - return baseSortedIndex(array, value, true); + function baseFill(array, value, start, end) { + var length = array.length; + + start = toInteger(start); + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = (end === undefined || end > length) ? length : toInteger(end); + if (end < 0) { + end += length; + } + end = start > end ? 0 : toLength(end); + while (start < end) { + array[start++] = value; + } + return array; } /** - * This method is like `_.sortedLastIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; - * - * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 1 + * The base implementation of `_.filter` without support for iteratee shorthands. * - * // The `_.property` iteratee shorthand. - * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); - * // => 1 + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. */ - function sortedLastIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); + function baseFilter(collection, predicate) { + var result = []; + baseEach(collection, function(value, index, collection) { + if (predicate(value, index, collection)) { + result.push(value); + } + }); + return result; } /** - * This method is like `_.lastIndexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example + * The base implementation of `_.flatten` with support for restricting flattening. * - * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); - * // => 3 + * @private + * @param {Array} array The array to flatten. + * @param {number} depth The maximum recursion depth. + * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. + * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. + * @param {Array} [result=[]] The initial result value. + * @returns {Array} Returns the new flattened array. */ - function sortedLastIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value, true) - 1; - if (eq(array[index], value)) { - return index; + function baseFlatten(array, depth, predicate, isStrict, result) { + var index = -1, + length = array.length; + + predicate || (predicate = isFlattenable); + result || (result = []); + + while (++index < length) { + var value = array[index]; + if (depth > 0 && predicate(value)) { + if (depth > 1) { + // Recursively flatten arrays (susceptible to call stack limits). + baseFlatten(value, depth - 1, predicate, isStrict, result); + } else { + arrayPush(result, value); + } + } else if (!isStrict) { + result[result.length] = value; } } - return -1; + return result; } /** - * This method is like `_.uniq` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example + * The base implementation of `baseForOwn` which iterates over `object` + * properties returned by `keysFunc` and invokes `iteratee` for each property. + * Iteratee functions may exit iteration early by explicitly returning `false`. * - * _.sortedUniq([1, 1, 2]); - * // => [1, 2] + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. */ - function sortedUniq(array) { - return (array && array.length) - ? baseSortedUniq(array) - : []; - } + var baseFor = createBaseFor(); /** - * This method is like `_.uniqBy` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example + * This function is like `baseFor` except that it iterates over properties + * in the opposite order. * - * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); - * // => [1.1, 2.3] + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. */ - function sortedUniqBy(array, iteratee) { - return (array && array.length) - ? baseSortedUniq(array, getIteratee(iteratee, 2)) - : []; - } + var baseForRight = createBaseFor(true); /** - * Gets all but the first element of `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example + * The base implementation of `_.forOwn` without support for iteratee shorthands. * - * _.tail([1, 2, 3]); - * // => [2, 3] + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. */ - function tail(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 1, length) : []; + function baseForOwn(object, iteratee) { + return object && baseFor(object, iteratee, keys); } /** - * Creates a slice of `array` with `n` elements taken from the beginning. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.take([1, 2, 3]); - * // => [1] - * - * _.take([1, 2, 3], 2); - * // => [1, 2] - * - * _.take([1, 2, 3], 5); - * // => [1, 2, 3] + * The base implementation of `_.forOwnRight` without support for iteratee shorthands. * - * _.take([1, 2, 3], 0); - * // => [] + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. */ - function take(array, n, guard) { - if (!(array && array.length)) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, 0, n < 0 ? 0 : n); + function baseForOwnRight(object, iteratee) { + return object && baseForRight(object, iteratee, keys); } /** - * Creates a slice of `array` with `n` elements taken from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.takeRight([1, 2, 3]); - * // => [3] - * - * _.takeRight([1, 2, 3], 2); - * // => [2, 3] - * - * _.takeRight([1, 2, 3], 5); - * // => [1, 2, 3] + * The base implementation of `_.functions` which creates an array of + * `object` function property names filtered from `props`. * - * _.takeRight([1, 2, 3], 0); - * // => [] + * @private + * @param {Object} object The object to inspect. + * @param {Array} props The property names to filter. + * @returns {Array} Returns the function names. */ - function takeRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, n < 0 ? 0 : n, length); + function baseFunctions(object, props) { + return arrayFilter(props, function(key) { + return isFunction(object[key]); + }); } /** - * Creates a slice of `array` with elements taken from the end. Elements are - * taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.takeRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeRightWhile(users, ['active', false]); - * // => objects for ['fred', 'pebbles'] + * The base implementation of `_.get` without support for default values. * - * // The `_.property` iteratee shorthand. - * _.takeRightWhile(users, 'active'); - * // => [] + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @returns {*} Returns the resolved value. */ - function takeRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), false, true) - : []; + function baseGet(object, path) { + path = castPath(path, object); + + var index = 0, + length = path.length; + + while (object != null && index < length) { + object = object[toKey(path[index++])]; + } + return (index && index == length) ? object : undefined; } /** - * Creates a slice of `array` with elements taken from the beginning. Elements - * are taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.takeWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matches` iteratee shorthand. - * _.takeWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeWhile(users, ['active', false]); - * // => objects for ['barney', 'fred'] + * The base implementation of `getAllKeys` and `getAllKeysIn` which uses + * `keysFunc` and `symbolsFunc` to get the enumerable property names and + * symbols of `object`. * - * // The `_.property` iteratee shorthand. - * _.takeWhile(users, 'active'); - * // => [] + * @private + * @param {Object} object The object to query. + * @param {Function} keysFunc The function to get the keys of `object`. + * @param {Function} symbolsFunc The function to get the symbols of `object`. + * @returns {Array} Returns the array of property names and symbols. */ - function takeWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3)) - : []; + function baseGetAllKeys(object, keysFunc, symbolsFunc) { + var result = keysFunc(object); + return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); } /** - * Creates an array of unique values, in order, from all given arrays using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of combined values. - * @example + * The base implementation of `getTag` without fallbacks for buggy environments. * - * _.union([2], [1, 2]); - * // => [2, 1] + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. */ - var union = baseRest(function(arrays) { - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); - }); + function baseGetTag(value) { + if (value == null) { + return value === undefined ? undefinedTag : nullTag; + } + return (symToStringTag && symToStringTag in Object(value)) + ? getRawTag(value) + : objectToString(value); + } /** - * This method is like `_.union` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which uniqueness is computed. Result values are chosen from the first - * array in which the value occurs. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * _.unionBy([2.1], [1.2, 2.3], Math.floor); - * // => [2.1, 1.2] + * The base implementation of `_.gt` which doesn't coerce arguments. * - * // The `_.property` iteratee shorthand. - * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. */ - var unionBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); - }); + function baseGt(value, other) { + return value > other; + } /** - * This method is like `_.union` except that it accepts `comparator` which - * is invoked to compare elements of `arrays`. Result values are chosen from - * the first array in which the value occurs. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * The base implementation of `_.has` without support for deep paths. * - * _.unionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. */ - var unionWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); - }); + function baseHas(object, key) { + return object != null && hasOwnProperty.call(object, key); + } /** - * Creates a duplicate-free version of an array, using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons, in which only the first occurrence of each element - * is kept. The order of result values is determined by the order they occur - * in the array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example + * The base implementation of `_.hasIn` without support for deep paths. * - * _.uniq([2, 1, 2]); - * // => [2, 1] + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. */ - function uniq(array) { - return (array && array.length) ? baseUniq(array) : []; + function baseHasIn(object, key) { + return object != null && key in Object(object); } /** - * This method is like `_.uniq` except that it accepts `iteratee` which is - * invoked for each element in `array` to generate the criterion by which - * uniqueness is computed. The order of result values is determined by the - * order they occur in the array. The iteratee is invoked with one argument: - * (value). + * The base implementation of `_.inRange` which doesn't coerce arguments. * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.uniqBy([2.1, 1.2, 2.3], Math.floor); - * // => [2.1, 1.2] - * - * // The `_.property` iteratee shorthand. - * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] + * @private + * @param {number} number The number to check. + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. */ - function uniqBy(array, iteratee) { - return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; + function baseInRange(number, start, end) { + return number >= nativeMin(start, end) && number < nativeMax(start, end); } /** - * This method is like `_.uniq` except that it accepts `comparator` which - * is invoked to compare elements of `array`. The order of result values is - * determined by the order they occur in the array.The comparator is invoked - * with two arguments: (arrVal, othVal). + * The base implementation of methods like `_.intersection`, without support + * for iteratee shorthands, that accepts an array of arrays to inspect. * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.uniqWith(objects, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] + * @returns {Array} Returns the new array of shared values. */ - function uniqWith(array, comparator) { - comparator = typeof comparator == 'function' ? comparator : undefined; - return (array && array.length) ? baseUniq(array, undefined, comparator) : []; - } + function baseIntersection(arrays, iteratee, comparator) { + var includes = comparator ? arrayIncludesWith : arrayIncludes, + length = arrays[0].length, + othLength = arrays.length, + othIndex = othLength, + caches = Array(othLength), + maxLength = Infinity, + result = []; - /** - * This method is like `_.zip` except that it accepts an array of grouped - * elements and creates an array regrouping the elements to their pre-zip - * configuration. - * - * @static - * @memberOf _ - * @since 1.2.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] - * - * _.unzip(zipped); - * // => [['a', 'b'], [1, 2], [true, false]] - */ - function unzip(array) { - if (!(array && array.length)) { - return []; + while (othIndex--) { + var array = arrays[othIndex]; + if (othIndex && iteratee) { + array = arrayMap(array, baseUnary(iteratee)); + } + maxLength = nativeMin(array.length, maxLength); + caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) + ? new SetCache(othIndex && array) + : undefined; } - var length = 0; - array = arrayFilter(array, function(group) { - if (isArrayLikeObject(group)) { - length = nativeMax(group.length, length); - return true; + array = arrays[0]; + + var index = -1, + seen = caches[0]; + + outer: + while (++index < length && result.length < maxLength) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (!(seen + ? cacheHas(seen, computed) + : includes(result, computed, comparator) + )) { + othIndex = othLength; + while (--othIndex) { + var cache = caches[othIndex]; + if (!(cache + ? cacheHas(cache, computed) + : includes(arrays[othIndex], computed, comparator)) + ) { + continue outer; + } + } + if (seen) { + seen.push(computed); + } + result.push(value); } - }); - return baseTimes(length, function(index) { - return arrayMap(array, baseProperty(index)); - }); + } + return result; } /** - * This method is like `_.unzip` except that it accepts `iteratee` to specify - * how regrouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @param {Function} [iteratee=_.identity] The function to combine - * regrouped values. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip([1, 2], [10, 20], [100, 200]); - * // => [[1, 10, 100], [2, 20, 200]] + * The base implementation of `_.invert` and `_.invertBy` which inverts + * `object` with values transformed by `iteratee` and set by `setter`. * - * _.unzipWith(zipped, _.add); - * // => [3, 30, 300] + * @private + * @param {Object} object The object to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform values. + * @param {Object} accumulator The initial inverted object. + * @returns {Function} Returns `accumulator`. */ - function unzipWith(array, iteratee) { - if (!(array && array.length)) { - return []; - } - var result = unzip(array); - if (iteratee == null) { - return result; - } - return arrayMap(result, function(group) { - return apply(iteratee, undefined, group); + function baseInverter(object, setter, iteratee, accumulator) { + baseForOwn(object, function(value, key, object) { + setter(accumulator, iteratee(value), key, object); }); + return accumulator; } /** - * Creates an array excluding all given values using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.pull`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...*} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.xor - * @example + * The base implementation of `_.invoke` without support for individual + * method arguments. * - * _.without([2, 1, 2, 3], 1, 2); - * // => [3] + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {Array} args The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. */ - var without = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, values) - : []; - }); + function baseInvoke(object, path, args) { + path = castPath(path, object); + object = parent(object, path); + var func = object == null ? object : object[toKey(last(path))]; + return func == null ? undefined : apply(func, object, args); + } /** - * Creates an array of unique values that is the - * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) - * of the given arrays. The order of result values is determined by the order - * they occur in the arrays. - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.without - * @example + * The base implementation of `_.isArguments`. * - * _.xor([2, 1], [2, 3]); - * // => [1, 3] + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, */ - var xor = baseRest(function(arrays) { - return baseXor(arrayFilter(arrays, isArrayLikeObject)); - }); + function baseIsArguments(value) { + return isObjectLike(value) && baseGetTag(value) == argsTag; + } /** - * This method is like `_.xor` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which by which they're compared. The order of result values is determined - * by the order they occur in the arrays. The iteratee is invoked with one - * argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2, 3.4] + * The base implementation of `_.isArrayBuffer` without Node.js optimizations. * - * // The `_.property` iteratee shorthand. - * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. */ - var xorBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); - }); + function baseIsArrayBuffer(value) { + return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; + } /** - * This method is like `_.xor` except that it accepts `comparator` which is - * invoked to compare elements of `arrays`. The order of result values is - * determined by the order they occur in the arrays. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * The base implementation of `_.isDate` without Node.js optimizations. * - * _.xorWith(objects, others, _.isEqual); - * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. */ - var xorWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); - }); + function baseIsDate(value) { + return isObjectLike(value) && baseGetTag(value) == dateTag; + } /** - * Creates an array of grouped elements, the first of which contains the - * first elements of the given arrays, the second of which contains the - * second elements of the given arrays, and so on. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @returns {Array} Returns the new array of grouped elements. - * @example + * The base implementation of `_.isEqual` which supports partial comparisons + * and tracks traversed objects. * - * _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {boolean} bitmask The bitmask flags. + * 1 - Unordered comparison + * 2 - Partial comparison + * @param {Function} [customizer] The function to customize comparisons. + * @param {Object} [stack] Tracks traversed `value` and `other` objects. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. */ - var zip = baseRest(unzip); + function baseIsEqual(value, other, bitmask, customizer, stack) { + if (value === other) { + return true; + } + if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { + return value !== value && other !== other; + } + return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); + } /** - * This method is like `_.fromPairs` except that it accepts two arrays, - * one of property identifiers and one of corresponding values. - * - * @static - * @memberOf _ - * @since 0.4.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example + * A specialized version of `baseIsEqual` for arrays and objects which performs + * deep comparisons and tracks traversed objects enabling objects with circular + * references to be compared. * - * _.zipObject(['a', 'b'], [1, 2]); - * // => { 'a': 1, 'b': 2 } + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} [stack] Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ - function zipObject(props, values) { - return baseZipObject(props || [], values || [], assignValue); + function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { + var objIsArr = isArray(object), + othIsArr = isArray(other), + objTag = objIsArr ? arrayTag : getTag(object), + othTag = othIsArr ? arrayTag : getTag(other); + + objTag = objTag == argsTag ? objectTag : objTag; + othTag = othTag == argsTag ? objectTag : othTag; + + var objIsObj = objTag == objectTag, + othIsObj = othTag == objectTag, + isSameTag = objTag == othTag; + + if (isSameTag && isBuffer(object)) { + if (!isBuffer(other)) { + return false; + } + objIsArr = true; + objIsObj = false; + } + if (isSameTag && !objIsObj) { + stack || (stack = new Stack); + return (objIsArr || isTypedArray(object)) + ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) + : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); + } + if (!(bitmask & COMPARE_PARTIAL_FLAG)) { + var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), + othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); + + if (objIsWrapped || othIsWrapped) { + var objUnwrapped = objIsWrapped ? object.value() : object, + othUnwrapped = othIsWrapped ? other.value() : other; + + stack || (stack = new Stack); + return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); + } + } + if (!isSameTag) { + return false; + } + stack || (stack = new Stack); + return equalObjects(object, other, bitmask, customizer, equalFunc, stack); } /** - * This method is like `_.zipObject` except that it supports property paths. - * - * @static - * @memberOf _ - * @since 4.1.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example + * The base implementation of `_.isMap` without Node.js optimizations. * - * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); - * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. */ - function zipObjectDeep(props, values) { - return baseZipObject(props || [], values || [], baseSet); + function baseIsMap(value) { + return isObjectLike(value) && getTag(value) == mapTag; } /** - * This method is like `_.zip` except that it accepts `iteratee` to specify - * how grouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @param {Function} [iteratee=_.identity] The function to combine - * grouped values. - * @returns {Array} Returns the new array of grouped elements. - * @example + * The base implementation of `_.isMatch` without support for iteratee shorthands. * - * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { - * return a + b + c; - * }); - * // => [111, 222] + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Array} matchData The property names, values, and compare flags to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. */ - var zipWith = baseRest(function(arrays) { - var length = arrays.length, - iteratee = length > 1 ? arrays[length - 1] : undefined; + function baseIsMatch(object, source, matchData, customizer) { + var index = matchData.length, + length = index, + noCustomizer = !customizer; - iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; - return unzipWith(arrays, iteratee); - }); + if (object == null) { + return !length; + } + object = Object(object); + while (index--) { + var data = matchData[index]; + if ((noCustomizer && data[2]) + ? data[1] !== object[data[0]] + : !(data[0] in object) + ) { + return false; + } + } + while (++index < length) { + data = matchData[index]; + var key = data[0], + objValue = object[key], + srcValue = data[1]; - /*------------------------------------------------------------------------*/ + if (noCustomizer && data[2]) { + if (objValue === undefined && !(key in object)) { + return false; + } + } else { + var stack = new Stack; + if (customizer) { + var result = customizer(objValue, srcValue, key, object, source, stack); + } + if (!(result === undefined + ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) + : result + )) { + return false; + } + } + } + return true; + } /** - * Creates a `lodash` wrapper instance that wraps `value` with explicit method - * chain sequences enabled. The result of such sequences must be unwrapped - * with `_#value`. - * - * @static - * @memberOf _ - * @since 1.3.0 - * @category Seq - * @param {*} value The value to wrap. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'pebbles', 'age': 1 } - * ]; + * The base implementation of `_.isNative` without bad shim checks. * - * var youngest = _ - * .chain(users) - * .sortBy('age') - * .map(function(o) { - * return o.user + ' is ' + o.age; - * }) - * .head() - * .value(); - * // => 'pebbles is 1' + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. */ - function chain(value) { - var result = lodash(value); - result.__chain__ = true; - return result; + function baseIsNative(value) { + if (!isObject(value) || isMasked(value)) { + return false; + } + var pattern = isFunction(value) ? reIsNative : reIsHostCtor; + return pattern.test(toSource(value)); } /** - * This method invokes `interceptor` and returns `value`. The interceptor - * is invoked with one argument; (value). The purpose of this method is to - * "tap into" a method chain sequence in order to modify intermediate results. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns `value`. - * @example + * The base implementation of `_.isRegExp` without Node.js optimizations. * - * _([1, 2, 3]) - * .tap(function(array) { - * // Mutate input array. - * array.pop(); - * }) - * .reverse() - * .value(); - * // => [2, 1] + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. */ - function tap(value, interceptor) { - interceptor(value); - return value; + function baseIsRegExp(value) { + return isObjectLike(value) && baseGetTag(value) == regexpTag; } /** - * This method is like `_.tap` except that it returns the result of `interceptor`. - * The purpose of this method is to "pass thru" values replacing intermediate - * results in a method chain sequence. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns the result of `interceptor`. - * @example + * The base implementation of `_.isSet` without Node.js optimizations. * - * _(' abc ') - * .chain() - * .trim() - * .thru(function(value) { - * return [value]; - * }) - * .value(); - * // => ['abc'] + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. */ - function thru(value, interceptor) { - return interceptor(value); + function baseIsSet(value) { + return isObjectLike(value) && getTag(value) == setTag; } /** - * This method is the wrapper version of `_.at`. - * - * @name at - * @memberOf _ - * @since 1.0.0 - * @category Seq - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * The base implementation of `_.isTypedArray` without Node.js optimizations. * - * _(object).at(['a[0].b.c', 'a[1]']).value(); - * // => [3, 4] + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. */ - var wrapperAt = flatRest(function(paths) { - var length = paths.length, - start = length ? paths[0] : 0, - value = this.__wrapped__, - interceptor = function(object) { return baseAt(object, paths); }; - - if (length > 1 || this.__actions__.length || - !(value instanceof LazyWrapper) || !isIndex(start)) { - return this.thru(interceptor); - } - value = value.slice(start, +start + (length ? 1 : 0)); - value.__actions__.push({ - 'func': thru, - 'args': [interceptor], - 'thisArg': undefined - }); - return new LodashWrapper(value, this.__chain__).thru(function(array) { - if (length && !array.length) { - array.push(undefined); - } - return array; - }); - }); + function baseIsTypedArray(value) { + return isObjectLike(value) && + isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; + } /** - * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. - * - * @name chain - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 } - * ]; - * - * // A sequence without explicit chaining. - * _(users).head(); - * // => { 'user': 'barney', 'age': 36 } + * The base implementation of `_.iteratee`. * - * // A sequence with explicit chaining. - * _(users) - * .chain() - * .head() - * .pick('user') - * .value(); - * // => { 'user': 'barney' } + * @private + * @param {*} [value=_.identity] The value to convert to an iteratee. + * @returns {Function} Returns the iteratee. */ - function wrapperChain() { - return chain(this); + function baseIteratee(value) { + // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. + // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. + if (typeof value == 'function') { + return value; + } + if (value == null) { + return identity; + } + if (typeof value == 'object') { + return isArray(value) + ? baseMatchesProperty(value[0], value[1]) + : baseMatches(value); + } + return property(value); } /** - * Executes the chain sequence and returns the wrapped result. - * - * @name commit - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2]; - * var wrapped = _(array).push(3); - * - * console.log(array); - * // => [1, 2] - * - * wrapped = wrapped.commit(); - * console.log(array); - * // => [1, 2, 3] - * - * wrapped.last(); - * // => 3 + * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. * - * console.log(array); - * // => [1, 2, 3] + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. */ - function wrapperCommit() { - return new LodashWrapper(this.value(), this.__chain__); + function baseKeys(object) { + if (!isPrototype(object)) { + return nativeKeys(object); + } + var result = []; + for (var key in Object(object)) { + if (hasOwnProperty.call(object, key) && key != 'constructor') { + result.push(key); + } + } + return result; } /** - * Gets the next value on a wrapped object following the - * [iterator protocol](https://mdn.io/iteration_protocols#iterator). - * - * @name next - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the next iterator value. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped.next(); - * // => { 'done': false, 'value': 1 } - * - * wrapped.next(); - * // => { 'done': false, 'value': 2 } + * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. * - * wrapped.next(); - * // => { 'done': true, 'value': undefined } + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. */ - function wrapperNext() { - if (this.__values__ === undefined) { - this.__values__ = toArray(this.value()); + function baseKeysIn(object) { + if (!isObject(object)) { + return nativeKeysIn(object); } - var done = this.__index__ >= this.__values__.length, - value = done ? undefined : this.__values__[this.__index__++]; + var isProto = isPrototype(object), + result = []; - return { 'done': done, 'value': value }; + for (var key in object) { + if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { + result.push(key); + } + } + return result; } /** - * Enables the wrapper to be iterable. - * - * @name Symbol.iterator - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the wrapper object. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped[Symbol.iterator]() === wrapped; - * // => true + * The base implementation of `_.lt` which doesn't coerce arguments. * - * Array.from(wrapped); - * // => [1, 2] + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. */ - function wrapperToIterator() { - return this; + function baseLt(value, other) { + return value < other; } /** - * Creates a clone of the chain sequence planting `value` as the wrapped value. - * - * @name plant - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @param {*} value The value to plant. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2]).map(square); - * var other = wrapped.plant([3, 4]); - * - * other.value(); - * // => [9, 16] + * The base implementation of `_.map` without support for iteratee shorthands. * - * wrapped.value(); - * // => [1, 4] + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. */ - function wrapperPlant(value) { - var result, - parent = this; + function baseMap(collection, iteratee) { + var index = -1, + result = isArrayLike(collection) ? Array(collection.length) : []; - while (parent instanceof baseLodash) { - var clone = wrapperClone(parent); - clone.__index__ = 0; - clone.__values__ = undefined; - if (result) { - previous.__wrapped__ = clone; - } else { - result = clone; - } - var previous = clone; - parent = parent.__wrapped__; - } - previous.__wrapped__ = value; + baseEach(collection, function(value, key, collection) { + result[++index] = iteratee(value, key, collection); + }); return result; } /** - * This method is the wrapper version of `_.reverse`. - * - * **Note:** This method mutates the wrapped array. - * - * @name reverse - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2, 3]; - * - * _(array).reverse().value() - * // => [3, 2, 1] + * The base implementation of `_.matches` which doesn't clone `source`. * - * console.log(array); - * // => [3, 2, 1] + * @private + * @param {Object} source The object of property values to match. + * @returns {Function} Returns the new spec function. */ - function wrapperReverse() { - var value = this.__wrapped__; - if (value instanceof LazyWrapper) { - var wrapped = value; - if (this.__actions__.length) { - wrapped = new LazyWrapper(this); - } - wrapped = wrapped.reverse(); - wrapped.__actions__.push({ - 'func': thru, - 'args': [reverse], - 'thisArg': undefined - }); - return new LodashWrapper(wrapped, this.__chain__); + function baseMatches(source) { + var matchData = getMatchData(source); + if (matchData.length == 1 && matchData[0][2]) { + return matchesStrictComparable(matchData[0][0], matchData[0][1]); } - return this.thru(reverse); + return function(object) { + return object === source || baseIsMatch(object, source, matchData); + }; } /** - * Executes the chain sequence to resolve the unwrapped value. - * - * @name value - * @memberOf _ - * @since 0.1.0 - * @alias toJSON, valueOf - * @category Seq - * @returns {*} Returns the resolved unwrapped value. - * @example + * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. * - * _([1, 2, 3]).value(); - * // => [1, 2, 3] + * @private + * @param {string} path The path of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. */ - function wrapperValue() { - return baseWrapperValue(this.__wrapped__, this.__actions__); + function baseMatchesProperty(path, srcValue) { + if (isKey(path) && isStrictComparable(srcValue)) { + return matchesStrictComparable(toKey(path), srcValue); + } + return function(object) { + var objValue = get(object, path); + return (objValue === undefined && objValue === srcValue) + ? hasIn(object, path) + : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); + }; } - /*------------------------------------------------------------------------*/ - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the number of times the key was returned by `iteratee`. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.countBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': 1, '6': 2 } + * The base implementation of `_.merge` without support for multiple sources. * - * // The `_.property` iteratee shorthand. - * _.countBy(['one', 'two', 'three'], 'length'); - * // => { '3': 2, '5': 1 } + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {number} srcIndex The index of `source`. + * @param {Function} [customizer] The function to customize merged values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. */ - var countBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - ++result[key]; - } else { - baseAssignValue(result, key, 1); + function baseMerge(object, source, srcIndex, customizer, stack) { + if (object === source) { + return; } - }); + baseFor(source, function(srcValue, key) { + if (isObject(srcValue)) { + stack || (stack = new Stack); + baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); + } + else { + var newValue = customizer + ? customizer(object[key], srcValue, (key + ''), object, source, stack) + : undefined; + + if (newValue === undefined) { + newValue = srcValue; + } + assignMergeValue(object, key, newValue); + } + }, keysIn); + } /** - * Checks if `predicate` returns truthy for **all** elements of `collection`. - * Iteration is stopped once `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * **Note:** This method returns `true` for - * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because - * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of - * elements of empty collections. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - * @example - * - * _.every([true, 1, null, 'yes'], Boolean); - * // => false - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.every(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.every(users, ['active', false]); - * // => true + * A specialized version of `baseMerge` for arrays and objects which performs + * deep merges and tracks traversed objects enabling objects with circular + * references to be merged. * - * // The `_.property` iteratee shorthand. - * _.every(users, 'active'); - * // => false + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {string} key The key of the value to merge. + * @param {number} srcIndex The index of `source`. + * @param {Function} mergeFunc The function to merge values. + * @param {Function} [customizer] The function to customize assigned values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. */ - function every(collection, predicate, guard) { - var func = isArray(collection) ? arrayEvery : baseEvery; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; + function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { + var objValue = object[key], + srcValue = source[key], + stacked = stack.get(srcValue); + + if (stacked) { + assignMergeValue(object, key, stacked); + return; } - return func(collection, getIteratee(predicate, 3)); - } + var newValue = customizer + ? customizer(objValue, srcValue, (key + ''), object, source, stack) + : undefined; - /** - * Iterates over elements of `collection`, returning an array of all elements - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * **Note:** Unlike `_.remove`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.reject - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * _.filter(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.filter(users, { 'age': 36, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.filter(users, ['active', false]); - * // => objects for ['fred'] - * - * // The `_.property` iteratee shorthand. - * _.filter(users, 'active'); - * // => objects for ['barney'] - */ - function filter(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, getIteratee(predicate, 3)); - } + var isCommon = newValue === undefined; - /** - * Iterates over elements of `collection`, returning the first element - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false }, - * { 'user': 'pebbles', 'age': 1, 'active': true } - * ]; - * - * _.find(users, function(o) { return o.age < 40; }); - * // => object for 'barney' - * - * // The `_.matches` iteratee shorthand. - * _.find(users, { 'age': 1, 'active': true }); - * // => object for 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.find(users, ['active', false]); - * // => object for 'fred' - * - * // The `_.property` iteratee shorthand. - * _.find(users, 'active'); - * // => object for 'barney' - */ - var find = createFind(findIndex); + if (isCommon) { + var isArr = isArray(srcValue), + isBuff = !isArr && isBuffer(srcValue), + isTyped = !isArr && !isBuff && isTypedArray(srcValue); - /** - * This method is like `_.find` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=collection.length-1] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * _.findLast([1, 2, 3, 4], function(n) { - * return n % 2 == 1; - * }); - * // => 3 - */ - var findLast = createFind(findLastIndex); + newValue = srcValue; + if (isArr || isBuff || isTyped) { + if (isArray(objValue)) { + newValue = objValue; + } + else if (isArrayLikeObject(objValue)) { + newValue = copyArray(objValue); + } + else if (isBuff) { + isCommon = false; + newValue = cloneBuffer(srcValue, true); + } + else if (isTyped) { + isCommon = false; + newValue = cloneTypedArray(srcValue, true); + } + else { + newValue = []; + } + } + else if (isPlainObject(srcValue) || isArguments(srcValue)) { + newValue = objValue; + if (isArguments(objValue)) { + newValue = toPlainObject(objValue); + } + else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { + newValue = initCloneObject(srcValue); + } + } + else { + isCommon = false; + } + } + if (isCommon) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, newValue); + mergeFunc(newValue, srcValue, srcIndex, customizer, stack); + stack['delete'](srcValue); + } + assignMergeValue(object, key, newValue); + } /** - * Creates a flattened array of values by running each element in `collection` - * thru `iteratee` and flattening the mapped results. The iteratee is invoked - * with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [n, n]; - * } + * The base implementation of `_.nth` which doesn't coerce arguments. * - * _.flatMap([1, 2], duplicate); - * // => [1, 1, 2, 2] + * @private + * @param {Array} array The array to query. + * @param {number} n The index of the element to return. + * @returns {*} Returns the nth element of `array`. */ - function flatMap(collection, iteratee) { - return baseFlatten(map(collection, iteratee), 1); + function baseNth(array, n) { + var length = array.length; + if (!length) { + return; + } + n += n < 0 ? length : 0; + return isIndex(n, length) ? array[n] : undefined; } /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results. + * The base implementation of `_.orderBy` without param guards. * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection + * @private * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } - * - * _.flatMapDeep([1, 2], duplicate); - * // => [1, 1, 2, 2] + * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. + * @param {string[]} orders The sort orders of `iteratees`. + * @returns {Array} Returns the new sorted array. */ - function flatMapDeep(collection, iteratee) { - return baseFlatten(map(collection, iteratee), INFINITY); + function baseOrderBy(collection, iteratees, orders) { + var index = -1; + iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); + + var result = baseMap(collection, function(value, key, collection) { + var criteria = arrayMap(iteratees, function(iteratee) { + return iteratee(value); + }); + return { 'criteria': criteria, 'index': ++index, 'value': value }; + }); + + return baseSortBy(result, function(object, other) { + return compareMultiple(object, other, orders); + }); } /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } + * The base implementation of `_.pick` without support for individual + * property identifiers. * - * _.flatMapDepth([1, 2], duplicate, 2); - * // => [[1, 1], [2, 2]] + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @returns {Object} Returns the new object. */ - function flatMapDepth(collection, iteratee, depth) { - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(map(collection, iteratee), depth); + function basePick(object, paths) { + return basePickBy(object, paths, function(value, path) { + return hasIn(object, path); + }); } /** - * Iterates over elements of `collection` and invokes `iteratee` for each element. - * The iteratee is invoked with three arguments: (value, index|key, collection). - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * **Note:** As with other "Collections" methods, objects with a "length" - * property are iterated like arrays. To avoid this behavior use `_.forIn` - * or `_.forOwn` for object iteration. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias each - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEachRight - * @example - * - * _.forEach([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `1` then `2`. + * The base implementation of `_.pickBy` without support for iteratee shorthands. * - * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @param {Function} predicate The function invoked per property. + * @returns {Object} Returns the new object. */ - function forEach(collection, iteratee) { - var func = isArray(collection) ? arrayEach : baseEach; - return func(collection, getIteratee(iteratee, 3)); + function basePickBy(object, paths, predicate) { + var index = -1, + length = paths.length, + result = {}; + + while (++index < length) { + var path = paths[index], + value = baseGet(object, path); + + if (predicate(value, path)) { + baseSet(result, castPath(path, object), value); + } + } + return result; } /** - * This method is like `_.forEach` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @alias eachRight - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEach - * @example + * A specialized version of `baseProperty` which supports deep paths. * - * _.forEachRight([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `2` then `1`. + * @private + * @param {Array|string} path The path of the property to get. + * @returns {Function} Returns the new accessor function. */ - function forEachRight(collection, iteratee) { - var func = isArray(collection) ? arrayEachRight : baseEachRight; - return func(collection, getIteratee(iteratee, 3)); + function basePropertyDeep(path) { + return function(object) { + return baseGet(object, path); + }; } /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The order of grouped values - * is determined by the order they occur in `collection`. The corresponding - * value of each key is an array of elements responsible for generating the - * key. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.groupBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': [4.2], '6': [6.1, 6.3] } + * The base implementation of `_.pullAllBy` without support for iteratee + * shorthands. * - * // The `_.property` iteratee shorthand. - * _.groupBy(['one', 'two', 'three'], 'length'); - * // => { '3': ['one', 'two'], '5': ['three'] } + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. */ - var groupBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - result[key].push(value); - } else { - baseAssignValue(result, key, [value]); - } - }); + function basePullAll(array, values, iteratee, comparator) { + var indexOf = comparator ? baseIndexOfWith : baseIndexOf, + index = -1, + length = values.length, + seen = array; - /** - * Checks if `value` is in `collection`. If `collection` is a string, it's - * checked for a substring of `value`, otherwise - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * is used for equality comparisons. If `fromIndex` is negative, it's used as - * the offset from the end of `collection`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {boolean} Returns `true` if `value` is found, else `false`. - * @example - * - * _.includes([1, 2, 3], 1); - * // => true - * - * _.includes([1, 2, 3], 1, 2); - * // => false - * - * _.includes({ 'a': 1, 'b': 2 }, 1); - * // => true - * - * _.includes('abcd', 'bc'); - * // => true - */ - function includes(collection, value, fromIndex, guard) { - collection = isArrayLike(collection) ? collection : values(collection); - fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; + if (array === values) { + values = copyArray(values); + } + if (iteratee) { + seen = arrayMap(array, baseUnary(iteratee)); + } + while (++index < length) { + var fromIndex = 0, + value = values[index], + computed = iteratee ? iteratee(value) : value; - var length = collection.length; - if (fromIndex < 0) { - fromIndex = nativeMax(length + fromIndex, 0); + while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { + if (seen !== array) { + splice.call(seen, fromIndex, 1); + } + splice.call(array, fromIndex, 1); + } } - return isString(collection) - ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) - : (!!length && baseIndexOf(collection, value, fromIndex) > -1); + return array; } /** - * Invokes the method at `path` of each element in `collection`, returning - * an array of the results of each invoked method. Any additional arguments - * are provided to each invoked method. If `path` is a function, it's invoked - * for, and `this` bound to, each element in `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array|Function|string} path The path of the method to invoke or - * the function invoked per iteration. - * @param {...*} [args] The arguments to invoke each method with. - * @returns {Array} Returns the array of results. - * @example - * - * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); - * // => [[1, 5, 7], [1, 2, 3]] + * The base implementation of `_.pullAt` without support for individual + * indexes or capturing the removed elements. * - * _.invokeMap([123, 456], String.prototype.split, ''); - * // => [['1', '2', '3'], ['4', '5', '6']] + * @private + * @param {Array} array The array to modify. + * @param {number[]} indexes The indexes of elements to remove. + * @returns {Array} Returns `array`. */ - var invokeMap = baseRest(function(collection, path, args) { - var index = -1, - isFunc = typeof path == 'function', - result = isArrayLike(collection) ? Array(collection.length) : []; + function basePullAt(array, indexes) { + var length = array ? indexes.length : 0, + lastIndex = length - 1; - baseEach(collection, function(value) { - result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); - }); - return result; - }); + while (length--) { + var index = indexes[length]; + if (length == lastIndex || index !== previous) { + var previous = index; + if (isIndex(index)) { + splice.call(array, index, 1); + } else { + baseUnset(array, index); + } + } + } + return array; + } /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the last element responsible for generating the key. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * var array = [ - * { 'dir': 'left', 'code': 97 }, - * { 'dir': 'right', 'code': 100 } - * ]; - * - * _.keyBy(array, function(o) { - * return String.fromCharCode(o.code); - * }); - * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + * The base implementation of `_.random` without support for returning + * floating-point numbers. * - * _.keyBy(array, 'dir'); - * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } + * @private + * @param {number} lower The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the random number. */ - var keyBy = createAggregator(function(result, value, key) { - baseAssignValue(result, key, value); - }); + function baseRandom(lower, upper) { + return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); + } /** - * Creates an array of values by running each element in `collection` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. - * - * The guarded methods are: - * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, - * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, - * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, - * `template`, `trim`, `trimEnd`, `trimStart`, and `words` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - * @example - * - * function square(n) { - * return n * n; - * } - * - * _.map([4, 8], square); - * // => [16, 64] - * - * _.map({ 'a': 4, 'b': 8 }, square); - * // => [16, 64] (iteration order is not guaranteed) - * - * var users = [ - * { 'user': 'barney' }, - * { 'user': 'fred' } - * ]; + * The base implementation of `_.range` and `_.rangeRight` which doesn't + * coerce arguments. * - * // The `_.property` iteratee shorthand. - * _.map(users, 'user'); - * // => ['barney', 'fred'] + * @private + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @param {number} step The value to increment or decrement by. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the range of numbers. */ - function map(collection, iteratee) { - var func = isArray(collection) ? arrayMap : baseMap; - return func(collection, getIteratee(iteratee, 3)); + function baseRange(start, end, step, fromRight) { + var index = -1, + length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), + result = Array(length); + + while (length--) { + result[fromRight ? length : ++index] = start; + start += step; + } + return result; } /** - * This method is like `_.sortBy` except that it allows specifying the sort - * orders of the iteratees to sort by. If `orders` is unspecified, all values - * are sorted in ascending order. Otherwise, specify an order of "desc" for - * descending or "asc" for ascending sort order of corresponding values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] - * The iteratees to sort by. - * @param {string[]} [orders] The sort orders of `iteratees`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 34 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 36 } - * ]; + * The base implementation of `_.repeat` which doesn't coerce arguments. * - * // Sort by `user` in ascending order and by `age` in descending order. - * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + * @private + * @param {string} string The string to repeat. + * @param {number} n The number of times to repeat the string. + * @returns {string} Returns the repeated string. */ - function orderBy(collection, iteratees, orders, guard) { - if (collection == null) { - return []; - } - if (!isArray(iteratees)) { - iteratees = iteratees == null ? [] : [iteratees]; - } - orders = guard ? undefined : orders; - if (!isArray(orders)) { - orders = orders == null ? [] : [orders]; + function baseRepeat(string, n) { + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; } - return baseOrderBy(collection, iteratees, orders); + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + if (n) { + string += string; + } + } while (n); + + return result; } /** - * Creates an array of elements split into two groups, the first of which - * contains elements `predicate` returns truthy for, the second of which - * contains elements `predicate` returns falsey for. The predicate is - * invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the array of grouped elements. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true }, - * { 'user': 'pebbles', 'age': 1, 'active': false } - * ]; - * - * _.partition(users, function(o) { return o.active; }); - * // => objects for [['fred'], ['barney', 'pebbles']] - * - * // The `_.matches` iteratee shorthand. - * _.partition(users, { 'age': 1, 'active': false }); - * // => objects for [['pebbles'], ['barney', 'fred']] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.partition(users, ['active', false]); - * // => objects for [['barney', 'pebbles'], ['fred']] + * The base implementation of `_.rest` which doesn't validate or coerce arguments. * - * // The `_.property` iteratee shorthand. - * _.partition(users, 'active'); - * // => objects for [['fred'], ['barney', 'pebbles']] + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. */ - var partition = createAggregator(function(result, value, key) { - result[key ? 0 : 1].push(value); - }, function() { return [[], []]; }); + function baseRest(func, start) { + return setToString(overRest(func, start, identity), func + ''); + } /** - * Reduces `collection` to a value which is the accumulated result of running - * each element in `collection` thru `iteratee`, where each successive - * invocation is supplied the return value of the previous. If `accumulator` - * is not given, the first element of `collection` is used as the initial - * value. The iteratee is invoked with four arguments: - * (accumulator, value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.reduce`, `_.reduceRight`, and `_.transform`. - * - * The guarded methods are: - * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, - * and `sortBy` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduceRight - * @example - * - * _.reduce([1, 2], function(sum, n) { - * return sum + n; - * }, 0); - * // => 3 + * The base implementation of `_.sample`. * - * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * return result; - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) + * @private + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. */ - function reduce(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduce : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); + function baseSample(collection) { + return arraySample(values(collection)); } /** - * This method is like `_.reduce` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduce - * @example - * - * var array = [[0, 1], [2, 3], [4, 5]]; + * The base implementation of `_.sampleSize` without param guards. * - * _.reduceRight(array, function(flattened, other) { - * return flattened.concat(other); - * }, []); - * // => [4, 5, 2, 3, 0, 1] + * @private + * @param {Array|Object} collection The collection to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. */ - function reduceRight(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduceRight : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); + function baseSampleSize(collection, n) { + var array = values(collection); + return shuffleSelf(array, baseClamp(n, 0, array.length)); } /** - * The opposite of `_.filter`; this method returns the elements of `collection` - * that `predicate` does **not** return truthy for. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.filter - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true } - * ]; - * - * _.reject(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.reject(users, { 'age': 40, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.reject(users, ['active', false]); - * // => objects for ['fred'] + * The base implementation of `_.set`. * - * // The `_.property` iteratee shorthand. - * _.reject(users, 'active'); - * // => objects for ['barney'] + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. */ - function reject(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, negate(getIteratee(predicate, 3))); + function baseSet(object, path, value, customizer) { + if (!isObject(object)) { + return object; + } + path = castPath(path, object); + + var index = -1, + length = path.length, + lastIndex = length - 1, + nested = object; + + while (nested != null && ++index < length) { + var key = toKey(path[index]), + newValue = value; + + if (index != lastIndex) { + var objValue = nested[key]; + newValue = customizer ? customizer(objValue, key, nested) : undefined; + if (newValue === undefined) { + newValue = isObject(objValue) + ? objValue + : (isIndex(path[index + 1]) ? [] : {}); + } + } + assignValue(nested, key, newValue); + nested = nested[key]; + } + return object; } /** - * Gets a random element from `collection`. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - * @example + * The base implementation of `setData` without support for hot loop shorting. * - * _.sample([1, 2, 3, 4]); - * // => 2 + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. */ - function sample(collection) { - var func = isArray(collection) ? arraySample : baseSample; - return func(collection); - } + var baseSetData = !metaMap ? identity : function(func, data) { + metaMap.set(func, data); + return func; + }; /** - * Gets `n` random elements at unique keys from `collection` up to the - * size of `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @param {number} [n=1] The number of elements to sample. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the random elements. - * @example - * - * _.sampleSize([1, 2, 3], 2); - * // => [3, 1] + * The base implementation of `setToString` without support for hot loop shorting. * - * _.sampleSize([1, 2, 3], 4); - * // => [2, 3, 1] + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. */ - function sampleSize(collection, n, guard) { - if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - var func = isArray(collection) ? arraySampleSize : baseSampleSize; - return func(collection, n); - } + var baseSetToString = !defineProperty ? identity : function(func, string) { + return defineProperty(func, 'toString', { + 'configurable': true, + 'enumerable': false, + 'value': constant(string), + 'writable': true + }); + }; /** - * Creates an array of shuffled values, using a version of the - * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). + * The base implementation of `_.shuffle`. * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection + * @private * @param {Array|Object} collection The collection to shuffle. * @returns {Array} Returns the new shuffled array. - * @example - * - * _.shuffle([1, 2, 3, 4]); - * // => [4, 1, 3, 2] */ - function shuffle(collection) { - var func = isArray(collection) ? arrayShuffle : baseShuffle; - return func(collection); + function baseShuffle(collection) { + return shuffleSelf(values(collection)); } /** - * Gets the size of `collection` by returning its length for array-like - * values or the number of own enumerable string keyed properties for objects. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @returns {number} Returns the collection size. - * @example - * - * _.size([1, 2, 3]); - * // => 3 - * - * _.size({ 'a': 1, 'b': 2 }); - * // => 2 + * The base implementation of `_.slice` without an iteratee call guard. * - * _.size('pebbles'); - * // => 7 + * @private + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. */ - function size(collection) { - if (collection == null) { - return 0; + function baseSlice(array, start, end) { + var index = -1, + length = array.length; + + if (start < 0) { + start = -start > length ? 0 : (length + start); } - if (isArrayLike(collection)) { - return isString(collection) ? stringSize(collection) : collection.length; + end = end > length ? length : end; + if (end < 0) { + end += length; } - var tag = getTag(collection); - if (tag == mapTag || tag == setTag) { - return collection.size; + length = start > end ? 0 : ((end - start) >>> 0); + start >>>= 0; + + var result = Array(length); + while (++index < length) { + result[index] = array[index + start]; } - return baseKeys(collection).length; + return result; } /** - * Checks if `predicate` returns truthy for **any** element of `collection`. - * Iteration is stopped once `predicate` returns truthy. The predicate is - * invoked with three arguments: (value, index|key, collection). + * The base implementation of `_.some` without support for iteratee shorthands. * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection + * @private * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. - * @example - * - * _.some([null, 0, 'yes', false], Boolean); - * // => true - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.some(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.some(users, ['active', false]); - * // => true + */ + function baseSome(collection, predicate) { + var result; + + baseEach(collection, function(value, index, collection) { + result = predicate(value, index, collection); + return !result; + }); + return !!result; + } + + /** + * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which + * performs a binary search of `array` to determine the index at which `value` + * should be inserted into `array` in order to maintain its sort order. * - * // The `_.property` iteratee shorthand. - * _.some(users, 'active'); - * // => true + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. */ - function some(collection, predicate, guard) { - var func = isArray(collection) ? arraySome : baseSome; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; + function baseSortedIndex(array, value, retHighest) { + var low = 0, + high = array == null ? low : array.length; + + if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { + while (low < high) { + var mid = (low + high) >>> 1, + computed = array[mid]; + + if (computed !== null && !isSymbol(computed) && + (retHighest ? (computed <= value) : (computed < value))) { + low = mid + 1; + } else { + high = mid; + } + } + return high; } - return func(collection, getIteratee(predicate, 3)); + return baseSortedIndexBy(array, value, identity, retHighest); } /** - * Creates an array of elements, sorted in ascending order by the results of - * running each element in a collection thru each iteratee. This method - * performs a stable sort, that is, it preserves the original sort order of - * equal elements. The iteratees are invoked with one argument: (value). + * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` + * which invokes `iteratee` for `value` and each element of `array` to compute + * their sort ranking. The iteratee is invoked with one argument; (value). * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {...(Function|Function[])} [iteratees=[_.identity]] - * The iteratees to sort by. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 34 } - * ]; - * - * _.sortBy(users, [function(o) { return o.user; }]); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] - * - * _.sortBy(users, ['user', 'age']); - * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} iteratee The iteratee invoked per element. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. */ - var sortBy = baseRest(function(collection, iteratees) { - if (collection == null) { - return []; - } - var length = iteratees.length; - if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { - iteratees = []; - } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { - iteratees = [iteratees[0]]; - } - return baseOrderBy(collection, baseFlatten(iteratees, 1), []); - }); + function baseSortedIndexBy(array, value, iteratee, retHighest) { + value = iteratee(value); - /*------------------------------------------------------------------------*/ + var low = 0, + high = array == null ? 0 : array.length, + valIsNaN = value !== value, + valIsNull = value === null, + valIsSymbol = isSymbol(value), + valIsUndefined = value === undefined; + + while (low < high) { + var mid = nativeFloor((low + high) / 2), + computed = iteratee(array[mid]), + othIsDefined = computed !== undefined, + othIsNull = computed === null, + othIsReflexive = computed === computed, + othIsSymbol = isSymbol(computed); + + if (valIsNaN) { + var setLow = retHighest || othIsReflexive; + } else if (valIsUndefined) { + setLow = othIsReflexive && (retHighest || othIsDefined); + } else if (valIsNull) { + setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); + } else if (valIsSymbol) { + setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); + } else if (othIsNull || othIsSymbol) { + setLow = false; + } else { + setLow = retHighest ? (computed <= value) : (computed < value); + } + if (setLow) { + low = mid + 1; + } else { + high = mid; + } + } + return nativeMin(high, MAX_ARRAY_INDEX); + } /** - * Gets the timestamp of the number of milliseconds that have elapsed since - * the Unix epoch (1 January 1970 00:00:00 UTC). - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Date - * @returns {number} Returns the timestamp. - * @example + * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without + * support for iteratee shorthands. * - * _.defer(function(stamp) { - * console.log(_.now() - stamp); - * }, _.now()); - * // => Logs the number of milliseconds it took for the deferred invocation. + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. */ - var now = ctxNow || function() { - return root.Date.now(); - }; + function baseSortedUniq(array, iteratee) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; - /*------------------------------------------------------------------------*/ + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + if (!index || !eq(computed, seen)) { + var seen = computed; + result[resIndex++] = value === 0 ? 0 : value; + } + } + return result; + } /** - * The opposite of `_.before`; this method creates a function that invokes - * `func` once it's called `n` or more times. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {number} n The number of calls before `func` is invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var saves = ['profile', 'settings']; - * - * var done = _.after(saves.length, function() { - * console.log('done saving!'); - * }); + * The base implementation of `_.toNumber` which doesn't ensure correct + * conversions of binary, hexadecimal, or octal string values. * - * _.forEach(saves, function(type) { - * asyncSave({ 'type': type, 'complete': done }); - * }); - * // => Logs 'done saving!' after the two async saves have completed. + * @private + * @param {*} value The value to process. + * @returns {number} Returns the number. */ - function after(n, func) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); + function baseToNumber(value) { + if (typeof value == 'number') { + return value; } - n = toInteger(n); - return function() { - if (--n < 1) { - return func.apply(this, arguments); - } - }; + if (isSymbol(value)) { + return NAN; + } + return +value; } /** - * Creates a function that invokes `func`, with up to `n` arguments, - * ignoring any additional arguments. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @param {number} [n=func.length] The arity cap. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new capped function. - * @example + * The base implementation of `_.toString` which doesn't convert nullish + * values to empty strings. * - * _.map(['6', '8', '10'], _.ary(parseInt, 1)); - * // => [6, 8, 10] + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. */ - function ary(func, n, guard) { - n = guard ? undefined : n; - n = (func && n == null) ? func.length : n; - return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); + function baseToString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (isArray(value)) { + // Recursively convert values (susceptible to call stack limits). + return arrayMap(value, baseToString) + ''; + } + if (isSymbol(value)) { + return symbolToString ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** - * Creates a function that invokes `func`, with the `this` binding and arguments - * of the created function, while it's called less than `n` times. Subsequent - * calls to the created function return the result of the last `func` invocation. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {number} n The number of calls at which `func` is no longer invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example + * The base implementation of `_.uniqBy` without support for iteratee shorthands. * - * jQuery(element).on('click', _.before(5, addContactToList)); - * // => Allows adding up to 4 contacts to the list. + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. */ - function before(n, func) { - var result; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); + function baseUniq(array, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + length = array.length, + isCommon = true, + result = [], + seen = result; + + if (comparator) { + isCommon = false; + includes = arrayIncludesWith; } - n = toInteger(n); - return function() { - if (--n > 0) { - result = func.apply(this, arguments); + else if (length >= LARGE_ARRAY_SIZE) { + var set = iteratee ? null : createSet(array); + if (set) { + return setToArray(set); } - if (n <= 1) { - func = undefined; + isCommon = false; + includes = cacheHas; + seen = new SetCache; + } + else { + seen = iteratee ? [] : result; + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var seenIndex = seen.length; + while (seenIndex--) { + if (seen[seenIndex] === computed) { + continue outer; + } + } + if (iteratee) { + seen.push(computed); + } + result.push(value); } - return result; - }; + else if (!includes(seen, computed, comparator)) { + if (seen !== result) { + seen.push(computed); + } + result.push(value); + } + } + return result; } /** - * Creates a function that invokes `func` with the `this` binding of `thisArg` - * and `partials` prepended to the arguments it receives. - * - * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for partially applied arguments. - * - * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" - * property of bound functions. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to bind. - * @param {*} thisArg The `this` binding of `func`. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * function greet(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * - * var object = { 'user': 'fred' }; - * - * var bound = _.bind(greet, object, 'hi'); - * bound('!'); - * // => 'hi fred!' + * The base implementation of `_.unset`. * - * // Bound with placeholders. - * var bound = _.bind(greet, object, _, '!'); - * bound('hi'); - * // => 'hi fred!' + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The property path to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. */ - var bind = baseRest(function(func, thisArg, partials) { - var bitmask = WRAP_BIND_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bind)); - bitmask |= WRAP_PARTIAL_FLAG; - } - return createWrap(func, bitmask, thisArg, partials, holders); - }); + function baseUnset(object, path) { + path = castPath(path, object); + object = parent(object, path); + return object == null || delete object[toKey(last(path))]; + } /** - * Creates a function that invokes the method at `object[key]` with `partials` - * prepended to the arguments it receives. - * - * This method differs from `_.bind` by allowing bound functions to reference - * methods that may be redefined or don't yet exist. See - * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) - * for more details. - * - * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Function - * @param {Object} object The object to invoke the method on. - * @param {string} key The key of the method. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * var object = { - * 'user': 'fred', - * 'greet': function(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * }; - * - * var bound = _.bindKey(object, 'greet', 'hi'); - * bound('!'); - * // => 'hi fred!' - * - * object.greet = function(greeting, punctuation) { - * return greeting + 'ya ' + this.user + punctuation; - * }; - * - * bound('!'); - * // => 'hiya fred!' + * The base implementation of `_.update`. * - * // Bound with placeholders. - * var bound = _.bindKey(object, 'greet', _, '!'); - * bound('hi'); - * // => 'hiya fred!' + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to update. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. */ - var bindKey = baseRest(function(object, key, partials) { - var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bindKey)); - bitmask |= WRAP_PARTIAL_FLAG; - } - return createWrap(key, bitmask, object, partials, holders); - }); + function baseUpdate(object, path, updater, customizer) { + return baseSet(object, path, updater(baseGet(object, path)), customizer); + } /** - * Creates a function that accepts arguments of `func` and either invokes - * `func` returning its result, if at least `arity` number of arguments have - * been provided, or returns a function that accepts the remaining `func` - * arguments, and so on. The arity of `func` may be specified if `func.length` - * is not sufficient. - * - * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. - * @example - * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curry(abc); - * - * curried(1)(2)(3); - * // => [1, 2, 3] - * - * curried(1, 2)(3); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] + * The base implementation of methods like `_.dropWhile` and `_.takeWhile` + * without support for iteratee shorthands. * - * // Curried with placeholders. - * curried(1)(_, 3)(2); - * // => [1, 2, 3] + * @private + * @param {Array} array The array to query. + * @param {Function} predicate The function invoked per iteration. + * @param {boolean} [isDrop] Specify dropping elements instead of taking them. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the slice of `array`. */ - function curry(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curry.placeholder; - return result; + function baseWhile(array, predicate, isDrop, fromRight) { + var length = array.length, + index = fromRight ? length : -1; + + while ((fromRight ? index-- : ++index < length) && + predicate(array[index], index, array)) {} + + return isDrop + ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) + : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); } /** - * This method is like `_.curry` except that arguments are applied to `func` - * in the manner of `_.partialRight` instead of `_.partial`. - * - * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. - * @example - * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curryRight(abc); - * - * curried(3)(2)(1); - * // => [1, 2, 3] - * - * curried(2, 3)(1); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] + * The base implementation of `wrapperValue` which returns the result of + * performing a sequence of actions on the unwrapped `value`, where each + * successive action is supplied the return value of the previous. * - * // Curried with placeholders. - * curried(3)(1, _)(2); - * // => [1, 2, 3] + * @private + * @param {*} value The unwrapped value. + * @param {Array} actions Actions to perform to resolve the unwrapped value. + * @returns {*} Returns the resolved value. */ - function curryRight(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curryRight.placeholder; - return result; + function baseWrapperValue(value, actions) { + var result = value; + if (result instanceof LazyWrapper) { + result = result.value(); + } + return arrayReduce(actions, function(result, action) { + return action.func.apply(action.thisArg, arrayPush([result], action.args)); + }, result); } /** - * Creates a debounced function that delays invoking `func` until after `wait` - * milliseconds have elapsed since the last time the debounced function was - * invoked. The debounced function comes with a `cancel` method to cancel - * delayed `func` invocations and a `flush` method to immediately invoke them. - * Provide `options` to indicate whether `func` should be invoked on the - * leading and/or trailing edge of the `wait` timeout. The `func` is invoked - * with the last arguments provided to the debounced function. Subsequent - * calls to the debounced function return the result of the last `func` - * invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the debounced function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.debounce` and `_.throttle`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to debounce. - * @param {number} [wait=0] The number of milliseconds to delay. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=false] - * Specify invoking on the leading edge of the timeout. - * @param {number} [options.maxWait] - * The maximum time `func` is allowed to be delayed before it's invoked. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new debounced function. - * @example - * - * // Avoid costly calculations while the window size is in flux. - * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); - * - * // Invoke `sendMail` when clicked, debouncing subsequent calls. - * jQuery(element).on('click', _.debounce(sendMail, 300, { - * 'leading': true, - * 'trailing': false - * })); - * - * // Ensure `batchLog` is invoked once after 1 second of debounced calls. - * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); - * var source = new EventSource('/stream'); - * jQuery(source).on('message', debounced); + * The base implementation of methods like `_.xor`, without support for + * iteratee shorthands, that accepts an array of arrays to inspect. * - * // Cancel the trailing debounced invocation. - * jQuery(window).on('popstate', debounced.cancel); + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of values. */ - function debounce(func, wait, options) { - var lastArgs, - lastThis, - maxWait, - result, - timerId, - lastCallTime, - lastInvokeTime = 0, - leading = false, - maxing = false, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - wait = toNumber(wait) || 0; - if (isObject(options)) { - leading = !!options.leading; - maxing = 'maxWait' in options; - maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; - trailing = 'trailing' in options ? !!options.trailing : trailing; - } - - function invokeFunc(time) { - var args = lastArgs, - thisArg = lastThis; - - lastArgs = lastThis = undefined; - lastInvokeTime = time; - result = func.apply(thisArg, args); - return result; - } - - function leadingEdge(time) { - // Reset any `maxWait` timer. - lastInvokeTime = time; - // Start the timer for the trailing edge. - timerId = setTimeout(timerExpired, wait); - // Invoke the leading edge. - return leading ? invokeFunc(time) : result; - } - - function remainingWait(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime, - result = wait - timeSinceLastCall; - - return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result; - } - - function shouldInvoke(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime; - - // Either this is the first call, activity has stopped and we're at the - // trailing edge, the system time has gone backwards and we're treating - // it as the trailing edge, or we've hit the `maxWait` limit. - return (lastCallTime === undefined || (timeSinceLastCall >= wait) || - (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); - } - - function timerExpired() { - var time = now(); - if (shouldInvoke(time)) { - return trailingEdge(time); - } - // Restart the timer. - timerId = setTimeout(timerExpired, remainingWait(time)); + function baseXor(arrays, iteratee, comparator) { + var length = arrays.length; + if (length < 2) { + return length ? baseUniq(arrays[0]) : []; } + var index = -1, + result = Array(length); - function trailingEdge(time) { - timerId = undefined; - - // Only invoke if we have `lastArgs` which means `func` has been - // debounced at least once. - if (trailing && lastArgs) { - return invokeFunc(time); - } - lastArgs = lastThis = undefined; - return result; - } + while (++index < length) { + var array = arrays[index], + othIndex = -1; - function cancel() { - if (timerId !== undefined) { - clearTimeout(timerId); + while (++othIndex < length) { + if (othIndex != index) { + result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); + } } - lastInvokeTime = 0; - lastArgs = lastCallTime = lastThis = timerId = undefined; - } - - function flush() { - return timerId === undefined ? result : trailingEdge(now()); } + return baseUniq(baseFlatten(result, 1), iteratee, comparator); + } - function debounced() { - var time = now(), - isInvoking = shouldInvoke(time); - - lastArgs = arguments; - lastThis = this; - lastCallTime = time; + /** + * This base implementation of `_.zipObject` which assigns values using `assignFunc`. + * + * @private + * @param {Array} props The property identifiers. + * @param {Array} values The property values. + * @param {Function} assignFunc The function to assign values. + * @returns {Object} Returns the new object. + */ + function baseZipObject(props, values, assignFunc) { + var index = -1, + length = props.length, + valsLength = values.length, + result = {}; - if (isInvoking) { - if (timerId === undefined) { - return leadingEdge(lastCallTime); - } - if (maxing) { - // Handle invocations in a tight loop. - timerId = setTimeout(timerExpired, wait); - return invokeFunc(lastCallTime); - } - } - if (timerId === undefined) { - timerId = setTimeout(timerExpired, wait); - } - return result; + while (++index < length) { + var value = index < valsLength ? values[index] : undefined; + assignFunc(result, props[index], value); } - debounced.cancel = cancel; - debounced.flush = flush; - return debounced; + return result; } /** - * Defers invoking the `func` until the current call stack has cleared. Any - * additional arguments are provided to `func` when it's invoked. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to defer. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. - * @example + * Casts `value` to an empty array if it's not an array like object. * - * _.defer(function(text) { - * console.log(text); - * }, 'deferred'); - * // => Logs 'deferred' after one millisecond. + * @private + * @param {*} value The value to inspect. + * @returns {Array|Object} Returns the cast array-like object. */ - var defer = baseRest(function(func, args) { - return baseDelay(func, 1, args); - }); + function castArrayLikeObject(value) { + return isArrayLikeObject(value) ? value : []; + } /** - * Invokes `func` after `wait` milliseconds. Any additional arguments are - * provided to `func` when it's invoked. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. - * @example + * Casts `value` to `identity` if it's not a function. * - * _.delay(function(text) { - * console.log(text); - * }, 1000, 'later'); - * // => Logs 'later' after one second. + * @private + * @param {*} value The value to inspect. + * @returns {Function} Returns cast function. */ - var delay = baseRest(function(func, wait, args) { - return baseDelay(func, toNumber(wait) || 0, args); - }); + function castFunction(value) { + return typeof value == 'function' ? value : identity; + } /** - * Creates a function that invokes `func` with arguments reversed. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to flip arguments for. - * @returns {Function} Returns the new flipped function. - * @example - * - * var flipped = _.flip(function() { - * return _.toArray(arguments); - * }); + * Casts `value` to a path array if it's not one. * - * flipped('a', 'b', 'c', 'd'); - * // => ['d', 'c', 'b', 'a'] + * @private + * @param {*} value The value to inspect. + * @param {Object} [object] The object to query keys on. + * @returns {Array} Returns the cast property path array. */ - function flip(func) { - return createWrap(func, WRAP_FLIP_FLAG); + function castPath(value, object) { + if (isArray(value)) { + return value; + } + return isKey(value, object) ? [value] : stringToPath(toString(value)); } /** - * Creates a function that memoizes the result of `func`. If `resolver` is - * provided, it determines the cache key for storing the result based on the - * arguments provided to the memoized function. By default, the first argument - * provided to the memoized function is used as the map cache key. The `func` - * is invoked with the `this` binding of the memoized function. - * - * **Note:** The cache is exposed as the `cache` property on the memoized - * function. Its creation may be customized by replacing the `_.memoize.Cache` - * constructor with one whose instances implement the - * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) - * method interface of `clear`, `delete`, `get`, `has`, and `set`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to have its output memoized. - * @param {Function} [resolver] The function to resolve the cache key. - * @returns {Function} Returns the new memoized function. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * var other = { 'c': 3, 'd': 4 }; - * - * var values = _.memoize(_.values); - * values(object); - * // => [1, 2] + * A `baseRest` alias which can be replaced with `identity` by module + * replacement plugins. * - * values(other); - * // => [3, 4] + * @private + * @type {Function} + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + var castRest = baseRest; + + /** + * Casts `array` to a slice if it's needed. * - * object.a = 2; - * values(object); - * // => [1, 2] + * @private + * @param {Array} array The array to inspect. + * @param {number} start The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the cast slice. + */ + function castSlice(array, start, end) { + var length = array.length; + end = end === undefined ? length : end; + return (!start && end >= length) ? array : baseSlice(array, start, end); + } + + /** + * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). * - * // Modify the result cache. - * values.cache.set(object, ['a', 'b']); - * values(object); - * // => ['a', 'b'] + * @private + * @param {number|Object} id The timer id or timeout object of the timer to clear. + */ + var clearTimeout = ctxClearTimeout || function(id) { + return root.clearTimeout(id); + }; + + /** + * Creates a clone of `buffer`. * - * // Replace `_.memoize.Cache`. - * _.memoize.Cache = WeakMap; + * @private + * @param {Buffer} buffer The buffer to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Buffer} Returns the cloned buffer. */ - function memoize(func, resolver) { - if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { - throw new TypeError(FUNC_ERROR_TEXT); + function cloneBuffer(buffer, isDeep) { + if (isDeep) { + return buffer.slice(); } - var memoized = function() { - var args = arguments, - key = resolver ? resolver.apply(this, args) : args[0], - cache = memoized.cache; + var length = buffer.length, + result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); - if (cache.has(key)) { - return cache.get(key); - } - var result = func.apply(this, args); - memoized.cache = cache.set(key, result) || cache; - return result; - }; - memoized.cache = new (memoize.Cache || MapCache); - return memoized; + buffer.copy(result); + return result; } - // Expose `MapCache`. - memoize.Cache = MapCache; - /** - * Creates a function that negates the result of the predicate `func`. The - * `func` predicate is invoked with the `this` binding and arguments of the - * created function. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} predicate The predicate to negate. - * @returns {Function} Returns the new negated function. - * @example - * - * function isEven(n) { - * return n % 2 == 0; - * } + * Creates a clone of `arrayBuffer`. * - * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); - * // => [1, 3, 5] + * @private + * @param {ArrayBuffer} arrayBuffer The array buffer to clone. + * @returns {ArrayBuffer} Returns the cloned array buffer. */ - function negate(predicate) { - if (typeof predicate != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return function() { - var args = arguments; - switch (args.length) { - case 0: return !predicate.call(this); - case 1: return !predicate.call(this, args[0]); - case 2: return !predicate.call(this, args[0], args[1]); - case 3: return !predicate.call(this, args[0], args[1], args[2]); - } - return !predicate.apply(this, args); - }; + function cloneArrayBuffer(arrayBuffer) { + var result = new arrayBuffer.constructor(arrayBuffer.byteLength); + new Uint8Array(result).set(new Uint8Array(arrayBuffer)); + return result; } /** - * Creates a function that is restricted to invoking `func` once. Repeat calls - * to the function return the value of the first invocation. The `func` is - * invoked with the `this` binding and arguments of the created function. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example + * Creates a clone of `dataView`. * - * var initialize = _.once(createApplication); - * initialize(); - * initialize(); - * // => `createApplication` is invoked once + * @private + * @param {Object} dataView The data view to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned data view. */ - function once(func) { - return before(2, func); + function cloneDataView(dataView, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; + return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); } /** - * Creates a function that invokes `func` with its arguments transformed. - * - * @static - * @since 4.0.0 - * @memberOf _ - * @category Function - * @param {Function} func The function to wrap. - * @param {...(Function|Function[])} [transforms=[_.identity]] - * The argument transforms. - * @returns {Function} Returns the new function. - * @example - * - * function doubled(n) { - * return n * 2; - * } - * - * function square(n) { - * return n * n; - * } - * - * var func = _.overArgs(function(x, y) { - * return [x, y]; - * }, [square, doubled]); - * - * func(9, 3); - * // => [81, 6] + * Creates a clone of `map`. * - * func(10, 5); - * // => [100, 10] + * @private + * @param {Object} map The map to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned map. */ - var overArgs = castRest(function(func, transforms) { - transforms = (transforms.length == 1 && isArray(transforms[0])) - ? arrayMap(transforms[0], baseUnary(getIteratee())) - : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); - - var funcsLength = transforms.length; - return baseRest(function(args) { - var index = -1, - length = nativeMin(args.length, funcsLength); - - while (++index < length) { - args[index] = transforms[index].call(this, args[index]); - } - return apply(func, this, args); - }); - }); + function cloneMap(map, isDeep, cloneFunc) { + var array = isDeep ? cloneFunc(mapToArray(map), CLONE_DEEP_FLAG) : mapToArray(map); + return arrayReduce(array, addMapEntry, new map.constructor); + } /** - * Creates a function that invokes `func` with `partials` prepended to the - * arguments it receives. This method is like `_.bind` except it does **not** - * alter the `this` binding. + * Creates a clone of `regexp`. * - * The `_.partial.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. + * @private + * @param {Object} regexp The regexp to clone. + * @returns {Object} Returns the cloned regexp. + */ + function cloneRegExp(regexp) { + var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); + result.lastIndex = regexp.lastIndex; + return result; + } + + /** + * Creates a clone of `set`. * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. - * - * @static - * @memberOf _ - * @since 0.2.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } - * - * var sayHelloTo = _.partial(greet, 'hello'); - * sayHelloTo('fred'); - * // => 'hello fred' - * - * // Partially applied with placeholders. - * var greetFred = _.partial(greet, _, 'fred'); - * greetFred('hi'); - * // => 'hi fred' + * @private + * @param {Object} set The set to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned set. */ - var partial = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partial)); - return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); - }); + function cloneSet(set, isDeep, cloneFunc) { + var array = isDeep ? cloneFunc(setToArray(set), CLONE_DEEP_FLAG) : setToArray(set); + return arrayReduce(array, addSetEntry, new set.constructor); + } /** - * This method is like `_.partial` except that partially applied arguments - * are appended to the arguments it receives. - * - * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } - * - * var greetFred = _.partialRight(greet, 'fred'); - * greetFred('hi'); - * // => 'hi fred' + * Creates a clone of the `symbol` object. * - * // Partially applied with placeholders. - * var sayHelloTo = _.partialRight(greet, 'hello', _); - * sayHelloTo('fred'); - * // => 'hello fred' + * @private + * @param {Object} symbol The symbol object to clone. + * @returns {Object} Returns the cloned symbol object. */ - var partialRight = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partialRight)); - return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); - }); + function cloneSymbol(symbol) { + return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; + } /** - * Creates a function that invokes `func` with arguments arranged according - * to the specified `indexes` where the argument value at the first index is - * provided as the first argument, the argument value at the second index is - * provided as the second argument, and so on. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to rearrange arguments for. - * @param {...(number|number[])} indexes The arranged argument indexes. - * @returns {Function} Returns the new function. - * @example - * - * var rearged = _.rearg(function(a, b, c) { - * return [a, b, c]; - * }, [2, 0, 1]); + * Creates a clone of `typedArray`. * - * rearged('b', 'c', 'a') - * // => ['a', 'b', 'c'] + * @private + * @param {Object} typedArray The typed array to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned typed array. */ - var rearg = flatRest(function(func, indexes) { - return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); - }); + function cloneTypedArray(typedArray, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; + return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); + } /** - * Creates a function that invokes `func` with the `this` binding of the - * created function and arguments from `start` and beyond provided as - * an array. - * - * **Note:** This method is based on the - * [rest parameter](https://mdn.io/rest_parameters). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - * @example - * - * var say = _.rest(function(what, names) { - * return what + ' ' + _.initial(names).join(', ') + - * (_.size(names) > 1 ? ', & ' : '') + _.last(names); - * }); + * Compares values to sort them in ascending order. * - * say('hello', 'fred', 'barney', 'pebbles'); - * // => 'hello fred, barney, & pebbles' + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {number} Returns the sort order indicator for `value`. */ - function rest(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); + function compareAscending(value, other) { + if (value !== other) { + var valIsDefined = value !== undefined, + valIsNull = value === null, + valIsReflexive = value === value, + valIsSymbol = isSymbol(value); + + var othIsDefined = other !== undefined, + othIsNull = other === null, + othIsReflexive = other === other, + othIsSymbol = isSymbol(other); + + if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || + (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || + (valIsNull && othIsDefined && othIsReflexive) || + (!valIsDefined && othIsReflexive) || + !valIsReflexive) { + return 1; + } + if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || + (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || + (othIsNull && valIsDefined && valIsReflexive) || + (!othIsDefined && valIsReflexive) || + !othIsReflexive) { + return -1; + } } - start = start === undefined ? start : toInteger(start); - return baseRest(func, start); + return 0; } /** - * Creates a function that invokes `func` with the `this` binding of the - * create function and an array of arguments much like - * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). - * - * **Note:** This method is based on the - * [spread operator](https://mdn.io/spread_operator). - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Function - * @param {Function} func The function to spread arguments over. - * @param {number} [start=0] The start position of the spread. - * @returns {Function} Returns the new function. - * @example - * - * var say = _.spread(function(who, what) { - * return who + ' says ' + what; - * }); - * - * say(['fred', 'hello']); - * // => 'fred says hello' + * Used by `_.orderBy` to compare multiple properties of a value to another + * and stable sort them. * - * var numbers = Promise.all([ - * Promise.resolve(40), - * Promise.resolve(36) - * ]); + * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, + * specify an order of "desc" for descending or "asc" for ascending sort order + * of corresponding values. * - * numbers.then(_.spread(function(x, y) { - * return x + y; - * })); - * // => a Promise of 76 + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {boolean[]|string[]} orders The order to sort by for each property. + * @returns {number} Returns the sort order indicator for `object`. */ - function spread(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start == null ? 0 : nativeMax(toInteger(start), 0); - return baseRest(function(args) { - var array = args[start], - otherArgs = castSlice(args, 0, start); + function compareMultiple(object, other, orders) { + var index = -1, + objCriteria = object.criteria, + othCriteria = other.criteria, + length = objCriteria.length, + ordersLength = orders.length; - if (array) { - arrayPush(otherArgs, array); + while (++index < length) { + var result = compareAscending(objCriteria[index], othCriteria[index]); + if (result) { + if (index >= ordersLength) { + return result; + } + var order = orders[index]; + return result * (order == 'desc' ? -1 : 1); } - return apply(func, this, otherArgs); - }); + } + // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications + // that causes it, under certain circumstances, to provide the same value for + // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 + // for more details. + // + // This also ensures a stable sort in V8 and other engines. + // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. + return object.index - other.index; } /** - * Creates a throttled function that only invokes `func` at most once per - * every `wait` milliseconds. The throttled function comes with a `cancel` - * method to cancel delayed `func` invocations and a `flush` method to - * immediately invoke them. Provide `options` to indicate whether `func` - * should be invoked on the leading and/or trailing edge of the `wait` - * timeout. The `func` is invoked with the last arguments provided to the - * throttled function. Subsequent calls to the throttled function return the - * result of the last `func` invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the throttled function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.throttle` and `_.debounce`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to throttle. - * @param {number} [wait=0] The number of milliseconds to throttle invocations to. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=true] - * Specify invoking on the leading edge of the timeout. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new throttled function. - * @example - * - * // Avoid excessively updating the position while scrolling. - * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); - * - * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. - * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); - * jQuery(element).on('click', throttled); + * Creates an array that is the composition of partially applied arguments, + * placeholders, and provided arguments into a single array of arguments. * - * // Cancel the trailing throttled invocation. - * jQuery(window).on('popstate', throttled.cancel); + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to prepend to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. */ - function throttle(func, wait, options) { - var leading = true, - trailing = true; + function composeArgs(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersLength = holders.length, + leftIndex = -1, + leftLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(leftLength + rangeLength), + isUncurried = !isCurried; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); + while (++leftIndex < leftLength) { + result[leftIndex] = partials[leftIndex]; } - if (isObject(options)) { - leading = 'leading' in options ? !!options.leading : leading; - trailing = 'trailing' in options ? !!options.trailing : trailing; + while (++argsIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[holders[argsIndex]] = args[argsIndex]; + } } - return debounce(func, wait, { - 'leading': leading, - 'maxWait': wait, - 'trailing': trailing - }); + while (rangeLength--) { + result[leftIndex++] = args[argsIndex++]; + } + return result; } /** - * Creates a function that accepts up to one argument, ignoring any - * additional arguments. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - * @example + * This function is like `composeArgs` except that the arguments composition + * is tailored for `_.partialRight`. * - * _.map(['6', '8', '10'], _.unary(parseInt)); - * // => [6, 8, 10] + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to append to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. */ - function unary(func) { - return ary(func, 1); + function composeArgsRight(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersIndex = -1, + holdersLength = holders.length, + rightIndex = -1, + rightLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(rangeLength + rightLength), + isUncurried = !isCurried; + + while (++argsIndex < rangeLength) { + result[argsIndex] = args[argsIndex]; + } + var offset = argsIndex; + while (++rightIndex < rightLength) { + result[offset + rightIndex] = partials[rightIndex]; + } + while (++holdersIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[offset + holders[holdersIndex]] = args[argsIndex++]; + } + } + return result; } /** - * Creates a function that provides `value` to `wrapper` as its first - * argument. Any additional arguments provided to the function are appended - * to those provided to the `wrapper`. The wrapper is invoked with the `this` - * binding of the created function. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {*} value The value to wrap. - * @param {Function} [wrapper=identity] The wrapper function. - * @returns {Function} Returns the new function. - * @example - * - * var p = _.wrap(_.escape, function(func, text) { - * return '

' + func(text) + '

'; - * }); + * Copies the values of `source` to `array`. * - * p('fred, barney, & pebbles'); - * // => '

fred, barney, & pebbles

' + * @private + * @param {Array} source The array to copy values from. + * @param {Array} [array=[]] The array to copy values to. + * @returns {Array} Returns `array`. */ - function wrap(value, wrapper) { - return partial(castFunction(wrapper), value); - } + function copyArray(source, array) { + var index = -1, + length = source.length; - /*------------------------------------------------------------------------*/ + array || (array = Array(length)); + while (++index < length) { + array[index] = source[index]; + } + return array; + } /** - * Casts `value` as an array if it's not one. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Lang - * @param {*} value The value to inspect. - * @returns {Array} Returns the cast array. - * @example - * - * _.castArray(1); - * // => [1] - * - * _.castArray({ 'a': 1 }); - * // => [{ 'a': 1 }] - * - * _.castArray('abc'); - * // => ['abc'] - * - * _.castArray(null); - * // => [null] - * - * _.castArray(undefined); - * // => [undefined] - * - * _.castArray(); - * // => [] + * Copies properties of `source` to `object`. * - * var array = [1, 2, 3]; - * console.log(_.castArray(array) === array); - * // => true + * @private + * @param {Object} source The object to copy properties from. + * @param {Array} props The property identifiers to copy. + * @param {Object} [object={}] The object to copy properties to. + * @param {Function} [customizer] The function to customize copied values. + * @returns {Object} Returns `object`. */ - function castArray() { - if (!arguments.length) { - return []; + function copyObject(source, props, object, customizer) { + var isNew = !object; + object || (object = {}); + + var index = -1, + length = props.length; + + while (++index < length) { + var key = props[index]; + + var newValue = customizer + ? customizer(object[key], source[key], key, object, source) + : undefined; + + if (newValue === undefined) { + newValue = source[key]; + } + if (isNew) { + baseAssignValue(object, key, newValue); + } else { + assignValue(object, key, newValue); + } } - var value = arguments[0]; - return isArray(value) ? value : [value]; + return object; } /** - * Creates a shallow clone of `value`. - * - * **Note:** This method is loosely based on the - * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) - * and supports cloning arrays, array buffers, booleans, date objects, maps, - * numbers, `Object` objects, regexes, sets, strings, symbols, and typed - * arrays. The own enumerable properties of `arguments` objects are cloned - * as plain objects. An empty object is returned for uncloneable values such - * as error objects, functions, DOM nodes, and WeakMaps. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to clone. - * @returns {*} Returns the cloned value. - * @see _.cloneDeep - * @example - * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * Copies own symbols of `source` to `object`. * - * var shallow = _.clone(objects); - * console.log(shallow[0] === objects[0]); - * // => true + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. */ - function clone(value) { - return baseClone(value, CLONE_SYMBOLS_FLAG); + function copySymbols(source, object) { + return copyObject(source, getSymbols(source), object); } /** - * This method is like `_.clone` except that it accepts `customizer` which - * is invoked to produce the cloned value. If `customizer` returns `undefined`, - * cloning is handled by the method instead. The `customizer` is invoked with - * up to four arguments; (value [, index|key, object, stack]). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the cloned value. - * @see _.cloneDeepWith - * @example - * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(false); - * } - * } - * - * var el = _.cloneWith(document.body, customizer); + * Copies own and inherited symbols of `source` to `object`. * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 0 + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. */ - function cloneWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); + function copySymbolsIn(source, object) { + return copyObject(source, getSymbolsIn(source), object); } /** - * This method is like `_.clone` except that it recursively clones `value`. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @returns {*} Returns the deep cloned value. - * @see _.clone - * @example - * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * Creates a function like `_.groupBy`. * - * var deep = _.cloneDeep(objects); - * console.log(deep[0] === objects[0]); - * // => false + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} [initializer] The accumulator object initializer. + * @returns {Function} Returns the new aggregator function. */ - function cloneDeep(value) { - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); + function createAggregator(setter, initializer) { + return function(collection, iteratee) { + var func = isArray(collection) ? arrayAggregator : baseAggregator, + accumulator = initializer ? initializer() : {}; + + return func(collection, setter, getIteratee(iteratee, 2), accumulator); + }; } /** - * This method is like `_.cloneWith` except that it recursively clones `value`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the deep cloned value. - * @see _.cloneWith - * @example - * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(true); - * } - * } - * - * var el = _.cloneDeepWith(document.body, customizer); + * Creates a function like `_.assign`. * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 20 + * @private + * @param {Function} assigner The function to assign values. + * @returns {Function} Returns the new assigner function. */ - function cloneDeepWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); + function createAssigner(assigner) { + return baseRest(function(object, sources) { + var index = -1, + length = sources.length, + customizer = length > 1 ? sources[length - 1] : undefined, + guard = length > 2 ? sources[2] : undefined; + + customizer = (assigner.length > 3 && typeof customizer == 'function') + ? (length--, customizer) + : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + customizer = length < 3 ? undefined : customizer; + length = 1; + } + object = Object(object); + while (++index < length) { + var source = sources[index]; + if (source) { + assigner(object, source, index, customizer); + } + } + return object; + }); } /** - * Checks if `object` conforms to `source` by invoking the predicate - * properties of `source` with the corresponding property values of `object`. - * - * **Note:** This method is equivalent to `_.conforms` when `source` is - * partially applied. - * - * @static - * @memberOf _ - * @since 4.14.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * - * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); - * // => true + * Creates a `baseEach` or `baseEachRight` function. * - * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); - * // => false + * @private + * @param {Function} eachFunc The function to iterate over a collection. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. */ - function conformsTo(object, source) { - return source == null || baseConformsTo(object, source, keys(source)); + function createBaseEach(eachFunc, fromRight) { + return function(collection, iteratee) { + if (collection == null) { + return collection; + } + if (!isArrayLike(collection)) { + return eachFunc(collection, iteratee); + } + var length = collection.length, + index = fromRight ? length : -1, + iterable = Object(collection); + + while ((fromRight ? index-- : ++index < length)) { + if (iteratee(iterable[index], index, iterable) === false) { + break; + } + } + return collection; + }; } /** - * Performs a - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * comparison between two values to determine if they are equivalent. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.eq(object, object); - * // => true - * - * _.eq(object, other); - * // => false - * - * _.eq('a', 'a'); - * // => true - * - * _.eq('a', Object('a')); - * // => false + * Creates a base function for methods like `_.forIn` and `_.forOwn`. * - * _.eq(NaN, NaN); - * // => true + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. */ - function eq(value, other) { - return value === other || (value !== value && other !== other); + function createBaseFor(fromRight) { + return function(object, iteratee, keysFunc) { + var index = -1, + iterable = Object(object), + props = keysFunc(object), + length = props.length; + + while (length--) { + var key = props[fromRight ? length : ++index]; + if (iteratee(iterable[key], key, iterable) === false) { + break; + } + } + return object; + }; } /** - * Checks if `value` is greater than `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - * @see _.lt - * @example - * - * _.gt(3, 1); - * // => true - * - * _.gt(3, 3); - * // => false + * Creates a function that wraps `func` to invoke it with the optional `this` + * binding of `thisArg`. * - * _.gt(1, 3); - * // => false + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new wrapped function. */ - var gt = createRelationalOperation(baseGt); + function createBind(func, bitmask, thisArg) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); - /** - * Checks if `value` is greater than or equal to `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than or equal to - * `other`, else `false`. - * @see _.lte - * @example - * - * _.gte(3, 1); - * // => true - * - * _.gte(3, 3); - * // => true - * - * _.gte(1, 3); - * // => false - */ - var gte = createRelationalOperation(function(value, other) { - return value >= other; - }); + function wrapper() { + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return fn.apply(isBind ? thisArg : this, arguments); + } + return wrapper; + } /** - * Checks if `value` is likely an `arguments` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - * else `false`. - * @example - * - * _.isArguments(function() { return arguments; }()); - * // => true + * Creates a function like `_.lowerFirst`. * - * _.isArguments([1, 2, 3]); - * // => false + * @private + * @param {string} methodName The name of the `String` case method to use. + * @returns {Function} Returns the new case function. */ - var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { - return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && - !propertyIsEnumerable.call(value, 'callee'); - }; + function createCaseFirst(methodName) { + return function(string) { + string = toString(string); - /** - * Checks if `value` is classified as an `Array` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array, else `false`. - * @example - * - * _.isArray([1, 2, 3]); - * // => true - * - * _.isArray(document.body.children); - * // => false - * - * _.isArray('abc'); - * // => false - * - * _.isArray(_.noop); - * // => false - */ - var isArray = Array.isArray; + var strSymbols = hasUnicode(string) + ? stringToArray(string) + : undefined; + + var chr = strSymbols + ? strSymbols[0] + : string.charAt(0); + + var trailing = strSymbols + ? castSlice(strSymbols, 1).join('') + : string.slice(1); + + return chr[methodName]() + trailing; + }; + } /** - * Checks if `value` is classified as an `ArrayBuffer` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - * @example - * - * _.isArrayBuffer(new ArrayBuffer(2)); - * // => true + * Creates a function like `_.camelCase`. * - * _.isArrayBuffer(new Array(2)); - * // => false + * @private + * @param {Function} callback The function to combine each word. + * @returns {Function} Returns the new compounder function. */ - var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; + function createCompounder(callback) { + return function(string) { + return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); + }; + } /** - * Checks if `value` is array-like. A value is considered array-like if it's - * not a function and has a `value.length` that's an integer greater than or - * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is array-like, else `false`. - * @example - * - * _.isArrayLike([1, 2, 3]); - * // => true - * - * _.isArrayLike(document.body.children); - * // => true - * - * _.isArrayLike('abc'); - * // => true + * Creates a function that produces an instance of `Ctor` regardless of + * whether it was invoked as part of a `new` expression or by `call` or `apply`. * - * _.isArrayLike(_.noop); - * // => false + * @private + * @param {Function} Ctor The constructor to wrap. + * @returns {Function} Returns the new wrapped function. */ - function isArrayLike(value) { - return value != null && isLength(value.length) && !isFunction(value); + function createCtor(Ctor) { + return function() { + // Use a `switch` statement to work with class constructors. See + // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist + // for more details. + var args = arguments; + switch (args.length) { + case 0: return new Ctor; + case 1: return new Ctor(args[0]); + case 2: return new Ctor(args[0], args[1]); + case 3: return new Ctor(args[0], args[1], args[2]); + case 4: return new Ctor(args[0], args[1], args[2], args[3]); + case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); + case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); + case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); + } + var thisBinding = baseCreate(Ctor.prototype), + result = Ctor.apply(thisBinding, args); + + // Mimic the constructor's `return` behavior. + // See https://es5.github.io/#x13.2.2 for more details. + return isObject(result) ? result : thisBinding; + }; } /** - * This method is like `_.isArrayLike` except that it also checks if `value` - * is an object. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array-like object, - * else `false`. - * @example - * - * _.isArrayLikeObject([1, 2, 3]); - * // => true - * - * _.isArrayLikeObject(document.body.children); - * // => true - * - * _.isArrayLikeObject('abc'); - * // => false + * Creates a function that wraps `func` to enable currying. * - * _.isArrayLikeObject(_.noop); - * // => false + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {number} arity The arity of `func`. + * @returns {Function} Returns the new wrapped function. */ - function isArrayLikeObject(value) { - return isObjectLike(value) && isArrayLike(value); + function createCurry(func, bitmask, arity) { + var Ctor = createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length, + placeholder = getHolder(wrapper); + + while (index--) { + args[index] = arguments[index]; + } + var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) + ? [] + : replaceHolders(args, placeholder); + + length -= holders.length; + if (length < arity) { + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, undefined, + args, holders, undefined, undefined, arity - length); + } + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return apply(fn, this, args); + } + return wrapper; } /** - * Checks if `value` is classified as a boolean primitive or object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. - * @example - * - * _.isBoolean(false); - * // => true + * Creates a `_.find` or `_.findLast` function. * - * _.isBoolean(null); - * // => false + * @private + * @param {Function} findIndexFunc The function to find the collection index. + * @returns {Function} Returns the new find function. */ - function isBoolean(value) { - return value === true || value === false || - (isObjectLike(value) && baseGetTag(value) == boolTag); + function createFind(findIndexFunc) { + return function(collection, predicate, fromIndex) { + var iterable = Object(collection); + if (!isArrayLike(collection)) { + var iteratee = getIteratee(predicate, 3); + collection = keys(collection); + predicate = function(key) { return iteratee(iterable[key], key, iterable); }; + } + var index = findIndexFunc(collection, predicate, fromIndex); + return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; + }; } /** - * Checks if `value` is a buffer. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. - * @example + * Creates a `_.flow` or `_.flowRight` function. * - * _.isBuffer(new Buffer(2)); - * // => true - * - * _.isBuffer(new Uint8Array(2)); - * // => false + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new flow function. */ - var isBuffer = nativeIsBuffer || stubFalse; + function createFlow(fromRight) { + return flatRest(function(funcs) { + var length = funcs.length, + index = length, + prereq = LodashWrapper.prototype.thru; - /** - * Checks if `value` is classified as a `Date` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - * @example - * - * _.isDate(new Date); - * // => true - * - * _.isDate('Mon April 23 2012'); - * // => false - */ - var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; + if (fromRight) { + funcs.reverse(); + } + while (index--) { + var func = funcs[index]; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (prereq && !wrapper && getFuncName(func) == 'wrapper') { + var wrapper = new LodashWrapper([], true); + } + } + index = wrapper ? index : length; + while (++index < length) { + func = funcs[index]; - /** - * Checks if `value` is likely a DOM element. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. - * @example - * - * _.isElement(document.body); - * // => true - * - * _.isElement(''); - * // => false - */ - function isElement(value) { - return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); + var funcName = getFuncName(func), + data = funcName == 'wrapper' ? getData(func) : undefined; + + if (data && isLaziable(data[0]) && + data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && + !data[4].length && data[9] == 1 + ) { + wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); + } else { + wrapper = (func.length == 1 && isLaziable(func)) + ? wrapper[funcName]() + : wrapper.thru(func); + } + } + return function() { + var args = arguments, + value = args[0]; + + if (wrapper && args.length == 1 && isArray(value)) { + return wrapper.plant(value).value(); + } + var index = 0, + result = length ? funcs[index].apply(this, args) : value; + + while (++index < length) { + result = funcs[index].call(this, result); + } + return result; + }; + }); } /** - * Checks if `value` is an empty object, collection, map, or set. - * - * Objects are considered empty if they have no own enumerable string keyed - * properties. - * - * Array-like values such as `arguments` objects, arrays, buffers, strings, or - * jQuery-like collections are considered empty if they have a `length` of `0`. - * Similarly, maps and sets are considered empty if they have a `size` of `0`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is empty, else `false`. - * @example - * - * _.isEmpty(null); - * // => true - * - * _.isEmpty(true); - * // => true - * - * _.isEmpty(1); - * // => true - * - * _.isEmpty([1, 2, 3]); - * // => false + * Creates a function that wraps `func` to invoke it with optional `this` + * binding of `thisArg`, partial application, and currying. * - * _.isEmpty({ 'a': 1 }); - * // => false + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [partialsRight] The arguments to append to those provided + * to the new function. + * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. */ - function isEmpty(value) { - if (value == null) { - return true; - } - if (isArrayLike(value) && - (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || - isBuffer(value) || isTypedArray(value) || isArguments(value))) { - return !value.length; - } - var tag = getTag(value); - if (tag == mapTag || tag == setTag) { - return !value.size; - } - if (isPrototype(value)) { - return !baseKeys(value).length; - } - for (var key in value) { - if (hasOwnProperty.call(value, key)) { - return false; + function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { + var isAry = bitmask & WRAP_ARY_FLAG, + isBind = bitmask & WRAP_BIND_FLAG, + isBindKey = bitmask & WRAP_BIND_KEY_FLAG, + isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), + isFlip = bitmask & WRAP_FLIP_FLAG, + Ctor = isBindKey ? undefined : createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length; + + while (index--) { + args[index] = arguments[index]; + } + if (isCurried) { + var placeholder = getHolder(wrapper), + holdersCount = countHolders(args, placeholder); + } + if (partials) { + args = composeArgs(args, partials, holders, isCurried); + } + if (partialsRight) { + args = composeArgsRight(args, partialsRight, holdersRight, isCurried); + } + length -= holdersCount; + if (isCurried && length < arity) { + var newHolders = replaceHolders(args, placeholder); + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, thisArg, + args, newHolders, argPos, ary, arity - length + ); + } + var thisBinding = isBind ? thisArg : this, + fn = isBindKey ? thisBinding[func] : func; + + length = args.length; + if (argPos) { + args = reorder(args, argPos); + } else if (isFlip && length > 1) { + args.reverse(); + } + if (isAry && ary < length) { + args.length = ary; + } + if (this && this !== root && this instanceof wrapper) { + fn = Ctor || createCtor(fn); } + return fn.apply(thisBinding, args); } - return true; + return wrapper; } /** - * Performs a deep comparison between two values to determine if they are - * equivalent. - * - * **Note:** This method supports comparing arrays, array buffers, booleans, - * date objects, error objects, maps, numbers, `Object` objects, regexes, - * sets, strings, symbols, and typed arrays. `Object` objects are compared - * by their own, not inherited, enumerable properties. Functions and DOM - * nodes are compared by strict equality, i.e. `===`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.isEqual(object, other); - * // => true + * Creates a function like `_.invertBy`. * - * object === other; - * // => false + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} toIteratee The function to resolve iteratees. + * @returns {Function} Returns the new inverter function. */ - function isEqual(value, other) { - return baseIsEqual(value, other); + function createInverter(setter, toIteratee) { + return function(object, iteratee) { + return baseInverter(object, setter, toIteratee(iteratee), {}); + }; } /** - * This method is like `_.isEqual` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with up to - * six arguments: (objValue, othValue [, index|key, object, other, stack]). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, othValue) { - * if (isGreeting(objValue) && isGreeting(othValue)) { - * return true; - * } - * } - * - * var array = ['hello', 'goodbye']; - * var other = ['hi', 'goodbye']; + * Creates a function that performs a mathematical operation on two values. * - * _.isEqualWith(array, other, customizer); - * // => true + * @private + * @param {Function} operator The function to perform the operation. + * @param {number} [defaultValue] The value used for `undefined` arguments. + * @returns {Function} Returns the new mathematical operation function. */ - function isEqualWith(value, other, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - var result = customizer ? customizer(value, other) : undefined; - return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; + function createMathOperation(operator, defaultValue) { + return function(value, other) { + var result; + if (value === undefined && other === undefined) { + return defaultValue; + } + if (value !== undefined) { + result = value; + } + if (other !== undefined) { + if (result === undefined) { + return other; + } + if (typeof value == 'string' || typeof other == 'string') { + value = baseToString(value); + other = baseToString(other); + } else { + value = baseToNumber(value); + other = baseToNumber(other); + } + result = operator(value, other); + } + return result; + }; } /** - * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, - * `SyntaxError`, `TypeError`, or `URIError` object. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an error object, else `false`. - * @example - * - * _.isError(new Error); - * // => true + * Creates a function like `_.over`. * - * _.isError(Error); - * // => false + * @private + * @param {Function} arrayFunc The function to iterate over iteratees. + * @returns {Function} Returns the new over function. */ - function isError(value) { - if (!isObjectLike(value)) { - return false; - } - var tag = baseGetTag(value); - return tag == errorTag || tag == domExcTag || - (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); + function createOver(arrayFunc) { + return flatRest(function(iteratees) { + iteratees = arrayMap(iteratees, baseUnary(getIteratee())); + return baseRest(function(args) { + var thisArg = this; + return arrayFunc(iteratees, function(iteratee) { + return apply(iteratee, thisArg, args); + }); + }); + }); } /** - * Checks if `value` is a finite primitive number. - * - * **Note:** This method is based on - * [`Number.isFinite`](https://mdn.io/Number/isFinite). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. - * @example - * - * _.isFinite(3); - * // => true - * - * _.isFinite(Number.MIN_VALUE); - * // => true - * - * _.isFinite(Infinity); - * // => false + * Creates the padding for `string` based on `length`. The `chars` string + * is truncated if the number of characters exceeds `length`. * - * _.isFinite('3'); - * // => false + * @private + * @param {number} length The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padding for `string`. */ - function isFinite(value) { - return typeof value == 'number' && nativeIsFinite(value); - } + function createPadding(length, chars) { + chars = chars === undefined ? ' ' : baseToString(chars); - /** - * Checks if `value` is classified as a `Function` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a function, else `false`. - * @example - * - * _.isFunction(_); - * // => true - * - * _.isFunction(/abc/); - * // => false - */ - function isFunction(value) { - if (!isObject(value)) { - return false; + var charsLength = chars.length; + if (charsLength < 2) { + return charsLength ? baseRepeat(chars, length) : chars; } - // The use of `Object#toString` avoids issues with the `typeof` operator - // in Safari 9 which returns 'object' for typed arrays and other constructors. - var tag = baseGetTag(value); - return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; + var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); + return hasUnicode(chars) + ? castSlice(stringToArray(result), 0, length).join('') + : result.slice(0, length); } /** - * Checks if `value` is an integer. - * - * **Note:** This method is based on - * [`Number.isInteger`](https://mdn.io/Number/isInteger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an integer, else `false`. - * @example - * - * _.isInteger(3); - * // => true - * - * _.isInteger(Number.MIN_VALUE); - * // => false - * - * _.isInteger(Infinity); - * // => false + * Creates a function that wraps `func` to invoke it with the `this` binding + * of `thisArg` and `partials` prepended to the arguments it receives. * - * _.isInteger('3'); - * // => false + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} partials The arguments to prepend to those provided to + * the new function. + * @returns {Function} Returns the new wrapped function. */ - function isInteger(value) { - return typeof value == 'number' && value == toInteger(value); + function createPartial(func, bitmask, thisArg, partials) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var argsIndex = -1, + argsLength = arguments.length, + leftIndex = -1, + leftLength = partials.length, + args = Array(leftLength + argsLength), + fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + + while (++leftIndex < leftLength) { + args[leftIndex] = partials[leftIndex]; + } + while (argsLength--) { + args[leftIndex++] = arguments[++argsIndex]; + } + return apply(fn, isBind ? thisArg : this, args); + } + return wrapper; } /** - * Checks if `value` is a valid array-like length. - * - * **Note:** This method is loosely based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. - * @example - * - * _.isLength(3); - * // => true - * - * _.isLength(Number.MIN_VALUE); - * // => false - * - * _.isLength(Infinity); - * // => false + * Creates a `_.range` or `_.rangeRight` function. * - * _.isLength('3'); - * // => false + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new range function. */ - function isLength(value) { - return typeof value == 'number' && - value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; + function createRange(fromRight) { + return function(start, end, step) { + if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { + end = step = undefined; + } + // Ensure the sign of `-0` is preserved. + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); + return baseRange(start, end, step, fromRight); + }; } /** - * Checks if `value` is the - * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) - * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an object, else `false`. - * @example - * - * _.isObject({}); - * // => true - * - * _.isObject([1, 2, 3]); - * // => true - * - * _.isObject(_.noop); - * // => true + * Creates a function that performs a relational operation on two values. * - * _.isObject(null); - * // => false + * @private + * @param {Function} operator The function to perform the operation. + * @returns {Function} Returns the new relational operation function. */ - function isObject(value) { - var type = typeof value; - return value != null && (type == 'object' || type == 'function'); + function createRelationalOperation(operator) { + return function(value, other) { + if (!(typeof value == 'string' && typeof other == 'string')) { + value = toNumber(value); + other = toNumber(other); + } + return operator(value, other); + }; } /** - * Checks if `value` is object-like. A value is object-like if it's not `null` - * and has a `typeof` result of "object". - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is object-like, else `false`. - * @example - * - * _.isObjectLike({}); - * // => true - * - * _.isObjectLike([1, 2, 3]); - * // => true - * - * _.isObjectLike(_.noop); - * // => false + * Creates a function that wraps `func` to continue currying. * - * _.isObjectLike(null); - * // => false + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {Function} wrapFunc The function to create the `func` wrapper. + * @param {*} placeholder The placeholder value. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. */ - function isObjectLike(value) { - return value != null && typeof value == 'object'; + function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { + var isCurry = bitmask & WRAP_CURRY_FLAG, + newHolders = isCurry ? holders : undefined, + newHoldersRight = isCurry ? undefined : holders, + newPartials = isCurry ? partials : undefined, + newPartialsRight = isCurry ? undefined : partials; + + bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); + bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); + + if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { + bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); + } + var newData = [ + func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, + newHoldersRight, argPos, ary, arity + ]; + + var result = wrapFunc.apply(undefined, newData); + if (isLaziable(func)) { + setData(result, newData); + } + result.placeholder = placeholder; + return setWrapToString(result, func, bitmask); } /** - * Checks if `value` is classified as a `Map` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - * @example - * - * _.isMap(new Map); - * // => true + * Creates a function like `_.round`. * - * _.isMap(new WeakMap); - * // => false + * @private + * @param {string} methodName The name of the `Math` method to use when rounding. + * @returns {Function} Returns the new round function. */ - var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; + function createRound(methodName) { + var func = Math[methodName]; + return function(number, precision) { + number = toNumber(number); + precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); + if (precision) { + // Shift with exponential notation to avoid floating-point issues. + // See [MDN](https://mdn.io/round#Examples) for more details. + var pair = (toString(number) + 'e').split('e'), + value = func(pair[0] + 'e' + (+pair[1] + precision)); - /** - * Performs a partial deep comparison between `object` and `source` to - * determine if `object` contains equivalent property values. - * - * **Note:** This method is equivalent to `_.matches` when `source` is - * partially applied. - * - * Partial comparisons will match empty array and empty object `source` - * values against any array or object value, respectively. See `_.isEqual` - * for a list of supported value comparisons. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * - * _.isMatch(object, { 'b': 2 }); - * // => true - * - * _.isMatch(object, { 'b': 1 }); - * // => false - */ - function isMatch(object, source) { - return object === source || baseIsMatch(object, source, getMatchData(source)); + pair = (toString(value) + 'e').split('e'); + return +(pair[0] + 'e' + (+pair[1] - precision)); + } + return func(number); + }; } /** - * This method is like `_.isMatch` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with five - * arguments: (objValue, srcValue, index|key, object, source). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - * @example - * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, srcValue) { - * if (isGreeting(objValue) && isGreeting(srcValue)) { - * return true; - * } - * } - * - * var object = { 'greeting': 'hello' }; - * var source = { 'greeting': 'hi' }; + * Creates a set object of `values`. * - * _.isMatchWith(object, source, customizer); - * // => true + * @private + * @param {Array} values The values to add to the set. + * @returns {Object} Returns the new set. */ - function isMatchWith(object, source, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseIsMatch(object, source, getMatchData(source), customizer); - } + var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { + return new Set(values); + }; /** - * Checks if `value` is `NaN`. - * - * **Note:** This method is based on - * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as - * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for - * `undefined` and other non-number values. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - * @example - * - * _.isNaN(NaN); - * // => true - * - * _.isNaN(new Number(NaN)); - * // => true - * - * isNaN(undefined); - * // => true + * Creates a `_.toPairs` or `_.toPairsIn` function. * - * _.isNaN(undefined); - * // => false + * @private + * @param {Function} keysFunc The function to get the keys of a given object. + * @returns {Function} Returns the new pairs function. */ - function isNaN(value) { - // An `NaN` primitive is the only value that is not equal to itself. - // Perform the `toStringTag` check first to avoid errors with some - // ActiveX objects in IE. - return isNumber(value) && value != +value; + function createToPairs(keysFunc) { + return function(object) { + var tag = getTag(object); + if (tag == mapTag) { + return mapToArray(object); + } + if (tag == setTag) { + return setToPairs(object); + } + return baseToPairs(object, keysFunc(object)); + }; } /** - * Checks if `value` is a pristine native function. - * - * **Note:** This method can't reliably detect native functions in the presence - * of the core-js package because core-js circumvents this kind of detection. - * Despite multiple requests, the core-js maintainer has made it clear: any - * attempt to fix the detection will be obstructed. As a result, we're left - * with little choice but to throw an error. Unfortunately, this also affects - * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), - * which rely on core-js. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - * @example - * - * _.isNative(Array.prototype.push); - * // => true + * Creates a function that either curries or invokes `func` with optional + * `this` binding and partially applied arguments. * - * _.isNative(_); - * // => false + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. + * 1 - `_.bind` + * 2 - `_.bindKey` + * 4 - `_.curry` or `_.curryRight` of a bound function + * 8 - `_.curry` + * 16 - `_.curryRight` + * 32 - `_.partial` + * 64 - `_.partialRight` + * 128 - `_.rearg` + * 256 - `_.ary` + * 512 - `_.flip` + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to be partially applied. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. */ - function isNative(value) { - if (isMaskable(value)) { - throw new Error(CORE_ERROR_TEXT); + function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { + var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; + if (!isBindKey && typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); } - return baseIsNative(value); + var length = partials ? partials.length : 0; + if (!length) { + bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); + partials = holders = undefined; + } + ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); + arity = arity === undefined ? arity : toInteger(arity); + length -= holders ? holders.length : 0; + + if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { + var partialsRight = partials, + holdersRight = holders; + + partials = holders = undefined; + } + var data = isBindKey ? undefined : getData(func); + + var newData = [ + func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, + argPos, ary, arity + ]; + + if (data) { + mergeData(newData, data); + } + func = newData[0]; + bitmask = newData[1]; + thisArg = newData[2]; + partials = newData[3]; + holders = newData[4]; + arity = newData[9] = newData[9] === undefined + ? (isBindKey ? 0 : func.length) + : nativeMax(newData[9] - length, 0); + + if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { + bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); + } + if (!bitmask || bitmask == WRAP_BIND_FLAG) { + var result = createBind(func, bitmask, thisArg); + } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { + result = createCurry(func, bitmask, arity); + } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { + result = createPartial(func, bitmask, thisArg, partials); + } else { + result = createHybrid.apply(undefined, newData); + } + var setter = data ? baseSetData : setData; + return setWrapToString(setter(result, newData), func, bitmask); } /** - * Checks if `value` is `null`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `null`, else `false`. - * @example - * - * _.isNull(null); - * // => true + * Used by `_.defaults` to customize its `_.assignIn` use to assign properties + * of source objects to the destination object for all destination properties + * that resolve to `undefined`. * - * _.isNull(void 0); - * // => false + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to assign. + * @param {Object} object The parent object of `objValue`. + * @returns {*} Returns the value to assign. */ - function isNull(value) { - return value === null; + function customDefaultsAssignIn(objValue, srcValue, key, object) { + if (objValue === undefined || + (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { + return srcValue; + } + return objValue; } /** - * Checks if `value` is `null` or `undefined`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is nullish, else `false`. - * @example - * - * _.isNil(null); - * // => true - * - * _.isNil(void 0); - * // => true + * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source + * objects into destination objects that are passed thru. * - * _.isNil(NaN); - * // => false + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to merge. + * @param {Object} object The parent object of `objValue`. + * @param {Object} source The parent object of `srcValue`. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + * @returns {*} Returns the value to assign. */ - function isNil(value) { - return value == null; + function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { + if (isObject(objValue) && isObject(srcValue)) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, objValue); + baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); + stack['delete'](srcValue); + } + return objValue; } /** - * Checks if `value` is classified as a `Number` primitive or object. - * - * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are - * classified as numbers, use the `_.isFinite` method. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a number, else `false`. - * @example - * - * _.isNumber(3); - * // => true - * - * _.isNumber(Number.MIN_VALUE); - * // => true - * - * _.isNumber(Infinity); - * // => true + * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain + * objects. * - * _.isNumber('3'); - * // => false + * @private + * @param {*} value The value to inspect. + * @param {string} key The key of the property to inspect. + * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. */ - function isNumber(value) { - return typeof value == 'number' || - (isObjectLike(value) && baseGetTag(value) == numberTag); + function customOmitClone(value) { + return isPlainObject(value) ? undefined : value; } /** - * Checks if `value` is a plain object, that is, an object created by the - * `Object` constructor or one with a `[[Prototype]]` of `null`. - * - * @static - * @memberOf _ - * @since 0.8.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * _.isPlainObject(new Foo); - * // => false - * - * _.isPlainObject([1, 2, 3]); - * // => false - * - * _.isPlainObject({ 'x': 0, 'y': 0 }); - * // => true + * A specialized version of `baseIsEqualDeep` for arrays with support for + * partial deep comparisons. * - * _.isPlainObject(Object.create(null)); - * // => true + * @private + * @param {Array} array The array to compare. + * @param {Array} other The other array to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `array` and `other` objects. + * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. */ - function isPlainObject(value) { - if (!isObjectLike(value) || baseGetTag(value) != objectTag) { + function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + arrLength = array.length, + othLength = other.length; + + if (arrLength != othLength && !(isPartial && othLength > arrLength)) { return false; } - var proto = getPrototype(value); - if (proto === null) { - return true; + // Assume cyclic values are equal. + var stacked = stack.get(array); + if (stacked && stack.get(other)) { + return stacked == other; } - var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; - return typeof Ctor == 'function' && Ctor instanceof Ctor && - funcToString.call(Ctor) == objectCtorString; - } + var index = -1, + result = true, + seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; - /** - * Checks if `value` is classified as a `RegExp` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - * @example + stack.set(array, other); + stack.set(other, array); + + // Ignore non-index properties. + while (++index < arrLength) { + var arrValue = array[index], + othValue = other[index]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, arrValue, index, other, array, stack) + : customizer(arrValue, othValue, index, array, other, stack); + } + if (compared !== undefined) { + if (compared) { + continue; + } + result = false; + break; + } + // Recursively compare arrays (susceptible to call stack limits). + if (seen) { + if (!arraySome(other, function(othValue, othIndex) { + if (!cacheHas(seen, othIndex) && + (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { + return seen.push(othIndex); + } + })) { + result = false; + break; + } + } else if (!( + arrValue === othValue || + equalFunc(arrValue, othValue, bitmask, customizer, stack) + )) { + result = false; + break; + } + } + stack['delete'](array); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseIsEqualDeep` for comparing objects of + * the same `toStringTag`. * - * _.isRegExp(/abc/); - * // => true + * **Note:** This function only supports comparing values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. * - * _.isRegExp('/abc/'); - * // => false + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {string} tag The `toStringTag` of the objects to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ - var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; + function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { + switch (tag) { + case dataViewTag: + if ((object.byteLength != other.byteLength) || + (object.byteOffset != other.byteOffset)) { + return false; + } + object = object.buffer; + other = other.buffer; + + case arrayBufferTag: + if ((object.byteLength != other.byteLength) || + !equalFunc(new Uint8Array(object), new Uint8Array(other))) { + return false; + } + return true; + + case boolTag: + case dateTag: + case numberTag: + // Coerce booleans to `1` or `0` and dates to milliseconds. + // Invalid dates are coerced to `NaN`. + return eq(+object, +other); + + case errorTag: + return object.name == other.name && object.message == other.message; + + case regexpTag: + case stringTag: + // Coerce regexes to strings and treat strings, primitives and objects, + // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring + // for more details. + return object == (other + ''); + + case mapTag: + var convert = mapToArray; + + case setTag: + var isPartial = bitmask & COMPARE_PARTIAL_FLAG; + convert || (convert = setToArray); + + if (object.size != other.size && !isPartial) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked) { + return stacked == other; + } + bitmask |= COMPARE_UNORDERED_FLAG; + + // Recursively compare objects (susceptible to call stack limits). + stack.set(object, other); + var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); + stack['delete'](object); + return result; + + case symbolTag: + if (symbolValueOf) { + return symbolValueOf.call(object) == symbolValueOf.call(other); + } + } + return false; + } /** - * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 - * double precision number which isn't the result of a rounded unsafe integer. - * - * **Note:** This method is based on - * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. - * @example - * - * _.isSafeInteger(3); - * // => true - * - * _.isSafeInteger(Number.MIN_VALUE); - * // => false - * - * _.isSafeInteger(Infinity); - * // => false + * A specialized version of `baseIsEqualDeep` for objects with support for + * partial deep comparisons. * - * _.isSafeInteger('3'); - * // => false + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ - function isSafeInteger(value) { - return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; + function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + objProps = getAllKeys(object), + objLength = objProps.length, + othProps = getAllKeys(other), + othLength = othProps.length; + + if (objLength != othLength && !isPartial) { + return false; + } + var index = objLength; + while (index--) { + var key = objProps[index]; + if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { + return false; + } + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked && stack.get(other)) { + return stacked == other; + } + var result = true; + stack.set(object, other); + stack.set(other, object); + + var skipCtor = isPartial; + while (++index < objLength) { + key = objProps[index]; + var objValue = object[key], + othValue = other[key]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, objValue, key, other, object, stack) + : customizer(objValue, othValue, key, object, other, stack); + } + // Recursively compare objects (susceptible to call stack limits). + if (!(compared === undefined + ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) + : compared + )) { + result = false; + break; + } + skipCtor || (skipCtor = key == 'constructor'); + } + if (result && !skipCtor) { + var objCtor = object.constructor, + othCtor = other.constructor; + + // Non `Object` object instances with different constructors are not equal. + if (objCtor != othCtor && + ('constructor' in object && 'constructor' in other) && + !(typeof objCtor == 'function' && objCtor instanceof objCtor && + typeof othCtor == 'function' && othCtor instanceof othCtor)) { + result = false; + } + } + stack['delete'](object); + stack['delete'](other); + return result; } /** - * Checks if `value` is classified as a `Set` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - * @example - * - * _.isSet(new Set); - * // => true + * A specialized version of `baseRest` which flattens the rest array. * - * _.isSet(new WeakSet); - * // => false + * @private + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. */ - var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; + function flatRest(func) { + return setToString(overRest(func, undefined, flatten), func + ''); + } /** - * Checks if `value` is classified as a `String` primitive or object. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a string, else `false`. - * @example - * - * _.isString('abc'); - * // => true + * Creates an array of own enumerable property names and symbols of `object`. * - * _.isString(1); - * // => false + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. */ - function isString(value) { - return typeof value == 'string' || - (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); + function getAllKeys(object) { + return baseGetAllKeys(object, keys, getSymbols); } /** - * Checks if `value` is classified as a `Symbol` primitive or object. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. - * @example - * - * _.isSymbol(Symbol.iterator); - * // => true + * Creates an array of own and inherited enumerable property names and + * symbols of `object`. * - * _.isSymbol('abc'); - * // => false + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. */ - function isSymbol(value) { - return typeof value == 'symbol' || - (isObjectLike(value) && baseGetTag(value) == symbolTag); + function getAllKeysIn(object) { + return baseGetAllKeys(object, keysIn, getSymbolsIn); } /** - * Checks if `value` is classified as a typed array. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - * @example - * - * _.isTypedArray(new Uint8Array); - * // => true + * Gets metadata for `func`. * - * _.isTypedArray([]); - * // => false + * @private + * @param {Function} func The function to query. + * @returns {*} Returns the metadata for `func`. */ - var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; + var getData = !metaMap ? noop : function(func) { + return metaMap.get(func); + }; /** - * Checks if `value` is `undefined`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. - * @example - * - * _.isUndefined(void 0); - * // => true + * Gets the name of `func`. * - * _.isUndefined(null); - * // => false + * @private + * @param {Function} func The function to query. + * @returns {string} Returns the function name. */ - function isUndefined(value) { - return value === undefined; + function getFuncName(func) { + var result = (func.name + ''), + array = realNames[result], + length = hasOwnProperty.call(realNames, result) ? array.length : 0; + + while (length--) { + var data = array[length], + otherFunc = data.func; + if (otherFunc == null || otherFunc == func) { + return data.name; + } + } + return result; } /** - * Checks if `value` is classified as a `WeakMap` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. - * @example - * - * _.isWeakMap(new WeakMap); - * // => true + * Gets the argument placeholder value for `func`. * - * _.isWeakMap(new Map); - * // => false + * @private + * @param {Function} func The function to inspect. + * @returns {*} Returns the placeholder value. */ - function isWeakMap(value) { - return isObjectLike(value) && getTag(value) == weakMapTag; + function getHolder(func) { + var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; + return object.placeholder; } /** - * Checks if `value` is classified as a `WeakSet` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. - * @example - * - * _.isWeakSet(new WeakSet); - * // => true + * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, + * this function returns the custom method, otherwise it returns `baseIteratee`. + * If arguments are provided, the chosen function is invoked with them and + * its result is returned. * - * _.isWeakSet(new Set); - * // => false + * @private + * @param {*} [value] The value to convert to an iteratee. + * @param {number} [arity] The arity of the created iteratee. + * @returns {Function} Returns the chosen function or its result. */ - function isWeakSet(value) { - return isObjectLike(value) && baseGetTag(value) == weakSetTag; + function getIteratee() { + var result = lodash.iteratee || iteratee; + result = result === iteratee ? baseIteratee : result; + return arguments.length ? result(arguments[0], arguments[1]) : result; } /** - * Checks if `value` is less than `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - * @see _.gt - * @example - * - * _.lt(1, 3); - * // => true - * - * _.lt(3, 3); - * // => false + * Gets the data for `map`. * - * _.lt(3, 1); - * // => false + * @private + * @param {Object} map The map to query. + * @param {string} key The reference key. + * @returns {*} Returns the map data. */ - var lt = createRelationalOperation(baseLt); + function getMapData(map, key) { + var data = map.__data__; + return isKeyable(key) + ? data[typeof key == 'string' ? 'string' : 'hash'] + : data.map; + } /** - * Checks if `value` is less than or equal to `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than or equal to - * `other`, else `false`. - * @see _.gte - * @example - * - * _.lte(1, 3); - * // => true - * - * _.lte(3, 3); - * // => true + * Gets the property names, values, and compare flags of `object`. * - * _.lte(3, 1); - * // => false + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the match data of `object`. */ - var lte = createRelationalOperation(function(value, other) { - return value <= other; - }); + function getMatchData(object) { + var result = keys(object), + length = result.length; + + while (length--) { + var key = result[length], + value = object[key]; + + result[length] = [key, value, isStrictComparable(value)]; + } + return result; + } /** - * Converts `value` to an array. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to convert. - * @returns {Array} Returns the converted array. - * @example - * - * _.toArray({ 'a': 1, 'b': 2 }); - * // => [1, 2] + * Gets the native function at `key` of `object`. * - * _.toArray('abc'); - * // => ['a', 'b', 'c'] + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. + */ + function getNative(object, key) { + var value = getValue(object, key); + return baseIsNative(value) ? value : undefined; + } + + /** + * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. * - * _.toArray(1); - * // => [] + * @private + * @param {*} value The value to query. + * @returns {string} Returns the raw `toStringTag`. + */ + function getRawTag(value) { + var isOwn = hasOwnProperty.call(value, symToStringTag), + tag = value[symToStringTag]; + + try { + value[symToStringTag] = undefined; + var unmasked = true; + } catch (e) {} + + var result = nativeObjectToString.call(value); + if (unmasked) { + if (isOwn) { + value[symToStringTag] = tag; + } else { + delete value[symToStringTag]; + } + } + return result; + } + + /** + * Creates an array of the own enumerable symbols of `object`. * - * _.toArray(null); - * // => [] + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. */ - function toArray(value) { - if (!value) { + var getSymbols = !nativeGetSymbols ? stubArray : function(object) { + if (object == null) { return []; } - if (isArrayLike(value)) { - return isString(value) ? stringToArray(value) : copyArray(value); - } - if (symIterator && value[symIterator]) { - return iteratorToArray(value[symIterator]()); + object = Object(object); + return arrayFilter(nativeGetSymbols(object), function(symbol) { + return propertyIsEnumerable.call(object, symbol); + }); + }; + + /** + * Creates an array of the own and inherited enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { + var result = []; + while (object) { + arrayPush(result, getSymbols(object)); + object = getPrototype(object); } - var tag = getTag(value), - func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); + return result; + }; - return func(value); + /** + * Gets the `toStringTag` of `value`. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + var getTag = baseGetTag; + + // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. + if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || + (Map && getTag(new Map) != mapTag) || + (Promise && getTag(Promise.resolve()) != promiseTag) || + (Set && getTag(new Set) != setTag) || + (WeakMap && getTag(new WeakMap) != weakMapTag)) { + getTag = function(value) { + var result = baseGetTag(value), + Ctor = result == objectTag ? value.constructor : undefined, + ctorString = Ctor ? toSource(Ctor) : ''; + + if (ctorString) { + switch (ctorString) { + case dataViewCtorString: return dataViewTag; + case mapCtorString: return mapTag; + case promiseCtorString: return promiseTag; + case setCtorString: return setTag; + case weakMapCtorString: return weakMapTag; + } + } + return result; + }; } /** - * Converts `value` to a finite number. - * - * @static - * @memberOf _ - * @since 4.12.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted number. - * @example - * - * _.toFinite(3.2); - * // => 3.2 + * Gets the view, applying any `transforms` to the `start` and `end` positions. * - * _.toFinite(Number.MIN_VALUE); - * // => 5e-324 + * @private + * @param {number} start The start of the view. + * @param {number} end The end of the view. + * @param {Array} transforms The transformations to apply to the view. + * @returns {Object} Returns an object containing the `start` and `end` + * positions of the view. + */ + function getView(start, end, transforms) { + var index = -1, + length = transforms.length; + + while (++index < length) { + var data = transforms[index], + size = data.size; + + switch (data.type) { + case 'drop': start += size; break; + case 'dropRight': end -= size; break; + case 'take': end = nativeMin(end, start + size); break; + case 'takeRight': start = nativeMax(start, end - size); break; + } + } + return { 'start': start, 'end': end }; + } + + /** + * Extracts wrapper details from the `source` body comment. * - * _.toFinite(Infinity); - * // => 1.7976931348623157e+308 + * @private + * @param {string} source The source to inspect. + * @returns {Array} Returns the wrapper details. + */ + function getWrapDetails(source) { + var match = source.match(reWrapDetails); + return match ? match[1].split(reSplitDetails) : []; + } + + /** + * Checks if `path` exists on `object`. * - * _.toFinite('3.2'); - * // => 3.2 + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @param {Function} hasFunc The function to check properties. + * @returns {boolean} Returns `true` if `path` exists, else `false`. */ - function toFinite(value) { - if (!value) { - return value === 0 ? value : 0; + function hasPath(object, path, hasFunc) { + path = castPath(path, object); + + var index = -1, + length = path.length, + result = false; + + while (++index < length) { + var key = toKey(path[index]); + if (!(result = object != null && hasFunc(object, key))) { + break; + } + object = object[key]; } - value = toNumber(value); - if (value === INFINITY || value === -INFINITY) { - var sign = (value < 0 ? -1 : 1); - return sign * MAX_INTEGER; + if (result || ++index != length) { + return result; } - return value === value ? value : 0; + length = object == null ? 0 : object.length; + return !!length && isLength(length) && isIndex(key, length) && + (isArray(object) || isArguments(object)); } /** - * Converts `value` to an integer. - * - * **Note:** This method is loosely based on - * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toInteger(3.2); - * // => 3 - * - * _.toInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toInteger(Infinity); - * // => 1.7976931348623157e+308 + * Initializes an array clone. * - * _.toInteger('3.2'); - * // => 3 + * @private + * @param {Array} array The array to clone. + * @returns {Array} Returns the initialized clone. */ - function toInteger(value) { - var result = toFinite(value), - remainder = result % 1; + function initCloneArray(array) { + var length = array.length, + result = array.constructor(length); - return result === result ? (remainder ? result - remainder : result) : 0; + // Add properties assigned by `RegExp#exec`. + if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { + result.index = array.index; + result.input = array.input; + } + return result; } /** - * Converts `value` to an integer suitable for use as the length of an - * array-like object. - * - * **Note:** This method is based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toLength(3.2); - * // => 3 - * - * _.toLength(Number.MIN_VALUE); - * // => 0 - * - * _.toLength(Infinity); - * // => 4294967295 + * Initializes an object clone. * - * _.toLength('3.2'); - * // => 3 + * @private + * @param {Object} object The object to clone. + * @returns {Object} Returns the initialized clone. */ - function toLength(value) { - return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; + function initCloneObject(object) { + return (typeof object.constructor == 'function' && !isPrototype(object)) + ? baseCreate(getPrototype(object)) + : {}; } /** - * Converts `value` to a number. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to process. - * @returns {number} Returns the number. - * @example - * - * _.toNumber(3.2); - * // => 3.2 - * - * _.toNumber(Number.MIN_VALUE); - * // => 5e-324 + * Initializes an object clone based on its `toStringTag`. * - * _.toNumber(Infinity); - * // => Infinity + * **Note:** This function only supports cloning values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. * - * _.toNumber('3.2'); - * // => 3.2 + * @private + * @param {Object} object The object to clone. + * @param {string} tag The `toStringTag` of the object to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the initialized clone. */ - function toNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - if (isObject(value)) { - var other = typeof value.valueOf == 'function' ? value.valueOf() : value; - value = isObject(other) ? (other + '') : other; - } - if (typeof value != 'string') { - return value === 0 ? value : +value; + function initCloneByTag(object, tag, cloneFunc, isDeep) { + var Ctor = object.constructor; + switch (tag) { + case arrayBufferTag: + return cloneArrayBuffer(object); + + case boolTag: + case dateTag: + return new Ctor(+object); + + case dataViewTag: + return cloneDataView(object, isDeep); + + case float32Tag: case float64Tag: + case int8Tag: case int16Tag: case int32Tag: + case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: + return cloneTypedArray(object, isDeep); + + case mapTag: + return cloneMap(object, isDeep, cloneFunc); + + case numberTag: + case stringTag: + return new Ctor(object); + + case regexpTag: + return cloneRegExp(object); + + case setTag: + return cloneSet(object, isDeep, cloneFunc); + + case symbolTag: + return cloneSymbol(object); } - value = value.replace(reTrim, ''); - var isBinary = reIsBinary.test(value); - return (isBinary || reIsOctal.test(value)) - ? freeParseInt(value.slice(2), isBinary ? 2 : 8) - : (reIsBadHex.test(value) ? NAN : +value); } /** - * Converts `value` to a plain object flattening inherited enumerable string - * keyed properties of `value` to own properties of the plain object. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {Object} Returns the converted plain object. - * @example - * - * function Foo() { - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.assign({ 'a': 1 }, new Foo); - * // => { 'a': 1, 'b': 2 } + * Inserts wrapper `details` in a comment at the top of the `source` body. * - * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); - * // => { 'a': 1, 'b': 2, 'c': 3 } + * @private + * @param {string} source The source to modify. + * @returns {Array} details The details to insert. + * @returns {string} Returns the modified source. */ - function toPlainObject(value) { - return copyObject(value, keysIn(value)); + function insertWrapDetails(source, details) { + var length = details.length; + if (!length) { + return source; + } + var lastIndex = length - 1; + details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; + details = details.join(length > 2 ? ', ' : ' '); + return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); } /** - * Converts `value` to a safe integer. A safe integer can be compared and - * represented correctly. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toSafeInteger(3.2); - * // => 3 - * - * _.toSafeInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toSafeInteger(Infinity); - * // => 9007199254740991 + * Checks if `value` is a flattenable `arguments` object or array. * - * _.toSafeInteger('3.2'); - * // => 3 + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. */ - function toSafeInteger(value) { - return value - ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) - : (value === 0 ? value : 0); + function isFlattenable(value) { + return isArray(value) || isArguments(value) || + !!(spreadableSymbol && value && value[spreadableSymbol]); } /** - * Converts `value` to a string. An empty string is returned for `null` - * and `undefined` values. The sign of `-0` is preserved. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. - * @example - * - * _.toString(null); - * // => '' - * - * _.toString(-0); - * // => '-0' + * Checks if `value` is a valid array-like index. * - * _.toString([1, 2, 3]); - * // => '1,2,3' + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. */ - function toString(value) { - return value == null ? '' : baseToString(value); + function isIndex(value, length) { + length = length == null ? MAX_SAFE_INTEGER : length; + return !!length && + (typeof value == 'number' || reIsUint.test(value)) && + (value > -1 && value % 1 == 0 && value < length); } - /*------------------------------------------------------------------------*/ - /** - * Assigns own enumerable string keyed properties of source objects to the - * destination object. Source objects are applied from left to right. - * Subsequent sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object` and is loosely based on - * [`Object.assign`](https://mdn.io/Object/assign). - * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assignIn - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * function Bar() { - * this.c = 3; - * } - * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; + * Checks if the given arguments are from an iteratee call. * - * _.assign({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'c': 3 } + * @private + * @param {*} value The potential iteratee value argument. + * @param {*} index The potential iteratee index or key argument. + * @param {*} object The potential iteratee object argument. + * @returns {boolean} Returns `true` if the arguments are from an iteratee call, + * else `false`. */ - var assign = createAssigner(function(object, source) { - if (isPrototype(source) || isArrayLike(source)) { - copyObject(source, keys(source), object); - return; + function isIterateeCall(value, index, object) { + if (!isObject(object)) { + return false; } - for (var key in source) { - if (hasOwnProperty.call(source, key)) { - assignValue(object, key, source[key]); - } + var type = typeof index; + if (type == 'number' + ? (isArrayLike(object) && isIndex(index, object.length)) + : (type == 'string' && index in object) + ) { + return eq(object[index], value); } - }); + return false; + } /** - * This method is like `_.assign` except that it iterates over own and - * inherited source properties. + * Checks if `value` is a property name and not a property path. * - * **Note:** This method mutates `object`. + * @private + * @param {*} value The value to check. + * @param {Object} [object] The object to query keys on. + * @returns {boolean} Returns `true` if `value` is a property name, else `false`. + */ + function isKey(value, object) { + if (isArray(value)) { + return false; + } + var type = typeof value; + if (type == 'number' || type == 'symbol' || type == 'boolean' || + value == null || isSymbol(value)) { + return true; + } + return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || + (object != null && value in Object(object)); + } + + /** + * Checks if `value` is suitable for use as unique object key. * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias extend - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assign - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * function Bar() { - * this.c = 3; - * } - * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; - * - * _.assignIn({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is suitable, else `false`. */ - var assignIn = createAssigner(function(object, source) { - copyObject(source, keysIn(source), object); - }); + function isKeyable(value) { + var type = typeof value; + return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') + ? (value !== '__proto__') + : (value === null); + } /** - * This method is like `_.assignIn` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). + * Checks if `func` has a lazy counterpart. * - * **Note:** This method mutates `object`. + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` has a lazy counterpart, + * else `false`. + */ + function isLaziable(func) { + var funcName = getFuncName(func), + other = lodash[funcName]; + + if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { + return false; + } + if (func === other) { + return true; + } + var data = getData(other); + return !!data && func === data[0]; + } + + /** + * Checks if `func` has its source masked. * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias extendWith - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignWith - * @example + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` is masked, else `false`. + */ + function isMasked(func) { + return !!maskSrcKey && (maskSrcKey in func); + } + + /** + * Checks if `func` is capable of being masked. * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `func` is maskable, else `false`. + */ + var isMaskable = coreJsData ? isFunction : stubFalse; + + /** + * Checks if `value` is likely a prototype object. * - * var defaults = _.partialRight(_.assignInWith, customizer); + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. + */ + function isPrototype(value) { + var Ctor = value && value.constructor, + proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; + + return value === proto; + } + + /** + * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` if suitable for strict + * equality comparisons, else `false`. */ - var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keysIn(source), object, customizer); - }); + function isStrictComparable(value) { + return value === value && !isObject(value); + } /** - * This method is like `_.assign` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). + * A specialized version of `matchesProperty` for source values suitable + * for strict equality comparisons, i.e. `===`. * - * **Note:** This method mutates `object`. + * @private + * @param {string} key The key of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function matchesStrictComparable(key, srcValue) { + return function(object) { + if (object == null) { + return false; + } + return object[key] === srcValue && + (srcValue !== undefined || (key in Object(object))); + }; + } + + /** + * A specialized version of `_.memoize` which clears the memoized function's + * cache when it exceeds `MAX_MEMOIZE_SIZE`. * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignInWith - * @example + * @private + * @param {Function} func The function to have its output memoized. + * @returns {Function} Returns the new memoized function. + */ + function memoizeCapped(func) { + var result = memoize(func, function(key) { + if (cache.size === MAX_MEMOIZE_SIZE) { + cache.clear(); + } + return key; + }); + + var cache = result.cache; + return result; + } + + /** + * Merges the function metadata of `source` into `data`. * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } + * Merging metadata reduces the number of wrappers used to invoke a function. + * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` + * may be applied regardless of execution order. Methods like `_.ary` and + * `_.rearg` modify function arguments, making the order in which they are + * executed important, preventing the merging of metadata. However, we make + * an exception for a safe combined case where curried functions have `_.ary` + * and or `_.rearg` applied. * - * var defaults = _.partialRight(_.assignWith, customizer); + * @private + * @param {Array} data The destination metadata. + * @param {Array} source The source metadata. + * @returns {Array} Returns `data`. + */ + function mergeData(data, source) { + var bitmask = data[1], + srcBitmask = source[1], + newBitmask = bitmask | srcBitmask, + isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); + + var isCombo = + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || + ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); + + // Exit early if metadata can't be merged. + if (!(isCommon || isCombo)) { + return data; + } + // Use source `thisArg` if available. + if (srcBitmask & WRAP_BIND_FLAG) { + data[2] = source[2]; + // Set when currying a bound function. + newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; + } + // Compose partial arguments. + var value = source[3]; + if (value) { + var partials = data[3]; + data[3] = partials ? composeArgs(partials, value, source[4]) : value; + data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; + } + // Compose partial right arguments. + value = source[5]; + if (value) { + partials = data[5]; + data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; + data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; + } + // Use source `argPos` if available. + value = source[7]; + if (value) { + data[7] = value; + } + // Use source `ary` if it's smaller. + if (srcBitmask & WRAP_ARY_FLAG) { + data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); + } + // Use source `arity` if one is not provided. + if (data[9] == null) { + data[9] = source[9]; + } + // Use source `func` and merge bitmasks. + data[0] = source[0]; + data[1] = newBitmask; + + return data; + } + + /** + * This function is like + * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * except that it includes inherited enumerable properties. * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. */ - var assignWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keys(source), object, customizer); - }); + function nativeKeysIn(object) { + var result = []; + if (object != null) { + for (var key in Object(object)) { + result.push(key); + } + } + return result; + } /** - * Creates an array of values corresponding to `paths` of `object`. + * Converts `value` to a string using `Object.prototype.toString`. * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Array} Returns the picked values. - * @example + * @private + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + */ + function objectToString(value) { + return nativeObjectToString.call(value); + } + + /** + * A specialized version of `baseRest` which transforms the rest array. * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @param {Function} transform The rest array transform. + * @returns {Function} Returns the new function. + */ + function overRest(func, start, transform) { + start = nativeMax(start === undefined ? (func.length - 1) : start, 0); + return function() { + var args = arguments, + index = -1, + length = nativeMax(args.length - start, 0), + array = Array(length); + + while (++index < length) { + array[index] = args[start + index]; + } + index = -1; + var otherArgs = Array(start + 1); + while (++index < start) { + otherArgs[index] = args[index]; + } + otherArgs[start] = transform(array); + return apply(func, this, otherArgs); + }; + } + + /** + * Gets the parent value at `path` of `object`. * - * _.at(object, ['a[0].b.c', 'a[1]']); - * // => [3, 4] + * @private + * @param {Object} object The object to query. + * @param {Array} path The path to get the parent value of. + * @returns {*} Returns the parent value. */ - var at = flatRest(baseAt); + function parent(object, path) { + return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); + } /** - * Creates an object that inherits from the `prototype` object. If a - * `properties` object is given, its own enumerable string keyed properties - * are assigned to the created object. + * Reorder `array` according to the specified indexes where the element at + * the first index is assigned as the first element, the element at + * the second index is assigned as the second element, and so on. * - * @static - * @memberOf _ - * @since 2.3.0 - * @category Object - * @param {Object} prototype The object to inherit from. - * @param {Object} [properties] The properties to assign to the object. - * @returns {Object} Returns the new object. - * @example + * @private + * @param {Array} array The array to reorder. + * @param {Array} indexes The arranged array indexes. + * @returns {Array} Returns `array`. + */ + function reorder(array, indexes) { + var arrLength = array.length, + length = nativeMin(indexes.length, arrLength), + oldArray = copyArray(array); + + while (length--) { + var index = indexes[length]; + array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; + } + return array; + } + + /** + * Sets metadata for `func`. * - * function Shape() { - * this.x = 0; - * this.y = 0; - * } + * **Note:** If this function becomes hot, i.e. is invoked a lot in a short + * period of time, it will trip its breaker and transition to an identity + * function to avoid garbage collection pauses in V8. See + * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) + * for more details. * - * function Circle() { - * Shape.call(this); - * } + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var setData = shortOut(baseSetData); + + /** + * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). * - * Circle.prototype = _.create(Shape.prototype, { - * 'constructor': Circle - * }); + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @returns {number|Object} Returns the timer id or timeout object. + */ + var setTimeout = ctxSetTimeout || function(func, wait) { + return root.setTimeout(func, wait); + }; + + /** + * Sets the `toString` method of `func` to return `string`. * - * var circle = new Circle; - * circle instanceof Circle; - * // => true + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var setToString = shortOut(baseSetToString); + + /** + * Sets the `toString` method of `wrapper` to mimic the source of `reference` + * with wrapper details in a comment at the top of the source body. * - * circle instanceof Shape; - * // => true + * @private + * @param {Function} wrapper The function to modify. + * @param {Function} reference The reference function. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Function} Returns `wrapper`. */ - function create(prototype, properties) { - var result = baseCreate(prototype); - return properties == null ? result : baseAssign(result, properties); + function setWrapToString(wrapper, reference, bitmask) { + var source = (reference + ''); + return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); } /** - * Assigns own and inherited enumerable string keyed properties of source - * objects to the destination object for all destination properties that - * resolve to `undefined`. Source objects are applied from left to right. - * Once a property is set, additional values of the same property are ignored. - * - * **Note:** This method mutates `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaultsDeep - * @example + * Creates a function that'll short out and invoke `identity` instead + * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` + * milliseconds. * - * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } + * @private + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new shortable function. */ - var defaults = baseRest(function(args) { - args.push(undefined, customDefaultsAssignIn); - return apply(assignInWith, undefined, args); - }); + function shortOut(func) { + var count = 0, + lastCalled = 0; + + return function() { + var stamp = nativeNow(), + remaining = HOT_SPAN - (stamp - lastCalled); + + lastCalled = stamp; + if (remaining > 0) { + if (++count >= HOT_COUNT) { + return arguments[0]; + } + } else { + count = 0; + } + return func.apply(undefined, arguments); + }; + } /** - * This method is like `_.defaults` except that it recursively assigns - * default properties. - * - * **Note:** This method mutates `object`. + * A specialized version of `_.shuffle` which mutates and sets the size of `array`. * - * @static - * @memberOf _ - * @since 3.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaults - * @example + * @private + * @param {Array} array The array to shuffle. + * @param {number} [size=array.length] The size of `array`. + * @returns {Array} Returns `array`. + */ + function shuffleSelf(array, size) { + var index = -1, + length = array.length, + lastIndex = length - 1; + + size = size === undefined ? length : size; + while (++index < size) { + var rand = baseRandom(index, lastIndex), + value = array[rand]; + + array[rand] = array[index]; + array[index] = value; + } + array.length = size; + return array; + } + + /** + * Converts `string` to a property path array. * - * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); - * // => { 'a': { 'b': 2, 'c': 3 } } + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the property path array. */ - var defaultsDeep = baseRest(function(args) { - args.push(undefined, customDefaultsMerge); - return apply(mergeWith, undefined, args); + var stringToPath = memoizeCapped(function(string) { + var result = []; + if (reLeadingDot.test(string)) { + result.push(''); + } + string.replace(rePropName, function(match, number, quote, string) { + result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match)); + }); + return result; }); /** - * This method is like `_.find` except that it returns the key of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. - * @example - * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findKey(users, function(o) { return o.age < 40; }); - * // => 'barney' (iteration order is not guaranteed) - * - * // The `_.matches` iteratee shorthand. - * _.findKey(users, { 'age': 1, 'active': true }); - * // => 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findKey(users, ['active', false]); - * // => 'fred' + * Converts `value` to a string key if it's not a string or symbol. * - * // The `_.property` iteratee shorthand. - * _.findKey(users, 'active'); - * // => 'barney' + * @private + * @param {*} value The value to inspect. + * @returns {string|symbol} Returns the key. */ - function findKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); + function toKey(value) { + if (typeof value == 'string' || isSymbol(value)) { + return value; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** - * This method is like `_.findKey` except that it iterates over elements of - * a collection in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. - * @example - * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findLastKey(users, function(o) { return o.age < 40; }); - * // => returns 'pebbles' assuming `_.findKey` returns 'barney' + * Converts `func` to its source code. * - * // The `_.matches` iteratee shorthand. - * _.findLastKey(users, { 'age': 36, 'active': true }); - * // => 'barney' + * @private + * @param {Function} func The function to convert. + * @returns {string} Returns the source code. + */ + function toSource(func) { + if (func != null) { + try { + return funcToString.call(func); + } catch (e) {} + try { + return (func + ''); + } catch (e) {} + } + return ''; + } + + /** + * Updates wrapper `details` based on `bitmask` flags. * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastKey(users, ['active', false]); - * // => 'fred' + * @private + * @returns {Array} details The details to modify. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Array} Returns `details`. + */ + function updateWrapDetails(details, bitmask) { + arrayEach(wrapFlags, function(pair) { + var value = '_.' + pair[0]; + if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { + details.push(value); + } + }); + return details.sort(); + } + + /** + * Creates a clone of `wrapper`. * - * // The `_.property` iteratee shorthand. - * _.findLastKey(users, 'active'); - * // => 'pebbles' + * @private + * @param {Object} wrapper The wrapper to clone. + * @returns {Object} Returns the cloned wrapper. */ - function findLastKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); + function wrapperClone(wrapper) { + if (wrapper instanceof LazyWrapper) { + return wrapper.clone(); + } + var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); + result.__actions__ = copyArray(wrapper.__actions__); + result.__index__ = wrapper.__index__; + result.__values__ = wrapper.__values__; + return result; } + /*------------------------------------------------------------------------*/ + /** - * Iterates over own and inherited enumerable string keyed properties of an - * object and invokes `iteratee` for each property. The iteratee is invoked - * with three arguments: (value, key, object). Iteratee functions may exit - * iteration early by explicitly returning `false`. + * Creates an array of elements split into groups the length of `size`. + * If `array` can't be split evenly, the final chunk will be the remaining + * elements. * * @static * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forInRight + * @since 3.0.0 + * @category Array + * @param {Array} array The array to process. + * @param {number} [size=1] The length of each chunk + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the new array of chunks. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * _.chunk(['a', 'b', 'c', 'd'], 2); + * // => [['a', 'b'], ['c', 'd']] * - * _.forIn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). + * _.chunk(['a', 'b', 'c', 'd'], 3); + * // => [['a', 'b', 'c'], ['d']] */ - function forIn(object, iteratee) { - return object == null - ? object - : baseFor(object, getIteratee(iteratee, 3), keysIn); + function chunk(array, size, guard) { + if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { + size = 1; + } else { + size = nativeMax(toInteger(size), 0); + } + var length = array == null ? 0 : array.length; + if (!length || size < 1) { + return []; + } + var index = 0, + resIndex = 0, + result = Array(nativeCeil(length / size)); + + while (index < length) { + result[resIndex++] = baseSlice(array, index, (index += size)); + } + return result; } /** - * This method is like `_.forIn` except that it iterates over properties of - * `object` in the opposite order. + * Creates an array with all falsey values removed. The values `false`, `null`, + * `0`, `""`, `undefined`, and `NaN` are falsey. * * @static * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forIn + * @since 0.1.0 + * @category Array + * @param {Array} array The array to compact. + * @returns {Array} Returns the new array of filtered values. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forInRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. + * _.compact([0, 1, false, 2, '', 3]); + * // => [1, 2, 3] */ - function forInRight(object, iteratee) { - return object == null - ? object - : baseForRight(object, getIteratee(iteratee, 3), keysIn); + function compact(array) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value) { + result[resIndex++] = value; + } + } + return result; } /** - * Iterates over own enumerable string keyed properties of an object and - * invokes `iteratee` for each property. The iteratee is invoked with three - * arguments: (value, key, object). Iteratee functions may exit iteration - * early by explicitly returning `false`. + * Creates a new array concatenating `array` with any additional arrays + * and/or values. * * @static * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwnRight + * @since 4.0.0 + * @category Array + * @param {Array} array The array to concatenate. + * @param {...*} [values] The values to concatenate. + * @returns {Array} Returns the new concatenated array. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } + * var array = [1]; + * var other = _.concat(array, 2, [3], [[4]]); * - * Foo.prototype.c = 3; + * console.log(other); + * // => [1, 2, 3, [4]] * - * _.forOwn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). + * console.log(array); + * // => [1] */ - function forOwn(object, iteratee) { - return object && baseForOwn(object, getIteratee(iteratee, 3)); + function concat() { + var length = arguments.length; + if (!length) { + return []; + } + var args = Array(length - 1), + array = arguments[0], + index = length; + + while (index--) { + args[index - 1] = arguments[index]; + } + return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); } /** - * This method is like `_.forOwn` except that it iterates over properties of - * `object` in the opposite order. + * Creates an array of `array` values not included in the other given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * **Note:** Unlike `_.pullAll`, this method returns a new array. * * @static * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwn + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.without, _.xor * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forOwnRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. + * _.difference([2, 1], [2, 3]); + * // => [1] */ - function forOwnRight(object, iteratee) { - return object && baseForOwnRight(object, getIteratee(iteratee, 3)); - } + var difference = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) + : []; + }); /** - * Creates an array of function property names from own enumerable properties - * of `object`. + * This method is like `_.difference` except that it accepts `iteratee` which + * is invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * **Note:** Unlike `_.pullAllBy`, this method returns a new array. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functionsIn + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. * @example * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); + * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2] * - * _.functions(new Foo); - * // => ['a', 'b'] + * // The `_.property` iteratee shorthand. + * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] */ - function functions(object) { - return object == null ? [] : baseFunctions(object, keys(object)); - } + var differenceBy = baseRest(function(array, values) { + var iteratee = last(values); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) + : []; + }); /** - * Creates an array of function property names from own and inherited - * enumerable properties of `object`. + * This method is like `_.difference` except that it accepts `comparator` + * which is invoked to compare elements of `array` to `values`. The order and + * references of result values are determined by the first array. The comparator + * is invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.pullAllWith`, this method returns a new array. * * @static * @memberOf _ * @since 4.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functions + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. * @example * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * - * _.functionsIn(new Foo); - * // => ['a', 'b', 'c'] + * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); + * // => [{ 'x': 2, 'y': 1 }] */ - function functionsIn(object) { - return object == null ? [] : baseFunctions(object, keysIn(object)); - } + var differenceWith = baseRest(function(array, values) { + var comparator = last(values); + if (isArrayLikeObject(comparator)) { + comparator = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) + : []; + }); /** - * Gets the value at `path` of `object`. If the resolved value is - * `undefined`, the `defaultValue` is returned in its place. + * Creates a slice of `array` with `n` elements dropped from the beginning. * * @static * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. + * @since 0.5.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. * @example * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * _.drop([1, 2, 3]); + * // => [2, 3] * - * _.get(object, 'a[0].b.c'); - * // => 3 + * _.drop([1, 2, 3], 2); + * // => [3] * - * _.get(object, ['a', '0', 'b', 'c']); - * // => 3 + * _.drop([1, 2, 3], 5); + * // => [] * - * _.get(object, 'a.b.c', 'default'); - * // => 'default' + * _.drop([1, 2, 3], 0); + * // => [1, 2, 3] */ - function get(object, path, defaultValue) { - var result = object == null ? undefined : baseGet(object, path); - return result === undefined ? defaultValue : result; + function drop(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, n < 0 ? 0 : n, length); } /** - * Checks if `path` is a direct property of `object`. + * Creates a slice of `array` with `n` elements dropped from the end. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. * @example * - * var object = { 'a': { 'b': 2 } }; - * var other = _.create({ 'a': _.create({ 'b': 2 }) }); - * - * _.has(object, 'a'); - * // => true + * _.dropRight([1, 2, 3]); + * // => [1, 2] * - * _.has(object, 'a.b'); - * // => true + * _.dropRight([1, 2, 3], 2); + * // => [1] * - * _.has(object, ['a', 'b']); - * // => true + * _.dropRight([1, 2, 3], 5); + * // => [] * - * _.has(other, 'a'); - * // => false + * _.dropRight([1, 2, 3], 0); + * // => [1, 2, 3] */ - function has(object, path) { - return object != null && hasPath(object, path, baseHas); + function dropRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, 0, n < 0 ? 0 : n); } /** - * Checks if `path` is a direct or inherited property of `object`. + * Creates a slice of `array` excluding elements dropped from the end. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. * @example * - * var object = _.create({ 'a': _.create({ 'b': 2 }) }); + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; * - * _.hasIn(object, 'a'); - * // => true + * _.dropRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney'] * - * _.hasIn(object, 'a.b'); - * // => true + * // The `_.matches` iteratee shorthand. + * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['barney', 'fred'] * - * _.hasIn(object, ['a', 'b']); - * // => true + * // The `_.matchesProperty` iteratee shorthand. + * _.dropRightWhile(users, ['active', false]); + * // => objects for ['barney'] * - * _.hasIn(object, 'b'); - * // => false + * // The `_.property` iteratee shorthand. + * _.dropRightWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] */ - function hasIn(object, path) { - return object != null && hasPath(object, path, baseHasIn); + function dropRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true, true) + : []; } /** - * Creates an object composed of the inverted keys and values of `object`. - * If `object` contains duplicate values, subsequent values overwrite - * property assignments of previous values. + * Creates a slice of `array` excluding elements dropped from the beginning. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). * * @static * @memberOf _ - * @since 0.7.0 - * @category Object - * @param {Object} object The object to invert. - * @returns {Object} Returns the new inverted object. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. * @example * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; * - * _.invert(object); - * // => { '1': 'c', '2': 'b' } + * _.dropWhile(users, function(o) { return !o.active; }); + * // => objects for ['pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.dropWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropWhile(users, ['active', false]); + * // => objects for ['pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.dropWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] */ - var invert = createInverter(function(result, value, key) { - result[value] = key; - }, constant(identity)); + function dropWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true) + : []; + } /** - * This method is like `_.invert` except that the inverted object is generated - * from the results of running each element of `object` thru `iteratee`. The - * corresponding inverted value of each inverted key is an array of keys - * responsible for generating the inverted value. The iteratee is invoked - * with one argument: (value). + * Fills elements of `array` with `value` from `start` up to, but not + * including, `end`. + * + * **Note:** This method mutates `array`. * * @static * @memberOf _ - * @since 4.1.0 - * @category Object - * @param {Object} object The object to invert. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Object} Returns the new inverted object. + * @since 3.2.0 + * @category Array + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. * @example * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * var array = [1, 2, 3]; * - * _.invertBy(object); - * // => { '1': ['a', 'c'], '2': ['b'] } + * _.fill(array, 'a'); + * console.log(array); + * // => ['a', 'a', 'a'] * - * _.invertBy(object, function(value) { - * return 'group' + value; - * }); - * // => { 'group1': ['a', 'c'], 'group2': ['b'] } + * _.fill(Array(3), 2); + * // => [2, 2, 2] + * + * _.fill([4, 6, 8, 10], '*', 1, 3); + * // => [4, '*', '*', 10] */ - var invertBy = createInverter(function(result, value, key) { - if (hasOwnProperty.call(result, value)) { - result[value].push(key); - } else { - result[value] = [key]; + function fill(array, value, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; } - }, getIteratee); + if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { + start = 0; + end = length; + } + return baseFill(array, value, start, end); + } /** - * Invokes the method at `path` of `object`. + * This method is like `_.find` except that it returns the index of the first + * element `predicate` returns truthy for instead of the element itself. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {...*} [args] The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. + * @since 1.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. * @example * - * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; * - * _.invoke(object, 'a[0].b.c.slice', 1, 3); - * // => [2, 3] + * _.findIndex(users, function(o) { return o.user == 'barney'; }); + * // => 0 + * + * // The `_.matches` iteratee shorthand. + * _.findIndex(users, { 'user': 'fred', 'active': false }); + * // => 1 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findIndex(users, ['active', false]); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.findIndex(users, 'active'); + * // => 2 */ - var invoke = baseRest(baseInvoke); + function findIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseFindIndex(array, getIteratee(predicate, 3), index); + } /** - * Creates an array of the own enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. See the - * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * for more details. + * This method is like `_.findIndex` except that it iterates over elements + * of `collection` from right to left. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. + * @since 2.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; * - * Foo.prototype.c = 3; + * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); + * // => 2 * - * _.keys(new Foo); - * // => ['a', 'b'] (iteration order is not guaranteed) + * // The `_.matches` iteratee shorthand. + * _.findLastIndex(users, { 'user': 'barney', 'active': true }); + * // => 0 * - * _.keys('hi'); - * // => ['0', '1'] + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastIndex(users, ['active', false]); + * // => 2 + * + * // The `_.property` iteratee shorthand. + * _.findLastIndex(users, 'active'); + * // => 0 */ - function keys(object) { - return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); + function findLastIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length - 1; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = fromIndex < 0 + ? nativeMax(length + index, 0) + : nativeMin(index, length - 1); + } + return baseFindIndex(array, getIteratee(predicate, 3), index, true); } /** - * Creates an array of the own and inherited enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. + * Flattens `array` a single level deep. * * @static * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.keysIn(new Foo); - * // => ['a', 'b', 'c'] (iteration order is not guaranteed) + * _.flatten([1, [2, [3, [4]], 5]]); + * // => [1, 2, [3, [4]], 5] */ - function keysIn(object) { - return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); + function flatten(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, 1) : []; } /** - * The opposite of `_.mapValues`; this method creates an object with the - * same values as `object` and keys generated by running each own enumerable - * string keyed property of `object` thru `iteratee`. The iteratee is invoked - * with three arguments: (value, key, object). + * Recursively flattens `array`. * * @static * @memberOf _ - * @since 3.8.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapValues + * @since 3.0.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. * @example * - * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { - * return key + value; - * }); - * // => { 'a1': 1, 'b2': 2 } + * _.flattenDeep([1, [2, [3, [4]], 5]]); + * // => [1, 2, 3, 4, 5] */ - function mapKeys(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, iteratee(value, key, object), value); - }); - return result; + function flattenDeep(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, INFINITY) : []; } /** - * Creates an object with the same keys as `object` and values generated - * by running each own enumerable string keyed property of `object` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, key, object). + * Recursively flatten `array` up to `depth` times. * * @static * @memberOf _ - * @since 2.4.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapKeys + * @since 4.4.0 + * @category Array + * @param {Array} array The array to flatten. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. * @example * - * var users = { - * 'fred': { 'user': 'fred', 'age': 40 }, - * 'pebbles': { 'user': 'pebbles', 'age': 1 } - * }; + * var array = [1, [2, [3, [4]], 5]]; * - * _.mapValues(users, function(o) { return o.age; }); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + * _.flattenDepth(array, 1); + * // => [1, 2, [3, [4]], 5] * - * // The `_.property` iteratee shorthand. - * _.mapValues(users, 'age'); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + * _.flattenDepth(array, 2); + * // => [1, 2, 3, [4], 5] */ - function mapValues(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, key, iteratee(value, key, object)); - }); - return result; + function flattenDepth(array, depth) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(array, depth); } /** - * This method is like `_.assign` except that it recursively merges own and - * inherited enumerable string keyed properties of source objects into the - * destination object. Source properties that resolve to `undefined` are - * skipped if a destination value exists. Array and plain object properties - * are merged recursively. Other objects and value types are overridden by - * assignment. Source objects are applied from left to right. Subsequent - * sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object`. + * The inverse of `_.toPairs`; this method returns an object composed + * from key-value `pairs`. * * @static * @memberOf _ - * @since 0.5.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. + * @since 4.0.0 + * @category Array + * @param {Array} pairs The key-value pairs. + * @returns {Object} Returns the new object. * @example * - * var object = { - * 'a': [{ 'b': 2 }, { 'd': 4 }] - * }; - * - * var other = { - * 'a': [{ 'c': 3 }, { 'e': 5 }] - * }; - * - * _.merge(object, other); - * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } + * _.fromPairs([['a', 1], ['b', 2]]); + * // => { 'a': 1, 'b': 2 } */ - var merge = createAssigner(function(object, source, srcIndex) { - baseMerge(object, source, srcIndex); - }); + function fromPairs(pairs) { + var index = -1, + length = pairs == null ? 0 : pairs.length, + result = {}; + + while (++index < length) { + var pair = pairs[index]; + result[pair[0]] = pair[1]; + } + return result; + } /** - * This method is like `_.merge` except that it accepts `customizer` which - * is invoked to produce the merged values of the destination and source - * properties. If `customizer` returns `undefined`, merging is handled by the - * method instead. The `customizer` is invoked with six arguments: - * (objValue, srcValue, key, object, source, stack). - * - * **Note:** This method mutates `object`. + * Gets the first element of `array`. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} customizer The function to customize assigned values. - * @returns {Object} Returns `object`. + * @since 0.1.0 + * @alias first + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the first element of `array`. * @example * - * function customizer(objValue, srcValue) { - * if (_.isArray(objValue)) { - * return objValue.concat(srcValue); - * } - * } - * - * var object = { 'a': [1], 'b': [2] }; - * var other = { 'a': [3], 'b': [4] }; + * _.head([1, 2, 3]); + * // => 1 * - * _.mergeWith(object, other, customizer); - * // => { 'a': [1, 3], 'b': [2, 4] } + * _.head([]); + * // => undefined */ - var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { - baseMerge(object, source, srcIndex, customizer); - }); + function head(array) { + return (array && array.length) ? array[0] : undefined; + } /** - * The opposite of `_.pick`; this method creates an object composed of the - * own and inherited enumerable property paths of `object` that are not omitted. - * - * **Note:** This method is considerably slower than `_.pick`. + * Gets the index at which the first occurrence of `value` is found in `array` + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. If `fromIndex` is negative, it's used as the + * offset from the end of `array`. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to omit. - * @returns {Object} Returns the new object. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. * @example * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * _.indexOf([1, 2, 1, 2], 2); + * // => 1 * - * _.omit(object, ['a', 'c']); - * // => { 'b': '2' } + * // Search from the `fromIndex`. + * _.indexOf([1, 2, 1, 2], 2, 2); + * // => 3 */ - var omit = flatRest(function(object, paths) { - var result = {}; - if (object == null) { - return result; - } - var isDeep = false; - paths = arrayMap(paths, function(path) { - path = castPath(path, object); - isDeep || (isDeep = path.length > 1); - return path; - }); - copyObject(object, getAllKeysIn(object), result); - if (isDeep) { - result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); + function indexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; } - var length = paths.length; - while (length--) { - baseUnset(result, paths[length]); + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); } - return result; - }); + return baseIndexOf(array, value, index); + } /** - * The opposite of `_.pickBy`; this method creates an object composed of - * the own and inherited enumerable string keyed properties of `object` that - * `predicate` doesn't return truthy for. The predicate is invoked with two - * arguments: (value, key). + * Gets all but the last element of `array`. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. * @example * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.omitBy(object, _.isNumber); - * // => { 'b': '2' } + * _.initial([1, 2, 3]); + * // => [1, 2] */ - function omitBy(object, predicate) { - return pickBy(object, negate(getIteratee(predicate))); + function initial(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 0, -1) : []; } /** - * Creates an object composed of the picked `object` properties. + * Creates an array of unique values that are included in all given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new object. + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of intersecting values. * @example * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.pick(object, ['a', 'c']); - * // => { 'a': 1, 'c': 3 } + * _.intersection([2, 1], [2, 3]); + * // => [2] */ - var pick = flatRest(function(object, paths) { - return object == null ? {} : basePick(object, paths); + var intersection = baseRest(function(arrays) { + var mapped = arrayMap(arrays, castArrayLikeObject); + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped) + : []; }); /** - * Creates an object composed of the `object` properties `predicate` returns - * truthy for. The predicate is invoked with two arguments: (value, key). + * This method is like `_.intersection` except that it accepts `iteratee` + * which is invoked for each element of each `arrays` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). * * @static * @memberOf _ * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of intersecting values. * @example * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [2.1] * - * _.pickBy(object, _.isNumber); - * // => { 'a': 1, 'c': 3 } + * // The `_.property` iteratee shorthand. + * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }] */ - function pickBy(object, predicate) { - if (object == null) { - return {}; + var intersectionBy = baseRest(function(arrays) { + var iteratee = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + if (iteratee === last(mapped)) { + iteratee = undefined; + } else { + mapped.pop(); } - var props = arrayMap(getAllKeysIn(object), function(prop) { - return [prop]; - }); - predicate = getIteratee(predicate); - return basePickBy(object, props, function(value, path) { - return predicate(value, path[0]); - }); - } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, getIteratee(iteratee, 2)) + : []; + }); /** - * This method is like `_.get` except that if the resolved value is a - * function it's invoked with the `this` binding of its parent object and - * its result is returned. + * This method is like `_.intersection` except that it accepts `comparator` + * which is invoked to compare elements of `arrays`. The order and references + * of result values are determined by the first array. The comparator is + * invoked with two arguments: (arrVal, othVal). * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to resolve. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of intersecting values. * @example * - * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; - * - * _.result(object, 'a[0].b.c1'); - * // => 3 - * - * _.result(object, 'a[0].b.c2'); - * // => 4 - * - * _.result(object, 'a[0].b.c3', 'default'); - * // => 'default' + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * - * _.result(object, 'a[0].b.c3', _.constant('default')); - * // => 'default' + * _.intersectionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }] */ - function result(object, path, defaultValue) { - path = castPath(path, object); - - var index = -1, - length = path.length; + var intersectionWith = baseRest(function(arrays) { + var comparator = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); - // Ensure the loop is entered when path is empty. - if (!length) { - length = 1; - object = undefined; - } - while (++index < length) { - var value = object == null ? undefined : object[toKey(path[index])]; - if (value === undefined) { - index = length; - value = defaultValue; - } - object = isFunction(value) ? value.call(object) : value; + comparator = typeof comparator == 'function' ? comparator : undefined; + if (comparator) { + mapped.pop(); } - return object; - } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, undefined, comparator) + : []; + }); /** - * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, - * it's created. Arrays are created for missing index properties while objects - * are created for all other missing properties. Use `_.setWith` to customize - * `path` creation. - * - * **Note:** This method mutates `object`. + * Converts all elements in `array` into a string separated by `separator`. * * @static * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @returns {Object} Returns `object`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to convert. + * @param {string} [separator=','] The element separator. + * @returns {string} Returns the joined string. * @example * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.set(object, 'a[0].b.c', 4); - * console.log(object.a[0].b.c); - * // => 4 - * - * _.set(object, ['x', '0', 'y', 'z'], 5); - * console.log(object.x[0].y.z); - * // => 5 + * _.join(['a', 'b', 'c'], '~'); + * // => 'a~b~c' */ - function set(object, path, value) { - return object == null ? object : baseSet(object, path, value); + function join(array, separator) { + return array == null ? '' : nativeJoin.call(array, separator); } /** - * This method is like `_.set` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). - * - * **Note:** This method mutates `object`. + * Gets the last element of `array`. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the last element of `array`. * @example * - * var object = {}; - * - * _.setWith(object, '[0][1]', 'a', Object); - * // => { '0': { '1': 'a' } } + * _.last([1, 2, 3]); + * // => 3 */ - function setWith(object, path, value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseSet(object, path, value, customizer); + function last(array) { + var length = array == null ? 0 : array.length; + return length ? array[length - 1] : undefined; } /** - * Creates an array of own enumerable string keyed-value pairs for `object` - * which can be consumed by `_.fromPairs`. If `object` is a map or set, its - * entries are returned. + * This method is like `_.indexOf` except that it iterates over elements of + * `array` from right to left. * * @static * @memberOf _ - * @since 4.0.0 - * @alias entries - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * _.lastIndexOf([1, 2, 1, 2], 2); + * // => 3 * - * _.toPairs(new Foo); - * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) + * // Search from the `fromIndex`. + * _.lastIndexOf([1, 2, 1, 2], 2, 2); + * // => 1 */ - var toPairs = createToPairs(keys); + function lastIndexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); + } + return value === value + ? strictLastIndexOf(array, value, index) + : baseFindIndex(array, baseIsNaN, index, true); + } /** - * Creates an array of own and inherited enumerable string keyed-value pairs - * for `object` which can be consumed by `_.fromPairs`. If `object` is a map - * or set, its entries are returned. + * Gets the element at index `n` of `array`. If `n` is negative, the nth + * element from the end is returned. * * @static * @memberOf _ - * @since 4.0.0 - * @alias entriesIn - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. + * @since 4.11.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=0] The index of the element to return. + * @returns {*} Returns the nth element of `array`. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } + * var array = ['a', 'b', 'c', 'd']; * - * Foo.prototype.c = 3; + * _.nth(array, 1); + * // => 'b' * - * _.toPairsIn(new Foo); - * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) + * _.nth(array, -2); + * // => 'c'; */ - var toPairsIn = createToPairs(keysIn); + function nth(array, n) { + return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; + } /** - * An alternative to `_.reduce`; this method transforms `object` to a new - * `accumulator` object which is the result of running each of its own - * enumerable string keyed properties thru `iteratee`, with each invocation - * potentially mutating the `accumulator` object. If `accumulator` is not - * provided, a new object with the same `[[Prototype]]` will be used. The - * iteratee is invoked with four arguments: (accumulator, value, key, object). - * Iteratee functions may exit iteration early by explicitly returning `false`. + * Removes all given values from `array` using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` + * to remove elements from an array by predicate. * * @static * @memberOf _ - * @since 1.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The custom accumulator value. - * @returns {*} Returns the accumulated value. + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...*} [values] The values to remove. + * @returns {Array} Returns `array`. * @example * - * _.transform([2, 3, 4], function(result, n) { - * result.push(n *= n); - * return n % 2 == 0; - * }, []); - * // => [4, 9] + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * - * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } + * _.pull(array, 'a', 'c'); + * console.log(array); + * // => ['b', 'b'] */ - function transform(object, iteratee, accumulator) { - var isArr = isArray(object), - isArrLike = isArr || isBuffer(object) || isTypedArray(object); - - iteratee = getIteratee(iteratee, 4); - if (accumulator == null) { - var Ctor = object && object.constructor; - if (isArrLike) { - accumulator = isArr ? new Ctor : []; - } - else if (isObject(object)) { - accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; - } - else { - accumulator = {}; - } - } - (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { - return iteratee(accumulator, value, index, object); - }); - return accumulator; - } + var pull = baseRest(pullAll); /** - * Removes the property at `path` of `object`. + * This method is like `_.pull` except that it accepts an array of values to remove. * - * **Note:** This method mutates `object`. + * **Note:** Unlike `_.difference`, this method mutates `array`. * * @static * @memberOf _ * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @returns {Array} Returns `array`. * @example * - * var object = { 'a': [{ 'b': { 'c': 7 } }] }; - * _.unset(object, 'a[0].b.c'); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; - * - * _.unset(object, ['a', '0', 'b', 'c']); - * // => true + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; + * _.pullAll(array, ['a', 'c']); + * console.log(array); + * // => ['b', 'b'] */ - function unset(object, path) { - return object == null ? true : baseUnset(object, path); + function pullAll(array, values) { + return (array && array.length && values && values.length) + ? basePullAll(array, values) + : array; } /** - * This method is like `_.set` except that accepts `updater` to produce the - * value to set. Use `_.updateWith` to customize `path` creation. The `updater` - * is invoked with one argument: (value). + * This method is like `_.pullAll` except that it accepts `iteratee` which is + * invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The iteratee is invoked with one argument: (value). * - * **Note:** This method mutates `object`. + * **Note:** Unlike `_.differenceBy`, this method mutates `array`. * * @static * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @returns {Object} Returns `object`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns `array`. * @example * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.update(object, 'a[0].b.c', function(n) { return n * n; }); - * console.log(object.a[0].b.c); - * // => 9 + * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; * - * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); - * console.log(object.x[0].y.z); - * // => 0 + * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); + * console.log(array); + * // => [{ 'x': 2 }] */ - function update(object, path, updater) { - return object == null ? object : baseUpdate(object, path, castFunction(updater)); + function pullAllBy(array, values, iteratee) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, getIteratee(iteratee, 2)) + : array; } /** - * This method is like `_.update` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). + * This method is like `_.pullAll` except that it accepts `comparator` which + * is invoked to compare elements of `array` to `values`. The comparator is + * invoked with two arguments: (arrVal, othVal). * - * **Note:** This method mutates `object`. + * **Note:** Unlike `_.differenceWith`, this method mutates `array`. * * @static * @memberOf _ * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. * @example * - * var object = {}; + * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; * - * _.updateWith(object, '[0][1]', _.constant('a'), Object); - * // => { '0': { '1': 'a' } } + * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); + * console.log(array); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] */ - function updateWith(object, path, updater, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); + function pullAllWith(array, values, comparator) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, undefined, comparator) + : array; } /** - * Creates an array of the own enumerable string keyed property values of `object`. + * Removes elements from `array` corresponding to `indexes` and returns an + * array of removed elements. * - * **Note:** Non-object values are coerced to objects. + * **Note:** Unlike `_.at`, this method mutates `array`. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...(number|number[])} [indexes] The indexes of elements to remove. + * @returns {Array} Returns the new array of removed elements. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * var array = ['a', 'b', 'c', 'd']; + * var pulled = _.pullAt(array, [1, 3]); * - * _.values(new Foo); - * // => [1, 2] (iteration order is not guaranteed) + * console.log(array); + * // => ['a', 'c'] * - * _.values('hi'); - * // => ['h', 'i'] + * console.log(pulled); + * // => ['b', 'd'] */ - function values(object) { - return object == null ? [] : baseValues(object, keys(object)); - } + var pullAt = flatRest(function(array, indexes) { + var length = array == null ? 0 : array.length, + result = baseAt(array, indexes); + + basePullAt(array, arrayMap(indexes, function(index) { + return isIndex(index, length) ? +index : index; + }).sort(compareAscending)); + + return result; + }); /** - * Creates an array of the own and inherited enumerable string keyed property - * values of `object`. + * Removes all elements from `array` that `predicate` returns truthy for + * and returns an array of the removed elements. The predicate is invoked + * with three arguments: (value, index, array). * - * **Note:** Non-object values are coerced to objects. + * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` + * to pull elements from an array by value. * * @static * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new array of removed elements. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } + * var array = [1, 2, 3, 4]; + * var evens = _.remove(array, function(n) { + * return n % 2 == 0; + * }); * - * Foo.prototype.c = 3; + * console.log(array); + * // => [1, 3] * - * _.valuesIn(new Foo); - * // => [1, 2, 3] (iteration order is not guaranteed) + * console.log(evens); + * // => [2, 4] */ - function valuesIn(object) { - return object == null ? [] : baseValues(object, keysIn(object)); - } - - /*------------------------------------------------------------------------*/ + function remove(array, predicate) { + var result = []; + if (!(array && array.length)) { + return result; + } + var index = -1, + indexes = [], + length = array.length; - /** - * Clamps `number` within the inclusive `lower` and `upper` bounds. + predicate = getIteratee(predicate, 3); + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result.push(value); + indexes.push(index); + } + } + basePullAt(array, indexes); + return result; + } + + /** + * Reverses `array` so that the first element becomes the last, the second + * element becomes the second to last, and so on. + * + * **Note:** This method mutates `array` and is based on + * [`Array#reverse`](https://mdn.io/Array/reverse). * * @static * @memberOf _ * @since 4.0.0 - * @category Number - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. + * @category Array + * @param {Array} array The array to modify. + * @returns {Array} Returns `array`. * @example * - * _.clamp(-10, -5, 5); - * // => -5 + * var array = [1, 2, 3]; * - * _.clamp(10, -5, 5); - * // => 5 + * _.reverse(array); + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] */ - function clamp(number, lower, upper) { - if (upper === undefined) { - upper = lower; - lower = undefined; + function reverse(array) { + return array == null ? array : nativeReverse.call(array); + } + + /** + * Creates a slice of `array` from `start` up to, but not including, `end`. + * + * **Note:** This method is used instead of + * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are + * returned. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function slice(array, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; } - if (upper !== undefined) { - upper = toNumber(upper); - upper = upper === upper ? upper : 0; + if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { + start = 0; + end = length; } - if (lower !== undefined) { - lower = toNumber(lower); - lower = lower === lower ? lower : 0; + else { + start = start == null ? 0 : toInteger(start); + end = end === undefined ? length : toInteger(end); } - return baseClamp(toNumber(number), lower, upper); + return baseSlice(array, start, end); } /** - * Checks if `n` is between `start` and up to, but not including, `end`. If - * `end` is not specified, it's set to `start` with `start` then set to `0`. - * If `start` is greater than `end` the params are swapped to support - * negative ranges. + * Uses a binary search to determine the lowest index at which `value` + * should be inserted into `array` in order to maintain its sort order. * * @static * @memberOf _ - * @since 3.3.0 - * @category Number - * @param {number} number The number to check. - * @param {number} [start=0] The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - * @see _.range, _.rangeRight + * @since 0.1.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. * @example * - * _.inRange(3, 2, 4); - * // => true + * _.sortedIndex([30, 50], 40); + * // => 1 + */ + function sortedIndex(array, value) { + return baseSortedIndex(array, value); + } + + /** + * This method is like `_.sortedIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). * - * _.inRange(4, 8); - * // => true + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example * - * _.inRange(4, 2); - * // => false + * var objects = [{ 'x': 4 }, { 'x': 5 }]; * - * _.inRange(2, 2); - * // => false + * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 0 * - * _.inRange(1.2, 2); - * // => true + * // The `_.property` iteratee shorthand. + * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); + * // => 0 + */ + function sortedIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); + } + + /** + * This method is like `_.indexOf` except that it performs a binary + * search on a sorted `array`. * - * _.inRange(5.2, 4); - * // => false + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example * - * _.inRange(-3, -2, -6); - * // => true + * _.sortedIndexOf([4, 5, 5, 5, 6], 5); + * // => 1 */ - function inRange(number, start, end) { - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); + function sortedIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value); + if (index < length && eq(array[index], value)) { + return index; + } } - number = toNumber(number); - return baseInRange(number, start, end); + return -1; } /** - * Produces a random number between the inclusive `lower` and `upper` bounds. - * If only one argument is provided a number between `0` and the given number - * is returned. If `floating` is `true`, or either `lower` or `upper` are - * floats, a floating-point number is returned instead of an integer. + * This method is like `_.sortedIndex` except that it returns the highest + * index at which `value` should be inserted into `array` in order to + * maintain its sort order. * - * **Note:** JavaScript follows the IEEE-754 standard for resolving - * floating-point values which can produce unexpected results. + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedLastIndex([4, 5, 5, 5, 6], 5); + * // => 4 + */ + function sortedLastIndex(array, value) { + return baseSortedIndex(array, value, true); + } + + /** + * This method is like `_.sortedLastIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ - * @since 0.7.0 - * @category Number - * @param {number} [lower=0] The lower bound. - * @param {number} [upper=1] The upper bound. - * @param {boolean} [floating] Specify returning a floating-point number. - * @returns {number} Returns the random number. + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. * @example * - * _.random(0, 5); - * // => an integer between 0 and 5 + * var objects = [{ 'x': 4 }, { 'x': 5 }]; * - * _.random(5); - * // => also an integer between 0 and 5 + * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 1 * - * _.random(5, true); - * // => a floating-point number between 0 and 5 + * // The `_.property` iteratee shorthand. + * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); + * // => 1 + */ + function sortedLastIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); + } + + /** + * This method is like `_.lastIndexOf` except that it performs a binary + * search on a sorted `array`. * - * _.random(1.2, 5.2); - * // => a floating-point number between 1.2 and 5.2 + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); + * // => 3 */ - function random(lower, upper, floating) { - if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { - upper = floating = undefined; - } - if (floating === undefined) { - if (typeof upper == 'boolean') { - floating = upper; - upper = undefined; - } - else if (typeof lower == 'boolean') { - floating = lower; - lower = undefined; - } - } - if (lower === undefined && upper === undefined) { - lower = 0; - upper = 1; - } - else { - lower = toFinite(lower); - if (upper === undefined) { - upper = lower; - lower = 0; - } else { - upper = toFinite(upper); + function sortedLastIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value, true) - 1; + if (eq(array[index], value)) { + return index; } } - if (lower > upper) { - var temp = lower; - lower = upper; - upper = temp; - } - if (floating || lower % 1 || upper % 1) { - var rand = nativeRandom(); - return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); - } - return baseRandom(lower, upper); + return -1; } - /*------------------------------------------------------------------------*/ - /** - * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). + * This method is like `_.uniq` except that it's designed and optimized + * for sorted arrays. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the camel cased string. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.camelCase('Foo Bar'); - * // => 'fooBar' - * - * _.camelCase('--foo-bar--'); - * // => 'fooBar' - * - * _.camelCase('__FOO_BAR__'); - * // => 'fooBar' + * _.sortedUniq([1, 1, 2]); + * // => [1, 2] */ - var camelCase = createCompounder(function(result, word, index) { - word = word.toLowerCase(); - return result + (index ? capitalize(word) : word); - }); + function sortedUniq(array) { + return (array && array.length) + ? baseSortedUniq(array) + : []; + } /** - * Converts the first character of `string` to upper case and the remaining - * to lower case. + * This method is like `_.uniqBy` except that it's designed and optimized + * for sorted arrays. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to capitalize. - * @returns {string} Returns the capitalized string. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.capitalize('FRED'); - * // => 'Fred' + * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); + * // => [1.1, 2.3] */ - function capitalize(string) { - return upperFirst(toString(string).toLowerCase()); + function sortedUniqBy(array, iteratee) { + return (array && array.length) + ? baseSortedUniq(array, getIteratee(iteratee, 2)) + : []; } /** - * Deburrs `string` by converting - * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) - * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) - * letters to basic Latin letters and removing - * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). + * Gets all but the first element of `array`. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to deburr. - * @returns {string} Returns the deburred string. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. * @example * - * _.deburr('déjà vu'); - * // => 'deja vu' + * _.tail([1, 2, 3]); + * // => [2, 3] */ - function deburr(string) { - string = toString(string); - return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); + function tail(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 1, length) : []; } /** - * Checks if `string` ends with the given target string. + * Creates a slice of `array` with `n` elements taken from the beginning. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=string.length] The position to search up to. - * @returns {boolean} Returns `true` if `string` ends with `target`, - * else `false`. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. * @example * - * _.endsWith('abc', 'c'); - * // => true + * _.take([1, 2, 3]); + * // => [1] * - * _.endsWith('abc', 'b'); - * // => false + * _.take([1, 2, 3], 2); + * // => [1, 2] * - * _.endsWith('abc', 'b', 2); - * // => true + * _.take([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.take([1, 2, 3], 0); + * // => [] */ - function endsWith(string, target, position) { - string = toString(string); - target = baseToString(target); - - var length = string.length; - position = position === undefined - ? length - : baseClamp(toInteger(position), 0, length); - - var end = position; - position -= target.length; - return position >= 0 && string.slice(position, end) == target; + function take(array, n, guard) { + if (!(array && array.length)) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, 0, n < 0 ? 0 : n); } /** - * Converts the characters "&", "<", ">", '"', and "'" in `string` to their - * corresponding HTML entities. - * - * **Note:** No other characters are escaped. To escape additional - * characters use a third-party library like [_he_](https://mths.be/he). - * - * Though the ">" character is escaped for symmetry, characters like - * ">" and "/" don't need escaping in HTML and have no special meaning - * unless they're part of a tag or unquoted attribute value. See - * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) - * (under "semi-related fun fact") for more details. - * - * When working with HTML you should always - * [quote attribute values](http://wonko.com/post/html-escaping) to reduce - * XSS vectors. + * Creates a slice of `array` with `n` elements taken from the end. * * @static - * @since 0.1.0 * @memberOf _ - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. * @example * - * _.escape('fred, barney, & pebbles'); - * // => 'fred, barney, & pebbles' + * _.takeRight([1, 2, 3]); + * // => [3] + * + * _.takeRight([1, 2, 3], 2); + * // => [2, 3] + * + * _.takeRight([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.takeRight([1, 2, 3], 0); + * // => [] */ - function escape(string) { - string = toString(string); - return (string && reHasUnescapedHtml.test(string)) - ? string.replace(reUnescapedHtml, escapeHtmlChar) - : string; + function takeRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, n < 0 ? 0 : n, length); } /** - * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", - * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. + * Creates a slice of `array` with elements taken from the end. Elements are + * taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. * @example * - * _.escapeRegExp('[lodash](https://lodash.com/)'); - * // => '\[lodash\]\(https://lodash\.com/\)' + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.takeRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeRightWhile(users, ['active', false]); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.takeRightWhile(users, 'active'); + * // => [] */ - function escapeRegExp(string) { - string = toString(string); - return (string && reHasRegExpChar.test(string)) - ? string.replace(reRegExpChar, '\\$&') - : string; + function takeRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), false, true) + : []; } /** - * Converts `string` to - * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). + * Creates a slice of `array` with elements taken from the beginning. Elements + * are taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the kebab cased string. + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. * @example * - * _.kebabCase('Foo Bar'); - * // => 'foo-bar' + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; * - * _.kebabCase('fooBar'); - * // => 'foo-bar' + * _.takeWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney', 'fred'] * - * _.kebabCase('__FOO_BAR__'); - * // => 'foo-bar' + * // The `_.matches` iteratee shorthand. + * _.takeWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeWhile(users, ['active', false]); + * // => objects for ['barney', 'fred'] + * + * // The `_.property` iteratee shorthand. + * _.takeWhile(users, 'active'); + * // => [] */ - var kebabCase = createCompounder(function(result, word, index) { - return result + (index ? '-' : '') + word.toLowerCase(); + function takeWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3)) + : []; + } + + /** + * Creates an array of unique values, in order, from all given arrays using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.union([2], [1, 2]); + * // => [2, 1] + */ + var union = baseRest(function(arrays) { + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); }); /** - * Converts `string`, as space separated words, to lower case. + * This method is like `_.union` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which uniqueness is computed. Result values are chosen from the first + * array in which the value occurs. The iteratee is invoked with one argument: + * (value). * * @static * @memberOf _ * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the lower cased string. + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of combined values. * @example * - * _.lowerCase('--Foo-Bar--'); - * // => 'foo bar' - * - * _.lowerCase('fooBar'); - * // => 'foo bar' + * _.unionBy([2.1], [1.2, 2.3], Math.floor); + * // => [2.1, 1.2] * - * _.lowerCase('__FOO_BAR__'); - * // => 'foo bar' + * // The `_.property` iteratee shorthand. + * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] */ - var lowerCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + word.toLowerCase(); + var unionBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); }); /** - * Converts the first character of `string` to lower case. + * This method is like `_.union` except that it accepts `comparator` which + * is invoked to compare elements of `arrays`. Result values are chosen from + * the first array in which the value occurs. The comparator is invoked + * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the converted string. + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of combined values. * @example * - * _.lowerFirst('Fred'); - * // => 'fred' + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * - * _.lowerFirst('FRED'); - * // => 'fRED' + * _.unionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ - var lowerFirst = createCaseFirst('toLowerCase'); + var unionWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); + }); /** - * Pads `string` on the left and right sides if it's shorter than `length`. - * Padding characters are truncated if they can't be evenly divided by `length`. + * Creates a duplicate-free version of an array, using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons, in which only the first occurrence of each element + * is kept. The order of result values is determined by the order they occur + * in the array. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.pad('abc', 8); - * // => ' abc ' - * - * _.pad('abc', 8, '_-'); - * // => '_-abc_-_' - * - * _.pad('abc', 3); - * // => 'abc' + * _.uniq([2, 1, 2]); + * // => [2, 1] */ - function pad(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - if (!length || strLength >= length) { - return string; - } - var mid = (length - strLength) / 2; - return ( - createPadding(nativeFloor(mid), chars) + - string + - createPadding(nativeCeil(mid), chars) - ); + function uniq(array) { + return (array && array.length) ? baseUniq(array) : []; } /** - * Pads `string` on the right side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. + * This method is like `_.uniq` except that it accepts `iteratee` which is + * invoked for each element in `array` to generate the criterion by which + * uniqueness is computed. The order of result values is determined by the + * order they occur in the array. The iteratee is invoked with one argument: + * (value). * * @static * @memberOf _ * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.padEnd('abc', 6); - * // => 'abc ' - * - * _.padEnd('abc', 6, '_-'); - * // => 'abc_-_' + * _.uniqBy([2.1, 1.2, 2.3], Math.floor); + * // => [2.1, 1.2] * - * _.padEnd('abc', 3); - * // => 'abc' + * // The `_.property` iteratee shorthand. + * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] */ - function padEnd(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (string + createPadding(length - strLength, chars)) - : string; + function uniqBy(array, iteratee) { + return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; } /** - * Pads `string` on the left side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. + * This method is like `_.uniq` except that it accepts `comparator` which + * is invoked to compare elements of `array`. The order of result values is + * determined by the order they occur in the array.The comparator is invoked + * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.padStart('abc', 6); - * // => ' abc' - * - * _.padStart('abc', 6, '_-'); - * // => '_-_abc' + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; * - * _.padStart('abc', 3); - * // => 'abc' + * _.uniqWith(objects, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] */ - function padStart(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (createPadding(length - strLength, chars) + string) - : string; + function uniqWith(array, comparator) { + comparator = typeof comparator == 'function' ? comparator : undefined; + return (array && array.length) ? baseUniq(array, undefined, comparator) : []; } /** - * Converts `string` to an integer of the specified radix. If `radix` is - * `undefined` or `0`, a `radix` of `10` is used unless `value` is a - * hexadecimal, in which case a `radix` of `16` is used. - * - * **Note:** This method aligns with the - * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. + * This method is like `_.zip` except that it accepts an array of grouped + * elements and creates an array regrouping the elements to their pre-zip + * configuration. * * @static * @memberOf _ - * @since 1.1.0 - * @category String - * @param {string} string The string to convert. - * @param {number} [radix=10] The radix to interpret `value` by. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {number} Returns the converted integer. + * @since 1.2.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @returns {Array} Returns the new array of regrouped elements. * @example * - * _.parseInt('08'); - * // => 8 + * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] * - * _.map(['6', '08', '10'], _.parseInt); - * // => [6, 8, 10] + * _.unzip(zipped); + * // => [['a', 'b'], [1, 2], [true, false]] */ - function parseInt(string, radix, guard) { - if (guard || radix == null) { - radix = 0; - } else if (radix) { - radix = +radix; + function unzip(array) { + if (!(array && array.length)) { + return []; } - return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); + var length = 0; + array = arrayFilter(array, function(group) { + if (isArrayLikeObject(group)) { + length = nativeMax(group.length, length); + return true; + } + }); + return baseTimes(length, function(index) { + return arrayMap(array, baseProperty(index)); + }); } /** - * Repeats the given string `n` times. + * This method is like `_.unzip` except that it accepts `iteratee` to specify + * how regrouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to repeat. - * @param {number} [n=1] The number of times to repeat the string. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {string} Returns the repeated string. + * @since 3.8.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @param {Function} [iteratee=_.identity] The function to combine + * regrouped values. + * @returns {Array} Returns the new array of regrouped elements. * @example * - * _.repeat('*', 3); - * // => '***' - * - * _.repeat('abc', 2); - * // => 'abcabc' + * var zipped = _.zip([1, 2], [10, 20], [100, 200]); + * // => [[1, 10, 100], [2, 20, 200]] * - * _.repeat('abc', 0); - * // => '' + * _.unzipWith(zipped, _.add); + * // => [3, 30, 300] */ - function repeat(string, n, guard) { - if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); + function unzipWith(array, iteratee) { + if (!(array && array.length)) { + return []; } - return baseRepeat(toString(string), n); + var result = unzip(array); + if (iteratee == null) { + return result; + } + return arrayMap(result, function(group) { + return apply(iteratee, undefined, group); + }); } /** - * Replaces matches for `pattern` in `string` with `replacement`. + * Creates an array excluding all given values using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. * - * **Note:** This method is based on - * [`String#replace`](https://mdn.io/String/replace). + * **Note:** Unlike `_.pull`, this method returns a new array. * * @static * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to modify. - * @param {RegExp|string} pattern The pattern to replace. - * @param {Function|string} replacement The match replacement. - * @returns {string} Returns the modified string. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...*} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.xor * @example * - * _.replace('Hi Fred', 'Fred', 'Barney'); - * // => 'Hi Barney' + * _.without([2, 1, 2, 3], 1, 2); + * // => [3] */ - function replace() { - var args = arguments, - string = toString(args[0]); - - return args.length < 3 ? string : string.replace(args[1], args[2]); - } + var without = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, values) + : []; + }); /** - * Converts `string` to - * [snake case](https://en.wikipedia.org/wiki/Snake_case). + * Creates an array of unique values that is the + * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) + * of the given arrays. The order of result values is determined by the order + * they occur in the arrays. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the snake cased string. + * @since 2.4.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.without * @example * - * _.snakeCase('Foo Bar'); - * // => 'foo_bar' - * - * _.snakeCase('fooBar'); - * // => 'foo_bar' - * - * _.snakeCase('--FOO-BAR--'); - * // => 'foo_bar' + * _.xor([2, 1], [2, 3]); + * // => [1, 3] */ - var snakeCase = createCompounder(function(result, word, index) { - return result + (index ? '_' : '') + word.toLowerCase(); + var xor = baseRest(function(arrays) { + return baseXor(arrayFilter(arrays, isArrayLikeObject)); }); /** - * Splits `string` by `separator`. - * - * **Note:** This method is based on - * [`String#split`](https://mdn.io/String/split). + * This method is like `_.xor` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which by which they're compared. The order of result values is determined + * by the order they occur in the arrays. The iteratee is invoked with one + * argument: (value). * * @static * @memberOf _ * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to split. - * @param {RegExp|string} separator The separator pattern to split by. - * @param {number} [limit] The length to truncate results to. - * @returns {Array} Returns the string segments. + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. * @example * - * _.split('a-b-c', '-', 2); - * // => ['a', 'b'] + * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2, 3.4] + * + * // The `_.property` iteratee shorthand. + * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] */ - function split(string, separator, limit) { - if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { - separator = limit = undefined; - } - limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; - if (!limit) { - return []; - } - string = toString(string); - if (string && ( - typeof separator == 'string' || - (separator != null && !isRegExp(separator)) - )) { - separator = baseToString(separator); - if (!separator && hasUnicode(string)) { - return castSlice(stringToArray(string), 0, limit); - } + var xorBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; } - return string.split(separator, limit); - } + return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); + }); /** - * Converts `string` to - * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). + * This method is like `_.xor` except that it accepts `comparator` which is + * invoked to compare elements of `arrays`. The order of result values is + * determined by the order they occur in the arrays. The comparator is invoked + * with two arguments: (arrVal, othVal). * * @static * @memberOf _ - * @since 3.1.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the start cased string. + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. * @example * - * _.startCase('--foo-bar--'); - * // => 'Foo Bar' - * - * _.startCase('fooBar'); - * // => 'Foo Bar' + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * - * _.startCase('__FOO_BAR__'); - * // => 'FOO BAR' + * _.xorWith(objects, others, _.isEqual); + * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ - var startCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + upperFirst(word); + var xorWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); }); /** - * Checks if `string` starts with the given target string. + * Creates an array of grouped elements, the first of which contains the + * first elements of the given arrays, the second of which contains the + * second elements of the given arrays, and so on. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=0] The position to search from. - * @returns {boolean} Returns `true` if `string` starts with `target`, - * else `false`. + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @returns {Array} Returns the new array of grouped elements. * @example * - * _.startsWith('abc', 'a'); - * // => true - * - * _.startsWith('abc', 'b'); - * // => false - * - * _.startsWith('abc', 'b', 1); - * // => true + * _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] */ - function startsWith(string, target, position) { - string = toString(string); - position = position == null - ? 0 - : baseClamp(toInteger(position), 0, string.length); - - target = baseToString(target); - return string.slice(position, position + target.length) == target; - } + var zip = baseRest(unzip); /** - * Creates a compiled template function that can interpolate data properties - * in "interpolate" delimiters, HTML-escape interpolated data properties in - * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data - * properties may be accessed as free variables in the template. If a setting - * object is given, it takes precedence over `_.templateSettings` values. - * - * **Note:** In the development build `_.template` utilizes - * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) - * for easier debugging. - * - * For more information on precompiling templates see - * [lodash's custom builds documentation](https://lodash.com/custom-builds). - * - * For more information on Chrome extension sandboxes see - * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). + * This method is like `_.fromPairs` except that it accepts two arrays, + * one of property identifiers and one of corresponding values. * * @static - * @since 0.1.0 * @memberOf _ - * @category String - * @param {string} [string=''] The template string. - * @param {Object} [options={}] The options object. - * @param {RegExp} [options.escape=_.templateSettings.escape] - * The HTML "escape" delimiter. - * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] - * The "evaluate" delimiter. - * @param {Object} [options.imports=_.templateSettings.imports] - * An object to import into the template as free variables. - * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] - * The "interpolate" delimiter. - * @param {string} [options.sourceURL='lodash.templateSources[n]'] - * The sourceURL of the compiled template. - * @param {string} [options.variable='obj'] - * The data object variable name. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the compiled template function. + * @since 0.4.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. * @example * - * // Use the "interpolate" delimiter to create a compiled template. - * var compiled = _.template('hello <%= user %>!'); - * compiled({ 'user': 'fred' }); - * // => 'hello fred!' - * - * // Use the HTML "escape" delimiter to escape data property values. - * var compiled = _.template('<%- value %>'); - * compiled({ 'value': '